Afatinib
drugOn this page
Also known as Bibw 2992BIBW-2992BIBW2992GilotrifGiotrifNSC-750691TomtovokTovokAFATINIB DIMALEATEBIBW2992 (AFATINIB)AFATINIB (BIBW2992)AFATINIB FREE BASEBIBW2992AFATINIBTOVOKS1011(E/Z)-AFATINIB(E/Z)-BIBW 2992AfatinibAfatinibÊAfatinibÂ
Summary
Afatinib (CHEMBL1173655) is an approved small-molecule tyrosine kinase inhibitor (ATC L01EB03) targeting EGFR and ERBB2; indicated across 30 conditions including neoplasm and head and neck squamous cell carcinoma; with CIViC clinical evidence for 98 variant-indication associations (e.g. EGFR L858R in lung non-small cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EB03
- Targets: 2 (EGFR, ERBB2)
- Indications: 30 conditions
- Clinical trials: 186
- Precision-oncology evidence (CIViC): 98 variant–indication associations
- Chemistry: 485.9 Da · C24H25ClFN5O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1173655 |
| Name | Afatinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 10184653 |
| ChEBI | CHEBI:61390 |
| ATC | L01EB03 |
| Molecular formula | C24H25ClFN5O3 |
| Molecular weight | 485.9 |
| InChIKey | ULXXDDBFHOBEHA-CWDCEQMOSA-N |
SMILES: CN(C)C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@H]4CCOC4
IUPAC name: (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide
ChEBI definition: A quinazoline compound having a 3-chloro-4-fluoroanilino group at the 4-position, a 4-dimethylamino-trans-but-2-enamido group at the 6-position, and an (S)-tetrahydrofuran-3-yloxy group at the 7-position. Used (as its dimaleate salt) for the first-line treatment of patients with metastatic non-small cell lung cancer.
Pharmacological roles (ChEBI): tyrosine kinase inhibitor, antineoplastic agent.
Also known as: Afatinib, Bibw 2992, BIBW-2992, BIBW2992, Gilotrif, Giotrif, NSC-750691, Tomtovok, Tovok, AFATINIB, TOVOK, AFATINIB DIMALEATE
Parent form; salt/anhydrous children: CHEMBL2105712
Patent coverage: 6,227 distinct patent families (15,144 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 14,879 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| EGFR | epidermal growth factor receptor | Inhibition | 7.82 | 17.5% | P00533 |
| ERBB2 | erb-b2 receptor tyrosine kinase 2 | Inhibition | 7.85 | 17.7% | P04626 |
Broader ChEMBL bioactivity targets: 52 (assay-derived). Sample: Homeodomain-interacting protein kinase 4, Serine/threonine-protein kinase SBK1, Receptor tyrosine-protein kinase erbB-2, Tyrosine-protein kinase ABL1, Cholecystokinin receptor type A, Alpha-2B adrenergic receptor, Receptor-type tyrosine-protein kinase FLT3, Epidermal growth factor receptor, Proto-oncogene tyrosine-protein kinase receptor Ret, Muscarinic acetylcholine receptor M2.
Bioactivity
ChEMBL activities: 235 potent at pChembl ≥ 5 of 242 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| EGFR | 10.21 | IC50 | 0.06 | nM | CHEMBL_ACT_29296692 |
| EGFR | 10.1 | IC50 | 0.08 | nM | CHEMBL_ACT_25094728 |
| EGFR | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_22844197 |
| EGFR | 10 | Kd | 0.1 | nM | CHEMBL_ACT_7576836 |
| EGFR | 9.99 | IC50 | 0.1 | nM | CHEMBL_ACT_29296689 |
| EGFR | 9.96 | Kd | 0.11 | nM | CHEMBL_ACT_7576835 |
| EGFR | 9.92 | Kd | 0.12 | nM | CHEMBL_ACT_7576839 |
| EGFR | 9.92 | Kd | 0.12 | nM | CHEMBL_ACT_7576840 |
| EGFR | 9.85 | Kd | 0.14 | nM | CHEMBL_ACT_7576838 |
| EGFR | 9.85 | Kd | 0.14 | nM | CHEMBL_ACT_7576844 |
| EGFR | 9.79 | IC50 | 0.16 | nM | CHEMBL_ACT_25078783 |
| EGFR | 9.78 | IC50 | 0.17 | nM | CHEMBL_ACT_25078707 |
| EGFR | 9.72 | IC50 | 0.19 | nM | CHEMBL_ACT_13852012 |
| EGFR | 9.72 | Kd | 0.19 | nM | CHEMBL_ACT_7576837 |
| EGFR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_22844221 |
| EGFR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_26199035 |
| EGFR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_26212556 |
| EGFR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_29233545 |
| EGFR | 9.7 | Kd | 0.2 | nM | CHEMBL_ACT_7576841 |
| EGFR | 9.64 | Kd | 0.23 | nM | CHEMBL_ACT_7576843 |
| EGFR | 9.62 | IC50 | 0.24 | nM | CHEMBL_ACT_22968079 |
| EGFR | 9.6 | Kd | 0.25 | nM | CHEMBL_ACT_19218671 |
| EGFR | 9.6 | Kd | 0.25 | nM | CHEMBL_ACT_7576834 |
| EGFR | 9.59 | IC50 | 0.26 | nM | CHEMBL_ACT_25078767 |
| EGFR | 9.55 | IC50 | 0.28 | nM | CHEMBL_ACT_19319721 |
| EGFR | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_22408225 |
| EGFR | 9.48 | IC50 | 0.33 | nM | CHEMBL_ACT_24848036 |
| EGFR | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_18456238 |
| EGFR | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_18997556 |
| EGFR | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_24862039 |
Target pathways
Aggregated over 2 target gene(s): EGFR, ERBB2.
Top Reactome pathways
53 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signaling by ERBB2 | 2 | EGFR, ERBB2 |
| SHC1 events in ERBB2 signaling | 2 | EGFR, ERBB2 |
| PLCG1 events in ERBB2 signaling | 2 | EGFR, ERBB2 |
| PIP3 activates AKT signaling | 2 | EGFR, ERBB2 |
| GRB2 events in ERBB2 signaling | 2 | EGFR, ERBB2 |
| PI3K events in ERBB2 signaling | 2 | EGFR, ERBB2 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 2 | EGFR, ERBB2 |
| RAF/MAP kinase cascade | 2 | EGFR, ERBB2 |
| ERBB2 Regulates Cell Motility | 2 | EGFR, ERBB2 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | EGFR, ERBB2 |
| ERBB2 Activates PTK6 Signaling | 2 | EGFR, ERBB2 |
| Downregulation of ERBB2 signaling | 2 | EGFR, ERBB2 |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 2 | EGFR, ERBB2 |
| Signaling by ERBB2 KD Mutants | 2 | EGFR, ERBB2 |
| Signaling by ERBB2 ECD mutants | 2 | EGFR, ERBB2 |
| Signaling by ERBB2 TMD/JMD mutants | 2 | EGFR, ERBB2 |
| Developmental Lineage of Mammary Gland Myoepithelial Cells | 2 | EGFR, ERBB2 |
| Constitutive Signaling by Ligand-Responsive EGFR Cancer Variants | 1 | EGFR |
| Signaling by ERBB4 | 1 | EGFR |
| GRB7 events in ERBB2 signaling | 1 | ERBB2 |
| Downregulation of ERBB2:ERBB3 signaling | 1 | ERBB2 |
| Signaling by EGFR | 1 | EGFR |
| GRB2 events in EGFR signaling | 1 | EGFR |
| GAB1 signalosome | 1 | EGFR |
| SHC1 events in EGFR signaling | 1 | EGFR |
| EGFR downregulation | 1 | EGFR |
| EGFR interacts with phospholipase C-gamma | 1 | EGFR |
| EGFR Transactivation by Gastrin | 1 | EGFR |
| Sema4D induced cell migration and growth-cone collapse | 1 | ERBB2 |
| Signal transduction by L1 | 1 | EGFR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| signal transduction | 2 |
| cell surface receptor signaling pathway | 2 |
| epidermal growth factor receptor signaling pathway | 2 |
| neuron differentiation | 2 |
| positive regulation of cell growth | 2 |
| ERBB2-EGFR signaling pathway | 2 |
| negative regulation of apoptotic process | 2 |
| positive regulation of MAPK cascade | 2 |
| phosphatidylinositol 3-kinase/protein kinase B signal transduction | 2 |
| positive regulation of epithelial cell proliferation | 2 |
| cellular response to epidermal growth factor stimulus | 2 |
| protein phosphorylation | 2 |
| cell surface receptor protein tyrosine kinase signaling pathway | 2 |
| cell population proliferation | 2 |
| regulation of cell population proliferation | 2 |
Indications & clinical
Indications
30 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 3 | MONDO:0005070 | EFO:0000616 |
| head and neck squamous cell carcinoma | 3 | MONDO:0010150 | EFO:0000181 |
| squamous cell carcinoma | 3 | MONDO:0005096 | EFO:0000707 |
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| upper aerodigestive tract neoplasm | 3 | MONDO:0005398 | EFO:0004284 |
| head and neck cancer | 3 | MONDO:0005627 | EFO:0006859 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| tumor of uterus | 2 | MONDO:0021353 | EFO:0003859 |
| colorectal neoplasm | 2 | MONDO:0005335 | EFO:0004142 |
| esophageal squamous cell carcinoma | 2 | MONDO:0005580 | EFO:0005922 |
| gallbladder carcinoma | 2 | MONDO:0003220 | EFO:1001956 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| chordoma | 2 | MONDO:0008978 | MONDO:0008978 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| paraganglioma | 2 | MONDO:0000448 | EFO:1000453 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| endometriosis | 1 | MONDO:0005133 | EFO:0001065 |
| metastatic neoplasm | 1 | MONDO:0024883 | EFO:0009709 |
| kidney failure | 1 | MONDO:0001106 | HP:0000083 |
| brain cancer | 1 | MONDO:0001657 | MONDO:0001657 |
| gastric neoplasm | 1 | MONDO:0021085 | EFO:0003897 |
| cholangiocarcinoma | 1 | MONDO:0019087 | EFO:0005221 |
4 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 186.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 84 |
| PHASE1 | 44 |
| Not specified | 22 |
| PHASE3 | 17 |
| PHASE1/PHASE2 | 11 |
| PHASE4 | 6 |
| PHASE2/PHASE3 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04413201 | PHASE4 | ACTIVE_NOT_RECRUITING | AFAMOSI: Efficacy and Safety of Afatinib Followed by Osimertinib Compared to Osimertinib in Patients with EGFRmutated/T790M Mutation Negative Nonsquamous NSCLC |
| NCT02208843 | PHASE4 | COMPLETED | Afatinib as Second-line Therapy for Lung Cancer With Epidermal Growth Factor Receptor (EGFR) Mutation |
| NCT02514174 | PHASE4 | COMPLETED | Afatinib Treatment for Patients With EGFR Mutation Positive NSCLC Who Are Age 70 or Older |
| NCT02695290 | PHASE4 | TERMINATED | Afatinib in EGFR+NSCLC (Recurrent or Stage IV) - Patients With Poor Performance Status (ECOG 2 or 3) |
| NCT04132102 | PHASE4 | UNKNOWN | To Evaluate the Efficacy of Afatinib in Advanced Lung Squamous Cell Carcinoma With EGFR Sensitive Mutation |
| NCT04814056 | PHASE4 | UNKNOWN | To Evaluate the Efficacy of Afatinib in the Treatment of Locally Advanced/Metastatic Non-Small Cell Lung Cancer With NRG1 Fusion |
| NCT06486142 | PHASE3 | RECRUITING | EGFR-mutated Lung Cancer in Randomized Investigator-Initiated Study |
| NCT06759857 | PHASE3 | ENROLLING_BY_INVITATION | FHND9041 Versus Afatinib for Non-small Cell Lung Cancer |
| NCT00656136 | PHASE3 | COMPLETED | BIBW 2992 and BSC Versus Placebo and BSC in Non-small Cell Lung Cancer Patients Failing Erlotinib or Gefitinib (LUX-LUNG 1) |
| NCT00949650 | PHASE3 | COMPLETED | BIBW 2992 (Afatinib) Versus Chemotherapy as First Line Treatment in NSCLC With EGFR Mutation |
| NCT01085136 | PHASE3 | COMPLETED | LUX-Lung 5: Afatinib Plus Weekly Paclitaxel Versus Investigator’s Choice of Single Agent Chemotherapy Following Afatinib Monotherapy in Non-small Cell Lung Cancer Patients Failing Erlotinib or Gefitinib |
| NCT01121393 | PHASE3 | COMPLETED | BIBW 2992 (Afatinib) vs Gemcitabine-cisplatin in 1st Line Non-small Cell Lung Cancer (NSCLC) |
| NCT01125566 | PHASE3 | COMPLETED | LUX-Breast 1: BIBW 2992 (Afatinib) in HER2-positive Metastatic Breast Cancer Patients After One Prior Herceptin Treatment |
| NCT01345669 | PHASE3 | TERMINATED | LUX-Head&Neck 2: A Phase III Trial of Afatinib (BIBW 2992) Versus Placebo for the Treatment of Head and Neck Squamous Cell Cancer After Treatment With Chemo-radiotherapy |
| NCT01345682 | PHASE3 | COMPLETED | LUX-Head&Neck 1: A Phase III Trial of Afatinib (BIBW2992) Versus Methotrexate for the Treatment of Recurrent and/or Metastatic (R/M) Head and Neck Squamous Cell Cancer After Platinum Based Chemotherapy |
| NCT01427478 | PHASE3 | COMPLETED | Evaluation of Afatinib in Maintenance Therapy in Squamous Cell Carcinoma of the Head and Neck |
| NCT01523587 | PHASE3 | COMPLETED | LUX-Lung 8: A Phase III Trial of Afatinib (BIBW 2992) Versus Erlotinib for the Treatment of Squamous Cell Lung Cancer After at Least One Prior Platinum Based Chemotherapy |
| NCT01814553 | PHASE3 | COMPLETED | ADAM-Afatinib Diarrhea Assessment and Management |
| NCT01853826 | PHASE3 | COMPLETED | An Open Label Trial of Afatinib (Giotrif) in Treatment-naive (1st Line) or Chemotherapy Pre-treated Patients With Locally Advanced or Metastatic Non-small Cell Lung Cancer (NSCLC) Harboring EGFR Mutation(s) |
| NCT01856478 | PHASE3 | COMPLETED | LUX-Head&Neck 3: Afatinib (BIBW2992) Versus Methotrexate for the Treatment of Recurrent and/or Metastatic Head and Neck Squamous Cell Cancer After Platinum Based Chemotherapy |
| NCT01953913 | PHASE3 | COMPLETED | Afatinib (BIBW 2992) in Advanced Non-Small Cell Lung Cancer Patients With EGFR Mutation |
| NCT02044380 | PHASE3 | COMPLETED | Afatinib in Patients With Non Small Cell Lung Cancer (NSCLC) With Epidermal Growth Factor Receptor (EGFR) Mutations |
| NCT02131155 | PHASE3 | TERMINATED | LUX-Head & Neck 4: Afatinib (BIBW 2992) Versus Placebo for the Treatment of Head and Neck Squamous Cell Cancer After Treatment With Chemo-radiotherapy |
| NCT02438722 | PHASE2/PHASE3 | COMPLETED | S1403, Afatinib Dimaleate With or Without Cetuximab in Treating Patients With Newly Diagnosed Stage IV or Recurrent, EGFR Mutation Positive Non-small Cell Lung Cancer |
| NCT01553942 | PHASE2 | ACTIVE_NOT_RECRUITING | Afatinib With CT and RT for EGFR-Mutant NSCLC |
| NCT02465060 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Patients With Advanced Refractory Solid Tumors, Lymphomas, or Multiple Myeloma (The MATCH Screening Trial) |
| NCT02491099 | PHASE2 | RECRUITING | A Phase II Evaluation of Afatinib in Patients With Persistent or Recurrent HER2-positive Uterine Serous Carcinoma |
| NCT02925234 | PHASE2 | RECRUITING | The Drug Rediscovery Protocol (DRUP Trial) |
| NCT03785249 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Phase 1/2 Study of MRTX849 in Patients With Cancer Having a KRAS G12C Mutation KRYSTAL-1 |
| NCT04183712 | PHASE2 | RECRUITING | Target Therapy With GEMOX in Recectable Gallbladder Carcinoma Patients Monitored by ctDNA |
| NCT04439136 | PHASE2 | ACTIVE_NOT_RECRUITING | Testing Afatinib as a Potential Targeted Treatment in Cancers With HER2 Genetic Changes (MATCH-Subprotocol B) |
| NCT04497584 | PHASE2 | ACTIVE_NOT_RECRUITING | Phase 2 Trial of Afatinib Plus Prednisone for Advanced Squamous NSCLC |
| NCT05070403 | PHASE2 | RECRUITING | Study of Afatinib in Advanced Cutaneous Squamous Cell Carcinoma |
| NCT05215548 | PHASE2 | ACTIVE_NOT_RECRUITING | Primary Tumor Resection With EGFR TKI for Stage IV NSCLC |
| NCT06062823 | PHASE2 | RECRUITING | Study of EGFR TKI in Patients With Advanced NSCLC Harbouring EGFR Mutations |
| NCT06071013 | PHASE1/PHASE2 | RECRUITING | Nintedanib Plus EGFR TKI In EGFR-mutated Non-small Cell Lung Cancer Patients |
| NCT06085755 | PHASE1/PHASE2 | RECRUITING | Trastuzumab Deruxtecan(T-DXd) and Afatinib Combination in HER2-low Advanced Gastric Cancer |
| NCT06385483 | PHASE2 | ACTIVE_NOT_RECRUITING | Testing Afatinib as Potentially Targeted Treatment in Cancers With EGFR Genetic Changes (MATCH - Subprotocol A) |
| NCT06648096 | PHASE1/PHASE2 | RECRUITING | Afatinib in Patients With Fanconi Anemia (FA) and Advanced Head and Neck Squamous Cell Carcinoma (HNSCC) |
| NCT07010120 | PHASE1/PHASE2 | RECRUITING | A Clinical Trial of Neoadjuvant Targeted Therapy, Immunotherapy, and Lysogenic HSV-Based Virotherapy in Resectable Head and Neck Squamous Cell Carcinoma |
Clinical evidence (CIViC)
Variant × indication × effect (98 predictive associations from 127 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| EGFR L858R | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC A | EID2997 +3 |
| EGFR Exon 19 Deletion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC A | EID2996 +2 |
| EGFR G719 | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC A | EID11242 |
| EGFR S768I OR EGFR G719A OR EGFR L861Q | Lung Adenocarcinoma | Sensitivity/Response | Afatinib | CIViC A | EID11229 |
| EGFR Exon 19 Deletion | Lung Adenocarcinoma | Sensitivity/Response | Afatinib | CIViC B | EID880 +3 |
| EGFR L858R | Lung Adenocarcinoma | Sensitivity/Response | Afatinib | CIViC B | EID879 +2 |
| EGFR Mutation | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID1728 +2 |
| ERBB2 Amplification | Her2-receptor Positive Breast Cancer | Sensitivity/Response | Afatinib | CIViC B | EID1011 +2 |
| ERBB2 A775_G776insYVMA | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID7202 +1 |
| EGFR Exon 19 Deletion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Gefitinib + Afatinib + Erlotinib | CIViC B | EID12202 |
| EGFR L858R | Lung Non-small Cell Carcinoma | Sensitivity/Response | Erlotinib + Gefitinib + Afatinib | CIViC B | EID12203 |
| ERBB2 Activating Mutation | Cancer | Sensitivity/Response | Afatinib | CIViC B | EID11676 |
| ERBB2 Activating Mutation | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID7201 |
| ERBB2 Amplification | Her2-receptor Positive Breast Cancer | Sensitivity/Response | Trastuzumab + Afatinib | CIViC B | EID1013 |
| ERBB2 Amplification | Transitional Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID7810 |
| ERBB2 Amplification | Her2-receptor Positive Breast Cancer | Sensitivity/Response | Afatinib + Lapatinib + Trastuzumab | CIViC B | EID887 |
| ERBB3 G284R | Transitional Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID1748 |
| ERBB3 R103G | Transitional Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID1747 |
| ERBB3 V104M | Transitional Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC B | EID1746 |
| CDKN2A p16 Expression | Head And Neck Squamous Cell Carcinoma | Resistance | Afatinib | CIViC B | EID1155 |
| EGFR Exon 20 Insertion | Lung Adenocarcinoma | Resistance | Afatinib | CIViC B | EID1809 |
| EGFR T790M | Lung Non-small Cell Carcinoma | Resistance | Afatinib | CIViC B | EID1863 |
| EGFR E746_A750del | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2515 +2 |
| CD74::NRG1 Fusion | Mucinous Adenocarcinoma | Sensitivity/Response | Afatinib | CIViC C | EID7490 +1 |
| EGFR E746V | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2540 +1 |
| EGFR E746_S752delinsD | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2571 +1 |
| EGFR E746_T751>I | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2527 +1 |
| EGFR L747_A750delinsP | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2550 +1 |
| EGFR L747_P753>Q | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2599 +1 |
| EGFR L747_P753delinsS | Lung Non-small Cell Carcinoma | Sensitivity/Response | Afatinib | CIViC C | EID2610 +1 |
+68 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 9 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
170 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| DACOMITINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| LAPATINIB DITOSYLATE | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| LAZERTINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| MOBOCERTINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| SELUMETINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR, ERBB2 |
| ACALABRUTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| COLISTIN | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| DASATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| EBASTINE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| IBRUTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| IMATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| LAPATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| NERATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| PONATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| TRIBROMSALAN | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| TUCATINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| VANDETANIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| ZANUBRUTINIB | ChEMBL | Phase 4 (approved) | EGFR, ERBB2 |
| ALISERTIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| ALVOCIDIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| CANDESARTAN | ChEMBL | Phase 3 | EGFR, ERBB2 |
| CANERTINIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| CEDIRANIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| ENCLOMIPHENE | ChEMBL | Phase 3 | EGFR, ERBB2 |
| MASITINIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| POZIOTINIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| PYROTINIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| REMIBRUTINIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| ZONGERTINIB | ChEMBL | Phase 3 | EGFR, ERBB2 |
| AEE-788 | ChEMBL | Phase 2 | EGFR, ERBB2 |
| ALLITINIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
| ATUZABRUTINIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
| CENISERTIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
| CLOSANTEL | ChEMBL | Phase 2 | EGFR, ERBB2 |
| CP-724714 | ChEMBL | Phase 2 | EGFR, ERBB2 |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
| ELLAGIC ACID | ChEMBL | Phase 2 | EGFR, ERBB2 |
| FALNIDAMOL | ChEMBL | Phase 2 | EGFR, ERBB2 |
| FORETINIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
| ILORASERTIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
| IODOQUINOL | ChEMBL | Phase 2 | EGFR, ERBB2 |
| PELITINIB | ChEMBL | Phase 2 | EGFR, ERBB2 |
Related Atlas pages
- Genes: EGFR, ERBB2
- Diseases: neoplasm, head and neck squamous cell carcinoma, squamous cell carcinoma, non-small cell lung carcinoma, breast neoplasm, upper aerodigestive tract neoplasm, head and neck cancer, lung adenocarcinoma, HER2 positive breast carcinoma, cancer, transitional cell carcinoma, mucinous adenocarcinoma
- Drugs: Crizotinib, Dacomitinib, Gefitinib, Lapatinib Ditosylate, Lazertinib, Mobocertinib, Selumetinib, Acalabrutinib, Astemizole, Bithionol, Bosutinib, Brigatinib, Cabozantinib, Chlorpromazine, Clotrimazole, Colistin, Dasatinib, Ebastine, Econazole, Erlotinib, Fluphenazine, Hexachlorophene, Ibrutinib, Imatinib, Miconazole, Mitoxantrone, Neratinib, Osimertinib, Ponatinib, Sorafenib, Tamoxifen, Tribromsalan, Tucatinib, Vandetanib, Zanubrutinib, Alisertib, Alvocidib, Candesartan, Canertinib, Cediranib, Enclomiphene, Masitinib, Poziotinib, Pyrotinib, Remibrutinib, Zongertinib
- Biomarker genes: CDKN2A, ERBB3, NRG1