Afimoxifene
drugOn this page
Also known as AfimoxifenoTamogelSID11532960SID17389512SID56422185SID26757818SID99357276SID144208141SID144213959hydroxy-tamoxifenEndoxifen
Summary
Afimoxifene (CHEMBL489) is a phase-3 clinical-stage small-molecule antineoplastic agent targeting GPER1, ESR1, and ESR2; indicated across 3 conditions including ductal breast carcinoma in situ and breast neoplasm.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 4 (GPER1, ESR1, ESR2…)
- Indications: 3 conditions
- Clinical trials: 12
- Chemistry: 387.5 Da · C26H29NO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL489 |
| Name | Afimoxifene |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 449459 |
| ChEBI | CHEBI:44616 |
| Molecular formula | C26H29NO2 |
| Molecular weight | 387.5 |
| InChIKey | TXUZVZSFRXZGTL-QPLCGJKRSA-N |
SMILES: CC/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3
IUPAC name: 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol
ChEBI definition: A tertiary amino compound that is tamoxifen in which the phenyl group which is in a Z- relationship to the ethyl substituent is hydroxylated at the para- position. It is the active metabolite of tamoxifen.
Pharmacological roles (ChEBI): antineoplastic agent, estrogen receptor antagonist.
Other ChEBI roles (chemical / environmental): metabolite.
Also known as: Afimoxifene, Afimoxifeno, Tamogel, SID11532960, SID17389512, SID56422185, SID26757818, AFIMOXIFENE, SID99357276, SID144208141, SID144213959, hydroxy-tamoxifen
Patent coverage: 6,096 distinct patent families (25,119 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GPER1 | GPER | Agonist | 0.2% | Q99527 | |
| ESR1 | Estrogen receptor-α | Agonist | 9.85 | 1.7% | P03372 |
| ESR2 | Estrogen receptor-β | Antagonist | 10.6 | 0.2% | Q92731 |
| ESRRG | Estrogen-related receptor-γ | Inverse agonist | 7.46 | 0.4% | P62508 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Microtubule-associated protein tau, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Prelamin-A/C, 4’-phosphopantetheinyl transferase ffp, Ferritin light chain, Estrogen receptor, Menin/Histone-lysine N-methyltransferase MLL, Estrogen receptor beta, Cytochrome P450 3A4.
Bioactivity
ChEMBL activities: 27 potent at pChembl ≥ 5 of 42 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ESR1 | 10.01 | EC50 | 0.1 | nM | CHEMBL_ACT_25477468 |
| ESR1 | 9.28 | IC50 | 0.53 | nM | CHEMBL_ACT_16843645 |
| ESR1 | 9.1 | IC50 | 0.79 | nM | CHEMBL_ACT_19211881 |
| ESR2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24503388 |
| ESR1 | 8.95 | IC50 | 1.12 | nM | CHEMBL_ACT_24751370 |
| ESR1 | 8.87 | IC50 | 1.36 | nM | CHEMBL_ACT_23232650 |
| ESR2 | 8.78 | IC50 | 1.68 | nM | CHEMBL_ACT_24503284 |
| ESR1 | 8.68 | IC50 | 2.1 | nM | CHEMBL_ACT_19211872 |
| ESR1 | 8.65 | IC50 | 2.24 | nM | CHEMBL_ACT_24503266 |
| ESR1 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_24503370 |
| ESR1 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_18113316 |
| ESR2 | 8.44 | IC50 | 3.61 | nM | CHEMBL_ACT_24751408 |
| ESR1 | 8.42 | IC50 | 3.8 | nM | CHEMBL_ACT_25522261 |
| ESR1 | 8.25 | IC50 | 5.6 | nM | CHEMBL_ACT_18340177 |
| ESR1 | 8.12 | IC50 | 7.5 | nM | CHEMBL_ACT_24506350 |
| ESR1 | 8 | IC50 | 10 | nM | CHEMBL_ACT_16392065 |
| ESR1 | 7.99 | IC50 | 10.2 | nM | CHEMBL_ACT_18113486 |
| ESR1 | 7.7 | Ki | 20 | nM | CHEMBL_ACT_25534826 |
| ESR2 | 7.4 | EC50 | 40 | nM | CHEMBL_ACT_29242928 |
| ESR1 | 7.16 | IC50 | 70 | nM | CHEMBL_ACT_16392057 |
| ESR2 | 7.16 | Ki | 70 | nM | CHEMBL_ACT_25534852 |
| ESR1 | 7.1 | EC50 | 80 | nM | CHEMBL_ACT_29242917 |
| ESR2 | 6.28 | IC50 | 520 | nM | CHEMBL_ACT_29242954 |
| ESR1 | 5.92 | IC50 | 1190 | nM | CHEMBL_ACT_29242939 |
| MAPT | 5.05 | Potency | 8912 | nM | CHEMBL_ACT_3967420 |
| MEN1 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4554647 |
| NPSR1 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4884926 |
Target pathways
Aggregated over 4 target gene(s): GPER1, ESR1, ESR2, ESRRG.
Top Reactome pathways
20 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 3 | ESR1, ESR2, ESRRG |
| PIP3 activates AKT signaling | 2 | ESR1, ESR2 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 2 | ESR1, ESR2 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | ESR1, ESR2 |
| ESR-mediated signaling | 2 | ESR1, ESR2 |
| Extra-nuclear estrogen signaling | 2 | ESR1, ESR2 |
| Nuclear signaling by ERBB4 | 1 | ESR1 |
| Peptide ligand-binding receptors | 1 | GPER1 |
| SUMOylation of intracellular receptors | 1 | ESR1 |
| G alpha (i) signalling events | 1 | GPER1 |
| Ovarian tumor domain proteases | 1 | ESR1 |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | ESR1 |
| RUNX1 regulates estrogen receptor mediated transcription | 1 | ESR1 |
| RUNX1 regulates transcription of genes involved in WNT signaling | 1 | ESR1 |
| Regulation of RUNX2 expression and activity | 1 | ESR1 |
| Estrogen-dependent gene expression | 1 | ESR1 |
| GPER1 signaling | 1 | GPER1 |
| Mitochondrial unfolded protein response (UPRmt) | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | ESR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| positive regulation of transcription by RNA polymerase II | 4 |
| nuclear receptor-mediated steroid hormone signaling pathway | 3 |
| cellular response to estradiol stimulus | 3 |
| signal transduction | 3 |
| regulation of DNA-templated transcription | 3 |
| regulation of transcription by RNA polymerase II | 3 |
| positive regulation of DNA-templated transcription | 3 |
| positive regulation of cytosolic calcium ion concentration | 2 |
| negative regulation of gene expression | 2 |
| steroid hormone receptor signaling pathway | 2 |
| negative regulation of transcription by RNA polymerase II | 2 |
| estrogen receptor signaling pathway | 2 |
| obsolete positive regulation of DNA-binding transcription factor activity | 2 |
| cellular response to oxygen-containing compound | 2 |
| positive regulation of protein phosphorylation | 1 |
Indications & clinical
Indications
3 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| ductal breast carcinoma in situ | 2 | MONDO:0005023 | EFO:0000432 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 8 |
| PHASE1 | 2 |
| PHASE3 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04315792 | PHASE3 | COMPLETED | Evaluate Efficacy and Safety of Endoxifen in Bipolar I Disorder Patients |
| NCT01042379 | PHASE2 | RECRUITING | I-SPY TRIAL: Neoadjuvant and Personalized Adaptive Novel Agents to Treat Breast Cancer |
| NCT02311933 | PHASE2 | ACTIVE_NOT_RECRUITING | Tamoxifen Citrate or Z-Endoxifen Hydrochloride in Treating Patients With Locally Advanced or Metastatic, Estrogen Receptor-Positive, HER2-Negative Breast Cancer |
| NCT04009044 | PHASE2 | ACTIVE_NOT_RECRUITING | Topical Afimoxifene in Treating Patients With Breast Cancer Who Have Undergone Radiation Therapy on One Breast |
| NCT00272714 | PHASE2 | COMPLETED | Study of Afimoxifene Gel to Treat Cyclic Mastalgia in Premenopausal Women |
| NCT00952731 | PHASE2 | COMPLETED | 4-Hydroxytamoxifen or Tamoxifen Citrate in Treating Women With Newly Diagnosed Ductal Breast Carcinoma in Situ |
| NCT02993159 | PHASE2 | COMPLETED | Testing an Active Form of Tamoxifen (4-hydroxytamoxifen) Delivered Through Breast Skin to Control Ductal Carcinoma in Situ (DCIS) of the Breast |
| NCT03063619 | PHASE2 | COMPLETED | Afimoxifene in Reducing the Risk of Breast Cancer in Women With Mammographically Dense Breast |
| NCT04616430 | PHASE2 | COMPLETED | Topical Endoxifen in Women |
| NCT01327781 | PHASE1 | ACTIVE_NOT_RECRUITING | Z-Endoxifen Hydrochloride in Treating Patients With Metastatic or Locally Recurrent Estrogen Receptor-Positive Breast Cancer |
| NCT03317405 | PHASE1 | ACTIVE_NOT_RECRUITING | Phase I Trial of Endoxifen Gel Versus Placebo in Women Undergoing Breast Surgery |
| NCT00084344 | Not specified | COMPLETED | Effect of 4-Hydroxytamoxifen Gel on Breast Density, Salivary Sex Steroids, and Quality of Life in Premenopausal Women |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 24 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
178 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRG, GPER1 |
| Tamoxifen | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRG, GPER1 |
| DIETHYLSTILBESTROL | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRG |
| Fulvestrant | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, GPER1 |
| Raloxifene | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, GPER1 |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | ESR1, ESR2, ESRRG |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| CISPLATIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ELACESTRANT | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTETROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| PHENOLPHTHALEIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ACOLBIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AMCENESTRANT | ChEMBL | Phase 3 | ESR1, ESR2 |
| ARZOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| BENSERAZIDE | ChEMBL | Phase 3 | ESR1, ESR2 |
| ALFATRADIOL | ChEMBL | Phase 2 | ESR1, ESR2 |
| AUS-131 | ChEMBL | Phase 2 | ESR1, ESR2 |
| BRILANESTRANT | ChEMBL | Phase 2 | ESR1, ESR2 |
| DAIDZEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| ERTEBEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| GTX-758 | ChEMBL | Phase 2 | ESR1, ESR2 |
| IDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| LEVORMELOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| MOXESTROL | ChEMBL | Phase 2 | ESR1, ESR2 |
| PIPENDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| PRINABEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| STALLIMYCIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| Bosentan | PubChem | Approved | ESR1, ESR2 |
| Dihydroergotamine | PubChem | Approved | ESR1, ESR2 |
| Fidaxomicin | PubChem | Approved | ESR1, ESR2 |
| Propoxyphene | PubChem | Approved | ESR1, ESR2 |
| Pyrazinamide | PubChem | Approved | ESR1, ESR2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | ESR1 |
| AZTREONAM | ChEMBL | Phase 4 (approved) | ESR1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | ESR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BISACODYL | ChEMBL | Phase 4 (approved) | ESR1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFADROXIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFEPIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFTAZIDIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CERIVASTATIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CHLOROTRIANISENE | ChEMBL | Phase 4 (approved) | ESR1 |
Related Atlas pages
- Genes: GPER1, ESR1, ESR2, ESRRG
- Drugs: Estradiol, Tamoxifen, Diethylstilbestrol, Fulvestrant, Raloxifene, Bazedoxifene, Bithionol, Cisplatin, Elacestrant, Estetrol, Estriol, Estrone, Ethinyl Estradiol, Hexachlorophene, Lasofoxifene, Medroxyprogesterone, Mifepristone, Phenolphthalein, Spironolactone, Acolbifene, Amcenestrant, Arzoxifene, Benserazide, Bosentan, Dihydroergotamine, Fidaxomicin, Propoxyphene, Pyrazinamide, Acetophenazine, Alectinib, Apomorphine, Aripiprazole, Aspirin, Aztreonam, Belinostat, Benzbromarone, Bexarotene, Bisacodyl, Bromocriptine, Butoconazole, Candesartan Cilexetil, Caspofungin, Cefadroxil, Cefepime, Ceftazidime, Cerivastatin, Chlorotrianisene