Afuresertib
drugOn this page
Also known as ASB-183ASB183Gsk-2110183GSK-2110183CGSK2110183GSK2110183C
Summary
Afuresertib (CHEMBL2219422) is a phase-3 clinical-stage small molecule targeting AKT1, AKT2, and AKT3; indicated across 7 conditions including breast neoplasm and langerhans cell histiocytosis.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 3 (AKT1, AKT2, AKT3)
- Indications: 7 conditions
- Clinical trials: 12
- Chemistry: 427.3 Da · C18H17Cl2FN4OS
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2219422 |
| Name | Afuresertib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 46843057 |
| Molecular formula | C18H17Cl2FN4OS |
| Molecular weight | 427.3 |
| InChIKey | AFJRDFWMXUECEW-LBPRGKRZSA-N |
SMILES: CN1C(=C(C=N1)Cl)C2=C(SC(=C2)C(=O)N[C@@H](CC3=CC(=CC=C3)F)CN)Cl
IUPAC name: N-[(2S)-1-amino-3-(3-fluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)thiophene-2-carboxamide
Also known as: Afuresertib, ASB-183, ASB183, Gsk-2110183, GSK-2110183, GSK-2110183C, GSK2110183, GSK2110183C, AFURESERTIB
Parent form; salt/anhydrous children: CHEMBL2219423
Patent coverage: 569 distinct patent families (1,467 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,202 (82%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AKT1 | AKT serine/threonine kinase 1 | Inhibition | 10.1 | 3.4% | P31749 |
| AKT2 | AKT serine/threonine kinase 2 | Inhibition | 8.7 | 2.6% | P31751 |
| AKT3 | AKT serine/threonine kinase 3 | Inhibition | 8.59 | 0.2% | Q9Y243 |
Broader ChEMBL bioactivity targets: 12 (assay-derived). Sample: RAC-beta serine/threonine-protein kinase, cAMP-dependent protein kinase catalytic subunit beta, Rho-associated protein kinase 2, Protein kinase C alpha type, Protein kinase C beta type, Rho-associated protein kinase 1, Serine/threonine-protein kinase N1, cAMP-dependent protein kinase catalytic subunit alpha, RAC-alpha serine/threonine-protein kinase, RAC-gamma serine/threonine-protein kinase.
Bioactivity
ChEMBL activities: 21 potent at pChembl ≥ 5 of 22 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| AKT1 | 10.1 | Ki | 0.08 | nM | CHEMBL_ACT_18854052 |
| AKT1 | 10.1 | IC50 | 0.08 | nM | CHEMBL_ACT_24978767 |
| AKT1 | 10.1 | Ki | 0.08 | nM | CHEMBL_ACT_25990832 |
| AKT1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16881166 |
| AKT3 | 8.8 | IC50 | 1.58 | nM | CHEMBL_ACT_16881208 |
| AKT2 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_24978769 |
| AKT2 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_25990833 |
| AKT3 | 8.59 | IC50 | 2.6 | nM | CHEMBL_ACT_24978771 |
| AKT3 | 8.15 | Kd | 7 | nM | CHEMBL_ACT_17883278 |
| AKT2 | 8 | IC50 | 10 | nM | CHEMBL_ACT_16881187 |
| AKT1 | 7.77 | IC50 | 16.9 | nM | CHEMBL_ACT_18854048 |
| AKT1 | 7.2 | Kd | 63 | nM | CHEMBL_ACT_17882787 |
| PRKACA | 6.88 | Kd | 133 | nM | CHEMBL_ACT_17928574 |
| PRKACB | 6.68 | Kd | 211 | nM | CHEMBL_ACT_17928662 |
| PKN1 | 6.06 | Kd | 880 | nM | CHEMBL_ACT_17927325 |
| ROCK1 | 5.67 | Kd | 2144 | nM | CHEMBL_ACT_17935943 |
| AKT2 | 5.55 | Kd | 2800 | nM | CHEMBL_ACT_17883062 |
| PRKD2 | 5.41 | Kd | 3911 | nM | CHEMBL_ACT_17931417 |
| CIT | 5.37 | Kd | 4258 | nM | CHEMBL_ACT_17892237 |
| ROCK2 | 5.33 | Kd | 4733 | nM | CHEMBL_ACT_17936160 |
| PRKCB | 5.31 | Kd | 4879 | nM | CHEMBL_ACT_17930136 |
Target pathways
Aggregated over 3 target gene(s): AKT1, AKT2, AKT3.
Top Reactome pathways
127 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Apoptosis | 3 | AKT1, AKT2, AKT3 |
| Intrinsic Pathway for Apoptosis | 3 | AKT1, AKT2, AKT3 |
| Activation of BAD and translocation to mitochondria | 3 | AKT1, AKT2, AKT3 |
| Activation of BH3-only proteins | 3 | AKT1, AKT2, AKT3 |
| Signaling by ERBB2 | 3 | AKT1, AKT2, AKT3 |
| PIP3 activates AKT signaling | 3 | AKT1, AKT2, AKT3 |
| Developmental Biology | 3 | AKT1, AKT2, AKT3 |
| Cytokine Signaling in Immune system | 3 | AKT1, AKT2, AKT3 |
| Adaptive Immune System | 3 | AKT1, AKT2, AKT3 |
| Downregulation of ERBB2:ERBB3 signaling | 3 | AKT1, AKT2, AKT3 |
| Signal Transduction | 3 | AKT1, AKT2, AKT3 |
| Cell Cycle | 3 | AKT1, AKT2, AKT3 |
| Disease | 3 | AKT1, AKT2, AKT3 |
| MTOR signalling | 3 | AKT1, AKT2, AKT3 |
| Inhibition of TSC complex formation by AKT (PKB) | 3 | AKT1, AKT2, AKT3 |
| Immune System | 3 | AKT1, AKT2, AKT3 |
| Regulation of beta-cell development | 3 | AKT1, AKT2, AKT3 |
| Signaling by VEGF | 3 | AKT1, AKT2, AKT3 |
| AKT phosphorylates targets in the cytosol | 3 | AKT1, AKT2, AKT3 |
| AKT phosphorylates targets in the nucleus | 3 | AKT1, AKT2, AKT3 |
| Negative regulation of the PI3K/AKT network | 3 | AKT1, AKT2, AKT3 |
| Membrane Trafficking | 3 | AKT1, AKT2, AKT3 |
| Regulation of gene expression in beta cells | 3 | AKT1, AKT2, AKT3 |
| AKT-mediated inactivation of FOXO1A | 3 | AKT1, AKT2, AKT3 |
| Generic Transcription Pathway | 3 | AKT1, AKT2, AKT3 |
| PI3K/AKT Signaling in Cancer | 3 | AKT1, AKT2, AKT3 |
| Cellular responses to stress | 3 | AKT1, AKT2, AKT3 |
| Transcriptional Regulation by TP53 | 3 | AKT1, AKT2, AKT3 |
| Signaling by GPCR | 3 | AKT1, AKT2, AKT3 |
| GPCR downstream signalling | 3 | AKT1, AKT2, AKT3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 3 |
| signal transduction | 3 |
| insulin receptor signaling pathway | 3 |
| positive regulation of cell migration | 3 |
| intracellular signal transduction | 3 |
| negative regulation of apoptotic process | 3 |
| positive regulation of blood vessel endothelial cell migration | 3 |
| negative regulation of PERK-mediated unfolded protein response | 3 |
| positive regulation of endothelial cell proliferation | 2 |
| glycogen biosynthetic process | 2 |
| glucose metabolic process | 2 |
| regulation of translation | 2 |
| negative regulation of long-chain fatty acid import across plasma membrane | 2 |
| positive regulation of glucose metabolic process | 2 |
| regulation of cell migration | 2 |
Indications & clinical
Indications
7 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 7 |
| PHASE2 | 3 |
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04851613 | PHASE3 | ACTIVE_NOT_RECRUITING | Study to Evaluate Efficacy & Safety of Afuresertib Plus Fulvestrant in Patients With Locally Advanced or Metastatic HR+/HER2- Breast Cancer |
| NCT01395004 | PHASE2 | COMPLETED | A Study to Test the Ability of and Safety of GSK2110183 in Treating Langerhans Cell Histiocytosis |
| NCT01531894 | PHASE2 | COMPLETED | Continuation Study of the Oral AKT Inhibitor GSK2110183 |
| NCT04374630 | PHASE2 | COMPLETED | Study With Afuresertib and Paclitaxel in Platinum Resistant Ovarian |
| NCT05383482 | PHASE1/PHASE2 | COMPLETED | Afuresertib +Sintilimab+Chemotherapy in Patients With Selected Solid Tumors That Resistance to Prior Anti-PD-1/PD-L1 |
| NCT01428492 | PHASE1 | COMPLETED | Ph 1b Study to Evaluate GSK2110183 in Combination With Bortezomib and Dexamethasone in Subjects With Multiple Myeloma |
| NCT01476137 | PHASE1 | COMPLETED | A Study of the Safety and Activity of the MEK Inhibitor Given Together With the AKT Inhibitor to Patients With Multiple Myeloma or Solid Tumor Cancers |
| NCT02177682 | PHASE1 | TERMINATED | Study of Afuresertib Monotherapy in Japanese Relapsed Multiple Myeloma Patients |
| NCT02235740 | PHASE1 | TERMINATED | A Study Conducted in Subjects With Relapsed/Refractory Multiple Myeloma (MM); to Determine Dose of Afuresertib in Combination With Carfilzomib (Part 1) and to Investigate the Safety, Pharmacokinetic and Clinical Activity of the Combination Compared With Carfilzomib Alone (Part 2) |
| NCT02240212 | PHASE1 | COMPLETED | Study of Afuresertib Combined With Paclitaxel in Gastric Cancer |
| NCT02380313 | PHASE1 | WITHDRAWN | Dose-Finding Study of Afuresertib Administered in Combination With Either Enzalutamide or Aibraterone |
| NCT05390710 | PHASE1 | COMPLETED | PhI to Solid Tumors and PhII to Locally Advanced or mTNBC |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
41 molecules share ≥1 primary target. Top 41 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CAPIVASERTIB | ChEMBL | Phase 4 (approved) | AKT1, AKT2, AKT3 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | AKT1, AKT2, AKT3 |
| IPATASERTIB | ChEMBL | Phase 3 | AKT1, AKT2, AKT3 |
| LESTAURTINIB | ChEMBL | Phase 3 | AKT1, AKT2, AKT3 |
| MIRANSERTIB | ChEMBL | Phase 2 | AKT1, AKT2, AKT3 |
| MK-2206 | ChEMBL | Phase 2 | AKT1, AKT2, AKT3 |
| UPROSERTIB | ChEMBL | Phase 2 | AKT1, AKT2, AKT3 |
| Afatinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| belumosudil | PubChem | Approved | AKT1, AKT2, AKT3 |
| Binimetinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| Crizotinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| dacomitinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| Fostamatinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| Idelalisib | PubChem | Approved | AKT1, AKT2, AKT3 |
| Pazopanib | PubChem | Approved | AKT1, AKT2, AKT3 |
| regorafenib | PubChem | Approved | AKT1, AKT2, AKT3 |
| Selumetinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| Trametinib | PubChem | Approved | AKT1, AKT2, AKT3 |
| FASUDIL | ChEMBL | Phase 3 | AKT1, AKT3 |
| RUBOXISTAURIN | ChEMBL | Phase 3 | AKT2, AKT3 |
| LAUROGUADINE | ChEMBL | Phase 2 | AKT1, AKT2 |
| SOTRASTAURIN | ChEMBL | Phase 2 | AKT1, AKT2 |
| Gefitinib | PubChem | Approved | AKT2, AKT3 |
| MILTEFOSINE | ChEMBL | Phase 4 (approved) | AKT1 |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | AKT1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | AKT2 |
| ENZASTAURIN | ChEMBL | Phase 3 | AKT3 |
| LINIFANIB | ChEMBL | Phase 3 | AKT1 |
| PERIFOSINE | ChEMBL | Phase 3 | AKT1 |
| QUERCETIN | ChEMBL | Phase 3 | AKT1 |
| EDELFOSINE | ChEMBL | Phase 2 | AKT1 |
| ELLAGIC ACID | ChEMBL | Phase 2 | AKT1 |
| KALAFUNGIN | ChEMBL | Phase 2 | AKT1 |
| PF-04691502 | ChEMBL | Phase 2 | AKT1 |
| PICTILISIB | ChEMBL | Phase 2 | AKT1 |
| RUPITASERTIB | ChEMBL | Phase 2 | AKT1 |
| SULFAETHIDOLE | ChEMBL | Phase 2 | AKT1 |
| Belzutifan | PubChem | Approved | AKT2 |
| Cobimetinib | PubChem | Approved | AKT3 |
| Fedratinib | PubChem | Approved | AKT3 |
| podofilox | PubChem | Approved | AKT1 |
Related Atlas pages
- Genes: AKT1, AKT2, AKT3
- Diseases: breast neoplasm
- Drugs: Capivasertib, Midostaurin, Ipatasertib, Lestaurtinib, Afatinib, belumosudil, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Idelalisib, Pazopanib, regorafenib, Selumetinib, Trametinib, Fasudil, Ruboxistaurin, Gefitinib, Miltefosine, Niclosamide, Sunitinib, Enzastaurin, Linifanib, Perifosine, Quercetin, Belzutifan, Cobimetinib, Fedratinib, podofilox