Alitretinoin
drugOn this page
Also known as AGN 192013AGN-192013AGN192013AlitretinoinaAlitretinoineALRT-1057ALRT1057BAL-4079LG-100057LG100057LGD-1057LGD1057NSC-659772PanretinToctinoSID26755228SID26755229SID26755230SID144212512
Summary
Alitretinoin (CHEMBL705) is an approved small-molecule antineoplastic agent (ATC D11AH04) targeting VKORC1, RARA, and RARB; indicated across 8 conditions including neoplasm and kaposi’s sarcoma.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: D11AH04 (+1 more)
- Targets: 7 (VKORC1, RARA, RARB…)
- Indications: 8 conditions
- Clinical trials: 22
- Chemistry: 300.4 Da · C20H28O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL705 |
| Name | Alitretinoin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 449171 |
| ChEBI | CHEBI:50648 |
| ATC | D11AH04, L01XF02 |
| Molecular formula | C20H28O2 |
| Molecular weight | 300.4 |
| InChIKey | SHGAZHPCJJPHSC-ZVCIMWCZSA-N |
SMILES: CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C\C(=C\C(=O)O)\C)/C
IUPAC name: (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid
ChEBI definition: A retinoic acid in which the exocyclic double bonds have 7E,9Z,11E,13E geometry.
Pharmacological roles (ChEBI): antineoplastic agent, retinoid X receptor agonist, keratolytic drug.
Other ChEBI roles (chemical / environmental): metabolite.
Also known as: AGN 192013, AGN-192013, AGN192013, Alitretinoin, Alitretinoina, Alitretinoine, ALRT-1057, ALRT1057, BAL-4079, LG-100057, LG100057, LGD-1057
Patent coverage: 10,446 distinct patent families (39,246 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| VKORC1 | vitamin K epoxide reductase complex subunit 1 | Inhibition | 0% | Q9BQB6 | |
| RARA | Retinoic acid receptor-α | Agonist | 9.5 | 0.8% | P10276 |
| RARB | Retinoic acid receptor-β | Agonist | 9.7 | 0.1% | P10826 |
| RARG | Retinoic acid receptor-γ | Agonist | 9 | 1.6% | P13631 |
| RXRA | Retinoid X receptor-α | Agonist | 8.2 | 5.1% | P19793 |
| RXRB | Retinoid X receptor-β | Agonist | 8.2 | 0.2% | P28702 |
| RXRG | Retinoid X receptor-γ | Agonist | 8 | 0.2% | P48443 |
Broader ChEMBL bioactivity targets: 23 (assay-derived). Sample: Microtubule-associated protein tau, Nuclear receptor subfamily 4immunitygroup A member 1, Nuclear receptor ROR-gamma, Ferritin light chain, Nuclear receptor ROR-gamma, Retinoic acid receptor RXR-beta, Retinoic acid receptor gamma, Retinoic acid receptor RXR-gamma, Retinoic acid receptor beta, Retinoic acid receptor alpha.
Bioactivity
ChEMBL activities: 151 potent at pChembl ≥ 5 of 161 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| RARB | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_221433 |
| RARB | 9.15 | Ki | 0.7 | nM | CHEMBL_ACT_221432 |
| RARG | 9.1 | Kd | 0.8 | nM | CHEMBL_ACT_1612378 |
| RARB | 9.1 | EC50 | 0.8 | nM | CHEMBL_ACT_24858588 |
| RARA | 9 | EC50 | 1 | nM | CHEMBL_ACT_24858587 |
| RARG | 9 | Ki | 1 | nM | CHEMBL_ACT_657659 |
| RXRA | 8.82 | Kd | 1.5 | nM | CHEMBL_ACT_1612377 |
| RXRA | 8.82 | EC50 | 1.5 | nM | CHEMBL_ACT_818769 |
| RARB | 8.7 | AC50 | 2 | nM | CHEMBL_ACT_381132 |
| RXRB | 8.59 | EC50 | 2.6 | nM | CHEMBL_ACT_239998 |
| RXRA | 8.52 | Kd | 3 | nM | CHEMBL_ACT_372911 |
| RARG | 8.52 | AC50 | 3 | nM | CHEMBL_ACT_381133 |
| RARB | 8.52 | EC50 | 3 | nM | CHEMBL_ACT_818767 |
| RARB | 8.48 | EC50 | 3.3 | nM | CHEMBL_ACT_268016 |
| RARB | 8.48 | EC50 | 3.3 | nM | CHEMBL_ACT_317600 |
| RARB | 8.48 | EC50 | 3.3 | nM | CHEMBL_ACT_476554 |
| RXRB | 8.42 | Ki | 3.8 | nM | CHEMBL_ACT_657661 |
| RXRA | 8.4 | EC50 | 4 | nM | CHEMBL_ACT_22450482 |
| RXRG | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_658378 |
| RARG | 8.4 | EC50 | 4 | nM | CHEMBL_ACT_818768 |
| P28705 | 8.4 | Kd | 4 | nM | CHEMBL_ACT_993460 |
| RXRG | 8.37 | EC50 | 4.3 | nM | CHEMBL_ACT_240000 |
| RXRG | 8.35 | EC50 | 4.5 | nM | CHEMBL_ACT_818771 |
| RXRA | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_239994 |
| RXRA | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_24858589 |
| RXRB | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_24858590 |
| RARG | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_268017 |
| RARG | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_317601 |
| RARG | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_476555 |
| RXRA | 8.15 | AC50 | 7 | nM | CHEMBL_ACT_381134 |
Target pathways
Aggregated over 7 target gene(s): VKORC1, RARA, RARB, RARG, RXRA, RXRB, RXRG.
Top Reactome pathways
67 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 6 | RARA, RARB, RARG, RXRA, RXRB, RXRG |
| Signaling by Retinoic Acid | 6 | RARA, RARB, RARG, RXRA, RXRB, RXRG |
| Activation of anterior HOX genes in hindbrain development during early embryogenesis | 4 | RARA, RARB, RARG, RXRA |
| Signal Transduction | 3 | RXRA, RXRB, RXRG |
| Generic Transcription Pathway | 3 | RXRA, RXRB, RXRG |
| RNA Polymerase II Transcription | 3 | RXRA, RXRB, RXRG |
| Gene expression (Transcription) | 3 | RXRA, RXRB, RXRG |
| Signaling by Nuclear Receptors | 3 | RXRA, RXRB, RXRG |
| Metabolism | 2 | RXRA, RXRB |
| PPARA activates gene expression | 2 | RXRA, RXRB |
| Regulation of lipid metabolism by PPARalpha | 2 | RXRA, RXRB |
| SUMOylation of intracellular receptors | 2 | RARA, RXRA |
| Metabolism of lipids | 2 | RXRA, RXRB |
| NR1H2 and NR1H3-mediated signaling | 2 | RXRA, RXRB |
| NR1H2 & NR1H3 regulate gene expression linked to lipogenesis | 2 | RXRA, RXRB |
| NR1H3 & NR1H2 regulate gene expression linked to cholesterol transport and efflux | 2 | RXRA, RXRB |
| NR1H2 & NR1H3 regulate gene expression to limit cholesterol uptake | 2 | RXRA, RXRB |
| NR1H2 & NR1H3 regulate gene expression linked to triglyceride lipolysis in adipose | 2 | RXRA, RXRB |
| Transcriptional regulation of granulopoiesis | 2 | RARA, RXRA |
| NR1H2 & NR1H3 regulate gene expression to control bile acid homeostasis | 2 | RXRA, RXRB |
| NR1H2 & NR1H3 regulate gene expression linked to gluconeogenesis | 2 | RXRA, RXRB |
| TGFBR3 expression | 2 | RARA, RXRA |
| Developmental Biology | 1 | RXRA |
| R-HSA-1368082 | 1 | RXRA |
| BMAL1:CLOCK,NPAS2 activates circadian expression | 1 | RXRA |
| Mitochondrial biogenesis | 1 | RXRA |
| Recycling of bile acids and salts | 1 | RXRA |
| Regulation of cholesterol biosynthesis by SREBP (SREBF) | 1 | RXRA |
| Organelle biogenesis and maintenance | 1 | RXRA |
| Synthesis of bile acids and bile salts | 1 | RXRA |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| cell differentiation | 6 |
| positive regulation of transcription by RNA polymerase II | 6 |
| retinoic acid receptor signaling pathway | 6 |
| regulation of DNA-templated transcription | 6 |
| bone development | 4 |
| negative regulation of transcription by RNA polymerase II | 4 |
| glandular epithelial cell development | 3 |
| growth plate cartilage development | 3 |
| regulation of myelination | 3 |
| response to retinoic acid | 3 |
| multicellular organism growth | 3 |
| mRNA transcription by RNA polymerase II | 3 |
| positive regulation of DNA-templated transcription | 3 |
| ventricular cardiac muscle cell differentiation | 3 |
| negative regulation of cartilage development | 3 |
Indications & clinical
Indications
8 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| Kaposi’s sarcoma | 4 | MONDO:0005055 | EFO:0000558 |
| hand dermatosis | 3 | MONDO:0006556 | EFO:1000706 |
| psoriasis | 2 | MONDO:0005083 | EFO:0000676 |
| cutaneous lupus erythematosus | 2 | MONDO:0005282 | EFO:0003834 |
| lichen planus | 2 | MONDO:0006572 | EFO:1000726 |
| breast neoplasm | 1 | MONDO:0021100 | MONDO:0007254 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 22.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 9 |
| PHASE2 | 8 |
| Not specified | 2 |
| PHASE4 | 1 |
| PHASE1/PHASE2 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01231854 | PHASE4 | TERMINATED | Ciclosporin Versus Alitretinoin for Severe Atopic Hand Dermatitis. |
| NCT00124436 | PHASE3 | COMPLETED | Follow-up Efficacy and Safety of Alitretinoin in Severe Chronic Hand Dermatitis |
| NCT00124475 | PHASE3 | COMPLETED | Efficacy and Safety of a Retinoid for the Treatment of Severe Chronic Hand Dermatitis |
| NCT00309621 | PHASE3 | COMPLETED | Safety and Efficacy of a Retinoid for the Treatment of Severe Chronic Hand Dermatitis |
| NCT00519675 | PHASE3 | COMPLETED | Alitretinoin in the Treatment of Chronic Hand Eczema |
| NCT00817063 | PHASE3 | COMPLETED | Efficacy and Safety of a Retinoid in the Treatment of Severe Chronic Hand Eczema |
| NCT03026907 | PHASE3 | UNKNOWN | Alitretinoin vs Azathioprine in Severe Non-hyperkeratotic Hand Eczema |
| NCT03026946 | PHASE3 | UNKNOWN | Alitretinoin vs Cyclosporine in Severe Recurrent Vesicular Hand Eczema |
| NCT03370367 | PHASE3 | COMPLETED | Double Blind Phase III Trial of Effects of Low Dose 13-Cisretinoic Acid on Prevention of Second Primaries in Stages I-II Head and Neck Cancer |
| NCT05259722 | PHASE3 | COMPLETED | A 24 Week Trial to Compare the Efficacy and Safety of Delgocitinib Cream 20 mg/g Twice-daily With Alitretinoin Capsules Once-daily in Adult Participants With Severe Chronic Hand Eczema |
| NCT00002188 | PHASE2 | COMPLETED | A Study of ALRT1057 in Patients With AIDS-Related Kaposi’s Sarcoma |
| NCT00002586 | PHASE2 | COMPLETED | 13-Cis Retinoic Acid With or Without Vitamin E for Prevention of Lung Cancer |
| NCT00135135 | PHASE2 | COMPLETED | Therapy for Children With Neuroblastoma |
| NCT01245140 | PHASE2 | COMPLETED | Efficacy of Alitretinoin Treatment in Patients With Pustular Form of Psoriasis |
| NCT01261923 | PHASE1/PHASE2 | COMPLETED | Pharmacokinetics of 9-cis-retinoic Acid (Alitretinoin, Toctino®) in Patients With Hepatic Disease |
| NCT01407679 | PHASE2 | TERMINATED | Efficacy and Safety of Oral Alitretinoin (Toctino®) in the Treatment of Patients With Cutaneous Lupus Erythematosus |
| NCT01538732 | PHASE2 | UNKNOWN | Lichen Planus Mucosae at USZ, Efficacy of Oral Alitretinoin |
| NCT02061384 | PHASE2 | COMPLETED | RA-2 13-cis Retinoic Acid (Isotretinoin) |
| NCT03323801 | PHASE2 | COMPLETED | RA-4: 13-cis Retinoic Acid for Treatment of Men With Azoospermia |
| NCT00001504 | PHASE1 | COMPLETED | A Phase I Trial of Tamoxifen and 9-Cis-Retinoic Acid in Breast Cancer Patients |
| NCT00002439 | Not specified | COMPLETED | A Study of ALRT 1057 Topical Gel in Patients With AIDS-Related Kaposi’s Sarcoma |
| NCT01891526 | Not specified | COMPLETED | Single Dose of 9-cis-retinoic Acid in Hepatic Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
56 molecules share ≥1 primary target. Top 56 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BEXAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG, RXRA, RXRB, RXRG |
| Calcitriol | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG, RXRA, RXRB, RXRG |
| TRETINOIN | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG, RXRA, RXRB, RXRG |
| Rosiglitazone | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG, RXRA |
| Acetaminophen | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| ADAPALENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Alprostadil | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Amoxicillin | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| cyclosporine | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Olanzapine | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| OXAPROZIN | ChEMBL + PubChem | Phase 4 (approved) | RXRA, RXRB, RXRG |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TAZAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Tolcapone | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TRIFAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Zafirlukast | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TAMIBAROTENE | ChEMBL | Phase 4 (approved) | RARA, RARB, RARG |
| CONESSINE | ChEMBL | Phase 2 | RARA, RARB, RARG |
| GLIQUIDONE | ChEMBL | Phase 2 | RARA, RARB, RARG |
| IRX-4204 | ChEMBL | Phase 2 | RXRA, RXRB, RXRG |
| PIRINIXIC ACID | ChEMBL | Phase 2 | RXRA, RXRB, RXRG |
| Atorvastatin | PubChem | Approved | RARA, RARB, RARG |
| Bosentan | PubChem | Approved | RARA, RARB, RARG |
| Carprofen | PubChem | Approved | RARA, RARB, RARG |
| Diclofenac | PubChem | Approved | RARA, RARB, RARG |
| ethinyl estradiol | PubChem | Approved | RARA, RARB, RARG |
| Repaglinide | PubChem | Approved | RARA, RARB, RARG |
| rifampin | PubChem | Approved | RARA, RARB, RARG |
| Simvastatin | PubChem | Approved | RARA, RARB, RARG |
| Sunitinib | PubChem | Approved | RARA, RARB, RARG |
| Ticlopidine | PubChem | Approved | RARA, RARB, RARG |
| Verapamil | PubChem | Approved | RARA, RARB, RARG |
| Domperidone | ChEMBL + PubChem | Phase 4 (approved) | RARG, RXRA |
| Pitavastatin | ChEMBL + PubChem | Phase 4 (approved) | RARG, RXRA |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | RARB, RARG |
| Rivaroxaban | PubChem | Approved | RARB, RARG |
| SULINDAC | ChEMBL + PubChem | Phase 4 (approved) | RXRA |
| WARFARIN | ChEMBL + PubChem | Phase 4 (approved) | VKORC1 |
| FLUVASTATIN | ChEMBL | Phase 4 (approved) | RXRA |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | RARB |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | RARB |
| LEVOTHYROXINE | ChEMBL | Phase 4 (approved) | RXRA |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | RXRA |
| PIOGLITAZONE | ChEMBL | Phase 4 (approved) | RXRA |
| RACECADOTRIL | ChEMBL | Phase 4 (approved) | RARG |
| TROVAFLOXACIN | ChEMBL | Phase 4 (approved) | RARB |
| DOCONEXENT | ChEMBL | Phase 3 | RXRA |
| ICOSAPENT | ChEMBL | Phase 3 | RXRA |
| TIRATRICOL | ChEMBL | Phase 3 | RXRA |
| MOLIBRESIB | ChEMBL | Phase 2 | RARA |
| NRX195183 | ChEMBL | Phase 2 | RARA |
| arsenic trichloride | PubChem | Approved | RARA |
| arsenic triiodide | PubChem | Approved | RARA |
| Berberine Chloride | PubChem | Approved | RXRA |
| Ezetimibe | PubChem | Approved | RXRA |
| Retinol | PubChem | Approved | RARA |
Related Atlas pages
- Genes: VKORC1, RARA, RARB, RARG, RXRA, RXRB, RXRG
- Diseases: neoplasm, Kaposi’s sarcoma, hand dermatosis
- Drugs: Bexarotene, Calcitriol, Tretinoin, Rosiglitazone, Acetaminophen, Adapalene, Alprostadil, Amoxicillin, cyclosporine, Olanzapine, Oxaprozin, Regorafenib, Tazarotene, Tolcapone, Trifarotene, Zafirlukast, Tamibarotene, Atorvastatin, Bosentan, Carprofen, Diclofenac, ethinyl estradiol, Repaglinide, rifampin, Simvastatin, Sunitinib, Ticlopidine, Verapamil, Domperidone, Pitavastatin, Troglitazone, Rivaroxaban, Sulindac, Warfarin, Fluvastatin, Ibuprofen, Ketoconazole, Levothyroxine, Meclofenamic Acid, Pioglitazone, Racecadotril, Trovafloxacin, Doconexent, Icosapent, Tiratricol, Berberine Chloride, Ezetimibe, Retinol