Almotriptan
drugOn this page
Also known as LAS 31416LAS-31416LAS31416NSC-760092SID26748976SID174006290SID170465288Almotriptan malate (Axert)
Summary
Almotriptan (CHEMBL1505) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC N02CC05) targeting HTR1B and HTR1D; indicated across 1 condition including migraine disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N02CC05
- Targets: 2 (HTR1B, HTR1D)
- Indications: 1 condition
- Clinical trials: 1
- Chemistry: 335.5 Da · C17H25N3O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1505 |
| Name | Almotriptan |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 123606 |
| ChEBI | CHEBI:520985 |
| ATC | N02CC05 |
| Molecular formula | C17H25N3O2S |
| Molecular weight | 335.5 |
| InChIKey | WKEMJKQOLOHJLZ-UHFFFAOYSA-N |
SMILES: CN(C)CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3
IUPAC name: N,N-dimethyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine
ChEBI definition: An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, serotonergic agonist, vasoconstrictor agent.
Also known as: Almotriptan, LAS 31416, LAS-31416, LAS31416, NSC-760092, SID26748976, almotriptan, ALMOTRIPTAN, SID174006290, SID170465288, Almotriptan malate (Axert)
Parent form; salt/anhydrous children: CHEMBL1200521
Patent coverage: 1,841 distinct patent families (7,443 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 7,418 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR1B | 5-HT1B receptor | Agonist | 7.92 | 0.2% | P28222 |
| HTR1D | 5-HT1D receptor | Agonist | 7.89 | 0% | P28221 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: Prelamin-A/C, 5-hydroxytryptamine receptor 2B, Alpha-2B adrenergic receptor, 5-hydroxytryptamine receptor 1A, 5-hydroxytryptamine receptor 2A, Voltage-gated inwardly rectifying potassium channel KCNH2.
Bioactivity
ChEMBL activities: 2 potent at pChembl ≥ 5 of 7 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2B | 6.29 | AC50 | 510 | nM | CHEMBL_ACT_25163972 |
| LMNA | 5.35 | Potency | 4467 | nM | CHEMBL_ACT_3641554 |
Target pathways
Aggregated over 2 target gene(s): HTR1B, HTR1D.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | HTR1B, HTR1D |
| Signaling by GPCR | 2 | HTR1B, HTR1D |
| Class A/1 (Rhodopsin-like receptors) | 2 | HTR1B, HTR1D |
| Amine ligand-binding receptors | 2 | HTR1B, HTR1D |
| GPCR downstream signalling | 2 | HTR1B, HTR1D |
| Serotonin receptors | 2 | HTR1B, HTR1D |
| G alpha (i) signalling events | 2 | HTR1B, HTR1D |
| GPCR ligand binding | 2 | HTR1B, HTR1D |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 2 |
| chemical synaptic transmission | 2 |
| vasoconstriction | 2 |
| regulation of behavior | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| phospholipase C-activating serotonin receptor signaling pathway | 1 |
| negative regulation of serotonin secretion | 1 |
| bone remodeling | 1 |
| cellular response to alkaloid | 1 |
| cellular response to xenobiotic stimulus | 1 |
| positive regulation of vascular associated smooth muscle cell proliferation | 1 |
| intestine smooth muscle contraction | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| migraine disorder | 2 | MONDO:0005277 | MONDO:0005277 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00432549 | PHASE4 | UNKNOWN | Detoxification and Treatment of Subjects With Medication Overuse Headache |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 7 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
51 molecules share ≥1 primary target. Top 51 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| FROVATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| NARATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| OXYMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| RIZATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| SALMETEROL | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| SILODOSIN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| SUMATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| VILAZODONE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| XYLOMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| ZOLMITRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D |
| SEROTONIN | ChEMBL | Phase 3 | HTR1B, HTR1D |
| YOHIMBINE | ChEMBL | Phase 3 | HTR1B, HTR1D |
| ACETRYPTINE | ChEMBL | Phase 2 | HTR1B, HTR1D |
| GSK163090 | ChEMBL | Phase 2 | HTR1B, HTR1D |
| MEBUFOTENIN | ChEMBL | Phase 2 | HTR1B, HTR1D |
| PSILOCIN | ChEMBL | Phase 2 | HTR1B, HTR1D |
| LASMIDITAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1D |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR1D |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HTR1B |
| ELETRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B |
| KETOTIFEN | ChEMBL | Phase 4 (approved) | HTR1B |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | HTR1D |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR1D |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | HTR1B |
| PINDOLOL | ChEMBL | Phase 4 (approved) | HTR1B |
| PRAMIPEXOLE | ChEMBL | Phase 4 (approved) | HTR1B |
| PRAZOSIN | ChEMBL | Phase 4 (approved) | HTR1D |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | HTR1B |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR1D |
| LATREPIRDINE | ChEMBL | Phase 3 | HTR1D |
| ALNIDITAN | ChEMBL | Phase 2 | HTR1D |
| ATUMELNANT | ChEMBL | Phase 2 | HTR1B |
| LEVOPROPRANOLOL | ChEMBL | Phase 2 | HTR1B |
| LYSERGIDE | ChEMBL | Phase 2 | HTR1D |
| MAZAPERTINE | ChEMBL | Phase 2 | HTR1B |
| NIGULDIPINE | ChEMBL | Phase 2 | HTR1B |
| PENFLURIDOL | ChEMBL | Phase 2 | HTR1D |
| PRUVANSERIN | ChEMBL | Phase 2 | HTR1D |
| RITANSERIN | ChEMBL | Phase 2 | HTR1B |
| SPIRAMIDE | ChEMBL | Phase 2 | HTR1D |
Related Atlas pages
- Genes: HTR1B, HTR1D
- Drugs: Dihydroergotamine, Paliperidone, Aripiprazole, Azelastine, Brexpiprazole, Cariprazine, Ergotamine, Frovatriptan, Imipramine, Ketanserin, Naratriptan, Nefazodone, Oxymetazoline, Risperidone, Rizatriptan, Salmeterol, Silodosin, Sumatriptan, Vilazodone, Xylometazoline, Zolmitriptan, Serotonin, Yohimbine, Lasmiditan, Cinacalcet, Clozapine, Eletriptan, Ketotifen, Loperamide, Mianserin, Olanzapine, Pindolol, Pramipexole, Prazosin, Sertindole, Tegaserod, Latrepirdine