Amiloride
drugOn this page
Also known as AmiclaranAmiloridaHydro-rideSID11110775SID11113372SID26751628SID26751629SID90341609SID104171108SID49645530SID124879259SID124879263SID170465124SID144203631AMILORIDE HYDROCHLORIDE
Summary
Amiloride (CHEMBL945) is an approved small-molecule sodium channel blocker (ATC C03DB01) targeting GABRA6, TRPA1, and TRPC6; indicated across 10 conditions including cardiovascular disorder and hypertensive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C03DB01
- Targets: 13 (GABRA6, TRPA1, TRPC6…)
- Indications: 10 conditions
- Clinical trials: 42
- Chemistry: 229.63 Da · C6H8ClN7O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL945 |
| Name | Amiloride |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 16231 |
| ChEBI | CHEBI:2639 |
| ATC | C03DB01 |
| Molecular formula | C6H8ClN7O |
| Molecular weight | 229.63 |
| InChIKey | XSDQTOBWRPYKKA-UHFFFAOYSA-N |
SMILES: C1(=C(N=C(C(=N1)Cl)N)N)C(=O)N=C(N)N
IUPAC name: 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide
ChEBI definition: A member of the class of pyrazines resulting from the formal monoacylation of guanidine with the carboxy group of 3,5-diamino-6-chloropyrazine-2-carboxylic acid.
Pharmacological roles (ChEBI): sodium channel blocker, diuretic.
Also known as: Amiclaran, Amilorida, Amiloride, Hydro-ride, amiloride, SID11110775, SID11113372, SID26751628, SID26751629, SID90341609, SID104171108, SID49645530
Parent form; salt/anhydrous children: CHEMBL540851, CHEMBL1201085, CHEMBL1398126
Patent coverage: 17,515 distinct patent families (63,705 SureChEMBL compound mentions), from 3 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GABRA6 | GABAA receptor α6 subunit | Antagonist | 0.1% | Q16445 | |
| TRPA1 | TRPA1 | Inhibition | 3.3 | 0.1% | O75762 |
| TRPC6 | TRPC6 | Antagonist | 3.9 | 0.2% | Q9Y210 |
| TRPC7 | TRPC7 | Q9HCX4 | |||
| PKD2L1 | TRPP2 | 3.8 | 0% | Q9P0L9 | |
| TRPV2 | TRPV2 | 1.4% | Q9Y5S1 | ||
| ASIC1 | ASIC1 | 4.68 | 2.6% | P78348 | |
| ASIC2 | ASIC2 | 4.6 | 0.1% | Q16515 | |
| ASIC3 | ASIC3 | 4.8 | 0% | Q9UHC3 | |
| ENaCαβγ | 7 | ||||
| SLC9A1 | Sodium/hydrogen exchanger 1 | Inhibition | 6 | 0.2% | P19634 |
| SLC9A2 | Sodium/hydrogen exchanger 2 | Inhibition | 7.1 | 0.1% | Q9UBY0 |
| SLC9A3 | Sodium/hydrogen exchanger 3 | Inhibition | 4 | 2.2% | P48764 |
| SLC9A5 | Sodium/hydrogen exchanger 5 | Inhibition | 4.68 | 0.2% | Q14940 |
Broader ChEMBL bioactivity targets: 33 (assay-derived). Sample: Urokinase-type plasminogen activator, Lysine-specific demethylase 4E, Prelamin-A/C, RecQ-like DNA helicase BLM, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Solute carrier family 22 member 2, Epithelial sodium channel subunit alpha, 5-hydroxytryptamine receptor 2B, Amine oxidase [flavin-containing] A, Thyrotropin receptor.
Bioactivity
ChEMBL activities: 32 potent at pChembl ≥ 5 of 67 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| LMNA | 6.15 | Potency | 707.9 | nM | CHEMBL_ACT_3654294 |
| SCNN1A | 6.11 | IC50 | 776 | nM | CHEMBL_ACT_1739351 |
| P50482 | 6 | Ki | 1000 | nM | CHEMBL_ACT_16889003 |
| P26431 | 6 | Ki | 1000 | nM | CHEMBL_ACT_16889004 |
| P26431 | 6 | Ki | 1000 | nM | CHEMBL_ACT_16895831 |
| P50482 | 6 | Ki | 1000 | nM | CHEMBL_ACT_16895846 |
| P26431 | 6 | IC50 | 1000 | nM | CHEMBL_ACT_18715250 |
| P50482 | 6 | IC50 | 1000 | nM | CHEMBL_ACT_18715270 |
| P26431 | 5.68 | IC50 | 2080 | nM | CHEMBL_ACT_25906581 |
| P06869 | 5.64 | Ki | 2313 | nM | CHEMBL_ACT_18556916 |
| P06869 | 5.64 | IC50 | 2300 | nM | CHEMBL_ACT_19288607 |
| PLAU | 5.62 | IC50 | 2400 | nM | CHEMBL_ACT_19288605 |
| PLAU | 5.62 | IC50 | 2400 | nM | CHEMBL_ACT_19288637 |
| PLAU | 5.61 | Ki | 2433 | nM | CHEMBL_ACT_18556812 |
| PLAU | 5.6 | Ki | 2512 | nM | CHEMBL_ACT_2651724 |
| ADRA1A | 5.57 | AC50 | 2693 | nM | CHEMBL_ACT_25137812 |
| ADORA2A | 5.48 | Ki | 3280 | nM | CHEMBL_ACT_523444 |
| MAOA | 5.41 | IC50 | 3909 | nM | CHEMBL_ACT_7637611 |
| OPRM1 | 5.4 | AC50 | 4000 | nM | CHEMBL_ACT_25146805 |
| MAOA | 5.36 | AC50 | 4409 | nM | CHEMBL_ACT_25159477 |
| ASIC3 | 5.36 | IC50 | 4400 | nM | CHEMBL_ACT_2521926 |
| Q9R0W2 | 5.33 | Ki | 4700 | nM | CHEMBL_ACT_11003117 |
| FTO | 5.32 | IC50 | 4740 | nM | CHEMBL_ACT_24989153 |
| HSD17B10 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4873559 |
| MAOA | 5.28 | AC50 | 5240 | nM | CHEMBL_ACT_25160667 |
| HTR2B | 5.25 | AC50 | 5633 | nM | CHEMBL_ACT_25164053 |
| PLAU | 5.16 | IC50 | 7000 | nM | CHEMBL_ACT_10844172 |
| Q63089 | 5.16 | Ki | 6900 | nM | CHEMBL_ACT_11003221 |
| PLAU | 5.16 | IC50 | 7000 | nM | CHEMBL_ACT_1109566 |
| PLAU | 5.16 | Ki | 7000 | nM | CHEMBL_ACT_18556974 |
Target pathways
Aggregated over 13 target gene(s): GABRA6, TRPA1, TRPC6, TRPC7, PKD2L1, TRPV2, ASIC1, ASIC2, ASIC3, SLC9A1, SLC9A2, SLC9A3, SLC9A5.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transport of small molecules | 7 | ASIC1, ASIC2, ASIC3, SLC9A1, SLC9A2, SLC9A3, SLC9A5 |
| TRP channels | 4 | TRPA1, TRPC6, TRPC7, TRPV2 |
| R-HSA-425393 | 4 | SLC9A1, SLC9A2, SLC9A3, SLC9A5 |
| SLC-mediated transmembrane transport | 4 | SLC9A1, SLC9A2, SLC9A3, SLC9A5 |
| Sodium/Proton exchangers | 4 | SLC9A1, SLC9A2, SLC9A3, SLC9A5 |
| Stimuli-sensing channels | 3 | ASIC1, ASIC2, ASIC3 |
| Ion channel transport | 3 | ASIC1, ASIC2, ASIC3 |
| Effects of PIP2 hydrolysis | 2 | TRPC6, TRPC7 |
| Elevation of cytosolic Ca2+ levels | 2 | TRPC6, TRPC7 |
| Role of second messengers in netrin-1 signaling | 2 | TRPC6, TRPC7 |
| Metabolism | 1 | SLC9A1 |
| Glycosaminoglycan metabolism | 1 | SLC9A1 |
| Hyaluronan metabolism | 1 | SLC9A1 |
| Hyaluronan degradation | 1 | SLC9A1 |
| Metabolism of carbohydrates and carbohydrate derivatives | 1 | SLC9A1 |
| GABA receptor activation | 1 | GABRA6 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 13 |
| monoatomic ion transmembrane transport | 9 |
| monoatomic cation transport | 9 |
| transmembrane transport | 8 |
| sodium ion transmembrane transport | 7 |
| sodium ion transport | 7 |
| calcium ion transmembrane transport | 6 |
| calcium ion transport | 6 |
| potassium ion transmembrane transport | 5 |
| sensory perception of sour taste | 4 |
| response to acidic pH | 4 |
| regulation of pH | 4 |
| regulation of intracellular pH | 4 |
| sodium ion import across plasma membrane | 4 |
| proton transmembrane transport | 4 |
Indications & clinical
Indications
10 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| coronary artery disorder | 2 | MONDO:0005010 | EFO:0001645 |
| optic neuritis | 2 | MONDO:0005885 | EFO:0007405 |
| primary hyperparathyroidism | 2 | MONDO:0010837 | EFO:0008519 |
| secondary progressive multiple sclerosis | 2 | MONDO:0000450 | EFO:0008522 |
| demyelinating disease | 2 | MONDO:0002562 | HP:0011096 |
| migraine with aura | 2 | MONDO:0005475 | MONDO:0005475 |
| cystic fibrosis | 1 | MONDO:0009061 | MONDO:0009061 |
| attention deficit-hyperactivity disorder | 0 | MONDO:0007743 | EFO:0003888 |
Clinical trials
Total trials: 42.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 11 |
| PHASE4 | 10 |
| PHASE2 | 8 |
| PHASE2/PHASE3 | 4 |
| PHASE3 | 3 |
| PHASE1 | 3 |
| EARLY_PHASE1 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01308983 | PHASE4 | UNKNOWN | Study of Amiloride on Vascular Phenotypes in Young Adults With Prehypertension |
| NCT01388088 | PHASE4 | COMPLETED | The Effect of Amiloride and Spironolactone in Patients With Hypertension |
| NCT02122731 | PHASE4 | COMPLETED | Amiloride for Resistant Hypertension |
| NCT02351973 | PHASE4 | UNKNOWN | Comparison of Single and Combination Diuretics in Low-Renin Hypertension |
| NCT02522650 | PHASE4 | UNKNOWN | A Crossover Pilot Study of the Effect of Amiloride on Proteinuria |
| NCT02832973 | PHASE4 | COMPLETED | Sequential Nephron Blockade vs. Dual Blockade Renin-angiotensin System + Bisoprolol in Resistant Arterial Hypertension |
| NCT02847338 | PHASE4 | COMPLETED | Comparison of Optimal Hypertension Regimens |
| NCT02875886 | PHASE4 | COMPLETED | DD-study: Diet or Diuretics for Salt-sensitivity in Chronic Kidney Disease |
| NCT03170336 | PHASE4 | COMPLETED | A New Application of Amiloride in the Treatment of Patient With Chronic Kidney Disease In Reducing Urinary PROtein |
| NCT04331691 | PHASE4 | COMPLETED | Comparison of Spironolactone and Amiloride on Home Blood Pressure in Resistant Hypertension |
| NCT01228214 | PHASE2/PHASE3 | UNKNOWN | Novel Treatment for Coronary Artery Disease |
| NCT01231165 | PHASE2/PHASE3 | COMPLETED | Treatment of Coronary Heart Disease With Amiloride |
| NCT02525796 | PHASE2/PHASE3 | COMPLETED | Evaluating Alternative Medical Therapies in Primary Hyperparathyroidism |
| NCT03837626 | PHASE2/PHASE3 | COMPLETED | ENAC Blockade and Arterial Stiffness |
| NCT03928145 | PHASE3 | UNKNOWN | Efficacy of Chlorthalidone and Hydrochlorothiazide Combined With Amiloride on Blood Pressure in Primary Hypertension. |
| NCT05079789 | PHASE3 | TERMINATED | Amiloride in Nephrotic Syndrome |
| NCT06416735 | PHASE3 | COMPLETED | Natriuretic Effect of Amiloride in Relation to the Alpha Adducin Gene (ADD-AMI) RS4961 Variant |
| NCT04063540 | PHASE2 | RECRUITING | Acid-Sensing Ion Channel and Migraine Disease Proof of Concept Study on the Efficacy of Amiloride in the Prophylaxis of Migraine Aura |
| NCT06224673 | PHASE2 | NOT_YET_RECRUITING | ARX788 for Treating Patients With HER2-low Locally Advanced Unresectable or Metastatic Breast Cancer |
| NCT06923709 | PHASE2 | RECRUITING | Beneficial Effect of Amiloride on Progression of Chronic Kidney Disease |
| NCT00394394 | PHASE2 | COMPLETED | Antihypertensive Effectiveness of the Associations of Hydrochlorothiazide and Amiloride and Hydrochlorothiazide and Enalapril |
| NCT01802489 | PHASE2 | COMPLETED | Amiloride Clinical Trial In Optic Neuritis |
| NCT01879527 | PHASE2 | UNKNOWN | Amiloride Hydrochlorothiazide as Treatment of Acute Inflammation of the Optic Nerve |
| NCT01910259 | PHASE2 | COMPLETED | MS-SMART: Multiple Sclerosis-Secondary Progressive Multi-Arm Randomisation Trial |
| NCT02497300 | PHASE2 | COMPLETED | Vascular Effects of Mineralocorticoid Receptor Antagonism in Kidney Disease |
| NCT05753059 | PHASE1 | RECRUITING | Mechanisms of Diuretic Resistance in Heart Failure, Aim 2 |
| NCT00857909 | PHASE1 | COMPLETED | The Effect of Amiloride and Spironolactone in Healthy Persons |
| NCT01095133 | PHASE1 | COMPLETED | Do Acid Sensing Ion Channels Contribute to Heartburn? |
| NCT01733680 | EARLY_PHASE1 | TERMINATED | Amiloride Hydrochloride as an Effective Treatment for ADHD |
| NCT01804777 | EARLY_PHASE1 | TERMINATED | Epithelial Sodium Channel (ENaC) as a Novel Mechanism for Hypertension and Volume Expansion in Type 2 Diabetes |
| NCT04181008 | EARLY_PHASE1 | COMPLETED | Pharmacokinetics of Amiloride Nasal Spray in Healthy Volunteers |
| NCT00004705 | Not specified | COMPLETED | Study of Uridine Triphosphate (UTP) as an Aerosol Spray for Cystic Fibrosis |
| NCT00424801 | Not specified | TERMINATED | Effects of Intensive Long-Term Vasodilation in Hypertensive Patients With Microvascular Angina Pectoris |
| NCT00429897 | Not specified | UNKNOWN | Double Blind Crossover Comparison of Diuretics in the Young |
| NCT00478335 | Not specified | COMPLETED | Pharmacologic Treatment of Congenital Nephrogenic Diabetes Insipidus |
| NCT00709137 | Not specified | WITHDRAWN | Spironolactone Versus Amiloride as an Add on Agent in Resistant Hypertension |
| NCT01055223 | Not specified | COMPLETED | Fracture Risk With Thiazolidinediones |
| NCT01195805 | Not specified | COMPLETED | The Effects of Amiloride and Spironolactone on Renophysiological and Cardiovascular Variables |
| NCT01246180 | Not specified | COMPLETED | Microcirculation & ASICs |
| NCT01706887 | Not specified | TERMINATED | Genetic Determinant of Blood Pressure Sensitivity to Salt Intake |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 3 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
59 molecules share ≥1 primary target. Top 59 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ENIPORIDE | ChEMBL | Phase 2 | SLC9A1, SLC9A2, SLC9A3 |
| CANNABINOL | ChEMBL | Phase 3 | TRPA1, TRPV2 |
| CANNABIDIVARIN | ChEMBL | Phase 2 | TRPA1, TRPV2 |
| CANNABIGEROL | ChEMBL | Phase 2 | TRPA1, TRPV2 |
| CARIPORIDE | ChEMBL | Phase 2 | SLC9A1, SLC9A2 |
| TETRAHYDROCANNABIVARIN | ChEMBL | Phase 2 | TRPA1, TRPV2 |
| ZONIPORIDE | ChEMBL | Phase 2 | SLC9A1, SLC9A2 |
| Caffeine | PubChem | Approved | GABRA6, TRPA1 |
| APALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| CLONAZEPAM | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| DIAZEPAM | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| DICLOFENAC | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| DISULFIRAM | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| ENZALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| FLUMAZENIL | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| MEFENAMIC ACID | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| TENAPANOR | ChEMBL + PubChem | Phase 4 (approved) | SLC9A3 |
| BREXANOLONE | ChEMBL | Phase 4 (approved) | GABRA6 |
| GANAXOLONE | ChEMBL | Phase 4 (approved) | GABRA6 |
| LINDANE | ChEMBL | Phase 4 (approved) | GABRA6 |
| LIOTHYRONINE | ChEMBL | Phase 4 (approved) | GABRA6 |
| MENTHOL | ChEMBL | Phase 4 (approved) | TRPA1 |
| NICOTINE | ChEMBL | Phase 4 (approved) | TRPA1 |
| PROPOFOL | ChEMBL | Phase 4 (approved) | GABRA6 |
| RESVERATROL | ChEMBL + PubChem | Phase 3 (approved) | TRPA1 |
| ICILLIN | ChEMBL | Phase 3 | TRPA1 |
| LEVOMENTHOL | ChEMBL | Phase 3 | TRPA1 |
| ABECARNIL | ChEMBL | Phase 2 | GABRA6 |
| ALLICIN | ChEMBL | Phase 2 | TRPA1 |
| BAICALEIN | ChEMBL | Phase 2 | GABRA6 |
| BRETAZENIL | ChEMBL | Phase 2 | GABRA6 |
| CARVACROL | ChEMBL | Phase 2 | TRPA1 |
| CHLORDANTOIN | ChEMBL | Phase 2 | TRPA1 |
| CLEMIZOLE | ChEMBL | Phase 2 | TRPC6 |
| DELORAZEPAM | ChEMBL | Phase 2 | GABRA6 |
| FLAVONE | ChEMBL | Phase 2 | GABRA6 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | TRPA1 |
| PANADIPLON | ChEMBL | Phase 2 | GABRA6 |
| PROGABIDE | ChEMBL | Phase 2 | GABRA6 |
| RG6341 | ChEMBL | Phase 2 | TRPA1 |
| RIMEPORIDE | ChEMBL | Phase 2 | SLC9A1 |
| SABIPORIDE | ChEMBL | Phase 2 | SLC9A1 |
| SALIRASIB | ChEMBL | Phase 2 | TRPA1 |
| SANGUINARIUM | ChEMBL | Phase 2 | TRPA1 |
| THYMOL | ChEMBL | Phase 2 | TRPA1 |
| .gamma.-aminobutyric acid | PubChem | Approved | GABRA6 |
| Acetaldehyde | PubChem | Approved | TRPA1 |
| alfaxalone | PubChem | Approved | GABRA6 |
| Aspirin | PubChem | Approved | ASIC3 |
| camphor (synthetic) | PubChem | Approved | TRPA1 |
| Cannabidiol | PubChem | Approved | TRPV2 |
| Ciprofloxacin | PubChem | Approved | GABRA6 |
| dronabinol | PubChem | Approved | TRPA1 |
| Eugenol | PubChem | Approved | TRPA1 |
| Fipronil | PubChem | Approved | GABRA6 |
| menthol, unspecified form | PubChem | Approved | TRPA1 |
| Phenytoin | PubChem | Approved | GABRA6 |
| Propylene Glycol | PubChem | Approved | TRPA1 |
| valproate | PubChem | Approved | GABRA6 |
Related Atlas pages
- Genes: GABRA6, TRPA1, TRPC6, TRPC7, PKD2L1, TRPV2, ASIC1, ASIC2, ASIC3, SLC9A1, SLC9A2, SLC9A3, SLC9A5
- Diseases: cardiovascular disorder, hypertensive disorder
- Drugs: Cannabinol, Caffeine, Apalutamide, Clonazepam, Diazepam, Diclofenac, Disulfiram, Enzalutamide, Flumazenil, Mefenamic Acid, Tenapanor, Brexanolone, Ganaxolone, Lindane, Liothyronine, Menthol, Nicotine, Propofol, Resveratrol, Icillin, Aspirin, camphor (synthetic), Cannabidiol, Ciprofloxacin, dronabinol, Phenytoin, Propylene Glycol, valproate