Aminoglutethimide
drugOn this page
Also known as AminoglutetimidaCytadrenNSC-330915OrimetenSID26747446SID50105852SID85230926Amino-glutethimideSID90340970SID459146SID46500462SID174007456SID144213805SID144203957SID170465259Glutethimidepara-aminoC0165002
Summary
Aminoglutethimide (CHEMBL488) is an approved small-molecule antineoplastic agent (ATC L02BG01) targeting CYP11A1 and CYP19A1; indicated across 3 conditions including neoplasm and breast neoplasm; with CIViC clinical evidence for 1 variant-indication association (e.g. TFF3 EXPRESSION in breast cancer).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L02BG01
- Targets: 2 (CYP11A1, CYP19A1)
- Indications: 3 conditions
- Clinical trials: 2
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 232.28 Da · C13H16N2O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL488 |
| Name | Aminoglutethimide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 2145 |
| ChEBI | CHEBI:2654 |
| ATC | L02BG01 |
| Molecular formula | C13H16N2O2 |
| Molecular weight | 232.28 |
| InChIKey | ROBVIMPUHSLWNV-UHFFFAOYSA-N |
SMILES: CCC1(CCC(=O)NC1=O)C2=CC=C(C=C2)N
IUPAC name: 3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione
ChEBI definition: A dicarboximide that is a six-membered cyclic compound having ethyl and 4-aminophenyl substituents at the 3-position.
Pharmacological roles (ChEBI): antineoplastic agent, adrenergic agent, EC 1.14.14.14 (aromatase) inhibitor, anticonvulsant.
Also known as: Aminoglutethimide, Aminoglutetimida, Cytadren, NSC-330915, Orimeten, aminoglutethimide, SID26747446, SID50105852, SID85230926, Amino-glutethimide, AMINOGLUTETHIMIDE, SID90340970
Patent coverage: 18,293 distinct patent families (74,271 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CYP11A1 | CYP11A1 | Inhibition | 4.52 | 0.2% | P05108 |
| CYP19A1 | CYP19A1 | Inhibition | 0% | P11511 |
Broader ChEMBL bioactivity targets: 11 (assay-derived). Sample: Peripheral myelin protein 22, Thromboxane-A synthase, Aromatase, Cholesterol side-chain cleavage enzyme, mitochondrial, cGMP-inhibited 3’,5’-cyclic phosphodiesterase 3A, 3’,5’-cyclic-AMP phosphodiesterase 4D, Cytochrome P450 11B2, mitochondrial, Cytochrome P450 3A4, Steroid 17-alpha-hydroxylase/17,20 lyase, Aromatase.
Bioactivity
ChEMBL activities: 35 potent at pChembl ≥ 5 of 65 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P22443 | 6.58 | EC50 | 260 | nM | CHEMBL_ACT_719199 |
| CYP19A1 | 6.57 | IC50 | 270 | nM | CHEMBL_ACT_1885050 |
| CYP19A1 | 6.57 | IC50 | 270 | nM | CHEMBL_ACT_2279870 |
| CYP19A1 | 6.33 | Ki | 470 | nM | CHEMBL_ACT_1099394 |
| CYP19A1 | 6.22 | Ki | 600 | nM | CHEMBL_ACT_160554 |
| CYP19A1 | 6.22 | Ki | 600 | nM | CHEMBL_ACT_195131 |
| CYP19A1 | 6.22 | Ki | 600 | nM | CHEMBL_ACT_595813 |
| CYP19A1 | 6.17 | Ki | 680 | nM | CHEMBL_ACT_1115197 |
| CYP19A1 | 5.85 | Ki | 1410 | nM | CHEMBL_ACT_1463459 |
| CYP19A1 | 5.85 | Ki | 1410 | nM | CHEMBL_ACT_1483240 |
| CYP19A1 | 5.77 | IC50 | 1700 | nM | CHEMBL_ACT_1099392 |
| CYP19A1 | 5.75 | Ki | 1800 | nM | CHEMBL_ACT_195132 |
| CYP19A1 | 5.75 | Ki | 1800 | nM | CHEMBL_ACT_895828 |
| CYP19A1 | 5.72 | IC50 | 1900 | nM | CHEMBL_ACT_325803 |
| CYP19A1 | 5.72 | IC50 | 1900 | nM | CHEMBL_ACT_478855 |
| CYP19A1 | 5.55 | IC50 | 2800 | nM | CHEMBL_ACT_1463457 |
| CYP19A1 | 5.55 | IC50 | 2800 | nM | CHEMBL_ACT_1483238 |
| CYP19A1 | 5.39 | Ki | 4100 | nM | CHEMBL_ACT_16432265 |
| CYP19A1 | 5.28 | IC50 | 5200 | nM | CHEMBL_ACT_1128695 |
| CYP19A1 | 5.28 | IC50 | 5200 | nM | CHEMBL_ACT_290938 |
| CYP19A1 | 5.24 | IC50 | 5800 | nM | CHEMBL_ACT_6219415 |
| CYP19A1 | 5.21 | IC50 | 6130 | nM | CHEMBL_ACT_1115196 |
| P22443 | 5.21 | IC50 | 6200 | nM | CHEMBL_ACT_789248 |
| CYP19A1 | 5.19 | IC50 | 6400 | nM | CHEMBL_ACT_15156701 |
| CYP19A1 | 5.19 | IC50 | 6400 | nM | CHEMBL_ACT_2201703 |
| CYP19A1 | 5.16 | IC50 | 7000 | nM | CHEMBL_ACT_18102349 |
| CYP19A1 | 5.1 | IC50 | 8000 | nM | CHEMBL_ACT_195129 |
| CYP19A1 | 5.1 | IC50 | 8000 | nM | CHEMBL_ACT_895825 |
| CYP19A1 | 5.08 | IC50 | 8300 | nM | CHEMBL_ACT_1115198 |
| CYP19A1 | 5.05 | IC50 | 9000 | nM | CHEMBL_ACT_18102374 |
Target pathways
Aggregated over 2 target gene(s): CYP11A1, CYP19A1.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Endogenous sterols | 2 | CYP11A1, CYP19A1 |
| Estrogen biosynthesis | 1 | CYP19A1 |
| Pregnenolone biosynthesis | 1 | CYP11A1 |
| Defective CYP11A1 causes AICSR | 1 | CYP11A1 |
| Defective CYP19A1 causes AEXS | 1 | CYP19A1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| sterol metabolic process | 2 |
| lipid metabolic process | 2 |
| steroid biosynthetic process | 2 |
| C21-steroid hormone biosynthetic process | 1 |
| glucocorticoid biosynthetic process | 1 |
| cholesterol metabolic process | 1 |
| cortisol metabolic process | 1 |
| vitamin D metabolic process | 1 |
| cellular response to peptide hormone stimulus | 1 |
| steroid hormone biosynthetic process | 1 |
| alcohol metabolic process | 1 |
| steroid metabolic process | 1 |
| C21-steroid hormone metabolic process | 1 |
| negative regulation of chronic inflammatory response | 1 |
| estrogen biosynthetic process | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00309491 | PHASE3 | COMPLETED | Randomized Study Comparing Tamoxifen vs. Tamoxifen + Aminoglutethimide in Postmenopausal Receptor-positive Patients |
| NCT00006371 | PHASE2 | TERMINATED | A Phase II Trial of Early Medical Adrenalectomy for D0.5 Prostate Cancer |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| TFF3 EXPRESSION | Breast Cancer | Sensitivity/Response | Aminoglutethimide + Tamoxifen | CIViC B | EID823 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
40 molecules share ≥1 primary target. Top 40 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ANASTROZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| ESTRONE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| EXEMESTANE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| FLUCONAZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| FLUOROURACIL | ChEMBL | Phase 4 (approved) | CYP19A1 |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| LETROZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| OSILODROSTAT | ChEMBL | Phase 4 (approved) | CYP19A1 |
| POSACONAZOLE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| TESTOLACTONE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| TESTOSTERONE | ChEMBL | Phase 4 (approved) | CYP19A1 |
| DOCONEXENT | ChEMBL | Phase 3 | CYP19A1 |
| ENDOXIFEN | ChEMBL | Phase 3 | CYP19A1 |
| ICOSAPENT | ChEMBL | Phase 3 | CYP19A1 |
| QUERCETIN | ChEMBL | Phase 3 | CYP19A1 |
| RESVERATROL | ChEMBL | Phase 3 | CYP19A1 |
| 2-METHOXYESTRADIOL | ChEMBL | Phase 2 | CYP19A1 |
| AZALANSTAT | ChEMBL | Phase 2 | CYP19A1 |
| DAIDZEIN | ChEMBL | Phase 2 | CYP19A1 |
| DEXFADROSTAT | ChEMBL | Phase 2 | CYP19A1 |
| DOCOSAPENTAENOIC ACID | ChEMBL | Phase 2 | CYP19A1 |
| FADROZOLE | ChEMBL | Phase 2 | CYP19A1 |
| FLAVONE | ChEMBL | Phase 2 | CYP19A1 |
| FORMESTANE | ChEMBL | Phase 2 | CYP19A1 |
| GENISTEIN | ChEMBL | Phase 2 | CYP19A1 |
| IROSUSTAT | ChEMBL | Phase 2 | CYP19A1 |
| LIAROZOLE | ChEMBL | Phase 2 | CYP19A1 |
| LINOLEIC ACID | ChEMBL | Phase 2 | CYP19A1 |
| LUTEOLIN | ChEMBL | Phase 2 | CYP19A1 |
| OLEIC ACID | ChEMBL | Phase 2 | CYP19A1 |
| PINOCEMBRIN | ChEMBL | Phase 2 | CYP19A1 |
| PLOMESTANE | ChEMBL | Phase 2 | CYP19A1 |
| ROGLETIMIDE | ChEMBL | Phase 2 | CYP19A1 |
| STANOLONE | ChEMBL | Phase 2 | CYP19A1 |
| URSOLIC ACID | ChEMBL | Phase 2 | CYP19A1 |
| VOROZOLE | ChEMBL | Phase 2 | CYP19A1 |
| Fulvestrant | PubChem | Approved | CYP19A1 |
Related Atlas pages
- Genes: CYP11A1, CYP19A1
- Diseases: neoplasm, breast neoplasm, breast carcinoma
- Drugs: Anastrozole, Clotrimazole, Estrone, Exemestane, Fluconazole, Fluorouracil, Ketoconazole, Letrozole, Miconazole, Nimesulide, Osilodrostat, Posaconazole, Testolactone, Testosterone, Doconexent, Endoxifen, Icosapent, Quercetin, Resveratrol, Fulvestrant