Amiodarone
drugOn this page
Also known as AmiodaronaSID11110784SID11110785SID26751596SID26751597SID90341282SID104171110SID50100172SID124879287SID144203634AmiodaloneSID170464920MMV001992
Summary
Amiodarone (CHEMBL633) is an approved small-molecule cardiovascular drug (ATC C01BD01) targeting CHRM5, KCNA7, and SCN5A; indicated across 18 conditions including atrial fibrillation and cardiomyopathy.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C01BD01
- Targets: 3 (CHRM5, KCNA7, SCN5A)
- Indications: 18 conditions
- Clinical trials: 85
- Chemistry: 645.3 Da · C25H29I2NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL633 |
| Name | Amiodarone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2157 |
| ChEBI | CHEBI:2663 |
| ATC | C01BD01 |
| Molecular formula | C25H29I2NO3 |
| Molecular weight | 645.3 |
| InChIKey | IYIKLHRQXLHMJQ-UHFFFAOYSA-N |
SMILES: CCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)I)OCCN(CC)CC)I
IUPAC name: (2-butyl-1-benzofuran-3-yl)-[4-[2-(diethylamino)ethoxy]-3,5-diiodophenyl]methanone
ChEBI definition: A member of the class of 1-benzofurans that is 1-benzofuran substituted by a butyl group at position 2 and a 4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl group at position 3. It is a cardiovascular drug used for the treatment of cardiac dysrhythmias.
Pharmacological roles (ChEBI): cardiovascular drug.
Also known as: Amiodarona, Amiodarone, amiodarone, SID11110784, SID11110785, SID26751596, SID26751597, SID90341282, SID104171110, SID50100172, SID124879287, SID144203634
Parent form; salt/anhydrous children: CHEMBL1083993
Patent coverage: 8,094 distinct patent families (29,704 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 29,399 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CHRM5 | M5 receptor | Positive | 7.25 | 0% | P08912 |
| KCNA7 | Kv1.7 | 4.5 | 0.5% | Q96RP8 | |
| SCN5A | Nav1.5 | Pore blocker | 5.7 | 0.2% | Q14524 |
Broader ChEMBL bioactivity targets: 86 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Nuclear receptor ROR-gamma, Survival motor neuron protein, 4’-phosphopantetheinyl transferase ffp, Thrombopoietin, Solute carrier organic anion transporter family member 1A4, Vasopressin V2 receptor, Muscarinic acetylcholine receptor M4, Receptor tyrosine-protein kinase erbB-2, 5-hydroxytryptamine receptor 2B.
Bioactivity
ChEMBL activities: 101 potent at pChembl ≥ 5 of 170 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SIGMAR1 | 9 | Ki | 1 | nM | CHEMBL_ACT_1483631 |
| CYP2C9 | 8.1 | Potency | 7.9 | nM | CHEMBL_ACT_5029393 |
| CYP2C9 | 8.1 | AC50 | 7.94 | nM | CHEMBL_ACT_6006393 |
| EBP | 7.6 | Ki | 25 | nM | CHEMBL_ACT_1483630 |
| KCNH2 | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_15257949 |
| SIGMAR1 | 7.39 | Ki | 41 | nM | CHEMBL_ACT_7634964 |
| P32352 | 7.21 | Ki | 62 | nM | CHEMBL_ACT_1483632 |
| CYP2C9 | 7.2 | Potency | 63.1 | nM | CHEMBL_ACT_5061496 |
| CYP2C9 | 7.2 | AC50 | 63.1 | nM | CHEMBL_ACT_5991682 |
| SIGMAR1 | 7.01 | IC50 | 97 | nM | CHEMBL_ACT_7634963 |
| ADRA2A | 6.93 | Ki | 117 | nM | CHEMBL_ACT_7632307 |
| ADRA1A | 6.77 | AC50 | 168.9 | nM | CHEMBL_ACT_25137635 |
| HTR2C | 6.67 | Ki | 212 | nM | CHEMBL_ACT_7634954 |
| CACNA1F | 6.57 | IC50 | 270 | nM | CHEMBL_ACT_15257921 |
| ADRA2A | 6.51 | IC50 | 312 | nM | CHEMBL_ACT_7632306 |
| DRD3 | 6.39 | Ki | 410 | nM | CHEMBL_ACT_7633601 |
| HTR2C | 6.39 | IC50 | 404 | nM | CHEMBL_ACT_7634953 |
| CHRM4 | 6.3 | Ki | 506 | nM | CHEMBL_ACT_7633665 |
| KCNH2 | 6.27 | AC50 | 540.2 | nM | CHEMBL_ACT_25117104 |
| HTR2B | 6.23 | Ki | 587 | nM | CHEMBL_ACT_7634952 |
| THRB | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_1013715 |
| CHRM1 | 6.2 | Ki | 629 | nM | CHEMBL_ACT_7633659 |
| THRA | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_1013714 |
| CHRM3 | 6.17 | Ki | 679 | nM | CHEMBL_ACT_7633663 |
| Q9F4F7 | 6.15 | Potency | 707.9 | nM | CHEMBL_ACT_4376176 |
| FYN | 6.09 | IC50 | 817 | nM | CHEMBL_ACT_7633726 |
| HTR2B | 6.04 | IC50 | 923 | nM | CHEMBL_ACT_7634951 |
| KCNH2 | 6 | IC50 | 1000 | nM | CHEMBL_ACT_5218939 |
| HTR2A | 5.99 | Ki | 1026 | nM | CHEMBL_ACT_7634950 |
| CHRM5 | 5.97 | Ki | 1077 | nM | CHEMBL_ACT_7633667 |
Target pathways
Aggregated over 3 target gene(s): CHRM5, KCNA7, SCN5A.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 1 | KCNA7 |
| Developmental Biology | 1 | SCN5A |
| Potassium Channels | 1 | KCNA7 |
| Voltage gated Potassium channels | 1 | KCNA7 |
| Signal Transduction | 1 | CHRM5 |
| Signaling by GPCR | 1 | CHRM5 |
| Class A/1 (Rhodopsin-like receptors) | 1 | CHRM5 |
| L1CAM interactions | 1 | SCN5A |
| Amine ligand-binding receptors | 1 | CHRM5 |
| GPCR downstream signalling | 1 | CHRM5 |
| Muscarinic acetylcholine receptors | 1 | CHRM5 |
| Muscle contraction | 1 | SCN5A |
| G alpha (q) signalling events | 1 | CHRM5 |
| Axon guidance | 1 | SCN5A |
| Interaction between L1 and Ankyrins | 1 | SCN5A |
| GPCR ligand binding | 1 | CHRM5 |
| Cardiac conduction | 1 | SCN5A |
| Phase 0 - rapid depolarisation | 1 | SCN5A |
| Nervous system development | 1 | SCN5A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 2 |
| monoatomic ion transmembrane transport | 2 |
| transmembrane transport | 2 |
| gastric acid secretion | 1 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 1 |
| adenylate cyclase-inhibiting G protein-coupled acetylcholine receptor signaling pathway | 1 |
| G protein-coupled acetylcholine receptor signaling pathway | 1 |
| chemical synaptic transmission | 1 |
| obsolete dopamine transport | 1 |
| transmission of nerve impulse | 1 |
| regulation of phosphatidylinositol dephosphorylation | 1 |
| signal transduction | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| acetylcholine receptor signaling pathway | 1 |
| action potential | 1 |
Indications & clinical
Indications
18 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| atrial fibrillation | 3 | MONDO:0004981 | EFO:0000275 |
| cardiomyopathy | 3 | MONDO:0004994 | EFO:0000318 |
| congestive heart failure | 3 | MONDO:0005009 | EFO:0000373 |
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| atrial flutter | 3 | MONDO:0005310 | EFO:0003911 |
| ventricular fibrillation | 3 | MONDO:0000190 | EFO:0004287 |
| ventricular tachycardia | 3 | MONDO:0005477 | EFO:0005306 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| cardiac arrest | 3 | MONDO:0000745 | EFO:0009492 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| Ebola hemorrhagic fever | 2 | MONDO:0005737 | EFO:0007243 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| hereditary amyloidosis | 2 | MONDO:0018634 | MONDO:0019438 |
| coronary artery disorder | 0 | MONDO:0005010 | EFO:0001645 |
4 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 85.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 29 |
| PHASE4 | 24 |
| Not specified | 23 |
| PHASE2 | 5 |
| PHASE2/PHASE3 | 3 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03868150 | PHASE4 | RECRUITING | Prevention of Postop Atrial Fibrillation Through Intraoperative Inducibility of Atrial Fibrillation and Amiodarone Treatment |
| NCT07273994 | PHASE4 | RECRUITING | Evaluation of Two Different Regimens of the Antiarrhythmic Drug Amiodarone to Maintain Normal Sinus Rhythm After Electrical Cardioversion in Patients With Persistent Atrial Fibrillation |
| NCT00127712 | PHASE4 | COMPLETED | Prevention of Atrial Fibrillation Following Noncardiac Thoracic Surgery |
| NCT00287209 | PHASE4 | COMPLETED | Reduction of Atrial Fibrillation Study in Patients Undergoing Coronary Artery Bypass Grafting. (RASCABG 1 Study) |
| NCT00420017 | PHASE4 | COMPLETED | Prevention of Atrial Fibrillation Following Esophagectomy |
| NCT00724581 | PHASE4 | UNKNOWN | Amiodarone Prophylaxis for Atrial Fibrillation in Patients Undergoing Surgery for Lung Cancer |
| NCT00729911 | PHASE4 | COMPLETED | Ablation vs Amiodarone for Treatment of AFib in Patients With CHF and an ICD |
| NCT00784316 | PHASE4 | COMPLETED | Intravenous Metoprolol Versus Intravenous Amiodarone in the Prevention of Atrial Fibrillation After Cardiac Surgery |
| NCT01181414 | PHASE4 | COMPLETED | Spanish Atrial Fibrillation And Resynchronization Study |
| NCT01341353 | PHASE4 | UNKNOWN | Catheter Ablation Versus Antiarrythmic Drugs for Atrial Fibrillation in China |
| NCT01461733 | PHASE4 | COMPLETED | Atrial Fibrillation Without Hemodynamic Instability in the Intensive Care Unit |
| NCT01627106 | PHASE4 | WITHDRAWN | A Study Comparing Vernakalant Therapy to Amiodarone Therapy in Acute Management of Recent Onset Atrial Fibrillation (AF) (MK-6621-055) |
| NCT01850277 | PHASE4 | UNKNOWN | Cardiac Resynchronization in Atrial Fibrillation Trial - a Pilot Study |
| NCT02145546 | PHASE4 | UNKNOWN | Antiarrhythmic Drugs Assessment in Preventing Atrial Fibrillation |
| NCT02341105 | PHASE4 | TERMINATED | AMIOdarone vs. Catheter Ablation for Prevention of Recurrent Symptomatic Atrial Fibrillation |
| NCT02668432 | PHASE4 | TERMINATED | Use of Amiodarone in Atrial Fibrillation Associated With Severe Sepsis or Septic Shock |
| NCT03029169 | PHASE4 | COMPLETED | Propafenone Versus Amiodarone in Septic Shock |
| NCT03855826 | PHASE4 | UNKNOWN | Evaluation of the Efficacy and Safety of Nifekalant Hydrochloride (NIF) Injection. |
| NCT04092621 | PHASE4 | UNKNOWN | Rapid Atrial Fibrillation Treatment Strategy |
| NCT04223739 | PHASE4 | UNKNOWN | Comparison of Two Strategies for the Management of Atrial Fibrillation After Cardiac Surgery |
| NCT04234906 | PHASE4 | UNKNOWN | Prevention of Post-Operative Cardiac Arrhythmias |
| NCT05004077 | PHASE4 | TERMINATED | Repeated Amiodarone Dosing In Cardiac surgicaL Procedures |
| NCT05543278 | PHASE4 | WITHDRAWN | Pragmatic Amiodarone Trial to Reduce Postoperative Atrial Fibrillation in Patients Undergoing Cardiac Surgery |
| NCT06262932 | PHASE4 | COMPLETED | Effectiveness of Repeated Amiodarone Dosing Regimen Versus Standard Dosing Regimen in Atrial Fibrillation Patient With Rapid Ventricular Response |
| NCT02750319 | PHASE3 | ACTIVE_NOT_RECRUITING | Amiodarone and N-Acetylcysteine or Amiodarone Alone for Preventing Atrial Fibrillation After Thoracic Surgery |
| NCT04748991 | PHASE3 | NOT_YET_RECRUITING | Vernakalant Versus Amiodarone for Post-operative Atrial Fibrillation in Cardiac Surgery Patients |
| NCT05169866 | PHASE3 | RECRUITING | Nifekalant Versus Amiodarone in New-Onset Atrial Fibrillation After Cardiac Surgery |
| NCT05841056 | PHASE3 | RECRUITING | Short Term Anti-aRrhythmic Therapy for Post-Operative AF in Cardiac Surgery Patients Pilot Trial |
| NCT06680869 | PHASE3 | RECRUITING | Early Amiodarone in Shockable Cardiac Arrest |
| NCT06722196 | PHASE3 | RECRUITING | BiodEgradable Soaked Amiodarone paTch Use for the Prevention of Atrial Fibrillation After Cardiac Surgery |
| NCT06835491 | PHASE3 | RECRUITING | Prophylactic Anti-aRrhythmic Therapy With Amiodarone in Critically Ill Patients Admitted for an Out-of-hospital Cardiac Arrest With Initial Shockable Rhythm |
| NCT00000464 | PHASE3 | COMPLETED | Cardiac Arrest in Seattle: Conventional Versus Amiodarone Drug Evaluation (CASCADE) |
| NCT00000531 | PHASE3 | COMPLETED | Antiarrhythmics Versus Implantable Defibrillators (AVID) |
| NCT00000556 | PHASE3 | COMPLETED | Atrial Fibrillation Follow-up Investigation of Rhythm Management (AFFIRM) |
| NCT00000609 | PHASE3 | COMPLETED | Sudden Cardiac Death in Heart Failure Trial (SCD-HeFT) |
| NCT00007605 | PHASE3 | COMPLETED | Comparing the Effects of Amiodarone, Sotalol, and Placebo in Maintaining Sinus Rhythm in Patients With Atrial Fibrillation Converted to Sinus Rhythm |
| NCT00251706 | PHASE3 | COMPLETED | Amiodarone to Prevent Post-Operative Arrhythmias |
| NCT00300495 | PHASE3 | TERMINATED | Study of Amiodarone Given Before Lung Surgery to Prevent Atrial Fibrillation After Lung Resection |
| NCT00392106 | PHASE3 | SUSPENDED | High Intensity Focused Ultrasound (HIFU) Ablation System Study |
| NCT00489736 | PHASE3 | COMPLETED | Efficacy & Safety of Dronedarone Versus Amiodarone for the Maintenance of Sinus Rhythm in Patients With Atrial Fibrillation |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for amiodarone and CYP2D6 | DPWG | CYP2D6 |
PharmGKB also curates 4 clinical and 13 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
217 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | CHRM5, SCN5A |
| Flecainide | ChEMBL + PubChem | Phase 4 (approved) | KCNA7, SCN5A |
| Quinidine | ChEMBL + PubChem | Phase 4 (approved) | KCNA7, SCN5A |
| Verapamil | ChEMBL + PubChem | Phase 4 (approved) | KCNA7, SCN5A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| DROPERIDOL | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| PAROXETINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| QUETIAPINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| SERTRALINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| SOLIFENACIN | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| SULOCTIDIL | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| TOLTERODINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| XANOMELINE | ChEMBL | Phase 4 (approved) | CHRM5, SCN5A |
| Alogliptin | PubChem | Approved | CHRM5, SCN5A |
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | CHRM5 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | CHRM5 |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | SCN5A |
| ACETYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| ACETYLCHOLINE CHLORIDE | ChEMBL | Phase 4 (approved) | CHRM5 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| ATROPINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | SCN5A |
| BENZONATATE | ChEMBL | Phase 4 (approved) | SCN5A |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SCN5A |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | CHRM5 |
| BETHANECHOL | ChEMBL | Phase 4 (approved) | CHRM5 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | CHRM5 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | SCN5A |
| CARBACHOL | ChEMBL | Phase 4 (approved) | CHRM5 |
| CARBAMAZEPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| CARBAMOYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | SCN5A |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | SCN5A |
| CLIDINIUM | ChEMBL | Phase 4 (approved) | CHRM5 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | CHRM5 |
| DABIGATRAN ETEXILATE | ChEMBL | Phase 4 (approved) | SCN5A |
| DARUNAVIR | ChEMBL | Phase 4 (approved) | SCN5A |
| DASATINIB | ChEMBL | Phase 4 (approved) | SCN5A |
| DEFERASIROX | ChEMBL | Phase 4 (approved) | SCN5A |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | SCN5A |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | CHRM5 |
Related Atlas pages
- Genes: CHRM5, KCNA7, SCN5A
- Diseases: atrial fibrillation, cardiomyopathy, congestive heart failure, heart failure, atrial flutter, ventricular fibrillation, ventricular tachycardia, myocardial infarction, cardiac arrest, heart disorder
- Drugs: Clozapine, Flecainide, Quinidine, Verapamil, Amitriptyline, Astemizole, Chlorpromazine, Clemastine, Darifenacin, Diphenhydramine, Droperidol, Haloperidol, Imipramine, Nelfinavir, Paroxetine, Quetiapine, Risperidone, Sertraline, Solifenacin, Suloctidil, Thioridazine, Tolterodine, Xanomeline, Alogliptin, Aclidinium Bromide, Olanzapine, Paliperidone, Acetylcholine, Amlodipine, Amoxapine, Asenapine, Atropine, Bazedoxifene, Benzonatate, Benztropine, Bepridil, Betamethasone Phosphoric Acid, Bethanechol, Bosutinib, Candesartan Cilexetil, Carbachol, Carbamazepine, Cariprazine, Carvedilol, Chloroquine, Chlorpheniramine, Cinnarizine, Cisapride, Clidinium, Clomipramine, Cyclizine, Cyproheptadine, Dabigatran Etexilate, Darunavir, Dasatinib, Deferasirox, Desipramine, Desloratadine