Amlexanox
drugOn this page
Also known as AA-673AmlexanoxoAmoxanoxAphthasolAphthealCHX 3673CHX-3673ElicsSolfaSID26719859SID50112726SID144206029SID124893315SID170465365AmlexanoxÊAmlexanoxÂC0164743
Summary
Amlexanox (CHEMBL1096) is an approved small-molecule anti-allergic agent (ATC A01AD07) targeting IKBKE and TBK1; indicated across 2 conditions including obstructive lung disease and stomatitis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A01AD07 (+1 more)
- Targets: 2 (IKBKE, TBK1)
- Indications: 2 conditions
- Clinical trials: 3
- Chemistry: 298.29 Da · C16H14N2O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1096 |
| Name | Amlexanox |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 2161 |
| ChEBI | CHEBI:31205 |
| ATC | A01AD07, R03DX01 |
| Molecular formula | C16H14N2O4 |
| Molecular weight | 298.29 |
| InChIKey | SGRYPYWGNKJSDL-UHFFFAOYSA-N |
SMILES: CC(C)C1=CC2=C(C=C1)OC3=NC(=C(C=C3C2=O)C(=O)O)N
IUPAC name: 2-amino-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridine-3-carboxylic acid
ChEBI definition: A pyridochromene-derived monocarboxylic acid having an amino substituent at the 2-position, an oxo substituent at the 5-position and an isopropyl substituent at the 7-position.
Pharmacological roles (ChEBI): anti-allergic agent, anti-ulcer drug, non-steroidal anti-inflammatory drug.
Also known as: AA-673, Amlexanox, Amlexanoxo, Amoxanox, Aphthasol, Aphtheal, CHX 3673, CHX-3673, Elics, Solfa, SID26719859, SID50112726
Patent coverage: 1,257 distinct patent families (4,195 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 4,126 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| IKBKE | inhibitor of nuclear factor kappa B kinase subunit epsilon | Inhibition | 6 | 0.3% | Q14164 |
| TBK1 | TANK binding kinase 1 | Inhibition | 6 | 0.7% | Q9UHD2 |
Broader ChEMBL bioactivity targets: 19 (assay-derived). Sample: Pyruvate kinase PKM, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Fructose-bisphosphate aldolase, G-protein coupled receptor 35, NPC intracellular cholesterol transporter 1, Ras-related protein Rab-9A, ATP-binding cassette sub-family C member 4, Alpha-1A adrenergic receptor, Delta-type opioid receptor.
Bioactivity
ChEMBL activities: 15 potent at pChembl ≥ 5 of 27 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NPC1 | 6.5 | Potency | 316.2 | nM | CHEMBL_ACT_4744305 |
| RAB9A | 6.3 | Potency | 501.2 | nM | CHEMBL_ACT_3854601 |
| TBK1 | 6.07 | IC50 | 850 | nM | CHEMBL_ACT_18811314 |
| TBK1 | 6.07 | IC50 | 851.1 | nM | CHEMBL_ACT_18811346 |
| TBK1 | 6.01 | IC50 | 980 | nM | CHEMBL_ACT_27401006 |
| ABCC4 | 5.66 | IC50 | 2200 | nM | CHEMBL_ACT_18130895 |
| GPR35 | 5.4 | EC50 | 4000 | nM | CHEMBL_ACT_18198030 |
| P51450 | 5.4 | Potency | 3981 | nM | CHEMBL_ACT_4094663 |
| IKBKE | 5.29 | IC50 | 5100 | nM | CHEMBL_ACT_18811456 |
| IKBKE | 5.29 | IC50 | 5129 | nM | CHEMBL_ACT_18811488 |
| Q27686 | 5.15 | Potency | 7080 | nM | CHEMBL_ACT_3908021 |
| Q27686 | 5.15 | Potency | 7080 | nM | CHEMBL_ACT_4282771 |
| P51450 | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_4778974 |
| Q8VEB1 | 5.05 | IC50 | 8860 | nM | CHEMBL_ACT_25578777 |
| P51450 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4778220 |
Target pathways
Aggregated over 2 target gene(s): IKBKE, TBK1.
Top Reactome pathways
50 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| TNFR1-induced proapoptotic signaling | 2 | IKBKE, TBK1 |
| Regulation of TNFR1 signaling | 2 | IKBKE, TBK1 |
| TICAM1-dependent activation of IRF3/IRF7 | 2 | IKBKE, TBK1 |
| TRAF3-dependent IRF activation pathway | 2 | IKBKE, TBK1 |
| TRAF6 mediated IRF7 activation | 2 | IKBKE, TBK1 |
| Negative regulators of DDX58/IFIH1 signaling | 2 | IKBKE, TBK1 |
| Activation of IRF3, IRF7 mediated by TBK1, IKKε (IKBKE) | 2 | IKBKE, TBK1 |
| SARS-CoV-1 activates/modulates innate immune responses | 2 | IKBKE, TBK1 |
| SARS-CoV-2 activates/modulates innate and adaptive immune responses | 2 | IKBKE, TBK1 |
| Regulation of TBK1, IKKε (IKBKE)-mediated activation of IRF3, IRF7 | 2 | IKBKE, TBK1 |
| Regulation of TBK1, IKKε-mediated activation of IRF3, IRF7 upon TLR3 ligation | 2 | IKBKE, TBK1 |
| Cytokine Signaling in Immune system | 1 | TBK1 |
| ZBP1(DAI) mediated induction of type I IFNs | 1 | TBK1 |
| IRF3 mediated activation of type 1 IFN | 1 | TBK1 |
| Signal Transduction | 1 | TBK1 |
| Macroautophagy | 1 | TBK1 |
| Disease | 1 | TBK1 |
| Toll Like Receptor 4 (TLR4) Cascade | 1 | TBK1 |
| MyD88-independent TLR4 cascade | 1 | TBK1 |
| Toll Like Receptor 3 (TLR3) Cascade | 1 | TBK1 |
| Innate Immune System | 1 | TBK1 |
| Immune System | 1 | TBK1 |
| Toll-like Receptor Cascades | 1 | TBK1 |
| DDX58/IFIH1-mediated induction of interferon-alpha/beta | 1 | TBK1 |
| STING mediated induction of host immune responses | 1 | TBK1 |
| Cytosolic sensors of pathogen-associated DNA | 1 | TBK1 |
| Regulation of innate immune responses to cytosolic DNA | 1 | TBK1 |
| STAT6-mediated induction of chemokines | 1 | TBK1 |
| IRF3-mediated induction of type I IFN | 1 | TBK1 |
| Interleukin-1 family signaling | 1 | TBK1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| activation of innate immune response | 2 |
| positive regulation of type I interferon production | 2 |
| positive regulation of canonical NF-kappaB signal transduction | 2 |
| defense response to virus | 2 |
| type I interferon-mediated signaling pathway | 2 |
| positive regulation of type I interferon-mediated signaling pathway | 2 |
| protein phosphorylation | 2 |
| response to stress | 2 |
| immune response | 1 |
| intrinsic apoptotic signaling pathway in response to DNA damage | 1 |
| gene expression | 1 |
| positive regulation of lipid storage | 1 |
| response to interferon-beta | 1 |
| regulation of protein-containing complex assembly | 1 |
| mRNA stabilization | 1 |
Indications & clinical
Indications
2 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| obstructive lung disease | 4 | MONDO:0002267 | HP:0006536 |
| stomatitis | 2 | MONDO:0004842 | EFO:1001904 |
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01083875 | PHASE2 | COMPLETED | Study to Determine the Effects Treatment With Amlexanox 0.5% Oral Rinse Solution on Oral Mucositis Associated With Radiation Therapy for Cancer of the Head and Neck Region |
| NCT01842282 | PHASE2 | TERMINATED | Amlexanox for Type 2 Diabetes and Obesity |
| NCT01975935 | PHASE2 | COMPLETED | Efficacy of Amlexanox vs. Placebo in Type 2 Diabetic Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
53 molecules share ≥1 primary target. Top 53 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| Entrectinib | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| Erlotinib | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| FOSTAMATINIB | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| MOMELOTINIB | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| RUXOLITINIB | ChEMBL + PubChem | Phase 4 (approved) | IKBKE, TBK1 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | IKBKE, TBK1 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | IKBKE, TBK1 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | IKBKE, TBK1 |
| PACRITINIB | ChEMBL | Phase 4 (approved) | IKBKE, TBK1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | IKBKE, TBK1 |
| ALVOCIDIB | ChEMBL | Phase 3 | IKBKE, TBK1 |
| DOVITINIB | ChEMBL | Phase 3 | IKBKE, TBK1 |
| LESTAURTINIB | ChEMBL | Phase 3 | IKBKE, TBK1 |
| ORANTINIB | ChEMBL | Phase 3 | IKBKE, TBK1 |
| ADAVOSERTIB | ChEMBL | Phase 2 | IKBKE, TBK1 |
| AT-9283 | ChEMBL | Phase 2 | IKBKE, TBK1 |
| CENISERTIB | ChEMBL | Phase 2 | IKBKE, TBK1 |
| FORETINIB | ChEMBL | Phase 2 | IKBKE, TBK1 |
| MILCICLIB | ChEMBL | Phase 2 | IKBKE, TBK1 |
| R-406 | ChEMBL | Phase 2 | IKBKE, TBK1 |
| SU-014813 | ChEMBL | Phase 2 | IKBKE, TBK1 |
| TOZASERTIB | ChEMBL | Phase 2 | IKBKE, TBK1 |
| UCN-01 | ChEMBL | Phase 2 | IKBKE, TBK1 |
| Afatinib | PubChem | Approved | IKBKE, TBK1 |
| Binimetinib | PubChem | Approved | IKBKE, TBK1 |
| Cabozantinib | PubChem | Approved | IKBKE, TBK1 |
| Capmatinib | PubChem | Approved | IKBKE, TBK1 |
| Cobimetinib | PubChem | Approved | IKBKE, TBK1 |
| dacomitinib | PubChem | Approved | IKBKE, TBK1 |
| Gefitinib | PubChem | Approved | IKBKE, TBK1 |
| Ibrutinib | PubChem | Approved | IKBKE, TBK1 |
| Idelalisib | PubChem | Approved | IKBKE, TBK1 |
| Lapatinib | PubChem | Approved | IKBKE, TBK1 |
| Pazopanib | PubChem | Approved | IKBKE, TBK1 |
| Pexidartinib | PubChem | Approved | IKBKE, TBK1 |
| Ponatinib | PubChem | Approved | IKBKE, TBK1 |
| Quizartinib | PubChem | Approved | IKBKE, TBK1 |
| regorafenib | PubChem | Approved | IKBKE, TBK1 |
| Selumetinib | PubChem | Approved | IKBKE, TBK1 |
| Sorafenib | PubChem | Approved | IKBKE, TBK1 |
| Tepotinib | PubChem | Approved | IKBKE, TBK1 |
| Tirbanibulin | PubChem | Approved | IKBKE, TBK1 |
| Tovorafenib | PubChem | Approved | IKBKE, TBK1 |
| Trametinib | PubChem | Approved | IKBKE, TBK1 |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | TBK1 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | IKBKE |
| RUBOXISTAURIN | ChEMBL | Phase 3 | TBK1 |
| CERDULATINIB | ChEMBL | Phase 2 | TBK1 |
| ILORASERTIB | ChEMBL | Phase 2 | IKBKE |
| SILMITASERTIB | ChEMBL | Phase 2 | TBK1 |
| Capivasertib | PubChem | Approved | IKBKE |
Related Atlas pages
- Genes: IKBKE, TBK1
- Diseases: obstructive lung disease
- Drugs: Crizotinib, Entrectinib, Erlotinib, Fedratinib, Fostamatinib, Momelotinib, Ruxolitinib, Bosutinib, Midostaurin, Nintedanib, Pacritinib, Sunitinib, Alvocidib, Dovitinib, Lestaurtinib, Orantinib, Afatinib, Binimetinib, Cabozantinib, Capmatinib, Cobimetinib, dacomitinib, Gefitinib, Ibrutinib, Idelalisib, Lapatinib, Pazopanib, Pexidartinib, Ponatinib, Quizartinib, regorafenib, Selumetinib, Sorafenib, Tepotinib, Tirbanibulin, Tovorafenib, Trametinib, Filgotinib, Gilteritinib, Ruboxistaurin, Capivasertib