Amlodipine
drugOn this page
Also known as AMLODIPINE COMPONENT OF CKD-330AmlodipinoAstudal 5HGP-0904HGP0904IstinNorvasNorvascSID29217715SID50111725SID124893198SID225144262C0164702AmiodipineAmlodipin
Summary
Amlodipine (CHEMBL1491) is an approved small-molecule antihypertensive agent (ATC C08CA01) targeting P2RX4, CACNA1C, and CACNA1D; indicated across 31 conditions including cardiovascular disorder and hypertensive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C08CA01
- Targets: 3 (P2RX4, CACNA1C, CACNA1D)
- Indications: 31 conditions
- Clinical trials: 377
- Chemistry: 408.9 Da · C20H25ClN2O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1491 |
| Name | Amlodipine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2162 |
| ChEBI | CHEBI:2668 |
| ATC | C08CA01 |
| Molecular formula | C20H25ClN2O5 |
| Molecular weight | 408.9 |
| InChIKey | HTIQEAQVCYTUBX-UHFFFAOYSA-N |
SMILES: CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN
IUPAC name: 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate
ChEBI definition: A fully substituted dialkyl 1,4-dihydropyridine-3,5-dicarboxylate derivative, which is used for the treatment of hypertension, chronic stable angina and confirmed or suspected vasospastic angina.
Pharmacological roles (ChEBI): antihypertensive agent, calcium channel blocker, vasodilator agent.
Also known as: Amlodipine, AMLODIPINE COMPONENT OF CKD-330, Amlodipino, Astudal 5, HGP-0904, HGP0904, Istin, Norvas, Norvasc, SID29217715, SID50111725, SID124893198
Parent form; salt/anhydrous children: CHEMBL1200402, CHEMBL1200984, CHEMBL4594262
Patent coverage: 10,910 distinct patent families (39,495 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 39,488 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| P2RX4 | P2X4 | Negative | 1.2% | Q99571 | |
| CACNA1C | Cav1.2 | 9.3 | 0.1% | Q13936 | |
| CACNA1D | Cav1.3 | Inhibition | 7.2 | 0.3% | Q01668 |
Broader ChEMBL bioactivity targets: 38 (assay-derived). Sample: Nuclear receptor ROR-gamma, Ferritin light chain, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, 5-hydroxytryptamine receptor 3A, Alpha-2C adrenergic receptor, Voltage-dependent L-type calcium channel subunit alpha-1C, Histamine H2 receptor, Sodium channel protein type 5 subunit alpha, D(1A) dopamine receptor.
Bioactivity
ChEMBL activities: 39 potent at pChembl ≥ 5 of 60 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P22002 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_824014 |
| P22002 | 6.96 | AC50 | 110.1 | nM | CHEMBL_ACT_25119543 |
| ADRA2A | 6.65 | Ki | 226 | nM | CHEMBL_ACT_7640494 |
| ADRA2C | 6.58 | Ki | 261 | nM | CHEMBL_ACT_7640498 |
| KCNK2 | 6.4 | IC50 | 400 | nM | CHEMBL_ACT_12662607 |
| KCNK2 | 6.37 | IC50 | 430 | nM | CHEMBL_ACT_29291075 |
| O35505 | 6.24 | IC50 | 570 | nM | CHEMBL_ACT_15373193 |
| ADRA2A | 6.22 | IC50 | 602 | nM | CHEMBL_ACT_7639292 |
| OPRK1 | 5.94 | AC50 | 1155 | nM | CHEMBL_ACT_25129369 |
| CACNA1C | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_15373195 |
| HTR6 | 5.87 | Ki | 1346 | nM | CHEMBL_ACT_7641982 |
| KCNK2 | 5.82 | IC50 | 1520 | nM | CHEMBL_ACT_29290947 |
| ADRB2 | 5.75 | AC50 | 1800 | nM | CHEMBL_ACT_25122820 |
| ADRA2C | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_7640497 |
| ADRA1A | 5.72 | AC50 | 1889 | nM | CHEMBL_ACT_25218921 |
| HTR6 | 5.69 | AC50 | 2030 | nM | CHEMBL_ACT_25118947 |
| ADRA2A | 5.66 | AC50 | 2215 | nM | CHEMBL_ACT_25156513 |
| HTR3A | 5.64 | AC50 | 2300 | nM | CHEMBL_ACT_25149061 |
| ADRA1A | 5.63 | Ki | 2344 | nM | CHEMBL_ACT_824011 |
| DRD3 | 5.55 | AC50 | 2800 | nM | CHEMBL_ACT_25193464 |
| DRD2 | 5.54 | AC50 | 2900 | nM | CHEMBL_ACT_25140269 |
| HTR6 | 5.54 | IC50 | 2898 | nM | CHEMBL_ACT_7641981 |
| SLC6A3 | 5.51 | AC50 | 3088 | nM | CHEMBL_ACT_25125043 |
| SLC6A3 | 5.48 | AC50 | 3290 | nM | CHEMBL_ACT_25123890 |
| DRD3 | 5.46 | AC50 | 3453 | nM | CHEMBL_ACT_25194606 |
| CACNA1C | 5.39 | AC50 | 4100 | nM | CHEMBL_ACT_25159090 |
| CACNA1C | 5.38 | IC50 | 4200 | nM | CHEMBL_ACT_15373194 |
| HTR2B | 5.36 | AC50 | 4322 | nM | CHEMBL_ACT_25164092 |
| SLC6A3 | 5.36 | Ki | 4387 | nM | CHEMBL_ACT_7640570 |
| OPRD1 | 5.29 | AC50 | 5100 | nM | CHEMBL_ACT_25154006 |
Target pathways
Aggregated over 3 target gene(s): P2RX4, CACNA1C, CACNA1D.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 2 | CACNA1C, CACNA1D |
| Metabolism | 2 | CACNA1C, CACNA1D |
| Integration of energy metabolism | 2 | CACNA1C, CACNA1D |
| NCAM signaling for neurite out-growth | 2 | CACNA1C, CACNA1D |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | CACNA1C, CACNA1D |
| NCAM1 interactions | 2 | CACNA1C, CACNA1D |
| Regulation of insulin secretion | 2 | CACNA1C, CACNA1D |
| Axon guidance | 2 | CACNA1C, CACNA1D |
| Nervous system development | 2 | CACNA1C, CACNA1D |
| Elevation of cytosolic Ca2+ levels | 1 | P2RX4 |
| Muscle contraction | 1 | CACNA1C |
| Platelet homeostasis | 1 | P2RX4 |
| Cardiac conduction | 1 | CACNA1C |
| Phase 0 - rapid depolarisation | 1 | CACNA1C |
| Phase 2 - plateau phase | 1 | CACNA1C |
| Sensory processing of sound | 1 | CACNA1D |
| Purinergic signaling in leishmaniasis infection | 1 | P2RX4 |
| Sensory processing of sound by inner hair cells of the cochlea | 1 | CACNA1D |
| Sensory Perception | 1 | CACNA1D |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transmembrane transport | 3 |
| calcium ion transmembrane transport | 3 |
| monoatomic ion transport | 3 |
| positive regulation of calcium ion transport | 2 |
| regulation of metal ion transport | 2 |
| positive regulation of adenylate cyclase activity | 2 |
| cardiac muscle cell action potential involved in contraction | 2 |
| membrane depolarization during cardiac muscle cell action potential | 2 |
| regulation of heart rate by cardiac conduction | 2 |
| calcium ion import across plasma membrane | 2 |
| calcium ion transport | 2 |
| muscle contraction | 2 |
| cell communication | 2 |
| signaling | 2 |
| transmembrane transport | 2 |
Indications & clinical
Indications
31 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| congestive heart failure | 3 | MONDO:0005009 | EFO:0000373 |
| diabetes mellitus | 3 | MONDO:0005015 | EFO:0000400 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| atherosclerosis | 3 | MONDO:0005311 | EFO:0003914 |
| myocardial ischemia | 3 | MONDO:0024644 | EFO:1001375 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| essential hypertension | 3 | MONDO:0001134 | MONDO:0001134 |
| type 2 diabetes mellitus | 3 | MONDO:0005148 | MONDO:0005148 |
| abdominal aortic aneurysm | 2 | MONDO:0005350 | EFO:0004214 |
| liver disorder | 2 | MONDO:0005154 | EFO:0001421 |
| heart disorder | 2 | MONDO:0005267 | EFO:0003777 |
| Raynaud disease | 2 | MONDO:0008364 | EFO:1001145 |
| thalassemia | 2 | MONDO:0000984 | EFO:1001996 |
| hypertrophic cardiomyopathy | 2 | MONDO:0005045 | EFO:0000538 |
| dystonic disorder | 2 | MONDO:0003441 | MONDO:0000477 |
| hyperaldosteronism | 2 | MONDO:0003009 | MONDO:0001422 |
| aortic valve insufficiency | 2 | MONDO:0005648 | EFO:0007148 |
| beta thalassemia | 2 | MONDO:0019402 | MONDO:0016486 |
| vascular disorder | 2 | MONDO:0005385 | EFO:0004264 |
| pancreatitis | 1 | MONDO:0004982 | EFO:0000278 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| erectile dysfunction | 1 | MONDO:0005362 | EFO:0004234 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| breast neoplasm | 1 | MONDO:0021100 | MONDO:0007254 |
| hyperlipidemia | 1 | MONDO:0021187 | MONDO:0021187 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 377.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 131 |
| PHASE3 | 103 |
| PHASE1 | 62 |
| Not specified | 42 |
| PHASE2 | 26 |
| PHASE2/PHASE3 | 9 |
| PHASE1/PHASE2 | 3 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03264352 | PHASE4 | RECRUITING | Intervention for High-normal Blood Pressure in Adults With Type 2 Diabetes |
| NCT04840342 | PHASE4 | ACTIVE_NOT_RECRUITING | MR Antagonist and LSD1 |
| NCT04974138 | PHASE4 | RECRUITING | China Stroke Primary Prevention Trial 2 for Participants With H-type Hypertension and MTHFR 677 CC/CT Genotype (CSPPT2-CC/CT) |
| NCT04974151 | PHASE4 | RECRUITING | China Stroke Primary Prevention Trial 2 for Participants With Hypertension and MTHFR 677 TT Genotype |
| NCT05169021 | PHASE4 | NOT_YET_RECRUITING | Folic Acid and Intensive Antihypertensive Therapy for Hypertension With CSVD |
| NCT05416840 | PHASE4 | NOT_YET_RECRUITING | Effects and Safety of Clonidine Patch on Young and Middle-aged Smokers With Mild Hypertension |
| NCT05917275 | PHASE4 | RECRUITING | Multi-Omics to Predict the Blood Pressure Response to Antihypertensives |
| NCT06041529 | PHASE4 | ACTIVE_NOT_RECRUITING | Study to Evaluate the Efficacy and Safety of TEL/AML/CTD in Elderly Patients With Essential Hypertension |
| NCT07241338 | PHASE4 | NOT_YET_RECRUITING | Sacubitril/Allisartan for Hypertensive Patients With Overweight or Obesity |
| NCT00124969 | PHASE4 | COMPLETED | Influence of Amlodipine on the Mortality of Patients With End-Stage Renal Failure |
| NCT00129233 | PHASE4 | COMPLETED | Comparison of Valsartan With Amlodipine in Hypertensive Patients With Glucose Intolerance |
| NCT00136773 | PHASE4 | COMPLETED | Effects of Amlodipine/Benazepril on Albuminuria in Hypertensive Patients With Type 2 Diabetes Mellitus |
| NCT00139555 | PHASE4 | COMPLETED | Effects of Amlodipine/Benazepril in Reducing Left Ventricular Hypertrophy in Patients With High Risk Hypertension |
| NCT00143195 | PHASE4 | COMPLETED | Amlodipine vs Nitrates Study in Patients With Chronic Stable Angina |
| NCT00150384 | PHASE4 | COMPLETED | Clinical Utility of Caduet in Achieving Blood Pressure and Lipid Endpoints in a Specific Patient Population |
| NCT00159692 | PHASE4 | COMPLETED | Amlodipine Diabetic Hypertension Efficacy Response Trial |
| NCT00159718 | PHASE4 | COMPLETED | Double Blind Atorvastatin Amlodipine Study |
| NCT00171054 | PHASE4 | COMPLETED | Efficacy and Safety of Valsartan Versus Amlodipine in Postmenopausal Women With Hypertension |
| NCT00174304 | PHASE4 | COMPLETED | Open Label Study To Assess The Effectiveness Of Amlodipine-Atorvastatin Combination In Hypertension And Dyslipidemia. |
| NCT00174330 | PHASE4 | COMPLETED | Comparing Amlodipine/Atorvastatin Co-Administration To Amlodipine Alone In Patients With Hypertension And Dyslipidemia |
| NCT00185120 | PHASE4 | COMPLETED | Treatment of High Blood Pressure Using Olmesartan With Hydrochlorothiazide Compared to an ACE Inhibitor With a Calcium Channel Blocker |
| NCT00198562 | PHASE4 | UNKNOWN | Hypertension Control Based on Home Blood Pressure |
| NCT00202618 | PHASE4 | UNKNOWN | Rationale and Design for Shiga Microalbuminuria Reduction Trial |
| NCT00242814 | PHASE4 | COMPLETED | Phase IV, 9 Weeks Comparison Between MICARDIS 80 mg and Amlodipine 10 mg on Biological PPAR Gamma Activities |
| NCT00304226 | PHASE4 | COMPLETED | Effectiveness of a Valsartan Based Versus an Amlodipine Based Treatment Strategy in naïve Patients With Stage 1 or Stage 2 Hypertension or in Patients Uncontrolled on Current Monotherapy |
| NCT00338338 | PHASE4 | COMPLETED | The Efficacy And Safety Of Lacidipine And Amlodipine Once-Daily Treatment In Hypertensive Adult Patients |
| NCT00351130 | PHASE4 | COMPLETED | Effectiveness of a Valsartan Based vs an Amlodipine Based Treatment Strategy in naïve Patients With Stage 1 or Stage 2 Hypertension or in Patients Uncontrolled on Current Monotherapy |
| NCT00367978 | PHASE4 | COMPLETED | Effects of Amlodipine/Benazepril in the Hypertensive African-American Population With Type 2 Diabetes Mellitus |
| NCT00400777 | PHASE4 | COMPLETED | Efficacy and Safety of Valsartan, Hydrochlorothiazide and Amlodipine Combination Therapy in Hypertension |
| NCT00421863 | PHASE4 | COMPLETED | Italian Study on the Cardiovascular Effects of Systolic Blood Pressure Control - CARDIOSIS Study |
| NCT00425997 | PHASE4 | COMPLETED | Efficacy of Valsartan/Hydrochlorothiazide Versus Amlodipine and Hydrochlorothiazide in Patients Hypertension |
| NCT00426478 | PHASE4 | COMPLETED | Safety and Efficacy of Valsartan Plus Hydrochlorothiazide and Amlodipine in Hypertensive Patients |
| NCT00439738 | PHASE4 | COMPLETED | Safety/Efficacy of Valsartan/Hydrochlorothiazide Combination Compared to Hydrochlorothiazide in Obese Hypertensive Adults |
| NCT00460915 | PHASE4 | COMPLETED | Efficacy and Safety of Lacidipine and Amlodipine on Blood Pressure in Korean ISH Patients Aged 60 to 80 Years |
| NCT00509470 | PHASE4 | COMPLETED | Evaluation of Effect of Combination With Telmisartan and Hydrochlorothiazide in Hypertensives Uncontrolled on Amlodipine |
| NCT00523549 | PHASE4 | COMPLETED | The Effects of Systolic Blood Pressure Lowering on Diastolic Function Using Valsartan + Amlodipine in Patients With Hypertension and Diastolic Dysfunction |
| NCT00535925 | PHASE4 | COMPLETED | Nephropathy In Type 2 Diabetes and Cardio-renal Events |
| NCT00538486 | PHASE4 | COMPLETED | A Randomized, Double-Blind, Active Control Trial Comparing Effects of Telmisartan, Candesartan and Amlodipine, Alone or Plus Metformin, on Non-Diabetic, Obese Hypertensive Patients |
| NCT00542269 | PHASE4 | TERMINATED | Efficacy and Safety of Aliskiren/Ramipril/Amlodipine Compared With Ramipril/Amlodipine and Aliskiren/Amlodipine in Patients With Metabolic Syndrome |
| NCT00637078 | PHASE4 | COMPLETED | STITCH2 (Simplified Therapeutic Intervention to Control Hypertension and Hypercholesterolemia) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 9 clinical and 31 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
118 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DULOXETINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D, P2RX4 |
| PAROXETINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D, P2RX4 |
| AMIODARONE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| CHLORPROMAZINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| CILOSTAZOL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| DIAZEPAM | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| DILTIAZEM | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| DOFETILIDE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| DONEPEZIL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| DROPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| FLECAINIDE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| HALOPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| IBUTILIDE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| ISRADIPINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| LAMIVUDINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| LORATADINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| METHADONE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| MEXILETINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| MITOXANTRONE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| NIFEDIPINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| NILOTINIB | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| NIMODIPINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| NISOLDIPINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| PHENYTOIN | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| QUINIDINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| RISPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| SAQUINAVIR | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| SOLIFENACIN | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| SUNITINIB | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| THIORIDAZINE | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| VERAPAMIL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C, CACNA1D |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| DASATINIB | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| HALOFANTRINE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| MIBEFRADIL | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| SPARFLOXACIN | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| TACRINE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| TERFENADINE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| TERODILINE | ChEMBL | Phase 4 (approved) | CACNA1C, CACNA1D |
| AJMALINE | ChEMBL | Phase 3 | CACNA1C, CACNA1D |
| NITRENDIPINE | ChEMBL | Phase 3 | CACNA1C, CACNA1D |
| CIFENLINE | ChEMBL | Phase 2 | CACNA1C, CACNA1D |
| GALLOPAMIL | ChEMBL | Phase 2 | CACNA1C, CACNA1D |
| Belzutifan | PubChem | Approved | CACNA1C, CACNA1D |
| Moxifloxacin | PubChem | Approved | CACNA1C, CACNA1D |
| Paliperidone | PubChem | Approved | CACNA1C, CACNA1D |
| SILDENAFIL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C |
| VARDENAFIL | ChEMBL + PubChem | Phase 4 (approved) | CACNA1C |
| ALVIMOPAN | ChEMBL | Phase 4 (approved) | CACNA1C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | CACNA1C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CACNA1C |
| DIBUCAINE | ChEMBL | Phase 4 (approved) | CACNA1C |
| DORIPENEM | ChEMBL | Phase 4 (approved) | CACNA1C |
Related Atlas pages
- Genes: P2RX4, CACNA1C, CACNA1D
- Diseases: cardiovascular disorder, hypertensive disorder, heart failure, congestive heart failure, diabetes mellitus, myocardial infarction, atherosclerosis, myocardial ischemia, coronary artery disorder, depressive disorder, essential hypertension, type 2 diabetes mellitus
- Drugs: Duloxetine, Paroxetine, Amiodarone, Amitriptyline, Chlorpromazine, Cilostazol, Clozapine, Diazepam, Diltiazem, Dofetilide, Donepezil, Droperidol, Flecainide, Haloperidol, Ibutilide, Imipramine, Isradipine, Lamivudine, Loratadine, Methadone, Mexiletine, Mitoxantrone, Nifedipine, Nilotinib, Nimodipine, Nisoldipine, Phenytoin, Pimozide, Quinidine, Risperidone, Saquinavir, Solifenacin, Sunitinib, Thioridazine, Verapamil, Astemizole, Bepridil, Cisapride, Dasatinib, Halofantrine, Mibefradil, Sertindole, Sparfloxacin, Tacrine, Terfenadine, Terodiline, Ajmaline, Nitrendipine, Belzutifan, Moxifloxacin, Paliperidone, Sildenafil, Vardenafil, Alvimopan, Clemastine, Clotrimazole, Dibucaine, Doripenem