Amoxapine
drugOn this page
Also known as AmoxapinaAsendinAsendisCL 67,772CL 67772CL-67,772CL-67772DefanylNSC-759559SID11110675SID11110676SID26747067SID26751577SID50104205SID85230879SID855963SID90341240SID104171096SID50100159
Summary
Amoxapine (CHEMBL1113) is an approved small-molecule antidepressant (ATC N06AA17) targeting HTR6, HTR7, and HTR2A; indicated across 1 condition including depressive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AA17
- Targets: 6 (HTR6, HTR7, HTR2A…)
- Indications: 1 condition
- Clinical trials: 13
- Chemistry: 313.8 Da · C17H16ClN3O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1113 |
| Name | Amoxapine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2170 |
| ChEBI | CHEBI:2675 |
| ATC | N06AA17 |
| Molecular formula | C17H16ClN3O |
| Molecular weight | 313.8 |
| InChIKey | QWGDMFLQWFTERH-UHFFFAOYSA-N |
SMILES: C1CN(CCN1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl
IUPAC name: 8-chloro-6-piperazin-1-ylbenzo[b][1,4]benzoxazepine
ChEBI definition: A dibenzooxazepine compound having a chloro substituent at the 2-position and a piperazin-1-yl group at the 11-position.
Pharmacological roles (ChEBI): antidepressant, adrenergic uptake inhibitor, dopaminergic antagonist, serotonin uptake inhibitor, geroprotector.
Also known as: Amoxapina, Amoxapine, Asendin, Asendis, CL 67,772, CL 67772, CL-67,772, CL-67772, Defanyl, NSC-759559, amoxapine, SID11110675
Patent coverage: 5,180 distinct patent families (20,128 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 20,006 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR6 | 5-HT6 receptor | Antagonist | 7.3 | 0.2% | P50406 |
| HTR7 | 5-HT7 receptor | Antagonist | 7.4 | 0.8% | P34969 |
| HTR2A | 5-HT2A receptor | Antagonist | 9 | 0% | P28223 |
| HTR2C | 5-HT2C receptor | Antagonist | 8.7 | 0% | P28335 |
| SLC6A2 | NET | Inhibition | 7.89 | 0.4% | P23975 |
| SLC6A4 | SERT | Inhibition | 7.74 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 63 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Lysine-specific demethylase 4E, Ubiquitin carboxyl-terminal hydrolase 2, Survival motor neuron protein, Prelamin-A/C, Inositol monophosphatase 1, Ferritin light chain, Thrombopoietin, Endonuclease 4, Peripheral myelin protein 22.
Bioactivity
ChEMBL activities: 102 potent at pChembl ≥ 5 of 131 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2A | 9.35 | Ki | 0.44 | nM | CHEMBL_ACT_7625580 |
| HTR2A | 8.81 | IC50 | 1.55 | nM | CHEMBL_ACT_7625579 |
| HTR2A | 8.77 | AC50 | 1.7 | nM | CHEMBL_ACT_25173573 |
| HTR2A | 8.75 | Ki | 1.77 | nM | CHEMBL_ACT_10878915 |
| HTR2C | 8.7 | Ki | 1.98 | nM | CHEMBL_ACT_7625584 |
| HTR2C | 8.42 | IC50 | 3.79 | nM | CHEMBL_ACT_7625583 |
| LMNA | 8.3 | Potency | 5 | nM | CHEMBL_ACT_3653418 |
| HTR2B | 8.18 | Ki | 6.57 | nM | CHEMBL_ACT_7625582 |
| HTR2B | 8.12 | AC50 | 7.6 | nM | CHEMBL_ACT_25164076 |
| TDP1 | 8 | Potency | 10 | nM | CHEMBL_ACT_3932592 |
| HTR2B | 8 | IC50 | 10 | nM | CHEMBL_ACT_7625581 |
| HTR2C | 7.96 | AC50 | 11 | nM | CHEMBL_ACT_25131694 |
| HRH1 | 7.96 | Ki | 11 | nM | CHEMBL_ACT_7624142 |
| SLC6A2 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_7622720 |
| SLC6A2 | 7.89 | Ki | 13 | nM | CHEMBL_ACT_7622721 |
| SLC6A2 | 7.84 | IC50 | 14.3 | nM | CHEMBL_ACT_29265423 |
| SLC6A4 | 7.75 | Ki | 18 | nM | CHEMBL_ACT_7625592 |
| HTR6 | 7.63 | AC50 | 23.4 | nM | CHEMBL_ACT_25118937 |
| DRD4 | 7.47 | Ki | 34 | nM | CHEMBL_ACT_10878895 |
| SLC6A4 | 7.47 | IC50 | 34 | nM | CHEMBL_ACT_7625591 |
| HTR6 | 7.46 | Ki | 35 | nM | CHEMBL_ACT_7625590 |
| DRD3 | 7.34 | Ki | 46 | nM | CHEMBL_ACT_7624112 |
| DRD4 | 7.29 | AC50 | 51.2 | nM | CHEMBL_ACT_25127354 |
| DRD3 | 7.25 | AC50 | 56 | nM | CHEMBL_ACT_25193412 |
| P15823 | 7.22 | Ki | 60 | nM | CHEMBL_ACT_7622705 |
| HRH1 | 7.17 | AC50 | 67 | nM | CHEMBL_ACT_25212391 |
| DRD2 | 7.17 | Ki | 67 | nM | CHEMBL_ACT_7624110 |
| HTR6 | 7.12 | IC50 | 76 | nM | CHEMBL_ACT_7625589 |
| SLC6A2 | 7.09 | AC50 | 81 | nM | CHEMBL_ACT_25144885 |
| HTR2A | 7.09 | AC50 | 82 | nM | CHEMBL_ACT_25225063 |
Target pathways
Aggregated over 6 target gene(s): HTR6, HTR7, HTR2A, HTR2C, SLC6A2, SLC6A4.
Top Reactome pathways
22 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| Signaling by GPCR | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| Class A/1 (Rhodopsin-like receptors) | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| Amine ligand-binding receptors | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| GPCR downstream signalling | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| Serotonin receptors | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| GPCR ligand binding | 4 | HTR2A, HTR2C, HTR6, HTR7 |
| G alpha (q) signalling events | 2 | HTR2A, HTR2C |
| G alpha (s) signalling events | 2 | HTR6, HTR7 |
| SLC-mediated transport of neurotransmitters | 2 | SLC6A2, SLC6A4 |
| Neurotransmitter clearance | 1 | SLC6A4 |
| Transmission across Chemical Synapses | 1 | SLC6A4 |
| Neuronal System | 1 | SLC6A4 |
| Disease | 1 | SLC6A2 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| Transport of small molecules | 1 | SLC6A2 |
| R-HSA-425366 | 1 | SLC6A2 |
| SLC-mediated transmembrane transport | 1 | SLC6A2 |
| SLC transporter disorders | 1 | SLC6A2 |
| Defective SLC6A2 causes orthostatic intolerance (OI) | 1 | SLC6A2 |
| Disorders of transmembrane transporters | 1 | SLC6A2 |
| RHOBTB3 ATPase cycle | 1 | HTR7 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| chemical synaptic transmission | 5 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 4 |
| signal transduction | 4 |
| G protein-coupled receptor signaling pathway | 4 |
| G protein-coupled serotonin receptor signaling pathway | 4 |
| response to xenobiotic stimulus | 3 |
| adenylate cyclase-activating serotonin receptor signaling pathway | 2 |
| circadian rhythm | 2 |
| vasoconstriction | 2 |
| intracellular calcium ion homeostasis | 2 |
| phospholipase C-activating serotonin receptor signaling pathway | 2 |
| serotonin receptor signaling pathway | 2 |
| memory | 2 |
| positive regulation of phosphatidylinositol biosynthetic process | 2 |
| positive regulation of fat cell differentiation | 2 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| depressive disorder | 4 | MONDO:0002050 | MONDO:0002009 |
Clinical trials
Total trials: 13.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 3 |
| PHASE1 | 3 |
| Not specified | 3 |
| PHASE4 | 2 |
| PHASE2 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01193816 | PHASE4 | COMPLETED | Loxapine in the Management of Restlessness During Mechanical Ventilation Weaning |
| NCT03110900 | PHASE4 | TERMINATED | Inhaled Loxapine vs Intramuscular (IM) Haloperidol + Lorazepam for Agitation |
| NCT00290082 | PHASE3 | TERMINATED | Randomized Double-blind Trial of Midazolam and Loxapine in Agitated Patients |
| NCT04148963 | PHASE3 | UNKNOWN | A Study of Staccato Loxapine (ADASUVE®) for Inhalation |
| NCT05324852 | PHASE3 | TERMINATED | AGItated Patients Management: intraNASAL Midazolam vs Intramuscular Loxapine |
| NCT00489476 | PHASE2 | COMPLETED | Staccato Loxapine in Migraine (in Clinic) |
| NCT02820519 | PHASE2 | TERMINATED | Tolerability and Analgesic Efficacy of Loxapine in Patients With Refractory, Chemotherapy-induced Neuropathic Pain |
| NCT00789360 | PHASE1 | COMPLETED | Staccato Loxapine Pulmonary Safety in Healthy Volunteers |
| NCT00874237 | PHASE1 | COMPLETED | Staccato Loxapine Thorough QT/QTc Study |
| NCT00889837 | PHASE1 | COMPLETED | Staccato Loxapine Pulmonary Safety in Patients With COPD |
| NCT00122733 | Not specified | COMPLETED | Loxapine and Weaning From Ventilator |
| NCT02600741 | Not specified | COMPLETED | Family Intervention in Recent Onset Schizophrenia Treatment (FIRST) |
| NCT03513549 | Not specified | SUSPENDED | Observational Study Evaluating the Safety of ADASUVE® in Agitation Associated With Schizophrenia or Bipolar I Disorder |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
785 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BREXPIPRAZOLE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| METERGOLINE | ChEMBL | Phase 2 | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| PENFLURIDOL | ChEMBL | Phase 2 | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| RITANSERIN | ChEMBL | Phase 2 | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| Pyrazinamide | PubChem | Approved | HTR2A, HTR2C, HTR6, HTR7, SLC6A2, SLC6A4 |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR6, HTR7, SLC6A2, SLC6A4 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| HALOPROGIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A4 |
| MEPAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| METHAPYRILENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, HTR7, SLC6A4 |
| ORPHENADRINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PERPHENAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PIPAMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROCHLORPERAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROMETHAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
Related Atlas pages
- Genes: HTR6, HTR7, HTR2A, HTR2C, SLC6A2, SLC6A4
- Diseases: depressive disorder
- Drugs: Brexpiprazole, Dihydroergotamine, Aripiprazole, Astemizole, Azelastine, Carvedilol, Chlorpromazine, Cinacalcet, Clozapine, Cyproheptadine, Doxepin, Fluphenazine, Haloperidol, Imipramine, Loxapine, Mianserin, Nefazodone, Promazine, Risperidone, Tegaserod, Thioridazine, Ziprasidone, Pyrazinamide, Amitriptyline, Amiodarone, Asenapine, Benztropine, Cariprazine, Clemastine, Clomipramine, Clotrimazole, Desloratadine, Dibenzepin, Diethylstilbestrol, Diphenhydramine, Ebastine, Econazole, Fluoxetine, Fluspirilene, Haloprogin, Iloperidone, Ketanserin, Mepazine, Methapyrilene, Miconazole, Nortriptyline, Olanzapine, Orphenadrine, Perphenazine, Pimozide, Pipamazine, Prochlorperazine, Promethazine, Propafenone, Propranolol, Raloxifene, Salmeterol