Arbaclofen
drug drugOn this page
Also known as (r)-baclofenArbaclofeneArbaclofenoBaclofen (r)-formBaclofen, (r)-Baclofen, r(-)-Baclofenr-D-baclofenR-(-)-baclofenSTX-209STX209SID11113710(-)-baclofen
Summary
Arbaclofen (CHEMBL301742) is a phase-3 clinical-stage small molecule targeting GABBR1; indicated across 3 conditions including autism spectrum disorder and fragile x syndrome.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (GABBR1)
- Indications: 3 conditions
- Clinical trials: 20
- Chemistry: 213.66 Da · C10H12ClNO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL301742 |
| Name | Arbaclofen |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 44602 |
| Molecular formula | C10H12ClNO2 |
| Molecular weight | 213.66 |
| InChIKey | KPYSYYIEGFHWSV-QMMMGPOBSA-N |
SMILES: C1=CC(=CC=C1[C@@H](CC(=O)O)CN)Cl
IUPAC name: (3R)-4-amino-3-(4-chlorophenyl)butanoic acid
Also known as: (r)-baclofen, Arbaclofen, Arbaclofene, Arbaclofeno, Baclofen (r)-form, Baclofen, (r)-, Baclofen, r(-)-, Baclofen, r-, D-baclofen, R-(-)-baclofen, STX-209
Patent coverage: 115 distinct patent families (253 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GABBR1 | GABAB1 | Full agonist | 4.6 | 0.2% | Q9UBS5 |
| GABAB receptor | Full agonist | 8.5 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: GABA-B receptor, GABA B receptor, Cytochrome P450 2D6, Cytochrome P450 1A2, Cytochrome P450 2C9, Cytochrome P450 2C19.
Bioactivity
ChEMBL activities: 8 potent at pChembl ≥ 5 of 11 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| GABBR2 | 7.82 | IC50 | 15 | nM | CHEMBL_ACT_80260 |
| O88871 | 7.5 | IC50 | 32 | nM | CHEMBL_ACT_80262 |
| O88871 | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_781694 |
| CYP2D6 | 6.1 | Potency | 794.3 | nM | CHEMBL_ACT_4949869 |
| CYP2D6 | 6.1 | AC50 | 794.3 | nM | CHEMBL_ACT_6062802 |
| GABBR2 | 6 | EC50 | 1000 | nM | CHEMBL_ACT_12648722 |
| CYP2C19 | 5.6 | Potency | 2512 | nM | CHEMBL_ACT_4016485 |
| CYP2C19 | 5.6 | AC50 | 2512 | nM | CHEMBL_ACT_6030525 |
Target pathways
Aggregated over 1 target gene(s): GABBR1.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Activation of G protein gated Potassium channels | 1 | GABBR1 |
| G alpha (i) signalling events | 1 | GABBR1 |
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 1 | GABBR1 |
| GABA B receptor activation | 1 | GABBR1 |
| Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits | 1 | GABBR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| osteoblast differentiation | 1 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 1 |
| gamma-aminobutyric acid signaling pathway | 1 |
| negative regulation of cell population proliferation | 1 |
| positive regulation of glutamate secretion | 1 |
| negative regulation of gamma-aminobutyric acid secretion | 1 |
| negative regulation of epinephrine secretion | 1 |
| negative regulation of dopamine secretion | 1 |
| response to nicotine | 1 |
| response to ethanol | 1 |
| negative regulation of synaptic transmission | 1 |
| synaptic transmission, GABAergic | 1 |
| positive regulation of growth hormone secretion | 1 |
| neuron-glial cell signaling | 1 |
| signal transduction | 1 |
Indications & clinical
Indications
2 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| autism spectrum disorder | 3 | MONDO:0005258 | EFO:0003756 |
| fragile X syndrome | 3 | MONDO:0010383 | MONDO:0010383 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 20.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 9 |
| PHASE2 | 8 |
| Not specified | 2 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05179577 | PHASE3 | NOT_YET_RECRUITING | A Study to Investigate Arbaclofen ER Tablets for the Treatment of Spasticity in Patients With Multiple Sclerosis |
| NCT01282268 | PHASE3 | COMPLETED | Efficacy and Safety Study of STX209 (Arbaclofen) for Social Withdrawal in Adolescents and Adults With Fragile X Syndrome |
| NCT01325220 | PHASE3 | COMPLETED | Efficacy and Safety Study of STX209 (Arbaclofen) for the Treatment of Social Withdrawal in Children With Fragile X Syndrome |
| NCT01555333 | PHASE3 | TERMINATED | An Open Label Extension Study in Subjects With Fragile X Syndrome |
| NCT01706523 | PHASE3 | TERMINATED | Open Label Extension Study of STX209 (Arbaclofen) in Autism Spectrum Disorders |
| NCT01743651 | PHASE3 | COMPLETED | Efficacy Study of Arbaclofen to Treat Spasticity in Multiple Sclerosis |
| NCT01844232 | PHASE3 | COMPLETED | One Year, Open Label, Dose Escalation Long-term Safety Study in Multiple Sclerosis (MS) Subjects With Spasticity |
| NCT03290131 | PHASE3 | COMPLETED | A Study to Investigate the Safety and Effectiveness of Arbaclofen Extended-Release Tablets for Patients With MS |
| NCT03319732 | PHASE3 | COMPLETED | A Study to Evaluate the Long-term Safety of Arbaclofen Extended-Release Tablets for Patients With Spasticity Due to MS |
| NCT04271332 | PHASE2 | ACTIVE_NOT_RECRUITING | Safety, Tolerability, and Efficacy of Arbaclofen in 16p11.2 Deletion |
| NCT00788073 | PHASE2 | COMPLETED | Safety, Tolerability and Efficacy Study of STX209 in Subjects With Fragile X Syndrome |
| NCT00846547 | PHASE2 | COMPLETED | Open-Label Study of the Safety and Tolerability of STX209 in Subjects With Autism Spectrum Disorders |
| NCT01013480 | PHASE2 | TERMINATED | An Open Label Extension Study of STX209 in Subjects With Fragile X Syndrome |
| NCT01064973 | PHASE2 | TERMINATED | An Open Label Extension Study of STX209 in Subjects With Autism Spectrum Disorders |
| NCT01288716 | PHASE2 | COMPLETED | Study of Arbaclofen for the Treatment of Social Withdrawal in Subjects With Autism Spectrum Disorders |
| NCT03682978 | PHASE2 | COMPLETED | Arbaclofen in Children and Adolescents With ASD |
| NCT03887676 | PHASE2 | COMPLETED | Arbaclofen vs. Placebo in the Treatment of Children and Adolescents With ASD (ARBA) |
| NCT02278328 | EARLY_PHASE1 | COMPLETED | MEG Study of Acute STX209 Effects in ASD |
| NCT00823368 | Not specified | COMPLETED | Biomarker Testing and DNA Collection in Subjects Participating in Protocol 22001 |
| NCT00892580 | Not specified | COMPLETED | Biomarker and DNA Collection in Subjects Participating in Protocol 22003 |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
98 molecules share ≥1 primary target. Top 98 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BACLOFEN | ChEMBL + PubChem | Phase 4 (approved) | GABBR1 |
| SGS-742 | ChEMBL | Phase 2 | GABBR1 |
| .gamma.-aminobutyric acid | PubChem | Approved | GABBR1 |
| Acyclovir | PubChem | Approved | GABBR1 |
| Alendronic Acid | PubChem | Approved | GABBR1 |
| Alogliptin | PubChem | Approved | GABBR1 |
| Amiloride | PubChem | Approved | GABBR1 |
| Amlodipine | PubChem | Approved | GABBR1 |
| Amoxapine | PubChem | Approved | GABBR1 |
| Amoxicillin | PubChem | Approved | GABBR1 |
| Aspirin | PubChem | Approved | GABBR1 |
| Atorvastatin | PubChem | Approved | GABBR1 |
| Avatrombopag | PubChem | Approved | GABBR1 |
| azithromycin, unspecified form | PubChem | Approved | GABBR1 |
| Belinostat | PubChem | Approved | GABBR1 |
| Benazepril | PubChem | Approved | GABBR1 |
| Bicalutamide | PubChem | Approved | GABBR1 |
| Bosentan | PubChem | Approved | GABBR1 |
| Bosutinib | PubChem | Approved | GABBR1 |
| Bumetanide | PubChem | Approved | GABBR1 |
| Bupropion | PubChem | Approved | GABBR1 |
| Caffeine | PubChem | Approved | GABBR1 |
| Candesartan | PubChem | Approved | GABBR1 |
| Candesartan Cilexetil | PubChem | Approved | GABBR1 |
| Carvedilol | PubChem | Approved | GABBR1 |
| Celecoxib | PubChem | Approved | GABBR1 |
| Cimetidine | PubChem | Approved | GABBR1 |
| Ciprofloxacin | PubChem | Approved | GABBR1 |
| Clozapine | PubChem | Approved | GABBR1 |
| Codeine | PubChem | Approved | GABBR1 |
| cyclosporine | PubChem | Approved | GABBR1 |
| Diclofenac | PubChem | Approved | GABBR1 |
| Diphenhydramine | PubChem | Approved | GABBR1 |
| Donepezil | PubChem | Approved | GABBR1 |
| Dyclonine | PubChem | Approved | GABBR1 |
| Enalapril | PubChem | Approved | GABBR1 |
| ethinyl estradiol | PubChem | Approved | GABBR1 |
| Fenfluramine | PubChem | Approved | GABBR1 |
| Fluoxetine | PubChem | Approved | GABBR1 |
| Fluticasone Furoate | PubChem | Approved | GABBR1 |
| Gabapentin | PubChem | Approved | GABBR1 |
| Gemfibrozil | PubChem | Approved | GABBR1 |
| Glipizide | PubChem | Approved | GABBR1 |
| Haloperidol | PubChem | Approved | GABBR1 |
| Hydrochlorothiazide | PubChem | Approved | GABBR1 |
| Irbesartan | PubChem | Approved | GABBR1 |
| Lamivudine | PubChem | Approved | GABBR1 |
| Lansoprazole | PubChem | Approved | GABBR1 |
| Leflunomide | PubChem | Approved | GABBR1 |
| Liothyronine | PubChem | Approved | GABBR1 |
| Losartan | PubChem | Approved | GABBR1 |
| Loxapine | PubChem | Approved | GABBR1 |
| Meloxicam | PubChem | Approved | GABBR1 |
| Modafinil | PubChem | Approved | GABBR1 |
| Nefazodone | PubChem | Approved | GABBR1 |
| Nilotinib | PubChem | Approved | GABBR1 |
| Olanzapine | PubChem | Approved | GABBR1 |
| Osilodrostat | PubChem | Approved | GABBR1 |
| Oxazepam | PubChem | Approved | GABBR1 |
| Palbociclib | PubChem | Approved | GABBR1 |
| Paroxetine | PubChem | Approved | GABBR1 |
| Pasireotide | PubChem | Approved | GABBR1 |
| Pemigatinib | PubChem | Approved | GABBR1 |
| Pergolide | PubChem | Approved | GABBR1 |
| Phentermine | PubChem | Approved | GABBR1 |
| phenylbutyric acid | PubChem | Approved | GABBR1 |
| Phenylephrine | PubChem | Approved | GABBR1 |
| Pioglitazone | PubChem | Approved | GABBR1 |
| Quinapril | PubChem | Approved | GABBR1 |
| risedronic acid | PubChem | Approved | GABBR1 |
| Risperidone | PubChem | Approved | GABBR1 |
| Rizatriptan | PubChem | Approved | GABBR1 |
| Rosiglitazone | PubChem | Approved | GABBR1 |
| Sertraline | PubChem | Approved | GABBR1 |
| Sildenafil | PubChem | Approved | GABBR1 |
| Simvastatin | PubChem | Approved | GABBR1 |
| Sirolimus | PubChem | Approved | GABBR1 |
| Sitagliptin | PubChem | Approved | GABBR1 |
| Stavudine | PubChem | Approved | GABBR1 |
| Sumatriptan | PubChem | Approved | GABBR1 |
| Tacrolimus | PubChem | Approved | GABBR1 |
| Tegaserod | PubChem | Approved | GABBR1 |
| Telmisartan | PubChem | Approved | GABBR1 |
| Temozolomide | PubChem | Approved | GABBR1 |
| Tetracaine | PubChem | Approved | GABBR1 |
| Thalidomide | PubChem | Approved | GABBR1 |
| Thiothixene | PubChem | Approved | GABBR1 |
| Tiotropium Bromide Monohydrate | PubChem | Approved | GABBR1 |
| Tofacitinib | PubChem | Approved | GABBR1 |
| Tolterodine | PubChem | Approved | GABBR1 |
| Topiramate | PubChem | Approved | GABBR1 |
| Triamterene | PubChem | Approved | GABBR1 |
| Valproic Acid | PubChem | Approved | GABBR1 |
| Viloxazine | PubChem | Approved | GABBR1 |
| Vorinostat | PubChem | Approved | GABBR1 |
| Warfarin | PubChem | Approved | GABBR1 |
| Zidovudine | PubChem | Approved | GABBR1 |
| Zolpidem | PubChem | Approved | GABBR1 |
Related Atlas pages
- Genes: GABBR1
- In clinical trials for: autism spectrum disorder, fragile X syndrome
- Drugs: Baclofen, Acyclovir, Alendronic Acid, Alogliptin, Amiloride, Amlodipine, Amoxapine, Amoxicillin, Aspirin, Atorvastatin, Avatrombopag, Belinostat, Benazepril, Bicalutamide, Bosentan, Bosutinib, Bumetanide, Bupropion, Caffeine, Candesartan, Candesartan Cilexetil, Carvedilol, Celecoxib, Cimetidine, Ciprofloxacin, Clozapine, Codeine, cyclosporine, Diclofenac, Diphenhydramine, Donepezil, Dyclonine, Enalapril, ethinyl estradiol, Fenfluramine, Fluoxetine, Fluticasone Furoate, Gabapentin, Gemfibrozil, Glipizide, Haloperidol, Hydrochlorothiazide, Irbesartan, Lamivudine, Lansoprazole, Leflunomide, Liothyronine, Losartan, Loxapine, Meloxicam, Modafinil, Nefazodone, Nilotinib, Olanzapine, Osilodrostat, Oxazepam, Palbociclib, Paroxetine, Pasireotide, Pemigatinib, Pergolide, Phentermine, phenylbutyric acid, Phenylephrine, Pioglitazone, Quinapril, risedronic acid, Risperidone, Rizatriptan, Rosiglitazone, Sertraline, Sildenafil, Simvastatin, Sirolimus, Sitagliptin, Stavudine, Sumatriptan, Tacrolimus, Tegaserod, Telmisartan, Temozolomide, Tetracaine, Thalidomide, Thiothixene, Tofacitinib, Tolterodine, Topiramate, Triamterene, Valproic Acid, Viloxazine, Vorinostat, Warfarin, Zidovudine, Zolpidem