Argatroban
drugOn this page
Also known as AcovaArgatroban anhydrousArgatroban hydrateArgatroban in dextroseArgatroban in sodium chlorideArgatroban monohydrateArgipidineDK-7419GN-1600GN1600MCI-9038MD-805NovastanSID174006836AgartrobanC0164864
Summary
Argatroban (CHEMBL1166) is an approved small molecule (ATC B01AE03) targeting F2; indicated across 7 conditions including thrombotic disease and thrombocytopenia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: B01AE03
- Targets: 1 (F2)
- Indications: 7 conditions
- Clinical trials: 24
- Chemistry: 508.6 Da · C23H36N6O5S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1166 |
| Name | Argatroban |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 92722 |
| ATC | B01AE03 |
| Molecular formula | C23H36N6O5S |
| Molecular weight | 508.6 |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
SMILES: C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)C2=CC=CC3=C2NCC(C3)C
IUPAC name: (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid
Also known as: Acova, Argatroban, Argatroban anhydrous, Argatroban hydrate, Argatroban in dextrose, Argatroban in sodium chloride, Argatroban monohydrate, Argipidine, DK-7419, GN-1600, GN1600, MCI-9038
Patent coverage: 153 distinct patent families (231 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 168 (73%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| F2 | coagulation factor II, thrombin | Inhibition | 7.7 | 1.4% | P00734 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: Tissue-type plasminogen activator, Prothrombin, Trypsin, Coagulation factor X, Serine protease 1, Prothrombin.
Bioactivity
ChEMBL activities: 32 potent at pChembl ≥ 5 of 34 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| F2 | 8.62 | Kd | 2.42 | nM | CHEMBL_ACT_13414419 |
| F2 | 8.41 | IC50 | 3.88 | nM | CHEMBL_ACT_15760231 |
| F2 | 8.4 | Ki | 4 | nM | CHEMBL_ACT_879656 |
| F2 | 8.35 | Ki | 4.5 | nM | CHEMBL_ACT_13414448 |
| F2 | 8.27 | IC50 | 5.4 | nM | CHEMBL_ACT_2060327 |
| F2 | 8.02 | IC50 | 9.46 | nM | CHEMBL_ACT_15213383 |
| F2 | 8.02 | IC50 | 9.46 | nM | CHEMBL_ACT_24773420 |
| P00735 | 8.02 | Ki | 9.6 | nM | CHEMBL_ACT_698412 |
| F2 | 8 | Ki | 10 | nM | CHEMBL_ACT_1277605 |
| F2 | 8 | Ki | 9.9 | nM | CHEMBL_ACT_1405031 |
| F2 | 7.97 | IC50 | 10.6 | nM | CHEMBL_ACT_13414413 |
| F2 | 7.93 | IC50 | 11.7 | nM | CHEMBL_ACT_16817212 |
| F2 | 7.72 | Ki | 19 | nM | CHEMBL_ACT_346451 |
| F2 | 7.72 | Ki | 19 | nM | CHEMBL_ACT_794253 |
| P00735 | 7.7 | Ki | 20 | nM | CHEMBL_ACT_18168778 |
| F2 | 7.7 | Ki | 20 | nM | CHEMBL_ACT_933725 |
| F2 | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_1173527 |
| F2 | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_995917 |
| F2 | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_352647 |
| F2 | 7.41 | Ki | 39 | nM | CHEMBL_ACT_643008 |
| F2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_18168781 |
| F2 | 7.28 | IC50 | 52 | nM | CHEMBL_ACT_1277612 |
| P00735 | 7.21 | Ki | 61 | nM | CHEMBL_ACT_434704 |
| P00735 | 7.07 | Ki | 85 | nM | CHEMBL_ACT_434705 |
| F2 | 7.03 | IC50 | 92.4 | nM | CHEMBL_ACT_13414410 |
| F2 | 6.48 | IC50 | 331 | nM | CHEMBL_ACT_1660746 |
| F2 | 6.26 | IC50 | 550 | nM | CHEMBL_ACT_1054134 |
| F2 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_498620 |
| F2 | 5.8 | IC50 | 1580 | nM | CHEMBL_ACT_13414416 |
| PRSS1 | 5.7 | Ki | 1990 | nM | CHEMBL_ACT_13414442 |
Target pathways
Aggregated over 1 target gene(s): F2.
Top Reactome pathways
38 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 1 | F2 |
| R-HSA-140837 | 1 | F2 |
| R-HSA-140875 | 1 | F2 |
| R-HSA-140877 | 1 | F2 |
| Gamma-carboxylation of protein precursors | 1 | F2 |
| Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus | 1 | F2 |
| Removal of aminoterminal propeptides from gamma-carboxylated proteins | 1 | F2 |
| Gamma-carboxylation, transport, and amino-terminal cleavage of proteins | 1 | F2 |
| Signal Transduction | 1 | F2 |
| Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation | 1 | F2 |
| Disease | 1 | F2 |
| Complement cascade | 1 | F2 |
| Innate Immune System | 1 | F2 |
| Immune System | 1 | F2 |
| Cell surface interactions at the vascular wall | 1 | F2 |
| Signaling by GPCR | 1 | F2 |
| Class A/1 (Rhodopsin-like receptors) | 1 | F2 |
| Peptide ligand-binding receptors | 1 | F2 |
| Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs) | 1 | F2 |
| GPCR downstream signalling | 1 | F2 |
| Metabolism of proteins | 1 | F2 |
| G alpha (q) signalling events | 1 | F2 |
| Thrombin signalling through proteinase activated receptors (PARs) | 1 | F2 |
| GPCR ligand binding | 1 | F2 |
| Post-translational protein modification | 1 | F2 |
| Platelet activation, signaling and aggregation | 1 | F2 |
| Platelet Aggregation (Plug Formation) | 1 | F2 |
| R-HSA-9651496 | 1 | F2 |
| Defective factor XII causes hereditary angioedema | 1 | F2 |
| Defective factor VIII causes hemophilia A | 1 | F2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| proteolysis | 1 |
| acute-phase response | 1 |
| cell surface receptor signaling pathway | 1 |
| blood coagulation | 1 |
| positive regulation of cell population proliferation | 1 |
| regulation of cell shape | 1 |
| response to wounding | 1 |
| negative regulation of platelet activation | 1 |
| platelet activation | 1 |
| regulation of blood coagulation | 1 |
| positive regulation of blood coagulation | 1 |
| negative regulation of blood coagulation | 1 |
| positive regulation of cell growth | 1 |
| positive regulation of insulin secretion | 1 |
| positive regulation of collagen biosynthetic process | 1 |
Indications & clinical
Indications
7 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| thrombotic disease | 4 | MONDO:0000831 | HP:0004419 |
| thrombocytopenia | 4 | MONDO:0002049 | HP:0001873 |
| intermediate coronary syndrome | 2 | MONDO:0006805 | EFO:1000985 |
| hemorrhagic disease | 2 | MONDO:0002243 | MONDO:0002243 |
| coronary artery disorder | 2 | MONDO:0005010 | EFO:0001645 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 24.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 10 |
| PHASE3 | 4 |
| PHASE2 | 4 |
| Not specified | 3 |
| PHASE2/PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00035178 | PHASE4 | COMPLETED | Pharmacokinetics/Pharmacodynamics of Argatroban Injection in End-Stage Renal Disease Patients Undergoing Hemodialysis |
| NCT00039858 | PHASE4 | COMPLETED | Evaluation of Argatroban Injection in Pediatric Patients Requiring Anticoagulant Alternatives to Heparin |
| NCT00798525 | PHASE4 | TERMINATED | Argatroban Versus Lepirudin in Critically Ill Patients |
| NCT01163604 | PHASE4 | COMPLETED | Argatroban for Preventing Occlusion and Restenosis After Intracranial and Extracranial Artery Stenting |
| NCT01246011 | PHASE4 | TERMINATED | Significance of Antibodies to Heparin/Platelet Factor 4 Complex in Vein Graft Patency and Potential Role of Argatroban for Prevention of Vein Graft Occlusion |
| NCT01980316 | PHASE4 | COMPLETED | Argatroban for Preventing Occlusion and Restenosis After Extracranial Vertebral Artery Stenting |
| NCT03740958 | PHASE4 | COMPLETED | Argatroban Plus R-tPA for Acute Ischemic Stroke |
| NCT04275180 | PHASE4 | COMPLETED | Efficacy Argatroban in Ischemic Stroke With Early Deterioration (EASE) |
| NCT04406389 | PHASE4 | TERMINATED | Anticoagulation in Critically Ill Patients With COVID-19 (The IMPACT Trial) |
| NCT05740371 | PHASE4 | COMPLETED | Safety of Argatroban Infusion in Conduction Disturbances |
| NCT00198588 | PHASE3 | COMPLETED | Efficacy and Safety Study of Argatroban to Treat Heparin-Induced Thrombocytopenia |
| NCT02935530 | PHASE3 | COMPLETED | Thromboprophylaxis After Surgery for Gynecologic Malignancy in China |
| NCT03735979 | PHASE3 | COMPLETED | Multi-arm Optimization of Stroke Thrombolysis |
| NCT03809481 | PHASE3 | TERMINATED | Open-Label, Randomised, Active Controlled, Multi-Centre Phase 3 Study Safety and Efficacy of Danaparoid vs Argatroban |
| NCT05226442 | PHASE2/PHASE3 | COMPLETED | Safety and Feasibility of Argatroban As Anticoagulant in Adults with ECMO |
| NCT00268762 | PHASE1/PHASE2 | COMPLETED | Argatroban Stroke Treatment - A Pilot Safety Study |
| NCT00508924 | PHASE2 | COMPLETED | Study on Safety and Effectiveness of Three Doses of Argatroban as Anticoagulant in Percutaneous Coronary Intervention (PCI) |
| NCT00861692 | PHASE2 | COMPLETED | Clinical Management of Argatroban in Patients With Heparin Induced Thrombocytopenia Type II |
| NCT01734252 | PHASE2 | COMPLETED | Argatroban in Critically Ill Patients With Heparin Resistance |
| NCT02448069 | PHASE2 | COMPLETED | Safety and Feasibility of Argatroban, Tissue Plasminogen Activator and Intra-arterial Therapy in Stroke |
| NCT05325346 | PHASE1 | COMPLETED | A Phase I Study of the Co-administration of VLX-1005 and Argatroban in Healthy Human Subjects |
| NCT01304238 | Not specified | COMPLETED | Retrospective Registry of Patients With Acute Heparin-induced Thrombocytopenia Type II |
| NCT04925167 | Not specified | COMPLETED | Safety and Efficacy of Argatroban Applicated in Anticoagulation of V-V ECMO |
| NCT06038682 | Not specified | COMPLETED | Monitoring Anticoagulation in Patients on ECMO for Severe Lung Failure |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
50 molecules share ≥1 primary target. Top 50 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| APIXABAN | ChEMBL + PubChem | Phase 4 (approved) | F2 |
| EDOXABAN | ChEMBL + PubChem | Phase 4 (approved) | F2 |
| BENZOYL PEROXIDE | ChEMBL | Phase 4 (approved) | F2 |
| BETRIXABAN | ChEMBL | Phase 4 (approved) | F2 |
| BIVALIRUDIN | ChEMBL | Phase 4 (approved) | F2 |
| BORTEZOMIB | ChEMBL | Phase 4 (approved) | F2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | F2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | F2 |
| DABIGATRAN ETEXILATE | ChEMBL | Phase 4 (approved) | F2 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | F2 |
| GENTIAN VIOLET | ChEMBL | Phase 4 (approved) | F2 |
| HEXAMIDINE | ChEMBL | Phase 4 (approved) | F2 |
| INDIGOTINDISULFONATE | ChEMBL | Phase 4 (approved) | F2 |
| LIOTHYRONINE | ChEMBL | Phase 4 (approved) | F2 |
| LUSUTROMBOPAG | ChEMBL | Phase 4 (approved) | F2 |
| MELAGATRAN | ChEMBL | Phase 4 (approved) | F2 |
| METHYLPREDNISOLONE | ChEMBL | Phase 4 (approved) | F2 |
| PENTAMIDINE | ChEMBL | Phase 4 (approved) | F2 |
| RIVAROXABAN | ChEMBL | Phase 4 (approved) | F2 |
| SUCCIMER | ChEMBL | Phase 4 (approved) | F2 |
| SULFAGUANIDINE | ChEMBL | Phase 4 (approved) | F2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | F2 |
| XIMELAGATRAN | ChEMBL | Phase 4 (approved) | F2 |
| CAMOSTAT | ChEMBL | Phase 3 | F2 |
| CAMOSTAT MESILATE | ChEMBL | Phase 3 | F2 |
| DABIGATRAN | ChEMBL | Phase 3 | F2 |
| GABEXATE | ChEMBL | Phase 3 | F2 |
| MILVEXIAN | ChEMBL | Phase 3 | F2 |
| NAFAMOSTAT | ChEMBL | Phase 3 | F2 |
| QUERCETIN | ChEMBL | Phase 3 | F2 |
| SILIBININ | ChEMBL | Phase 3 | F2 |
| BMS-986141 | ChEMBL | Phase 2 | F2 |
| CETRAXATE | ChEMBL | Phase 2 | F2 |
| DIBROMPROPAMIDINE | ChEMBL | Phase 2 | F2 |
| EFEGATRAN | ChEMBL | Phase 2 | F2 |
| FIDEXABAN | ChEMBL | Phase 2 | F2 |
| GW813893 | ChEMBL | Phase 2 | F2 |
| INOGATRAN | ChEMBL | Phase 2 | F2 |
| LETAXABAN | ChEMBL | Phase 2 | F2 |
| NAPSAGATRAN | ChEMBL | Phase 2 | F2 |
| PROFLAVINE | ChEMBL | Phase 2 | F2 |
| RAZAXABAN | ChEMBL | Phase 2 | F2 |
| SEGATROXABAN | ChEMBL | Phase 2 | F2 |
| TANOGITRAN | ChEMBL | Phase 2 | F2 |
| Echothiophate | PubChem | Approved | F2 |
| Pimavanserin | PubChem | Approved | F2 |
| Propylene Glycol | PubChem | Approved | F2 |
| Pyrazinamide | PubChem | Approved | F2 |
| Pyridoxine | PubChem | Approved | F2 |
| Vorapaxar | PubChem | Approved | F2 |
Related Atlas pages
- Genes: F2
- Diseases: thrombotic disease, thrombocytopenia
- Drugs: Apixaban, Edoxaban, Benzoyl Peroxide, Betrixaban, Bivalirudin, Bortezomib, Captopril, Cianidanol, Dabigatran Etexilate, Dequalinium, Hexamidine, Liothyronine, Lusutrombopag, Melagatran, Methylprednisolone, Pentamidine, Rivaroxaban, Succimer, Sulfaguanidine, Telotristat, Ximelagatran, Camostat, Gabexate, Milvexian, Nafamostat, Quercetin, Silibinin, Echothiophate, Pimavanserin, Propylene Glycol, Pyrazinamide, Pyridoxine, Vorapaxar