ARRY-797
drugOn this page
Also known as ARRY-371797
Summary
Arry-797 (CHEMBL1088750) is a phase-3 clinical-stage small molecule targeting MAPK14; indicated across 5 conditions including dilated cardiomyopathy and ankylosing spondylitis.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (MAPK14)
- Indications: 5 conditions
- Clinical trials: 9
- Chemistry: 416.5 Da · C22H26F2N4O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1088750 |
| Name | ARRY-797 |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 46883775 |
| Molecular formula | C22H26F2N4O2 |
| Molecular weight | 416.5 |
| InChIKey | IFGWYHGYNVGVRB-UHFFFAOYSA-N |
SMILES: CC(C)CN1C2=CC(=C(C=C2C=N1)OC3=C(C=C(C=C3)F)F)C(=O)NCCN(C)C
IUPAC name: 5-(2,4-difluorophenoxy)-N-[2-(dimethylamino)ethyl]-1-(2-methylpropyl)indazole-6-carboxamide
Also known as: ARRY-371797, Arry-797, ARRY-797
Patent coverage: 202 distinct patent families (641 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 457 (71%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MAPK14 | mitogen-activated protein kinase 14 | Inhibition | 8.35 | 9% | Q16539 |
Broader ChEMBL bioactivity targets: 1 (assay-derived). Sample: Mitogen-activated protein kinase 14.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 1 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MAPK14 | 8.35 | IC50 | 4.5 | nM | CHEMBL_ACT_3260866 |
Target pathways
Aggregated over 1 target gene(s): MAPK14.
Top Reactome pathways
78 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 1 | MAPK14 |
| Developmental Biology | 1 | MAPK14 |
| Cytokine Signaling in Immune system | 1 | MAPK14 |
| Mitochondrial biogenesis | 1 | MAPK14 |
| Signal Transduction | 1 | MAPK14 |
| Disease | 1 | MAPK14 |
| Toll Like Receptor 4 (TLR4) Cascade | 1 | MAPK14 |
| MyD88:MAL(TIRAP) cascade initiated on plasma membrane | 1 | MAPK14 |
| MyD88-independent TLR4 cascade | 1 | MAPK14 |
| Signaling by NTRKs | 1 | MAPK14 |
| Signalling to RAS | 1 | MAPK14 |
| Toll Like Receptor 9 (TLR9) Cascade | 1 | MAPK14 |
| Toll Like Receptor 10 (TLR10) Cascade | 1 | MAPK14 |
| Toll Like Receptor 3 (TLR3) Cascade | 1 | MAPK14 |
| Toll Like Receptor 5 (TLR5) Cascade | 1 | MAPK14 |
| Toll Like Receptor TLR1:TLR2 Cascade | 1 | MAPK14 |
| Toll Like Receptor 7/8 (TLR7/8) Cascade | 1 | MAPK14 |
| Toll Like Receptor TLR6:TLR2 Cascade | 1 | MAPK14 |
| Innate Immune System | 1 | MAPK14 |
| Immune System | 1 | MAPK14 |
| NOD1/2 Signaling Pathway | 1 | MAPK14 |
| Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways | 1 | MAPK14 |
| Toll-like Receptor Cascades | 1 | MAPK14 |
| p38MAPK events | 1 | MAPK14 |
| Toll Like Receptor 2 (TLR2) Cascade | 1 | MAPK14 |
| Organelle biogenesis and maintenance | 1 | MAPK14 |
| Signaling by NTRK1 (TRKA) | 1 | MAPK14 |
| Signalling to ERKs | 1 | MAPK14 |
| Signaling by VEGF | 1 | MAPK14 |
| Signaling by Rho GTPases | 1 | MAPK14 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| DNA damage checkpoint signaling | 1 |
| MAPK cascade | 1 |
| cell morphogenesis | 1 |
| cartilage condensation | 1 |
| angiogenesis | 1 |
| osteoblast differentiation | 1 |
| placenta development | 1 |
| response to dietary excess | 1 |
| chondrocyte differentiation | 1 |
| negative regulation of inflammatory response to antigenic stimulus | 1 |
| glucose metabolic process | 1 |
| regulation of transcription by RNA polymerase II | 1 |
| transcription by RNA polymerase II | 1 |
| apoptotic process | 1 |
| chemotaxis | 1 |
Indications & clinical
Indications
5 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| dilated cardiomyopathy | 3 | MONDO:0005021 | EFO:0000407 |
| ankylosing spondylitis | 2 | MONDO:0005306 | EFO:0003898 |
| osteoarthritis, knee | 2 | MONDO:0005416 | EFO:0004616 |
| rheumatoid arthritis | 1 | MONDO:0008383 | EFO:0000685 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 9.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 6 |
| PHASE1 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03439514 | PHASE3 | TERMINATED | A Study of ARRY-371797 (PF-07265803) in Patients With Symptomatic Dilated Cardiomyopathy Due to a Lamin A/C Gene Mutation |
| NCT00542035 | PHASE2 | COMPLETED | A Study of ARRY-371797 in Subjects Undergoing Third Molar Extraction |
| NCT00663767 | PHASE2 | COMPLETED | A Study of ARRY-371797 in Subjects Undergoing Third Molar Extraction |
| NCT00811499 | PHASE2 | TERMINATED | A Study of ARRY-371797 in Patients With Active Ankylosing Spondylitis |
| NCT01366014 | PHASE2 | COMPLETED | A Study of ARRY-371797 in Patients With Osteoarthritis of the Knee |
| NCT02057341 | PHASE2 | COMPLETED | A Study of ARRY-371797 in Patients With LMNA-Related Dilated Cardiomyopathy |
| NCT02351856 | PHASE2 | COMPLETED | A Rollover Study of ARRY-371797 in Patients With LMNA-Related Dilated Cardiomyopathy |
| NCT00729209 | PHASE1 | COMPLETED | A Study of ARRY-371797 in Patients With Rheumatoid Arthritis |
| NCT00790049 | PHASE1 | COMPLETED | A Safety Study of ARRY-371797 in Healthy Subjects |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
65 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAPK14 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MAPK14 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | MAPK14 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | MAPK14 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | MAPK14 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| DASATINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | MAPK14 |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| GEFITINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | MAPK14 |
| IMATINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| ISOTRETINOIN | ChEMBL | Phase 4 (approved) | MAPK14 |
| LENVATINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | MAPK14 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | MAPK14 |
| NALFURAFINE | ChEMBL | Phase 4 (approved) | MAPK14 |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | MAPK14 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| PONATINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| TANNIC ACID | ChEMBL | Phase 4 (approved) | MAPK14 |
| TOVORAFENIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| TRIBROMSALAN | ChEMBL | Phase 4 (approved) | MAPK14 |
| VANDETANIB | ChEMBL | Phase 4 (approved) | MAPK14 |
| ZAFIRLUKAST | ChEMBL | Phase 4 (approved) | MAPK14 |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | MAPK14 |
| LINIFANIB | ChEMBL | Phase 3 | MAPK14 |
| LOSMAPIMOD | ChEMBL | Phase 3 | MAPK14 |
| PERIFOSINE | ChEMBL | Phase 3 | MAPK14 |
| TIRILAZAD | ChEMBL | Phase 3 | MAPK14 |
| BAFETINIB | ChEMBL | Phase 2 | MAPK14 |
| BMS-582949 | ChEMBL | Phase 2 | MAPK14 |
| CEP-32496 | ChEMBL | Phase 2 | MAPK14 |
| CLOSANTEL | ChEMBL | Phase 2 | MAPK14 |
| DIELDRIN | ChEMBL | Phase 2 | MAPK14 |
| DORAMAPIMOD | ChEMBL | Phase 2 | MAPK14 |
| FENBENDAZOLE | ChEMBL | Phase 2 | MAPK14 |
| FILAMINAST | ChEMBL | Phase 2 | MAPK14 |
| FORETINIB | ChEMBL | Phase 2 | MAPK14 |
| GALUNISERTIB | ChEMBL | Phase 2 | MAPK14 |
| GOLVATINIB | ChEMBL | Phase 2 | MAPK14 |
| ILORASERTIB | ChEMBL | Phase 2 | MAPK14 |
| IODOQUINOL | ChEMBL | Phase 2 | MAPK14 |
| ITX-5061 FREE BASE | ChEMBL | Phase 2 | MAPK14 |
| JNJ-49095397 | ChEMBL | Phase 2 | MAPK14 |
| MW-150 | ChEMBL | Phase 2 | MAPK14 |
| NAFENOPIN | ChEMBL | Phase 2 | MAPK14 |
| NEFLAMAPIMOD | ChEMBL | Phase 2 | MAPK14 |
| OSI-632 | ChEMBL | Phase 2 | MAPK14 |
| PAMAPIMOD | ChEMBL | Phase 2 | MAPK14 |
| PEXMETINIB | ChEMBL | Phase 2 | MAPK14 |
| PH-797804 | ChEMBL | Phase 2 | MAPK14 |
| REBASTINIB | ChEMBL | Phase 2 | MAPK14 |
| TAK-715 | ChEMBL | Phase 2 | MAPK14 |
| TALMAPIMOD | ChEMBL | Phase 2 | MAPK14 |
| TANZISERTIB | ChEMBL | Phase 2 | MAPK14 |
| TOP-1288 | ChEMBL | Phase 2 | MAPK14 |
Related Atlas pages
- Genes: MAPK14
- Diseases: dilated cardiomyopathy
- Drugs: Afatinib, Regorafenib, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Benzbromarone, Bithionol, Celecoxib, Dasatinib, Diethylstilbestrol, Encorafenib, Etoricoxib, Gefitinib, Hexachlorophene, Imatinib, Isotretinoin, Lenvatinib, Mifepristone, Montelukast, Nalfurafine, Nelfinavir, Nilotinib, Ponatinib, Quizartinib, Sorafenib, Tannic Acid, Tovorafenib, Tribromsalan, Vandetanib, Zafirlukast, Epigalocatechin Gallate, Linifanib, Losmapimod, Perifosine, Tirilazad