Atorvastatin
drugOn this page
Also known as AtorvastatinaAtorvastatineCardylLipitorPrevencorSortisTahorZaratorATORVASTATIN CALCIUMSID29215408Atorvastatin acidAtrovastatinSID124892211SID99355609SID144212734
Summary
Atorvastatin (CHEMBL1487) is an approved small molecule (ATC C10AA05) targeting HMGCR; indicated across 108 conditions including cardiovascular disorder and metabolic syndrome x.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C10AA05
- Targets: 1 (HMGCR)
- Indications: 108 conditions
- Clinical trials: 784
- Chemistry: 558.6 Da · C33H35FN2O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1487 |
| Name | Atorvastatin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 60823 |
| ChEBI | CHEBI:39548 |
| ATC | C10AA05 |
| Molecular formula | C33H35FN2O5 |
| Molecular weight | 558.6 |
| InChIKey | XUKUURHRXDUEBC-KAYWLYCHSA-N |
SMILES: CC(C)C1=C(C(=C(N1CC[C@H](C[C@H](CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4
IUPAC name: (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid
ChEBI definition: A dihydroxy monocarboxylic acid that is a member of the drug class known as statins, used primarily for lowering blood cholesterol and for preventing cardiovascular diseases.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Atorvastatin, Atorvastatina, Atorvastatine, Cardyl, Lipitor, Prevencor, Sortis, Tahor, Zarator, ATORVASTATIN, LIPITOR, ATORVASTATIN CALCIUM
Parent form; salt/anhydrous children: CHEMBL393220, CHEMBL3349878
Patent coverage: 18,407 distinct patent families (68,788 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HMGCR | hydroxymethylglutaryl-CoA reductase | Competitive | 7.85 | 84.4% | P04035 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Solute carrier organic anion transporter family member 1B1, Protein deacetylase HDAC6, Histone deacetylase 2, Thyroid hormone receptor beta, Bile acid receptor, 3-hydroxy-3-methylglutaryl-coenzyme A reductase, Histone deacetylase 1, Cytochrome P450 3A4, Nuclear receptor subfamily 1 group I member 2, Cruzipain.
Bioactivity
ChEMBL activities: 19 potent at pChembl ≥ 5 of 30 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HMGCR | 9.64 | IC50 | 0.23 | nM | CHEMBL_ACT_7606224 |
| P51639 | 8.42 | IC50 | 3.8 | nM | CHEMBL_ACT_2075559 |
| HMGCR | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_1439884 |
| HMGCR | 8.21 | Ki | 6.2 | nM | CHEMBL_ACT_18916437 |
| P51639 | 8.21 | IC50 | 6.2 | nM | CHEMBL_ACT_2218036 |
| P51639 | 8.15 | IC50 | 7 | nM | CHEMBL_ACT_17678556 |
| HMGCR | 7.94 | IC50 | 11.6 | nM | CHEMBL_ACT_17773211 |
| P51639 | 7.92 | IC50 | 12 | nM | CHEMBL_ACT_2064391 |
| HMGCR | 7.89 | IC50 | 12.9 | nM | CHEMBL_ACT_12718209 |
| SLCO1B1 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_15448316 |
| SLCO1B1 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_15448325 |
| SLCO1B1 | 6.06 | IC50 | 870 | nM | CHEMBL_ACT_11000887 |
| Q1W675 | 6.03 | IC50 | 930 | nM | CHEMBL_ACT_18474230 |
| SLCO1B1 | 5.8 | IC50 | 1600 | nM | CHEMBL_ACT_15448331 |
| ABCG2 | 5.37 | IC50 | 4300 | nM | CHEMBL_ACT_24777401 |
| RHOC | 5.3 | IC50 | 5000 | nM | CHEMBL_ACT_25481071 |
| CYP3A4 | 5.29 | IC50 | 5100 | nM | CHEMBL_ACT_5234095 |
| NR1H4 | 5.17 | AC50 | 6800 | nM | CHEMBL_ACT_25234601 |
| P25779 | 5.15 | Potency | 7080 | nM | CHEMBL_ACT_4005399 |
Target pathways
Aggregated over 1 target gene(s): HMGCR.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cholesterol biosynthesis | 1 | HMGCR |
| PPARA activates gene expression | 1 | HMGCR |
| Activation of gene expression by SREBF (SREBP) | 1 | HMGCR |
| EGR2 and SOX10-mediated initiation of Schwann cell myelination | 1 | HMGCR |
| Lanosterol biosynthesis | 1 | HMGCR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| cholesterol biosynthetic process | 1 |
| isoprenoid biosynthetic process | 1 |
| visual learning | 1 |
| coenzyme A metabolic process | 1 |
| sterol biosynthetic process | 1 |
| negative regulation of protein catabolic process | 1 |
| negative regulation of protein secretion | 1 |
| long-term synaptic potentiation | 1 |
| regulation of ERK1 and ERK2 cascade | 1 |
| negative regulation of amyloid-beta clearance | 1 |
| lipid metabolic process | 1 |
| steroid biosynthetic process | 1 |
| steroid metabolic process | 1 |
| cholesterol metabolic process | 1 |
Indications & clinical
Indications
108 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| metabolic syndrome X | 3 | MONDO:0011565 | EFO:0000195 |
| atherosclerosis | 3 | MONDO:0005311 | EFO:0003914 |
| familial hypercholesterolemia | 3 | MONDO:0005439 | EFO:0004911 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| diabetes mellitus | 3 | MONDO:0005015 | EFO:0000400 |
| hypertriglyceridemia | 3 | MONDO:0005347 | EFO:0004211 |
| type 2 diabetes mellitus | 3 | MONDO:0005148 | MONDO:0005148 |
| hyperlipidemia | 3 | MONDO:0021187 | MONDO:0021187 |
| HIV infectious disease | 3 | MONDO:0005109 | EFO:0000180 |
| metastatic prostate carcinoma | 3 | MONDO:0004956 | EFO:0000196 |
| atrial fibrillation | 3 | MONDO:0004981 | EFO:0000275 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| hypertrophic cardiomyopathy | 3 | MONDO:0005045 | EFO:0000538 |
| preeclampsia | 3 | MONDO:0005081 | EFO:0000668 |
| prostate adenocarcinoma | 3 | MONDO:0005082 | EFO:0000673 |
| psoriasis | 3 | MONDO:0005083 | EFO:0000676 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| acute coronary syndrome | 3 | MONDO:0005542 | EFO:0005672 |
| acute chest syndrome | 3 | MONDO:0005632 | EFO:0007129 |
| ST-elevation myocardial infarction | 3 | MONDO:0041656 | EFO:0008585 |
| kidney failure | 3 | MONDO:0001106 | HP:0000083 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| systemic lupus erythematosus | 3 | MONDO:0007915 | MONDO:0007915 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| periodontitis | 2 | MONDO:0005076 | EFO:0000649 |
| hepatitis C virus infection | 2 | MONDO:0005231 | EFO:0003047 |
| paraplegia | 2 | MONDO:0003757 | HP:0001258 |
| cardiomyopathy | 2 | MONDO:0004994 | EFO:0000318 |
| Crohn disease | 2 | MONDO:0005011 | EFO:0000384 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| leukemia | 2 | MONDO:0005059 | EFO:0000565 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| myocardial infarction | 2 | MONDO:0005068 | EFO:0000612 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| rheumatoid arthritis | 2 | MONDO:0008383 | EFO:0000685 |
| stroke disorder | 2 | MONDO:0005098 | EFO:0000712 |
| pulmonary arterial hypertension | 2 | MONDO:0015924 | EFO:0001361 |
| age-related macular degeneration | 2 | MONDO:0005150 | EFO:0001365 |
| cirrhosis of liver | 2 | MONDO:0005155 | EFO:0001422 |
| metabolic dysfunction-associated steatotic liver disease | 2 | MONDO:0013209 | EFO:0003095 |
| heart failure | 2 | MONDO:0005252 | EFO:0003144 |
| inflammatory bowel disease | 2 | MONDO:0005265 | EFO:0003767 |
| brain aneurysm | 2 | MONDO:0005291 | EFO:0003870 |
| obstructive sleep apnea syndrome | 2 | MONDO:0007147 | EFO:0003918 |
| relapsing-remitting multiple sclerosis | 2 | MONDO:0005314 | EFO:0003929 |
| vitiligo | 2 | MONDO:0008661 | EFO:0004208 |
| focal segmental glomerulosclerosis | 2 | MONDO:0100313 | EFO:0004236 |
| nephrotic syndrome | 2 | MONDO:0005377 | EFO:0004255 |
| vascular disorder | 2 | MONDO:0005385 | EFO:0004264 |
| osteoarthritis, knee | 2 | MONDO:0005416 | EFO:0004616 |
| non-Hodgkin lymphoma | 2 | MONDO:0018908 | EFO:0005952 |
| autoimmune thrombocytopenic purpura | 2 | MONDO:0008558 | EFO:0007160 |
| influenza | 2 | MONDO:0005812 | EFO:0007328 |
| carotid artery disorder | 2 | MONDO:0005269 | EFO:0009783 |
| inflammatory breast carcinoma | 2 | MONDO:0006804 | EFO:1000984 |
| metabolic dysfunction-associated steatohepatitis | 2 | MONDO:0007027 | EFO:1001249 |
| scleroderma | 2 | MONDO:0019340 | EFO:1001993 |
| Chagas disease | 2 | MONDO:0001444 | MONDO:0001444 |
| depressive disorder | 2 | MONDO:0002050 | MONDO:0002050 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| acute kidney injury | 2 | MONDO:0002492 | MONDO:0002492 |
| diabetes insipidus | 2 | MONDO:0004782 | MONDO:0004782 |
| asthma | 2 | MONDO:0004979 | MONDO:0004979 |
| type 1 diabetes mellitus | 2 | MONDO:0005147 | MONDO:0005147 |
| migraine disorder | 2 | MONDO:0005277 | MONDO:0005277 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| nasopharyngeal carcinoma | 2 | MONDO:0015459 | MONDO:0015459 |
| tuberculosis | 2 | MONDO:0018076 | MONDO:0018076 |
| osteonecrosis | 2 | MONDO:0005380 | MONDO:0018373 |
| sarcoidosis | 2 | MONDO:0019338 | MONDO:0019338 |
| Ebola hemorrhagic fever | 1 | MONDO:0005737 | EFO:0007243 |
| myelodysplastic syndrome | 1 | MONDO:0018881 | EFO:0000198 |
| acute myeloid leukemia | 1 | MONDO:0018874 | EFO:0000222 |
| colorectal adenocarcinoma | 1 | MONDO:0005008 | EFO:0000365 |
| epilepsy | 1 | MONDO:0005027 | EFO:0000474 |
| obesity disorder | 1 | MONDO:0011122 | EFO:0001073 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
| Kawasaki disease | 1 | MONDO:0012727 | EFO:0004246 |
| sleep disorder | 1 | MONDO:0100081 | EFO:0008568 |
| essential hypertension | 1 | MONDO:0001134 | MONDO:0001134 |
| venous thromboembolism | 0 | MONDO:0005399 | EFO:0004286 |
| endometrium neoplasm | 0 | MONDO:0021251 | MONDO:0011962 |
20 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 784.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 214 |
| PHASE3 | 168 |
| PHASE2 | 143 |
| PHASE1 | 116 |
| Not specified | 101 |
| PHASE2/PHASE3 | 20 |
| PHASE1/PHASE2 | 13 |
| EARLY_PHASE1 | 9 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02099123 | PHASE4 | ACTIVE_NOT_RECRUITING | A Clinical Trial of STAtin Therapy for Reducing Events in the Elderly (STAREE) |
| NCT03024684 | PHASE4 | ACTIVE_NOT_RECRUITING | Statin for Preventing Hepatocellular Carcinoma Recurrence After Curative Treatment |
| NCT03753555 | PHASE4 | RECRUITING | The Effect of InTensive Statin in Ischemic Stroke With inTracranial Atherosclerotic Plaques |
| NCT04347434 | PHASE4 | RECRUITING | Assessment of the Effects of Long-term Lipid-lowering Therapy in Patients With Primary STEMI or NSTEMI |
| NCT05030818 | PHASE4 | RECRUITING | Cross-over Study of Coronary Risk Factors With a Polypill |
| NCT05589454 | PHASE4 | NOT_YET_RECRUITING | Intracranial Hemorrhage Risk of Intensive Statin in Acute Ischemic Stroke With Cerebral Microbleeds |
| NCT05641753 | PHASE4 | RECRUITING | Cholesterol Lowering and Residual Risk in Diabetes, Type 1 |
| NCT05912686 | PHASE4 | NOT_YET_RECRUITING | High-Dose Atorvastatin for Vascular Wall Protection in Thrombectomy Patients |
| NCT06308952 | PHASE4 | RECRUITING | Atorvastatin Pretreatment in Cerebrovascular Events (APICES) After Flow Diverter Implantation |
| NCT06372925 | PHASE4 | RECRUITING | Intravascular Imaging Study of the Effect of Inclisiran on Plaque in Patients With Acute Myocardial Infarction |
| NCT06632379 | PHASE4 | RECRUITING | AtorvaStatin Postpartum and Reduction of Cardiovascular risK |
| NCT06750783 | PHASE4 | RECRUITING | The Effects of Xuezhikang and Atorvastatin on Lipid in Patients With Dyslipidemia and Prediabetes |
| NCT06765265 | PHASE4 | RECRUITING | Impact of Atorvastatin Versus Rosuvastatin on 25 Hydroxy Vitamin D Levels in Patients With Acute Coronary Syndrome |
| NCT06784557 | PHASE4 | RECRUITING | Effect of Ezetimibe on Gut Microbiota |
| NCT06785974 | PHASE4 | NOT_YET_RECRUITING | Statins to Prevent Immune Checkpoint Inhibitor-induced PRogression of AtherosLerosis |
| NCT06789432 | PHASE4 | RECRUITING | Efficacy and Safety of Atorvastatin and Ezetimibe (10/10mg) Fixed Dose Combination Versus Atorvastatin (20mg) Monotherapy in Bangladeshi Population |
| NCT06856772 | PHASE4 | NOT_YET_RECRUITING | Randomized Comparison of Morning Versus Bedtime Administration of Statins: A Cardiovascular Circadian Chronotherapy (C3) Trial |
| NCT07042165 | PHASE4 | RECRUITING | Treatment of Bile Acid Diarrhoea With Atorvastatin |
| NCT07462715 | PHASE4 | NOT_YET_RECRUITING | Statins Against Bushfire Smoke |
| NCT00079638 | PHASE4 | COMPLETED | Comparative Efficacy Evaluation of Lipids When Treated With Niaspan & Statin or Other Lipid-Modifying Therapies-COMPELL |
| NCT00120055 | PHASE4 | COMPLETED | Association Between Systemic Exposure of Atorvastatin and Metabolites and Atorvastatin-induced Myotoxicity |
| NCT00120887 | PHASE4 | COMPLETED | Lupus Atherosclerosis Prevention Study |
| NCT00124397 | PHASE4 | COMPLETED | Atorvastatin and Endothelial Function in Type 2 Diabetes Mellitus (ATTEND-Study) |
| NCT00141141 | PHASE4 | COMPLETED | Efficacy And Safety Study Of Atorvastatin Versus Simvastatin In Type 2 Diabetic Subjects With Hypercholesterolemia |
| NCT00141232 | PHASE4 | COMPLETED | Evaluating Atorvastatin With Omega-3 Fatty Acids in Cardiovascular Risk Reduction in Patients With Type 2 Diabetes |
| NCT00147602 | PHASE4 | COMPLETED | Lipitor In The Prevention Of Stroke, For Patients Who Have Had A Previous Stroke |
| NCT00150384 | PHASE4 | COMPLETED | Clinical Utility of Caduet in Achieving Blood Pressure and Lipid Endpoints in a Specific Patient Population |
| NCT00157924 | PHASE4 | COMPLETED | Ezetimibe (+) Simvastatin vs. Atorvastatin Comparative Study in DM or Metabolic Syndrome Patients (0653A-093) |
| NCT00159718 | PHASE4 | COMPLETED | Double Blind Atorvastatin Amlodipine Study |
| NCT00159835 | PHASE4 | COMPLETED | Atorvastatin Versus Simvastatin In The Prevention Of Coronary Heart Disease (CHD) In Patients With Known CHD |
| NCT00163150 | PHASE4 | COMPLETED | Vasomotor Reactivity In Cerebral Small Vessel Disease And New Approach To Treat Lacunar Stroke |
| NCT00163202 | PHASE4 | COMPLETED | Comparative Atorvastatin Pleiotropic Effects |
| NCT00166504 | PHASE4 | COMPLETED | Ezetimibe Plus (+) Simvastatin Versus Atorvastatin Comparative Study (0653A-092)(COMPLETED) |
| NCT00166530 | PHASE4 | COMPLETED | EASEGO Study: Doubling of Atorvastatin/Simvastatin or INEGY in Patients With Hypercholesterolemia and Coronary Artery Disease(CAD)(0653A-089) |
| NCT00174330 | PHASE4 | COMPLETED | Comparing Amlodipine/Atorvastatin Co-Administration To Amlodipine Alone In Patients With Hypertension And Dyslipidemia |
| NCT00181181 | PHASE4 | TERMINATED | The Effect of Statin Use on Vascular Function in Hypertensive Subjects |
| NCT00194402 | PHASE4 | COMPLETED | SLIM: Combined Effects of Slo-Niacin and Atorvastatin on Lipoproteins and Inflammatory Markers in Hyperlipidemia |
| NCT00199745 | PHASE4 | COMPLETED | Differences in Atorvastatin Metabolite Ratios as a Diagnostic Tool in Detecting Atorvastatin Induced Myotoxicity |
| NCT00211939 | PHASE4 | COMPLETED | CARE-2 (Calcium Acetate [PhosLo®]/Sevelamer[Renagel®] Evaluation Study 2) for Heart Calcification in Dialysis Patients |
| NCT00233480 | PHASE4 | COMPLETED | Statin Therapy in Heart Failure: Potential Mechanisms of Benefit |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (4) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for atorvastatin and SLCO1B1 | DPWG | SLCO1B1 | yes | yes |
| Annotation of CPIC Guideline for atorvastatin and SLCO1B1 | CPIC | SLCO1B1 | yes | yes |
| Annotation of CPIC Guideline for atorvastatin, fluvastatin, lovastatin | CPIC | ABCG2 | ||
| Annotation of CPIC Guideline for atorvastatin, fluvastatin, lovastatin | CPIC | CYP3A4;CYP3A5;HMGCR |
PharmGKB also curates 54 clinical and 296 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
13 molecules share ≥1 primary target. Top 13 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| LOVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| PITAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| PRAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| ROSUVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| SIMVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| CERIVASTATIN | ChEMBL | Phase 4 (approved) | HMGCR |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HMGCR |
| FLUVASTATIN | ChEMBL | Phase 4 (approved) | HMGCR |
| TANNIC ACID | ChEMBL | Phase 4 (approved) | HMGCR |
| GLENVASTATIN | ChEMBL | Phase 2 | HMGCR |
| MEGLUTOL | ChEMBL | Phase 2 | HMGCR |
| MEVASTATIN | ChEMBL | Phase 2 | HMGCR |
| Vorinostat | PubChem | Approved | HMGCR |
Related Atlas pages
- Genes: HMGCR
- Diseases: cardiovascular disorder, metabolic syndrome X, atherosclerosis, familial hypercholesterolemia, breast neoplasm, diabetes mellitus, hypertriglyceridemia, type 2 diabetes mellitus, hyperlipidemia, HIV infectious disease, metastatic prostate carcinoma, atrial fibrillation, hypertensive disorder, hypertrophic cardiomyopathy, preeclampsia, prostate adenocarcinoma, psoriasis, coronary artery disorder, kidney disorder, chronic kidney disease, acute coronary syndrome, acute chest syndrome, ST-elevation myocardial infarction, kidney failure, Alzheimer disease, systemic lupus erythematosus, severe acute respiratory syndrome
- Drugs: Lovastatin, Pitavastatin, Pravastatin, Rosuvastatin, Simvastatin, Cerivastatin, Cisapride, Fluvastatin, Tannic Acid, Vorinostat