Auranofin
drugOn this page
Also known as AuranofinaAuranofineNSC-321521RidauraSK&F 39162SK&F-39162SK-39162Auronofin
Summary
Auranofin (CHEMBL1366) is an approved small molecule (ATC M01CB03) targeting TRPA1; indicated across 14 conditions including rheumatoid arthritis and rheumatic disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01CB03
- Targets: 1 (TRPA1)
- Indications: 14 conditions
- Clinical trials: 13
- Chemistry: 679.5 Da · C20H35AuO9PS
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1366 |
| Name | Auranofin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 70788951 |
| ATC | M01CB03 |
| Molecular formula | C20H35AuO9PS |
| Molecular weight | 679.5 |
| InChIKey | IRPYFWIZKIOHQN-XTZHGVARSA-N |
SMILES: CC[PH+](CC)CC.CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)[S-])OC(=O)C)OC(=O)C)OC(=O)C.[Au]
IUPAC name: gold;(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate;triethylphosphanium
Also known as: Auranofin, Auranofina, Auranofine, NSC-321521, Ridaura, SK&F 39162, SK&F-39162, SK-39162, AURANOFIN, auranofin, Auronofin
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TRPA1 | TRPA1 | Activation | 6 | 0.1% | O75762 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Tyrosine-protein kinase Fyn, Alpha-2A adrenergic receptor, Alpha-2B adrenergic receptor, Glucocorticoid receptor, D(4) dopamine receptor, D(3) dopamine receptor, Adenosine receptor A3.
Bioactivity
ChEMBL activities: 13 potent at pChembl ≥ 5 of 13 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DRD3 | 6.65 | Ki | 224 | nM | CHEMBL_ACT_7614568 |
| ADRA2A | 6.48 | Ki | 331 | nM | CHEMBL_ACT_7613159 |
| ADRA2B | 6.44 | Ki | 363 | nM | CHEMBL_ACT_7613161 |
| DRD4 | 6.41 | Ki | 394 | nM | CHEMBL_ACT_7614570 |
| NR3C1 | 6.22 | Ki | 599 | nM | CHEMBL_ACT_7614586 |
| DRD3 | 6.18 | IC50 | 659 | nM | CHEMBL_ACT_7614567 |
| ADRA2B | 6.1 | IC50 | 796 | nM | CHEMBL_ACT_7613160 |
| ADRA2A | 6.05 | IC50 | 884 | nM | CHEMBL_ACT_7613158 |
| ADORA3 | 6.02 | Ki | 954 | nM | CHEMBL_ACT_7613149 |
| DRD4 | 5.95 | IC50 | 1123 | nM | CHEMBL_ACT_7614569 |
| FYN | 5.92 | IC50 | 1197 | nM | CHEMBL_ACT_7616052 |
| NR3C1 | 5.88 | IC50 | 1317 | nM | CHEMBL_ACT_7614585 |
| ADORA3 | 5.77 | IC50 | 1688 | nM | CHEMBL_ACT_7613148 |
Target pathways
Aggregated over 1 target gene(s): TRPA1.
Top Reactome pathways
1 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| TRP channels | 1 | TRPA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 1 |
| intracellular calcium ion homeostasis | 1 |
| cell surface receptor signaling pathway | 1 |
| response to cold | 1 |
| response to xenobiotic stimulus | 1 |
| urinary bladder smooth muscle contraction | 1 |
| sensory perception of pain | 1 |
| cellular response to heat | 1 |
| positive regulation of insulin secretion involved in cellular response to glucose stimulus | 1 |
| response to pain | 1 |
| thermoception | 1 |
| detection of mechanical stimulus involved in sensory perception of pain | 1 |
| detection of chemical stimulus involved in sensory perception of pain | 1 |
| protein homotetramerization | 1 |
| cellular response to hydrogen peroxide | 1 |
Indications & clinical
Indications
14 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| ovarian carcinoma | 2 | MONDO:0005140 | EFO:0001075 |
| tuberculosis | 2 | MONDO:0018076 | MONDO:0018076 |
| leukemia | 2 | MONDO:0005059 | EFO:0000565 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| small cell lung carcinoma | 1 | MONDO:0008433 | EFO:0000702 |
| squamous cell lung carcinoma | 1 | MONDO:0005097 | EFO:0000708 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| amebiasis | 1 | MONDO:0005644 | EFO:0007144 |
| lung adenocarcinoma | 1 | MONDO:0005061 | EFO:0000571 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 13.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 6 |
| PHASE1/PHASE2 | 3 |
| PHASE1 | 2 |
| EARLY_PHASE1 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06805656 | PHASE2 | NOT_YET_RECRUITING | Multi Interventional Approaches to Mitigate HIV Reservoirs Aiming the Sustained HIV Remission Without Antiretrovirals |
| NCT01419691 | PHASE2 | COMPLETED | Phase I and II Study of Auranofin in Chronic Lymphocytic Leukemia (CLL) |
| NCT01737502 | PHASE1/PHASE2 | COMPLETED | Sirolimus and Auranofin in Treating Patients With Advanced or Recurrent Non-Small Cell Lung Cancer or Small Cell Lung Cancer |
| NCT02063698 | PHASE2 | COMPLETED | Auranofin in Decreasing Pain in Patients With Paclitaxel-Induced Pain Syndrome |
| NCT02176135 | PHASE1/PHASE2 | WITHDRAWN | Oral Auranofin for Reduction of Latent Viral Reservoir in Patients With HIV Infection |
| NCT02736968 | PHASE2 | COMPLETED | Auranofin for Giardia Protozoa |
| NCT02770378 | PHASE1/PHASE2 | COMPLETED | A Proof-of-concept Clinical Trial Assessing the Safety of the Coordinated Undermining of Survival Paths by 9 Repurposed Drugs Combined With Metronomic Temozolomide (CUSP9v3 Treatment Protocol) for Recurrent Glioblastoma |
| NCT02968927 | PHASE2 | UNKNOWN | TB Host Directed Therapy |
| NCT03456700 | PHASE2 | TERMINATED | Auranofin and Sirolimus in Treating Participants With Ovarian Cancer |
| NCT02089048 | PHASE1 | COMPLETED | Auranofin PK Following Oral Dose Administration |
| NCT02126527 | PHASE1 | WITHDRAWN | Auranofin and Sirolimus in Treating Patients With Advanced Solid Tumors or Recurrent Non-Small Cell Lung Cancer |
| NCT01747798 | EARLY_PHASE1 | COMPLETED | Auranofin in Treating Patients With Recurrent Epithelial Ovarian, Primary Peritoneal, or Fallopian Tube Cancer |
| NCT02961829 | Not specified | COMPLETED | Multi Interventional Study Exploring HIV-1 Residual Replication: a Step Towards HIV-1 Eradication and Sterilizing Cure |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
27 molecules share ≥1 primary target. Top 27 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DICLOFENAC | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| DISULFIRAM | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| MEFENAMIC ACID | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| MENTHOL | ChEMBL | Phase 4 (approved) | TRPA1 |
| NICOTINE | ChEMBL | Phase 4 (approved) | TRPA1 |
| RESVERATROL | ChEMBL + PubChem | Phase 3 (approved) | TRPA1 |
| CANNABINOL | ChEMBL | Phase 3 | TRPA1 |
| ICILLIN | ChEMBL | Phase 3 | TRPA1 |
| LEVOMENTHOL | ChEMBL | Phase 3 | TRPA1 |
| ALLICIN | ChEMBL | Phase 2 | TRPA1 |
| CANNABIDIVARIN | ChEMBL | Phase 2 | TRPA1 |
| CANNABIGEROL | ChEMBL | Phase 2 | TRPA1 |
| CARVACROL | ChEMBL | Phase 2 | TRPA1 |
| CHLORDANTOIN | ChEMBL | Phase 2 | TRPA1 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | TRPA1 |
| RG6341 | ChEMBL | Phase 2 | TRPA1 |
| SALIRASIB | ChEMBL | Phase 2 | TRPA1 |
| SANGUINARIUM | ChEMBL | Phase 2 | TRPA1 |
| TETRAHYDROCANNABIVARIN | ChEMBL | Phase 2 | TRPA1 |
| THYMOL | ChEMBL | Phase 2 | TRPA1 |
| Acetaldehyde | PubChem | Approved | TRPA1 |
| Caffeine | PubChem | Approved | TRPA1 |
| camphor (synthetic) | PubChem | Approved | TRPA1 |
| dronabinol | PubChem | Approved | TRPA1 |
| Eugenol | PubChem | Approved | TRPA1 |
| menthol, unspecified form | PubChem | Approved | TRPA1 |
| Propylene Glycol | PubChem | Approved | TRPA1 |
Related Atlas pages
- Genes: TRPA1
- Diseases: rheumatoid arthritis, rheumatic disorder
- Drugs: Diclofenac, Disulfiram, Mefenamic Acid, Menthol, Nicotine, Resveratrol, Cannabinol, Icillin, Caffeine, camphor (synthetic), dronabinol, Propylene Glycol