Avapritinib
drug drugOn this page
Also known as 70C366AyvakitAyvakytBLU-285C-366X-720776X720776AvarpritinibUS10807985Compound 44
Summary
Avapritinib (CHEMBL4204794) is an approved small molecule (ATC L01EX18) targeting KIT; indicated across 7 conditions including neoplasm and gastrointestinal stromal tumor; with CIViC clinical evidence for 3 variant-indication associations (e.g. KIT D816V in systemic mastocytosis).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EX18
- Targets: 1 (KIT)
- Indications: 7 conditions
- Clinical trials: 22
- Precision-oncology evidence (CIViC): 3 variant–indication associations
- Chemistry: 498.6 Da · C26H27FN10
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4204794 |
| Name | Avapritinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 118023034 |
| ATC | L01EX18 |
| Molecular formula | C26H27FN10 |
| Molecular weight | 498.6 |
| InChIKey | DWYRIWUZIJHQKQ-SANMLTNESA-N |
SMILES: C[C@](C1=CC=C(C=C1)F)(C2=CN=C(N=C2)N3CCN(CC3)C4=NC=NN5C4=CC(=C5)C6=CN(N=C6)C)N
IUPAC name: (1S)-1-(4-fluorophenyl)-1-[2-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanamine
Also known as: 70C366, Avapritinib, Ayvakit, Ayvakyt, BLU-285, C-366, X-720776, X720776, AVAPRITINIB, Avarpritinib, US10807985, Compound 44
Patent coverage: 529 distinct patent families (1,306 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| KIT | KIT proto-oncogene, receptor tyrosine kinase | Inhibition | 7.14 | 0.5% | P10721 |
Broader ChEMBL bioactivity targets: 3 (assay-derived). Sample: Mast/stem cell growth factor receptor Kit, Platelet-derived growth factor receptor alpha, Broad substrate specificity ATP-binding cassette transporter ABCG2.
Bioactivity
ChEMBL activities: 12 potent at pChembl ≥ 5 of 12 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| KIT | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_29279065 |
| PDGFRA | 9.62 | IC50 | 0.24 | nM | CHEMBL_ACT_26186122 |
| KIT | 9.62 | IC50 | 0.24 | nM | CHEMBL_ACT_26186123 |
| PDGFRA | 9.62 | IC50 | 0.24 | nM | CHEMBL_ACT_29055503 |
| KIT | 9.57 | IC50 | 0.27 | nM | CHEMBL_ACT_26186120 |
| KIT | 9.57 | IC50 | 0.27 | nM | CHEMBL_ACT_29055502 |
| ABCG2 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_24963508 |
| PDGFRA | 8.48 | IC50 | 3.3 | nM | CHEMBL_ACT_29168405 |
| KIT | 8.24 | IC50 | 5.8 | nM | CHEMBL_ACT_29279027 |
| PDGFRA | 7.72 | IC50 | 19.1 | nM | CHEMBL_ACT_29168393 |
| KIT | 5.82 | IC50 | 1518 | nM | CHEMBL_ACT_29279095 |
| PDGFRA | 5.39 | IC50 | 4039 | nM | CHEMBL_ACT_29279197 |
Target pathways
Aggregated over 1 target gene(s): KIT.
Top Reactome pathways
39 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 1 | KIT |
| Developmental Biology | 1 | KIT |
| Signaling by SCF-KIT | 1 | KIT |
| Regulation of KIT signaling | 1 | KIT |
| Signal Transduction | 1 | KIT |
| Disease | 1 | KIT |
| Negative regulation of the PI3K/AKT network | 1 | KIT |
| Generic Transcription Pathway | 1 | KIT |
| PI3K/AKT Signaling in Cancer | 1 | KIT |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | KIT |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | KIT |
| RAF/MAP kinase cascade | 1 | KIT |
| MAPK family signaling cascades | 1 | KIT |
| MAPK1/MAPK3 signaling | 1 | KIT |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | KIT |
| RNA Polymerase II Transcription | 1 | KIT |
| Gene expression (Transcription) | 1 | KIT |
| Transcriptional regulation by the AP-2 (TFAP2) family of transcription factors | 1 | KIT |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | KIT |
| Intracellular signaling by second messengers | 1 | KIT |
| Signaling by Receptor Tyrosine Kinases | 1 | KIT |
| Dasatinib-resistant KIT mutants | 1 | KIT |
| Imatinib-resistant KIT mutants | 1 | KIT |
| KIT mutants bind TKIs | 1 | KIT |
| Masitinib-resistant KIT mutants | 1 | KIT |
| Nilotinib-resistant KIT mutants | 1 | KIT |
| Regorafenib-resistant KIT mutants | 1 | KIT |
| Signaling by kinase domain mutants of KIT | 1 | KIT |
| Sunitinib-resistant KIT mutants | 1 | KIT |
| Signaling by juxtamembrane domain KIT mutants | 1 | KIT |
| Sorafenib-resistant KIT mutants | 1 | KIT |
| Drug resistance of KIT mutants | 1 | KIT |
| Signaling by KIT in disease | 1 | KIT |
| Signaling by phosphorylated juxtamembrane, extracellular and kinase domain KIT mutants | 1 | KIT |
| Signaling by extracellular domain mutants of KIT | 1 | KIT |
| MITF-M-regulated melanocyte development | 1 | KIT |
| Transcriptional and post-translational regulation of MITF-M expression and activity | 1 | KIT |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | KIT |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | KIT |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| ovarian follicle development | 1 |
| hematopoietic progenitor cell differentiation | 1 |
| myeloid progenitor cell differentiation | 1 |
| lymphoid progenitor cell differentiation | 1 |
| immature B cell differentiation | 1 |
| mast cell chemotaxis | 1 |
| positive regulation of dendritic cell cytokine production | 1 |
| glycosphingolipid metabolic process | 1 |
| inflammatory response | 1 |
| signal transduction | 1 |
| spermatogenesis | 1 |
| spermatid development | 1 |
| positive regulation of cell population proliferation | 1 |
| primordial germ cell migration | 1 |
| regulation of cell shape | 1 |
Indications & clinical
Indications
2 approved indications. FDA phase 4, plus an anticancer drug’s labelled cancer uses (which ChEMBL often logs at phase 3).
| Indication | Phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| gastrointestinal stromal tumor | 4 | MONDO:0011719 | MONDO:0011719 |
3 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| mast cell leukemia | 2 | MONDO:0020334 | EFO:0007359 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| central nervous system cancer | 1 | MONDO:0002714 | EFO:0000326 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 22.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 9 |
| Not specified | 5 |
| PHASE1 | 4 |
| PHASE4 | 2 |
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06748001 | PHASE4 | RECRUITING | Avapritinib Rollover Study |
| NCT04825574 | PHASE4 | COMPLETED | Study for Patients Previously Treated in Avapritinib Clinical Trials |
| NCT03465722 | PHASE3 | COMPLETED | (VOYAGER) Study of Avapritinib vs Regorafenib in Patients With Locally Advanced Unresectable or Metastatic GIST |
| NCT03731260 | PHASE2 | ACTIVE_NOT_RECRUITING | (PIONEER) Study to Evaluate Efficacy and Safety of Avapritinib (BLU-285), A Selective KIT Mutation-targeted Tyrosine Kinase Inhibitor, Versus Placebo in Patients With Indolent Systemic Mastocytosis |
| NCT04116541 | PHASE2 | RECRUITING | A Study Evaluating the Activity of Anti-cancer Treatments Targeting Tumor Molecular Alterations/Characteristics in Advanced / Metastatic Tumors. |
| NCT04771520 | PHASE2 | RECRUITING | Avapritinib for the Treatment of CKIT or PDGFRA Mutation-Positive Locally Advanced or Metastatic Malignant Solid Tumors |
| NCT06221683 | PHASE2 | RECRUITING | Clinical Study of Induction Therapy Options Based on Molecular Subtyping and MRD in Children and Adolescents With AML |
| NCT06316960 | PHASE2 | RECRUITING | Safety and Efficacy of Avapritinib in Relapsed or Refractory Pediatric CBF-AML With KIT Mutation |
| NCT06765915 | PHASE2 | NOT_YET_RECRUITING | Avapritinib Maintenance for AML With KIT Mutations |
| NCT06783790 | PHASE2 | RECRUITING | Avapritinib Combined With Azacitidine and Venetoclax in the Treatment of Relapsed AML After Allo-HSCT |
| NCT03580655 | PHASE2 | COMPLETED | (PATHFINDER) Study to Evaluate Efficacy and Safety of Avapritinib (BLU-285), A Selective KIT Mutation-targeted Tyrosine Kinase Inhibitor, in Patients With Advanced Systemic Mastocytosis |
| NCT04773782 | PHASE1/PHASE2 | COMPLETED | A Study of Avapritinib in Pediatric Patients With Solid Tumors Dependent on KIT or PDGFRA Signaling |
| NCT05821738 | PHASE2 | UNKNOWN | Avapritinib in CBF-AML With KIT Mutations |
| NCT06327685 | PHASE1 | RECRUITING | Avapritinib With Decitabine in Patients With SM-AHN |
| NCT02508532 | PHASE1 | COMPLETED | (NAVIGATOR) Study of BLU-285 in Patients With Gastrointestinal Stromal Tumors (GIST) and Other Relapsed and Refractory Solid Tumors |
| NCT02561988 | PHASE1 | COMPLETED | (EXPLORER) Study of BLU-285 in Patients With Advanced Systemic Mastocytosis (AdvSM) and Relapsed or Refractory Myeloid Malignancies |
| NCT04908176 | PHASE1 | COMPLETED | A Drug-drug Interaction Study of Avapritinib and Midazolam |
| NCT07131059 | Not specified | RECRUITING | MRD-positive AML Clinical Study |
| NCT07255638 | Not specified | RECRUITING | A Non-Interventional Study in Participants With Indolent Systemic Mastocytosis (ISM) in Germany |
| NCT03862885 | Not specified | APPROVED_FOR_MARKETING | Early Access Program (EAP) for Avapritinib in Patients With Locally Advanced Unresectable or Metastatic GIST |
| NCT04714086 | Not specified | NO_LONGER_AVAILABLE | Expanded Access Program for Avapritinib |
| NCT05381753 | Not specified | COMPLETED | Safety and Efficacy of Avapritinib in Chinese Patients With Gastrointestinal Stromal Tumor (GIST) in the Real World |
Clinical evidence (CIViC)
Variant × indication × effect (3 predictive associations from 3 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| KIT D816V | Systemic Mastocytosis | Sensitivity/Response | Avapritinib | CIViC A | EID11274 |
| PDGFRA Exon 18 Mutation | Gastrointestinal Stromal Tumor | Sensitivity/Response | Avapritinib | CIViC A | EID7809 |
| PDGFRA D842V | Gastrointestinal Stromal Tumor | Sensitivity/Response | Avapritinib | CIViC B | EID7479 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
83 molecules share ≥1 primary target. Top 83 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| IMATINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| AXITINIB | ChEMBL | Phase 4 (approved) | KIT |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | KIT |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | KIT |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | KIT |
| CERITINIB | ChEMBL | Phase 4 (approved) | KIT |
| DASATINIB | ChEMBL | Phase 4 (approved) | KIT |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | KIT |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | KIT |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | KIT |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | KIT |
| LENVATINIB | ChEMBL | Phase 4 (approved) | KIT |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | KIT |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | KIT |
| NILOTINIB | ChEMBL | Phase 4 (approved) | KIT |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | KIT |
| PEXIDARTINIB | ChEMBL | Phase 4 (approved) | KIT |
| PONATINIB | ChEMBL | Phase 4 (approved) | KIT |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | KIT |
| RIPRETINIB | ChEMBL | Phase 4 (approved) | KIT |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | KIT |
| SORAFENIB | ChEMBL | Phase 4 (approved) | KIT |
| SUNITINIB | ChEMBL | Phase 4 (approved) | KIT |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | KIT |
| VANDETANIB | ChEMBL | Phase 4 (approved) | KIT |
| ALVOCIDIB | ChEMBL | Phase 3 | KIT |
| BARASERTIB | ChEMBL | Phase 3 | KIT |
| BEZUCLASTINIB | ChEMBL | Phase 3 | KIT |
| BRIVANIB | ChEMBL | Phase 3 | KIT |
| CANERTINIB | ChEMBL | Phase 3 | KIT |
| CEDIRANIB | ChEMBL | Phase 3 | KIT |
| DOVITINIB | ChEMBL | Phase 3 | KIT |
| ENZASTAURIN | ChEMBL | Phase 3 | KIT |
| FAMITINIB | ChEMBL | Phase 3 | KIT |
| FLUMATINIB | ChEMBL | Phase 3 | KIT |
| LESTAURTINIB | ChEMBL | Phase 3 | KIT |
| LINIFANIB | ChEMBL | Phase 3 | KIT |
| MASITINIB | ChEMBL | Phase 3 | KIT |
| MOTESANIB | ChEMBL | Phase 3 | KIT |
| PIMICOTINIB | ChEMBL | Phase 3 | KIT |
| RUBOXISTAURIN | ChEMBL | Phase 3 | KIT |
| SARACATINIB | ChEMBL | Phase 3 | KIT |
| SEMAXANIB | ChEMBL | Phase 3 | KIT |
| SITRAVATINIB | ChEMBL | Phase 3 | KIT |
| VATALANIB | ChEMBL | Phase 3 | KIT |
| VIMSELTINIB | ChEMBL | Phase 3 | KIT |
| AMUVATINIB | ChEMBL | Phase 2 | KIT |
| BAY-1161909 | ChEMBL | Phase 2 | KIT |
| BEMCENTINIB | ChEMBL | Phase 2 | KIT |
| BERZOSERTIB | ChEMBL | Phase 2 | KIT |
| BFH-772 | ChEMBL | Phase 2 | KIT |
| BMS-777607 | ChEMBL | Phase 2 | KIT |
| CENISERTIB | ChEMBL | Phase 2 | KIT |
| CEP-32496 | ChEMBL | Phase 2 | KIT |
| DANUSERTIB | ChEMBL | Phase 2 | KIT |
| DATELLIPTIUM | ChEMBL | Phase 2 | KIT |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | KIT |
| DENFIVONTINIB | ChEMBL | Phase 2 | KIT |
| DORAMAPIMOD | ChEMBL | Phase 2 | KIT |
| EDICOTINIB | ChEMBL | Phase 2 | KIT |
| ELLIPTINIUM | ChEMBL | Phase 2 | KIT |
| ENMD-2076 | ChEMBL | Phase 2 | KIT |
| ENRUPATINIB | ChEMBL | Phase 2 | KIT |
| FORETINIB | ChEMBL | Phase 2 | KIT |
| ILORASERTIB | ChEMBL | Phase 2 | KIT |
| LABUXTINIB | ChEMBL | Phase 2 | KIT |
| MILCICLIB | ChEMBL | Phase 2 | KIT |
| R-406 | ChEMBL | Phase 2 | KIT |
| RAF-265 | ChEMBL | Phase 2 | KIT |
| REBASTINIB | ChEMBL | Phase 2 | KIT |
| RISVODETINIB | ChEMBL | Phase 2 | KIT |
| SOTULETINIB | ChEMBL | Phase 2 | KIT |
| SU-014813 | ChEMBL | Phase 2 | KIT |
| TANDUTINIB | ChEMBL | Phase 2 | KIT |
| TELATINIB | ChEMBL | Phase 2 | KIT |
| TOZASERTIB | ChEMBL | Phase 2 | KIT |
| Afatinib | PubChem | Approved | KIT |
| Idelalisib | PubChem | Approved | KIT |
| Selumetinib | PubChem | Approved | KIT |
Related Atlas pages
- Genes: KIT
- Indicated for: neoplasm, gastrointestinal stromal tumor, systemic mastocytosis
- In clinical trials for: mast cell leukemia, acute myeloid leukemia
- Drugs: Crizotinib, Gefitinib, Imatinib, Pazopanib, Regorafenib, Axitinib, Bosutinib, Brigatinib, Cabozantinib, Ceritinib, Dasatinib, Entrectinib, Erlotinib, Fedratinib, Infigratinib, Lenvatinib, Midostaurin, Niclosamide, Nilotinib, Nintedanib, Pexidartinib, Ponatinib, Quizartinib, Ripretinib, Ruxolitinib, Sorafenib, Sunitinib, Tivozanib, Vandetanib, Alvocidib, Barasertib, Bezuclastinib, Brivanib, Canertinib, Cediranib, Dovitinib, Enzastaurin, Famitinib, Flumatinib, Lestaurtinib, Linifanib, Masitinib, Motesanib, Pimicotinib, Ruboxistaurin, Saracatinib, Semaxanib, Sitravatinib, Vatalanib, Vimseltinib, Afatinib, Idelalisib, Selumetinib
- Biomarker genes: PDGFRA