Avutometinib
drug drugOn this page
Also known as CH-5126766CH5126766CKI-27R-7304Rg-7304Ro 5126766Ro-5126766VS-6766RO5126766 (CH5126766)
Summary
Avutometinib (CHEMBL3264002) is a phase-3 clinical-stage small-molecule EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor targeting MAP2K1 and RAF1; indicated across 13 conditions including ovarian cancer and non-small cell lung carcinoma.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (MAP2K1, RAF1)
- Indications: 13 conditions
- Clinical trials: 25
- Chemistry: 471.5 Da · C21H18FN5O5S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3264002 |
| Name | Avutometinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 16719221 |
| ChEBI | CHEBI:78825 |
| Molecular formula | C21H18FN5O5S |
| Molecular weight | 471.5 |
| InChIKey | LMMJFBMMJUMSJS-UHFFFAOYSA-N |
SMILES: CC1=C(C(=O)OC2=C1C=CC(=C2)OC3=NC=CC=N3)CC4=C(C(=NC=C4)NS(=O)(=O)NC)F
IUPAC name: 3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one
ChEBI definition: A member of the class of coumarins that is 4-methyl-7-[(pyrimidin-2-yl)oxy]coumarin carrying an additional [2-[(methylaminosulfonyl)amino]-3-fluoropyridin-4-yl]methyl substituent at position 3.
Pharmacological roles (ChEBI): EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor, antineoplastic agent.
Also known as: Avutometinib, CH-5126766, CH5126766, CKI-27, R-7304, Rg-7304, Ro 5126766, Ro-5126766, VS-6766, AVUTOMETINIB, RO5126766 (CH5126766)
Parent form; salt/anhydrous children: CHEMBL3264004
Patent coverage: 820 distinct patent families (2,208 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 1,636 (74%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MAP2K1 | mitogen-activated protein kinase kinase 1 | Inhibition | 6.8 | 4.7% | Q02750 |
| RAF1 | Raf-1 proto-oncogene, serine/threonine kinase | Inhibition | 7.25 | P04049 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: RAF proto-oncogene serine/threonine-protein kinase, Dual specificity mitogen-activated protein kinase kinase; MEK1/2, Dual specificity mitogen-activated protein kinase kinase 2, Cytochrome P450 2C9, Dual specificity mitogen-activated protein kinase kinase 1, Dual specificity mitogen-activated protein kinase kinase 5, Serine/threonine-protein kinase B-raf.
Bioactivity
ChEMBL activities: 12 potent at pChembl ≥ 5 of 14 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| BRAF | 8.15 | Kd | 7 | nM | CHEMBL_ACT_17885864 |
| BRAF | 8.09 | IC50 | 8.2 | nM | CHEMBL_ACT_24691458 |
| BRAF | 7.72 | IC50 | 19 | nM | CHEMBL_ACT_24691457 |
| MAP2K1 | 7.52 | Kd | 30 | nM | CHEMBL_ACT_17910326 |
| MAP2K2 | 7.43 | Kd | 37 | nM | CHEMBL_ACT_17910652 |
| RAF1 | 7.25 | IC50 | 56 | nM | CHEMBL_ACT_14653712 |
| RAF1 | 7.25 | IC50 | 56 | nM | CHEMBL_ACT_24691456 |
| MAP2K1 | 6.8 | IC50 | 160 | nM | CHEMBL_ACT_14653725 |
| MAP2K1 | 6.8 | IC50 | 160 | nM | CHEMBL_ACT_24999394 |
| MAP2K1 | 6.8 | IC50 | 160 | nM | CHEMBL_ACT_25892743 |
| MAP2K2 | 6.8 | IC50 | 160 | nM | CHEMBL_ACT_29048810 |
| MAP2K5 | 5.7 | Kd | 1996 | nM | CHEMBL_ACT_17911212 |
Target pathways
Aggregated over 2 target gene(s): MAP2K1, RAF1.
Top Reactome pathways
68 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| RAF activation | 2 | MAP2K1, RAF1 |
| MAP2K and MAPK activation | 2 | MAP2K1, RAF1 |
| Negative feedback regulation of MAPK pathway | 2 | MAP2K1, RAF1 |
| Negative regulation of MAPK pathway | 2 | MAP2K1, RAF1 |
| Signaling by moderate kinase activity BRAF mutants | 2 | MAP2K1, RAF1 |
| Signaling by high-kinase activity BRAF mutants | 2 | MAP2K1, RAF1 |
| Signaling by BRAF and RAF1 fusions | 2 | MAP2K1, RAF1 |
| Paradoxical activation of RAF signaling by kinase inactive BRAF | 2 | MAP2K1, RAF1 |
| Signaling downstream of RAS mutants | 2 | MAP2K1, RAF1 |
| Signaling by RAF1 mutants | 2 | MAP2K1, RAF1 |
| MAPK3 (ERK1) activation | 1 | MAP2K1 |
| RAF-independent MAPK1/3 activation | 1 | MAP2K1 |
| Developmental Biology | 1 | MAP2K1 |
| Cytokine Signaling in Immune system | 1 | MAP2K1 |
| Signal Transduction | 1 | MAP2K1 |
| Disease | 1 | MAP2K1 |
| Toll Like Receptor 4 (TLR4) Cascade | 1 | MAP2K1 |
| MyD88:MAL(TIRAP) cascade initiated on plasma membrane | 1 | MAP2K1 |
| MyD88-independent TLR4 cascade | 1 | MAP2K1 |
| Signaling by NTRKs | 1 | MAP2K1 |
| Toll Like Receptor 9 (TLR9) Cascade | 1 | MAP2K1 |
| Toll Like Receptor 10 (TLR10) Cascade | 1 | MAP2K1 |
| Toll Like Receptor 3 (TLR3) Cascade | 1 | MAP2K1 |
| Toll Like Receptor 5 (TLR5) Cascade | 1 | MAP2K1 |
| Toll Like Receptor TLR1:TLR2 Cascade | 1 | MAP2K1 |
| Toll Like Receptor 7/8 (TLR7/8) Cascade | 1 | MAP2K1 |
| Toll Like Receptor TLR6:TLR2 Cascade | 1 | MAP2K1 |
| Innate Immune System | 1 | MAP2K1 |
| Immune System | 1 | MAP2K1 |
| Toll-like Receptor Cascades | 1 | MAP2K1 |
| Prolonged ERK activation events | 1 | MAP2K1 |
| Frs2-mediated activation | 1 | MAP2K1 |
| Toll Like Receptor 2 (TLR2) Cascade | 1 | MAP2K1 |
| Signaling by NTRK1 (TRKA) | 1 | MAP2K1 |
| Signalling to ERKs | 1 | MAP2K1 |
| Stimuli-sensing channels | 1 | RAF1 |
| L1CAM interactions | 1 | MAP2K1 |
| Rap1 signalling | 1 | RAF1 |
| Axon guidance | 1 | MAP2K1 |
| GP1b-IX-V activation signalling | 1 | RAF1 |
| Signal transduction by L1 | 1 | MAP2K1 |
| Interleukin-1 family signaling | 1 | MAP2K1 |
| Interleukin-17 signaling | 1 | MAP2K1 |
| Signaling by Interleukins | 1 | MAP2K1 |
| MAP kinase activation | 1 | MAP2K1 |
| Uptake and function of anthrax toxins | 1 | MAP2K1 |
| Uptake and actions of bacterial toxins | 1 | MAP2K1 |
| CD209 (DC-SIGN) signaling | 1 | RAF1 |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | MAP2K1 |
| Infectious disease | 1 | MAP2K1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| MAPK cascade | 2 |
| signal transduction | 2 |
| negative regulation of cell population proliferation | 2 |
| Schwann cell development | 2 |
| thyroid gland development | 2 |
| ERBB2-ERBB3 signaling pathway | 2 |
| myelination | 2 |
| type B pancreatic cell proliferation | 2 |
| insulin-like growth factor receptor signaling pathway | 2 |
| thymus development | 2 |
| face development | 2 |
| protein phosphorylation | 2 |
| positive regulation of MAPK cascade | 2 |
| regulation of vascular associated smooth muscle contraction | 1 |
| chemotaxis | 1 |
Indications & clinical
Indications
12 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| ovarian cancer | 3 | MONDO:0008170 | MONDO:0008170 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| female reproductive system neoplasm | 2 | MONDO:0021148 | MONDO:0021148 |
| colorectal adenocarcinoma | 2 | MONDO:0005008 | EFO:0000365 |
| thyroid gland carcinoma | 2 | MONDO:0015075 | EFO:0002892 |
| uveal melanoma | 2 | MONDO:0006486 | EFO:1000616 |
| colorectal neoplasm | 2 | MONDO:0005335 | MONDO:0005575 |
| endometrioid adenocarcinoma | 1 | MONDO:0005026 | EFO:0000466 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
Clinical trials
Total trials: 25.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 11 |
| PHASE1/PHASE2 | 7 |
| PHASE1 | 5 |
| PHASE3 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06072781 | PHASE3 | RECRUITING | A Study of Avutometinib (VS-6766) + Defactinib (VS-6063) in Recurrent Low-Grade Serous Ovarian Cancer |
| NCT04625270 | PHASE2 | ACTIVE_NOT_RECRUITING | A Study of Avutometinib (VS-6766) v. Avutometinib (VS-6766) + Defactinib in Recurrent Low-Grade Serous Ovarian Cancer With and Without a KRAS Mutation |
| NCT05074810 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Phase 1/2 Study of Avutometinib (VS-6766) + Sotorasib With or Without Defactinib in KRAS G12C NSCLC Patients |
| NCT05375994 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Study of Avutometinib (VS-6766) + Adagrasib in KRAS G12C NSCLC Patients |
| NCT05512208 | PHASE2 | RECRUITING | A Phase 2 Study of Avutometinib (VS-6766) Plus Defactinib |
| NCT05608252 | PHASE1/PHASE2 | RECRUITING | VS-6766+Abema+Fulv in Met HR+/HER- BC |
| NCT05669482 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Study of Avutometinib (VS-6766) +Defactinib With Gemcitabine and Nab-paclitaxel in Patients With Pancreatic Cancer |
| NCT05787561 | PHASE2 | RECRUITING | A Study of Avutometinib (VS-6766) and Defactinib in People With Mesonephric Gynecologic Cancer |
| NCT06007924 | PHASE2 | RECRUITING | A Study of Avutometinib and Defactinib in People With Thyroid Cancer |
| NCT06194929 | PHASE1/PHASE2 | RECRUITING | Defactinib and Avutometinib, With or Without Encorafenib, for the Treatment of Patients With Brain Metastases From Cutaneous Melanoma |
| NCT06369259 | PHASE2 | RECRUITING | Open-label Phase 2 Study of Avutometinib (RAF/MEK Clamp) in Combination With Defactinib (FAK Inhibitor) and Cetuximab in Patients With Unresectable, Anti-EGFR-Refractory Advanced Colorectal Cancer |
| NCT06394804 | PHASE2 | RECRUITING | A Study of Avutometinib, Defactinib, and Letrozole in People With Low-Grade Serous Ovarian Cancer |
| NCT06487221 | PHASE2 | RECRUITING | Avutometinib and Defactinib in Diffuse Gastric Cancer |
| NCT06495125 | PHASE2 | RECRUITING | Defactinib, Avutometinib and Nivolumab for the Treatment of Anti-PD1 Refractory LKB1-Mutant Advanced Non-Small Cell Lung Cancer |
| NCT06630260 | PHASE1/PHASE2 | RECRUITING | 5G-RUBY: Avutometinib and Defactinib in Malignant Brain Tumours |
| NCT06682572 | PHASE2 | ACTIVE_NOT_RECRUITING | A Study of Avutometinib + Defactinib in Recurrent Low-Grade Serous Ovarian Cancer in Japanese Patients |
| NCT07126158 | PHASE2 | RECRUITING | Stereotactic Body Radiotherapy Plus FAK and RAF/MEK Inhibition in Advanced Pancreatic Adenocarcinoma |
| NCT04620330 | PHASE2 | COMPLETED | A Study of Avutometinib (VS-6766) + Defactinib in Recurrent KRAS G12V, Other KRAS and BRAF Non-Small Cell Lung Cancer |
| NCT05200442 | PHASE1/PHASE2 | SUSPENDED | A Study of VS-6766 and Cetuximab in Patients With Advanced Colorectal Cancer |
| NCT03875820 | PHASE1 | ACTIVE_NOT_RECRUITING | Phase I Trial of Defactinib and VS-6766. |
| NCT06104488 | PHASE1 | RECRUITING | A Study of Avutometinib for People With Solid Tumor Cancers |
| NCT07318324 | PHASE1 | NOT_YET_RECRUITING | Phase Ib Study of Avutometinib, Defactinib, and Everolimus in RAS Pathway Mutant Endometrial Cancer |
| NCT02407509 | PHASE1 | COMPLETED | Phase I Trial of VS-6766 Alone and in Combination With Everolimus |
| NCT05187169 | PHASE1 | COMPLETED | Food Effect of VS-6766 in Healthy Adult Subjects |
| NCT05798507 | EARLY_PHASE1 | ACTIVE_NOT_RECRUITING | Identification of Treatment Concentrations of Defactinib or VS-6766 for the Treatment of Patients With Glioblastoma |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
64 molecules share ≥1 primary target. Top 64 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Pazopanib | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, RAF1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, RAF1 |
| SELUMETINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, RAF1 |
| DASATINIB | ChEMBL | Phase 4 (approved) | MAP2K1, RAF1 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | MAP2K1, RAF1 |
| VEMURAFENIB | ChEMBL | Phase 4 (approved) | MAP2K1, RAF1 |
| CEP-32496 | ChEMBL | Phase 2 | MAP2K1, RAF1 |
| CI-1040 | ChEMBL | Phase 2 | MAP2K1, RAF1 |
| FORETINIB | ChEMBL | Phase 2 | MAP2K1, RAF1 |
| R-406 | ChEMBL | Phase 2 | MAP2K1, RAF1 |
| TOLONIUM CHLORIDE | ChEMBL | Phase 2 | MAP2K1, RAF1 |
| Afatinib | PubChem | Approved | MAP2K1, RAF1 |
| Crizotinib | PubChem | Approved | MAP2K1, RAF1 |
| Gefitinib | PubChem | Approved | MAP2K1, RAF1 |
| Idelalisib | PubChem | Approved | MAP2K1, RAF1 |
| BINIMETINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1 |
| TRAMETINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1 |
| AXITINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | RAF1 |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | RAF1 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| IMATINIB | ChEMBL | Phase 4 (approved) | RAF1 |
| NERATINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | RAF1 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| TOVORAFENIB | ChEMBL | Phase 4 (approved) | RAF1 |
| VANDETANIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| CANERTINIB | ChEMBL | Phase 3 | MAP2K1 |
| DOVITINIB | ChEMBL | Phase 3 | MAP2K1 |
| LESTAURTINIB | ChEMBL | Phase 3 | MAP2K1 |
| LINSITINIB | ChEMBL | Phase 3 | MAP2K1 |
| MOTESANIB | ChEMBL | Phase 3 | RAF1 |
| NAPORAFENIB | ChEMBL | Phase 3 | RAF1 |
| ORANTINIB | ChEMBL | Phase 3 | MAP2K1 |
| PLINABULIN | ChEMBL | Phase 3 | RAF1 |
| SARACATINIB | ChEMBL | Phase 3 | MAP2K1 |
| BELVARAFENIB | ChEMBL | Phase 2 | RAF1 |
| BRIMARAFENIB | ChEMBL | Phase 2 | RAF1 |
| CENISERTIB | ChEMBL | Phase 2 | MAP2K1 |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | MAP2K1 |
| DORAMAPIMOD | ChEMBL | Phase 2 | RAF1 |
| E-6201 | ChEMBL | Phase 2 | MAP2K1 |
| EXARAFENIB | ChEMBL | Phase 2 | RAF1 |
| ILORASERTIB | ChEMBL | Phase 2 | MAP2K1 |
| MIRDAMETINIB | ChEMBL | Phase 2 | MAP2K1 |
| PELITINIB | ChEMBL | Phase 2 | MAP2K1 |
| PIMASERTIB | ChEMBL | Phase 2 | MAP2K1 |
| RAF-265 | ChEMBL | Phase 2 | RAF1 |
| REBASTINIB | ChEMBL | Phase 2 | RAF1 |
| REFAMETINIB | ChEMBL | Phase 2 | MAP2K1 |
| RISOVALISIB | ChEMBL | Phase 2 | RAF1 |
| SOTRASTAURIN | ChEMBL | Phase 2 | MAP2K1 |
| SU-014813 | ChEMBL | Phase 2 | MAP2K1 |
| TAK-733 | ChEMBL | Phase 2 | MAP2K1 |
| TOZASERTIB | ChEMBL | Phase 2 | MAP2K1 |
| ZAPNOMETINIB | ChEMBL | Phase 2 | MAP2K1 |
| dacomitinib | PubChem | Approved | MAP2K1 |
| Fostamatinib | PubChem | Approved | MAP2K1 |
Related Atlas pages
- Genes: MAP2K1, RAF1
- In clinical trials for: ovarian cancer, non-small cell lung carcinoma, female reproductive system neoplasm, colorectal adenocarcinoma, thyroid gland carcinoma, uveal melanoma, colorectal neoplasm
- Drugs: Pazopanib, Regorafenib, Selumetinib, Dasatinib, Sorafenib, Vemurafenib, Afatinib, Crizotinib, Gefitinib, Idelalisib, Binimetinib, Trametinib, Axitinib, Bosutinib, Cobimetinib, Dabrafenib, Erlotinib, Fedratinib, Gilteritinib, Imatinib, Neratinib, Nilotinib, Nintedanib, Ruxolitinib, Sunitinib, Tofacitinib, Tovorafenib, Vandetanib, Canertinib, Dovitinib, Lestaurtinib, Linsitinib, Motesanib, Naporafenib, Orantinib, Plinabulin, Saracatinib, dacomitinib, Fostamatinib