Azithromycin
drugOn this page
Also known as Anhydrous azithromycinAruzilinaAzasiteAziromycinAzithrocinAzithromycin (as dihydrate)Azithromycin anhydrousAzithromycin dihydrateAzithromycin hydrateunspecifiedunspecified formAzithromycineAzitromicinaAziwinAzyterClamelleCP 62993CP-62,993CP-62993
Summary
Azithromycin (CHEMBL529) is an approved small-molecule antibacterial drug (ATC J01FA10) targeting MLNR and TAS2R4; indicated across 87 conditions including urethritis and chronic obstructive pulmonary disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: J01FA10 (+1 more)
- Targets: 2 (MLNR, TAS2R4)
- Indications: 87 conditions
- Clinical trials: 444
- Chemistry: 749 Da · C38H72N2O12
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL529 |
| Name | Azithromycin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 447043 |
| ChEBI | CHEBI:2955 |
| ATC | J01FA10, S01AA26 |
| Molecular formula | C38H72N2O12 |
| Molecular weight | 749 |
| InChIKey | MQTOSJVFKKJCRP-BICOPXKESA-N |
SMILES: CC[C@@H]1[C@@]([C@@H]([C@H](N(C[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)C)O)(C)O
IUPAC name: (2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one
ChEBI definition: A macrolide antibiotic useful for the treatment of bacterial infections.
Pharmacological roles (ChEBI): antibacterial drug.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Anhydrous azithromycin, Aruzilina, Azasite, Aziromycin, Azithrocin, Azithromycin, Azithromycin (as dihydrate), Azithromycin anhydrous, Azithromycin dihydrate, Azithromycin hydrate, unspecified, unspecified form
Parent form; salt/anhydrous children: CHEMBL1200502
Patent coverage: 24,359 distinct patent families (75,139 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MLNR | motilin receptor | Full agonist | 5.5 | 0.1% | O43193 |
| TAS2R4 | TAS2R4 | Agonist | 4.13 | 0% | Q9NYW5 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Prelamin-A/C, Thyrotropin receptor, Bacterial 70S ribosome, Cytochrome P450 3A4.
Bioactivity
ChEMBL activities: 4 potent at pChembl ≥ 5 of 6 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P02358 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_2702686 |
| LMNA | 6.2 | Potency | 631 | nM | CHEMBL_ACT_3644797 |
| TSHR | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_3924142 |
| TSHR | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_4698790 |
Target pathways
Aggregated over 2 target gene(s): MLNR, TAS2R4.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | MLNR, TAS2R4 |
| Signaling by GPCR | 2 | MLNR, TAS2R4 |
| GPCR downstream signalling | 2 | MLNR, TAS2R4 |
| GPCR ligand binding | 2 | MLNR, TAS2R4 |
| Class A/1 (Rhodopsin-like receptors) | 1 | MLNR |
| Peptide ligand-binding receptors | 1 | MLNR |
| G alpha (q) signalling events | 1 | MLNR |
| G alpha (i) signalling events | 1 | TAS2R4 |
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 1 | TAS2R4 |
| Sensory Perception | 1 | TAS2R4 |
| Sensory perception of taste | 1 | TAS2R4 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 1 | TAS2R4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 2 |
| signal transduction | 2 |
| detection of chemical stimulus involved in sensory perception of bitter taste | 1 |
| respiratory gaseous exchange by respiratory system | 1 |
| sensory perception of taste | 1 |
Indications & clinical
Indications
87 indications (18 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| urethritis | 4 | MONDO:0005297 | EFO:0003878 |
| chronic obstructive pulmonary disease | 4 | MONDO:0005002 | EFO:0000341 |
| otitis media | 4 | MONDO:0005441 | EFO:0004992 |
| pneumonia | 4 | MONDO:0005249 | EFO:0003106 |
| chronic bronchitis | 4 | MONDO:0005607 | EFO:0006505 |
| sinusitis | 4 | MONDO:0005961 | EFO:0007486 |
| bacterial conjunctivitis | 4 | MONDO:0006668 | EFO:1000829 |
| HIV infectious disease | 4 | MONDO:0005109 | EFO:0000764 |
| pelvic inflammatory disease | 4 | MONDO:0000922 | EFO:1001388 |
| bacterial infectious disease | 4 | MONDO:0005113 | EFO:0000771 |
| tonsillitis | 4 | MONDO:0001039 | HP:0011110 |
| eye infectious disorder | 4 | MONDO:0043885 | EFO:1001888 |
| pharyngitis | 4 | MONDO:0002258 | MONDO:0002258 |
| cervicitis | 4 | MONDO:0002345 | HP:0030160 |
| cystic fibrosis | 4 | MONDO:0009061 | MONDO:0009061 |
| acne | 3 | MONDO:0011438 | EFO:0003894 |
| bronchiectasis | 3 | MONDO:0004822 | HP:0002110 |
| Plasmodium falciparum malaria | 3 | MONDO:0005920 | EFO:0007444 |
| bronchiolitis obliterans syndrome | 3 | MONDO:0015265 | EFO:0007183 |
| gonorrhea | 3 | MONDO:0004277 | DOID:7551 |
| malaria | 3 | MONDO:0005136 | EFO:0001068 |
| chlamydia trachomatis infectious disease | 3 | MONDO:0005701 | EFO:0007205 |
| maxillary sinusitis | 3 | MONDO:0005842 | EFO:0007361 |
| reactive arthritis | 3 | MONDO:0017376 | EFO:0007460 |
| suppurative otitis media | 3 | MONDO:0005975 | EFO:0007503 |
| syphilis | 3 | MONDO:0005976 | EFO:0007504 |
| yaws | 3 | MONDO:0006019 | EFO:0007548 |
| diarrheal disease | 3 | MONDO:0001673 | HP:0002014 |
| blepharitis | 3 | MONDO:0004785 | EFO:0009536 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| lung disorder | 3 | MONDO:0005275 | EFO:0003818 |
| Mycobacterium avium complex disease | 3 | MONDO:0005866 | EFO:0007386 |
| viral pneumonia | 3 | MONDO:0006012 | EFO:0007541 |
| respiratory failure | 3 | MONDO:0021113 | EFO:0009686 |
| bronchial disorder | 3 | MONDO:0001358 | EFO:1002018 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| inclusion conjunctivitis | 3 | MONDO:0005808 | EFO:0007324 |
| mycobacterial infectious disease | 3 | MONDO:0020590 | EFO:0009429 |
| fungal infectious disease | 3 | MONDO:0002041 | MONDO:0002041 |
| spotted fever | 3 | MONDO:0001195 | EFO:1002047 |
| asthma | 3 | MONDO:0004979 | MONDO:0004979 |
| bronchopulmonary dysplasia | 3 | MONDO:0019091 | MONDO:0019091 |
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| chronic periodontitis | 3 | MONDO:0005593 | EFO:0006343 |
| bronchitis | 3 | MONDO:0003781 | EFO:0009661 |
| eye disorder | 2 | MONDO:0005328 | EFO:0003966 |
| obsessive-compulsive disorder | 2 | MONDO:0008114 | EFO:0004242 |
| periodontitis | 2 | MONDO:0005076 | EFO:0000649 |
| gastroparesis | 2 | MONDO:0006769 | EFO:1000948 |
| respiratory syncytial virus infectious disease | 2 | MONDO:0001577 | EFO:1001413 |
| onchocerciasis | 2 | MONDO:0017137 | EFO:0007402 |
| Crohn disease | 2 | MONDO:0005011 | EFO:0000384 |
| pertussis | 2 | MONDO:0005077 | EFO:0000650 |
| shigellosis | 2 | MONDO:0019345 | EFO:0005585 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| tuberculosis | 2 | MONDO:0018076 | MONDO:0018076 |
| sarcoidosis | 2 | MONDO:0019338 | MONDO:0019338 |
| neoplasm | 2 | MONDO:0005070 | MONDO:0004992 |
| viral infectious disease | 2 | MONDO:0005108 | EFO:0000763 |
| infectious disease | 2 | MONDO:0005550 | EFO:0005741 |
| immune system disorder | 1 | MONDO:0005046 | EFO:0000540 |
| Ebola hemorrhagic fever | 1 | MONDO:0005737 | EFO:0007243 |
| cerebral toxoplasmosis | 1 | MONDO:0005697 | EFO:0007200 |
| acute respiratory distress syndrome | 1 | MONDO:0006502 | EFO:1000637 |
| sickle cell disease | 1 | MONDO:0011382 | MONDO:0011382 |
| osteomyelitis | 0 | MONDO:0005246 | EFO:0003102 |
| obesity disorder | 0 | MONDO:0011122 | EFO:0001073 |
18 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 444.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 114 |
| PHASE3 | 105 |
| Not specified | 84 |
| PHASE2 | 71 |
| PHASE1 | 37 |
| PHASE2/PHASE3 | 18 |
| PHASE1/PHASE2 | 9 |
| EARLY_PHASE1 | 6 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03083197 | PHASE4 | ACTIVE_NOT_RECRUITING | Scrub Typhus Antibiotic Resistance Trial |
| NCT03335072 | PHASE4 | ACTIVE_NOT_RECRUITING | Kebele Elimination of Trachoma for Ocular Health |
| NCT04716712 | PHASE4 | ACTIVE_NOT_RECRUITING | Infant Mortality Reduction by the Mass Administration of Azithromycin |
| NCT04921943 | PHASE4 | RECRUITING | Hypertonic Saline for MAC |
| NCT05345457 | PHASE4 | RECRUITING | Outpatient Antibiotics Following Previable Rupture of Membranes (pPPROM) Between 18 0/7 and 22 6/7 Weeks Gestational Age |
| NCT05677282 | PHASE4 | RECRUITING | Single Dose Antibiotic Treatment of Acute Watery Diarrhea, Rifaximin Versus Azithromycin, With Loperamide Adjunct |
| NCT05772013 | PHASE4 | RECRUITING | Optimising Azithromycin Prevention Treatment in COPD to Reduce Exacerbations |
| NCT06010719 | PHASE4 | RECRUITING | Azithromycin as Adjunctive Treatment for Uncomplicated Severe Acute Malnutrition |
| NCT06349122 | PHASE4 | NOT_YET_RECRUITING | Screen-and-treat Strategy for Vaginal Flora Abnormalities in Pregnant Women at High Risk of Preterm Birth |
| NCT06396078 | PHASE4 | RECRUITING | Improvement of PPROM Management With Prophylactic Antimicrobial Therapy (iPROMPT) |
| NCT06958146 | PHASE4 | NOT_YET_RECRUITING | Azithromycin for Preventing Maternal and Neonatal Infections During Labor. |
| NCT07052942 | PHASE4 | RECRUITING | Individualizing Treatment for Asthma in Primary Care (Full Study) |
| NCT07164131 | PHASE4 | RECRUITING | Azithromycin Versus Doxycycline in Hospitalized Adult Patients With Community Acquired Pneumonia Treated With Beta-lactams |
| NCT07213765 | PHASE4 | RECRUITING | Short-term Antibiotic Therapy in Mycobacterium Avium Complex Pulmonary Disease |
| NCT07306234 | PHASE4 | NOT_YET_RECRUITING | Doxycycline vs. Macrolide for MRMP (DOMINO) |
| NCT07314281 | PHASE4 | RECRUITING | Meropenem vs Azithromycin Efficacy in Case XDR Enteric Fever |
| NCT07608328 | PHASE4 | NOT_YET_RECRUITING | Azithromycin to Modify Bronchiectasis Exacerbation Risk |
| NCT07608562 | PHASE4 | NOT_YET_RECRUITING | Azithromycin for Cerclage Prophylaxis |
| NCT00035347 | PHASE4 | COMPLETED | Intravenous Azithromycin Plus Intravenous Ceftriaxone Followed by Oral Azithromycin With Intravenous Levofloxacin Followed by Oral Levofloxacin for the Treatment of Moderate to Severely Ill Hospitalized Patients With Community Acquired Pneumonia |
| NCT00132860 | PHASE4 | UNKNOWN | Prophylactic Antibiotic Treatment of Patients With Chronic Obstructive Lung Disease (COLD) |
| NCT00132951 | PHASE4 | TERMINATED | KEYS: Study Comparing Clinical Health Outcomes of Telithromycin Versus Azithromycin in Outpatients With Community-acquired Lower Respiratory Tract Infections |
| NCT00137007 | PHASE4 | COMPLETED | Zithromax EV in Community-Acquired Pneumonia (CAP) |
| NCT00237445 | PHASE4 | TERMINATED | Study Comparing the Clinical Efficacy and Health Outcomes of Outpatients With Mild to Moderate Community-Acquired Pneumonia (CAP) Treated With Either Telithromycin Once Daily for 7 Days, or Azithromycin Once Daily for 5 Days |
| NCT00245440 | PHASE4 | TERMINATED | Study to Measure the Impact of Antibiotics on Bacterial Flora in Adults With Acute Sinusitis |
| NCT00245453 | PHASE4 | WITHDRAWN | Outpatient Registry Trial of Respiratory Tract Infections in Adults |
| NCT00286026 | PHASE4 | WITHDRAWN | Azithromycin in Control of Trachoma II |
| NCT00315601 | PHASE4 | TERMINATED | Intrapulmonary Pharmacokinetics of Antibiotics |
| NCT00324818 | PHASE4 | COMPLETED | Treatment of Bacterial Vaginosis |
| NCT00347776 | PHASE4 | COMPLETED | Study of Azithromycin to Prevent Recurrent Trichiasis Following Surgery in Ethiopia |
| NCT00359970 | PHASE4 | COMPLETED | Azithromycin, With or Without Loperamide, to Treat Travelers’ Diarrhea |
| NCT00368342 | PHASE4 | COMPLETED | Chronic Bronchiolitis or Resistant Asthma? |
| NCT00471809 | PHASE4 | TERMINATED | Childhood Asthma Research and Education (CARE) Network Trial - Montelukast or Azithromycin for Reduction of Inhaled Corticosteroids in Childhood Asthma (MARS) |
| NCT00564447 | PHASE4 | COMPLETED | Study of AzaSite (Azithromycin) Versus Vigamox in the Conjunctiva of Healthy Volunteers |
| NCT00598962 | PHASE4 | COMPLETED | Use of Azithromycin and Rifabutin Administered 3 Times Weekly for the Treatment of M. Avium Complex (MAC) Lung Disease |
| NCT00599079 | PHASE4 | COMPLETED | Azithromycin in the Treatment of M. Avium Complex Lung Disease |
| NCT00618449 | PHASE4 | COMPLETED | Impact of Two Alternative Dosing Strategies for Trachoma Control in Niger |
| NCT00643539 | PHASE4 | COMPLETED | Multicenter, Open, Randomized Comparative Trial To Compare The Efficacy Of Azithromycin Versus Amoxicillin In Children With Strep Throat |
| NCT00644774 | PHASE4 | COMPLETED | A Pediatric Taste Test Study of Omnicef Versus Zithromax Antibiotic Suspension Medications |
| NCT00645112 | PHASE4 | COMPLETED | A Comparison of Safety and Efficacy of Cefdinir Oral Suspension Versus Azithromycin in Pediatric Subjects With Acute Otitis Media |
| NCT00760838 | PHASE4 | COMPLETED | AZISAST Study: AZIthromycin in Severe ASThma Study |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
323 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMIODARONE | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| CANDESARTAN CILEXETIL | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| CARVEDILOL | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| CINACALCET | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| CLEMASTINE | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| CLOBETASOL PROPIONATE | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| ERYTHROMYCIN | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| HYDROXYPROGESTERONE CAPROATE | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| PONATINIB | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| TELOTRISTAT ETHYL | ChEMBL + PubChem | Phase 4 (approved) | MLNR |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | MLNR |
| AMPRENAVIR | ChEMBL | Phase 4 (approved) | MLNR |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | MLNR |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | MLNR |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | MLNR |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | MLNR |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | MLNR |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | MLNR |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | MLNR |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | MLNR |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | MLNR |
| DULOXETINE | ChEMBL | Phase 4 (approved) | MLNR |
| EBASTINE | ChEMBL | Phase 4 (approved) | MLNR |
| FENTICONAZOLE | ChEMBL | Phase 4 (approved) | MLNR |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | MLNR |
| FLUTRIMAZOLE | ChEMBL | Phase 4 (approved) | MLNR |
| GLAFENINE | ChEMBL | Phase 4 (approved) | MLNR |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | MLNR |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | TAS2R4 |
| ISRADIPINE | ChEMBL | Phase 4 (approved) | MLNR |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | MLNR |
| NAFARELIN | ChEMBL | Phase 4 (approved) | MLNR |
| NEBIVOLOL | ChEMBL | Phase 4 (approved) | MLNR |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | MLNR |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | MLNR |
| NOSCAPINE | ChEMBL | Phase 4 (approved) | MLNR |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | MLNR |
| PERHEXILINE | ChEMBL | Phase 4 (approved) | MLNR |
| PROPIVERINE | ChEMBL | Phase 4 (approved) | MLNR |
| PYRVINIUM | ChEMBL | Phase 4 (approved) | MLNR |
| REBOXETINE | ChEMBL | Phase 4 (approved) | MLNR |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | MLNR |
| RIMONABANT | ChEMBL | Phase 4 (approved) | MLNR |
| RITONAVIR | ChEMBL | Phase 4 (approved) | MLNR |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | MLNR |
| SERTRALINE | ChEMBL | Phase 4 (approved) | MLNR |
| SUNITINIB | ChEMBL | Phase 4 (approved) | MLNR |
| TACROLIMUS | ChEMBL | Phase 4 (approved) | MLNR |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | MLNR |
| TRIFLUOPERAZINE | ChEMBL | Phase 4 (approved) | MLNR |
| VILANTEROL | ChEMBL | Phase 4 (approved) | MLNR |
| VINDESINE | ChEMBL | Phase 4 (approved) | MLNR |
| AZELNIDIPINE | ChEMBL | Phase 3 | MLNR |
| BENIDIPINE | ChEMBL | Phase 3 | MLNR |
Related Atlas pages
- Genes: MLNR, TAS2R4
- Diseases: urethritis, chronic obstructive pulmonary disease, otitis media, pneumonia, chronic bronchitis, sinusitis, bacterial conjunctivitis, HIV infectious disease, pelvic inflammatory disease, bacterial infectious disease, tonsillitis, eye infectious disorder, pharyngitis, cervicitis, cystic fibrosis, acne, bronchiectasis, Plasmodium falciparum malaria, bronchiolitis obliterans syndrome, gonorrhea, malaria, chlamydia trachomatis infectious disease, maxillary sinusitis, reactive arthritis, suppurative otitis media, syphilis, yaws, diarrheal disease, blepharitis, myocardial infarction, lung disorder, Mycobacterium avium complex disease, viral pneumonia, respiratory failure, bronchial disorder, severe acute respiratory syndrome, coronary artery disorder, inclusion conjunctivitis, mycobacterial infectious disease, fungal infectious disease, spotted fever, asthma, bronchopulmonary dysplasia, cardiovascular disorder, heart disorder, chronic periodontitis, bronchitis
- Drugs: Amiodarone, Atazanavir, Candesartan Cilexetil, Carvedilol, Cinacalcet, Clemastine, Clobetasol Propionate, Crizotinib, Erythromycin, Fedratinib, Hydroxyprogesterone Caproate, Pimozide, Ponatinib, Sorafenib, Tegaserod, Telotristat Ethyl, Acetophenazine, Amprenavir, Aripiprazole, Astemizole, Bazedoxifene, Benperidol, Bepridil, Cannabidiol, Chlorhexidine, Chlorprothixene, Cisapride, Duloxetine, Ebastine, Fenticonazole, Fluspirilene, Flutrimazole, Glafenine, Indocyanine Green Acid Form, Isoproterenol, Isradipine, Lasofoxifene, Nafarelin, Nebivolol, Nimesulide, Nitazoxanide, Noscapine, Osimertinib, Perhexiline, Propiverine, Pyrvinium, Reboxetine, Rifaximin, Rimonabant, Ritonavir, Sertindole, Sertraline, Sunitinib, Tacrolimus, Tipranavir, Trifluoperazine, Vilanterol, Vindesine, Azelnidipine, Benidipine