Betaxolol
drugOn this page
Also known as ALO-140102 FREE BASEBetopticBetoptic suspKerledexSL-7521210 FREE BASESID144203642SID90341580SID170465448BETAXALOL
Summary
Betaxolol (CHEMBL423) is an approved small-molecule β-adrenergic antagonist (ATC S01ED52) targeting ADRB1 and ADRB2; indicated across 4 conditions including cardiovascular disorder and glaucoma.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: S01ED52 (+2 more)
- Targets: 2 (ADRB1, ADRB2)
- Indications: 4 conditions
- Clinical trials: 2
- Chemistry: 307.4 Da · C18H29NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL423 |
| Name | Betaxolol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2369 |
| ChEBI | CHEBI:3082 |
| ATC | S01ED52, C07AB05, S01ED02 |
| Molecular formula | C18H29NO3 |
| Molecular weight | 307.4 |
| InChIKey | NWIUTZDMDHAVTP-UHFFFAOYSA-N |
SMILES: CC(C)NCC(COC1=CC=C(C=C1)CCOCC2CC2)O
IUPAC name: 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol
ChEBI definition: A propanolamine that is 3-aminopropane-1,2-diol in which the hydrogen of the primary hydoxy is substituted by a 4-[2-(cyclopropylmethoxy)ethyl]phenyl group and one of the hydrogens attached to the amino group is substituted by isopropyl. It is a selective β1-receptor blocker and is used in the treatment of glaucoma as well as hypertension, arrhythmias, and coronary heart disease. It is also used to reduce non-fatal cardiac events in patients with heart failure.
Pharmacological roles (ChEBI): β-adrenergic antagonist, antihypertensive agent, sympatholytic agent.
Also known as: ALO-140102 FREE BASE, Betaxolol, Betoptic, Betoptic susp, Kerledex, SL-7521210 FREE BASE, betaxolol, SID144203642, SID90341580, SID170465448, BETAXOLOL, BETAXALOL
Parent form; salt/anhydrous children: CHEMBL1691
Patent coverage: 5,861 distinct patent families (23,812 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRB1 | β1-adrenoceptor | Antagonist | 9.12 | 0% | P08588 |
| ADRB2 | β2-adrenoceptor | Antagonist | 8.2 | 0.4% | P07550 |
Broader ChEMBL bioactivity targets: 5 (assay-derived). Sample: Beta-1 adrenergic receptor, Cytochrome P450 2D6, Beta-1 adrenergic receptor, Beta-2 adrenergic receptor, Beta-2 adrenergic receptor.
Bioactivity
ChEMBL activities: 7 potent at pChembl ≥ 5 of 8 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRB1 | 8.8 | Kd | 1.58 | nM | CHEMBL_ACT_15644291 |
| P18090 | 8.53 | Kd | 2.95 | nM | CHEMBL_ACT_16742562 |
| ADRB1 | 7.43 | IC50 | 37.1 | nM | CHEMBL_ACT_61754 |
| Q8K4Z4 | 6.98 | Kd | 104.7 | nM | CHEMBL_ACT_1055288 |
| Q8K4Z4 | 6.98 | Kd | 104.7 | nM | CHEMBL_ACT_518400 |
| P18090 | 6.9 | Kd | 125.9 | nM | CHEMBL_ACT_995654 |
| Q28044 | 6.18 | IC50 | 657 | nM | CHEMBL_ACT_61755 |
Target pathways
Aggregated over 2 target gene(s): ADRB1, ADRB2.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | ADRB1, ADRB2 |
| Signaling by GPCR | 2 | ADRB1, ADRB2 |
| Class A/1 (Rhodopsin-like receptors) | 2 | ADRB1, ADRB2 |
| Amine ligand-binding receptors | 2 | ADRB1, ADRB2 |
| GPCR downstream signalling | 2 | ADRB1, ADRB2 |
| Adrenoceptors | 2 | ADRB1, ADRB2 |
| G alpha (s) signalling events | 2 | ADRB1, ADRB2 |
| GPCR ligand binding | 2 | ADRB1, ADRB2 |
| Membrane Trafficking | 1 | ADRB2 |
| Metabolism of proteins | 1 | ADRB2 |
| Vesicle-mediated transport | 1 | ADRB2 |
| Deubiquitination | 1 | ADRB2 |
| Ub-specific processing proteases | 1 | ADRB2 |
| Post-translational protein modification | 1 | ADRB2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | ADRB2 |
| Clathrin-mediated endocytosis | 1 | ADRB2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| diet induced thermogenesis | 2 |
| norepinephrine-epinephrine-mediated vasodilation involved in regulation of systemic arterial blood pressure | 2 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 2 |
| response to cold | 2 |
| positive regulation of cardiac muscle cell apoptotic process | 2 |
| heat generation | 2 |
| negative regulation of multicellular organism growth | 2 |
| positive regulation of MAPK cascade | 2 |
| brown fat cell differentiation | 2 |
| adenylate cyclase-activating adrenergic receptor signaling pathway | 2 |
| positive regulation of cold-induced thermogenesis | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| positive regulation of heart rate by epinephrine-norepinephrine | 1 |
| positive regulation of the force of heart contraction by epinephrine-norepinephrine | 1 |
Indications & clinical
Indications
4 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| glaucoma | 4 | MONDO:0005041 | MONDO:0005041 |
| open-angle glaucoma | 3 | MONDO:0005338 | EFO:0004190 |
| ocular hypertension | 3 | MONDO:0006875 | EFO:1001069 |
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00000132 | PHASE3 | UNKNOWN | Early Manifest Glaucoma Trial (EMGT) |
| NCT01660620 | PHASE1 | COMPLETED | Topical Betaxolol for the Prevention of Retinopathy of Prematurity |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (2) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for acebutolol, betaxolol, bisoprolol, ca | CPIC | CYP2D6 | ||
| Annotation of CPIC Guideline for acebutolol, atenolol, betaxolol, biso | CPIC | ADRA2C;ADRB1;GRK4;GRK5 |
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
238 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Desloratadine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| Pramipexole | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| ACEBUTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ALBUTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ATENOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BISOPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CARTEOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CELIPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ESMOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| FENOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| FORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| INDACATEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| LABETALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| LEVOBUNOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| METOPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NADOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NEBIVOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NOREPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| OXPRENOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PINDOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PRACTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PRENYLAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RANOLAZINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RIFAMPIN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RITODRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| SOTALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
Related Atlas pages
- Genes: ADRB1, ADRB2
- Diseases: cardiovascular disorder, glaucoma, open-angle glaucoma, ocular hypertension
- Drugs: Desloratadine, Dihydroergotamine, Olodaterol, Pramipexole, Tamsulosin, Acebutolol, Albuterol, Amitriptyline, Arformoterol, Aripiprazole, Atenolol, Benperidol, Bisoprolol, Brexpiprazole, Bromocriptine, Candesartan Cilexetil, Carteolol, Carvedilol, Celiprolol, Chlorhexidine, Clemastine, Clomipramine, Clotrimazole, Darifenacin, Dobutamine, Domperidone, Epinephrine, Ergotamine, Esmolol, Fenoterol, Fluspirilene, Formoterol, Indacaterol, Isoproterenol, Labetalol, Levobunolol, Metoprolol, Montelukast, Nadolol, Nebivolol, Nitazoxanide, Norepinephrine, Nortriptyline, Oxprenolol, Phenylephrine, Pimozide, Pindolol, Practolol, Prenylamine, Primaquine, Propafenone, Propranolol, Ranolazine, Rifampin, Rifaximin, Ritodrine, Salmeterol, Sotalol, Sunitinib, Tamoxifen