Bezuclastinib
drugOn this page
Also known as CGT-9486CGT9486Plx-9486Plx9486
Summary
Bezuclastinib (CHEMBL5095229) is a phase-3 clinical-stage small molecule targeting KIT; indicated across 3 conditions including neoplasm and gastrointestinal stromal tumor.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (KIT)
- Indications: 3 conditions
- Clinical trials: 5
- Chemistry: 331.4 Da · C19H17N5O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL5095229 |
| Name | Bezuclastinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 75593308 |
| Molecular formula | C19H17N5O |
| Molecular weight | 331.4 |
| InChIKey | NVSHVYGIYPBTEZ-UHFFFAOYSA-N |
SMILES: CC1=C(NN=C1C(=O)NC2=CN=C3C(=C2)C=C(N3)C4=CC=CC=C4)C
IUPAC name: 4,5-dimethyl-N-(2-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrazole-3-carboxamide
Also known as: Bezuclastinib, CGT-9486, CGT9486, Plx-9486, Plx9486, PLX9486, BEZUCLASTINIB
Patent coverage: 126 distinct patent families (438 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 373 (85%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| KIT | KIT proto-oncogene, receptor tyrosine kinase | Inhibition | 7.55 | 0.5% | P10721 |
Broader ChEMBL bioactivity targets: 1 (assay-derived). Sample: Mast/stem cell growth factor receptor Kit.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 1 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| KIT | 5.26 | Ki | 5500 | nM | CHEMBL_ACT_27624476 |
Target pathways
Aggregated over 1 target gene(s): KIT.
Top Reactome pathways
39 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 1 | KIT |
| Developmental Biology | 1 | KIT |
| Signaling by SCF-KIT | 1 | KIT |
| Regulation of KIT signaling | 1 | KIT |
| Signal Transduction | 1 | KIT |
| Disease | 1 | KIT |
| Negative regulation of the PI3K/AKT network | 1 | KIT |
| Generic Transcription Pathway | 1 | KIT |
| PI3K/AKT Signaling in Cancer | 1 | KIT |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | KIT |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | KIT |
| RAF/MAP kinase cascade | 1 | KIT |
| MAPK family signaling cascades | 1 | KIT |
| MAPK1/MAPK3 signaling | 1 | KIT |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | KIT |
| RNA Polymerase II Transcription | 1 | KIT |
| Gene expression (Transcription) | 1 | KIT |
| Transcriptional regulation by the AP-2 (TFAP2) family of transcription factors | 1 | KIT |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | KIT |
| Intracellular signaling by second messengers | 1 | KIT |
| Signaling by Receptor Tyrosine Kinases | 1 | KIT |
| Dasatinib-resistant KIT mutants | 1 | KIT |
| Imatinib-resistant KIT mutants | 1 | KIT |
| KIT mutants bind TKIs | 1 | KIT |
| Masitinib-resistant KIT mutants | 1 | KIT |
| Nilotinib-resistant KIT mutants | 1 | KIT |
| Regorafenib-resistant KIT mutants | 1 | KIT |
| Signaling by kinase domain mutants of KIT | 1 | KIT |
| Sunitinib-resistant KIT mutants | 1 | KIT |
| Signaling by juxtamembrane domain KIT mutants | 1 | KIT |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| ovarian follicle development | 1 |
| hematopoietic progenitor cell differentiation | 1 |
| myeloid progenitor cell differentiation | 1 |
| lymphoid progenitor cell differentiation | 1 |
| immature B cell differentiation | 1 |
| mast cell chemotaxis | 1 |
| positive regulation of dendritic cell cytokine production | 1 |
| glycosphingolipid metabolic process | 1 |
| inflammatory response | 1 |
| signal transduction | 1 |
| spermatogenesis | 1 |
| spermatid development | 1 |
| positive regulation of cell population proliferation | 1 |
| primordial germ cell migration | 1 |
| regulation of cell shape | 1 |
Indications & clinical
Indications
3 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| gastrointestinal stromal tumor | 1 | MONDO:0011719 | MONDO:0011719 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 5.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 2 |
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05208047 | PHASE3 | ACTIVE_NOT_RECRUITING | (Peak) A Phase 3 Randomized Trial of CGT9486+Sunitinib vs. Sunitinib in Subjects With Gastrointestinal Stromal Tumors |
| NCT04996875 | PHASE2 | RECRUITING | (Apex) Bezuclastinib in Patients With Advanced Systemic Mastocytosis |
| NCT02401815 | PHASE1/PHASE2 | COMPLETED | CGT9486 (Formerly Known as PLX9486) as a Single Agent and in Combination With PLX3397 (Pexidartinib) or Sunitinib in Participants With Advanced Solid Tumors |
| NCT06915766 | Not specified | AVAILABLE | Expanded Access to Bezuclastinib for Patients With NonAdvanced Systemic Mastocytosis or Advanced Systemic Mastocytosis |
| NCT06948955 | Not specified | AVAILABLE | Expanded Access to Bezuclastinib to be Coadministered With Sunitinib for Patients With Gastrointestinal Stromal Tumors |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
83 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AVAPRITINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| IMATINIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | KIT |
| AXITINIB | ChEMBL | Phase 4 (approved) | KIT |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | KIT |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | KIT |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | KIT |
| CERITINIB | ChEMBL | Phase 4 (approved) | KIT |
| DASATINIB | ChEMBL | Phase 4 (approved) | KIT |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | KIT |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | KIT |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | KIT |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | KIT |
| LENVATINIB | ChEMBL | Phase 4 (approved) | KIT |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | KIT |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | KIT |
| NILOTINIB | ChEMBL | Phase 4 (approved) | KIT |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | KIT |
| PEXIDARTINIB | ChEMBL | Phase 4 (approved) | KIT |
| PONATINIB | ChEMBL | Phase 4 (approved) | KIT |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | KIT |
| RIPRETINIB | ChEMBL | Phase 4 (approved) | KIT |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | KIT |
| SORAFENIB | ChEMBL | Phase 4 (approved) | KIT |
| SUNITINIB | ChEMBL | Phase 4 (approved) | KIT |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | KIT |
| VANDETANIB | ChEMBL | Phase 4 (approved) | KIT |
| ALVOCIDIB | ChEMBL | Phase 3 | KIT |
| BARASERTIB | ChEMBL | Phase 3 | KIT |
| BRIVANIB | ChEMBL | Phase 3 | KIT |
| CANERTINIB | ChEMBL | Phase 3 | KIT |
| CEDIRANIB | ChEMBL | Phase 3 | KIT |
| DOVITINIB | ChEMBL | Phase 3 | KIT |
| ENZASTAURIN | ChEMBL | Phase 3 | KIT |
| FAMITINIB | ChEMBL | Phase 3 | KIT |
| FLUMATINIB | ChEMBL | Phase 3 | KIT |
| LESTAURTINIB | ChEMBL | Phase 3 | KIT |
| LINIFANIB | ChEMBL | Phase 3 | KIT |
| MASITINIB | ChEMBL | Phase 3 | KIT |
| MOTESANIB | ChEMBL | Phase 3 | KIT |
| PIMICOTINIB | ChEMBL | Phase 3 | KIT |
| RUBOXISTAURIN | ChEMBL | Phase 3 | KIT |
| SARACATINIB | ChEMBL | Phase 3 | KIT |
| SEMAXANIB | ChEMBL | Phase 3 | KIT |
| SITRAVATINIB | ChEMBL | Phase 3 | KIT |
| VATALANIB | ChEMBL | Phase 3 | KIT |
| VIMSELTINIB | ChEMBL | Phase 3 | KIT |
| AMUVATINIB | ChEMBL | Phase 2 | KIT |
| BAY-1161909 | ChEMBL | Phase 2 | KIT |
| BEMCENTINIB | ChEMBL | Phase 2 | KIT |
| BERZOSERTIB | ChEMBL | Phase 2 | KIT |
| BFH-772 | ChEMBL | Phase 2 | KIT |
| BMS-777607 | ChEMBL | Phase 2 | KIT |
| CENISERTIB | ChEMBL | Phase 2 | KIT |
| CEP-32496 | ChEMBL | Phase 2 | KIT |
| DANUSERTIB | ChEMBL | Phase 2 | KIT |
| DATELLIPTIUM | ChEMBL | Phase 2 | KIT |
Related Atlas pages
- Genes: KIT
- Drugs: Avapritinib, Crizotinib, Gefitinib, Imatinib, Pazopanib, Regorafenib, Axitinib, Bosutinib, Brigatinib, Cabozantinib, Ceritinib, Dasatinib, Entrectinib, Erlotinib, Fedratinib, Infigratinib, Lenvatinib, Midostaurin, Niclosamide, Nilotinib, Nintedanib, Pexidartinib, Ponatinib, Quizartinib, Ripretinib, Ruxolitinib, Sorafenib, Sunitinib, Tivozanib, Vandetanib, Alvocidib, Barasertib, Brivanib, Canertinib, Cediranib, Dovitinib, Enzastaurin, Famitinib, Flumatinib, Lestaurtinib, Linifanib, Masitinib, Motesanib, Pimicotinib, Ruboxistaurin, Saracatinib, Semaxanib, Sitravatinib, Vatalanib, Vimseltinib