Blonanserin
drugOn this page
Also known as AD-5423BlonanserinaBlonanserineDSP-5423SID144206818BLONANSERIN (LONASEN)BlonanserinÊBlonanserinÂ
Summary
Blonanserin (CHEMBL178803) is an approved small molecule targeting DRD2 and HTR2A; indicated across 1 condition.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 2 (DRD2, HTR2A)
- Indications: 1 condition
- Clinical trials: 2
- Chemistry: 367.5 Da · C23H30FN3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL178803 |
| Name | Blonanserin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 125564 |
| Molecular formula | C23H30FN3 |
| Molecular weight | 367.5 |
| InChIKey | XVGOZDAJGBALKS-UHFFFAOYSA-N |
SMILES: CCN1CCN(CC1)C2=NC3=C(CCCCCC3)C(=C2)C4=CC=C(C=C4)F
IUPAC name: 2-(4-ethylpiperazin-1-yl)-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine
Also known as: AD-5423, Blonanserin, Blonanserina, Blonanserine, DSP-5423, SID144206818, BLONANSERIN, BLONANSERIN (LONASEN), blonanserin, BlonanserinÊ, Blonanserin (Lonasen), BlonanserinÂ
Patent coverage: 901 distinct patent families (3,292 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 3,267 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| DRD2 | D2 receptor | Antagonist | 9.85 | 0% | P14416 |
| HTR2A | 5-HT2A receptor | Antagonist | 9.09 | 0% | P28223 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: D(2) dopamine receptor, 5-hydroxytryptamine receptor 2A.
Bioactivity
ChEMBL activities: 2 potent at pChembl ≥ 5 of 2 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DRD2 | 9.85 | Ki | 0.14 | nM | CHEMBL_ACT_1421609 |
| HTR2A | 9.09 | Ki | 0.81 | nM | CHEMBL_ACT_1421610 |
Target pathways
Aggregated over 2 target gene(s): DRD2, HTR2A.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | HTR2A |
| Signaling by GPCR | 1 | HTR2A |
| Class A/1 (Rhodopsin-like receptors) | 1 | HTR2A |
| Amine ligand-binding receptors | 1 | HTR2A |
| GPCR downstream signalling | 1 | HTR2A |
| Dopamine receptors | 1 | DRD2 |
| Serotonin receptors | 1 | HTR2A |
| G alpha (q) signalling events | 1 | HTR2A |
| GPCR ligand binding | 1 | HTR2A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| temperature homeostasis | 2 |
| intracellular calcium ion homeostasis | 2 |
| response to xenobiotic stimulus | 2 |
| regulation of dopamine secretion | 2 |
| response to cocaine | 2 |
| behavioral response to cocaine | 2 |
| release of sequestered calcium ion into cytosol | 2 |
| negative regulation of synaptic transmission, glutamatergic | 2 |
| positive regulation of ERK1 and ERK2 cascade | 2 |
| presynaptic modulation of chemical synaptic transmission | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| response to hypoxia | 1 |
| response to amphetamine | 1 |
| nervous system process involved in regulation of systemic arterial blood pressure | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4).
The 1 indication record carries no mapped disease name (EFO/MeSH-only); none shown.
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 1 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03784222 | PHASE4 | TERMINATED | Effects on Social and Cognition Functions of Blonanserin in First Episode Schizophrenia Patients |
| NCT01516424 | PHASE3 | COMPLETED | Efficiency Study to Investigate Blonanserin in Treatment of Schizophrenia When Compared With Risperidone |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 3 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
480 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HTR2A |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HTR2A |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HTR2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AMIODARONE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| ASENAPINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AZATADINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| BUTRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CINACALCET | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DIPHENIDOL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DOXEPIN | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DROPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| DULOXETINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| EBASTINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| FEXOFENADINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | DRD2, HTR2A |
Related Atlas pages
- Genes: DRD2, HTR2A
- Drugs: Dihydroergotamine, Fidaxomicin, Propoxyphene, Acetophenazine, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amoxapine, Apomorphine, Aripiprazole, Asenapine, Astemizole, Azatadine, Azelastine, Bazedoxifene, Benperidol, Benzquinamide, Benztropine, Bepridil, Bosutinib, Brexpiprazole, Bromocriptine, Bromperidol, Buspirone, Butriptyline, Cabergoline, Cannabidiol, Cariprazine, Carvedilol, Chlorhexidine, Chlorpromazine, Cinacalcet, Cinnarizine, Cisapride, Clemastine, Clomipramine, Clotrimazole, Clozapine, Cyclobenzaprine, Cyproheptadine, Darifenacin, Desipramine, Desloratadine, Dibenzepin, Diethylstilbestrol, Diphenidol, Dobutamine, Domperidone, Dothiepin, Doxepin, Droperidol, Duloxetine, Ebastine, Econazole, Ergotamine, Fexofenadine, Fluoxetine, Fluphenazine, Fluspirilene