Brimapitide, C-Terminal Acid
drugOn this page
Also known as Am-111Brimapitidec-terminal acidD-jnki-1Xg-102 c-terminal acid
Summary
Brimapitide, C-Terminal Acid (CHEMBL4297348) is a phase-3 clinical-stage protein targeting MAPK10; indicated across 1 condition including hearing loss disorder.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Protein
- Targets: 1 (MAPK10)
- Indications: 1 condition
- Clinical trials: 3
- Chemistry: 3823.4 Da · C164H285N65O41
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4297348 |
| Name | Brimapitide, C-Terminal Acid |
| Type | Protein |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 72941992 |
| Molecular formula | C164H285N65O41 |
| Molecular weight | 3823.4 |
| InChIKey | HRMVIAFZYCCHGF-BMCUWHFPSA-N |
SMILES: C[C@@H]([C@H](C(=O)N[C@H]([C@H](C)O)C(=O)N1CCC[C@@H]1C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@H](CCCCN)C(=O)N2CCC[C@@H]2C(=O)N[C@H](CCCNC(=N)N)C(=O)N3CCC[C@@H]3C(=O)N4CCC[C@@H]4C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@H](CCC(=O)N)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCNC(=N)N)C(=O)NCC(=O)O)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CC(=O)N)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CC5=CC=CC=C5)NC(=O)[C@H]6CCCN6C(=O)[C@@H](CCC(=O)N)NC(=O)[C@@H](C(C)C)NC(=O)[C@H]7CCCN7C(=O)[C@@H](CCCNC(=N)N)NC(=O)[C@@H](CO)NC(=O)[C@@H](CCC(=O)N)NC(=O)[C@@H](CC(=O)O)N)O
IUPAC name: (3R)-3-amino-4-[[(2R)-5-amino-1-[[(2R)-1-[[(2R)-1-[(2R)-2-[[(2R)-1-[[(2R)-5-amino-1-[(2R)-2-[[(2R)-1-[[(2R)-1-[[(2R)-4-amino-1-[[(2R)-1-[[(2R,3S)-1-[[(2R,3S)-1-[(2R)-2-[[(2R)-1-[[(2R)-6-amino-1-[(2R)-2-[[(2R)-1-[(2R)-2-[(2R)-2-[[(2R)-1-[[(2R)-1-[[(2R)-1-[[(2R)-5-amino-1-[[(2R)-1-[[(2R)-1-[[(2R)-6-amino-1-[[(2R)-6-amino-1-[[(2R)-5-carbamimidamido-1-(carboxymethylamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-5-carbamimidamido-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxohexan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-5-carbamimidamido-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-oxobutanoic acid
Also known as: Am-111, AM-111, Brimapitide, c-terminal acid, D-jnki-1, Xg-102 c-terminal acid, BRIMAPITIDE, C-TERMINAL ACID
Patent coverage: 76 distinct patent families (184 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MAPK10 | mitogen-activated protein kinase 10 | Inhibition | 7 | 0.2% | P53779 |
Bioactivity
No ChEMBL bioactivity rows at pChembl ≥ 5 (expected for biologics / antibodies).
Target pathways
Aggregated over 1 target gene(s): MAPK10.
Top Reactome pathways
31 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cytokine Signaling in Immune system | 1 | MAPK10 |
| Toll Like Receptor 4 (TLR4) Cascade | 1 | MAPK10 |
| MyD88:MAL(TIRAP) cascade initiated on plasma membrane | 1 | MAPK10 |
| MyD88-independent TLR4 cascade | 1 | MAPK10 |
| Toll Like Receptor 9 (TLR9) Cascade | 1 | MAPK10 |
| Toll Like Receptor 10 (TLR10) Cascade | 1 | MAPK10 |
| Toll Like Receptor 3 (TLR3) Cascade | 1 | MAPK10 |
| Toll Like Receptor 5 (TLR5) Cascade | 1 | MAPK10 |
| Toll Like Receptor TLR1:TLR2 Cascade | 1 | MAPK10 |
| Toll Like Receptor 7/8 (TLR7/8) Cascade | 1 | MAPK10 |
| Toll Like Receptor TLR6:TLR2 Cascade | 1 | MAPK10 |
| Innate Immune System | 1 | MAPK10 |
| Immune System | 1 | MAPK10 |
| Toll-like Receptor Cascades | 1 | MAPK10 |
| Toll Like Receptor 2 (TLR2) Cascade | 1 | MAPK10 |
| Cellular responses to stress | 1 | MAPK10 |
| Fc epsilon receptor (FCERI) signaling | 1 | MAPK10 |
| Oxidative Stress Induced Senescence | 1 | MAPK10 |
| Cellular Senescence | 1 | MAPK10 |
| FCERI mediated MAPK activation | 1 | MAPK10 |
| Interleukin-17 signaling | 1 | MAPK10 |
| Signaling by Interleukins | 1 | MAPK10 |
| MAPK targets/ Nuclear events mediated by MAP kinases | 1 | MAPK10 |
| MAP kinase activation | 1 | MAPK10 |
| JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 | 1 | MAPK10 |
| Activation of the AP-1 family of transcription factors | 1 | MAPK10 |
| Cellular responses to stimuli | 1 | MAPK10 |
| TRIF (TICAM1)-mediated TLR4 signaling | 1 | MAPK10 |
| TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation | 1 | MAPK10 |
| MyD88 dependent cascade initiated on endosome | 1 | MAPK10 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 1 |
| signal transduction | 1 |
| JNK cascade | 1 |
| response to light stimulus | 1 |
| Fc-epsilon receptor signaling pathway | 1 |
| regulation of circadian rhythm | 1 |
| rhythmic process | 1 |
| cellular senescence | 1 |
| MAPK cascade | 1 |
| cellular response to stress | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| hearing loss disorder | 3 | MONDO:0005365 | EFO:0004238 |
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02561091 | PHASE3 | COMPLETED | AM-111 in the Treatment of Acute Inner Ear Hearing Loss |
| NCT02809118 | PHASE3 | TERMINATED | Efficacy and Safety of AM-111 as Acute Sudden Sensorineural Hearing Loss Treatment |
| NCT00802425 | PHASE2 | COMPLETED | Efficacy of AM-111 in Patients With Acute Sensorineural Hearing Loss |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
53 molecules share ≥1 primary target. Top 53 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAPK10 |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | MAPK10 |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | MAPK10 |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| AXITINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| IMATINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | MAPK10 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| NERATINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | MAPK10 |
| ALVOCIDIB | ChEMBL | Phase 3 | MAPK10 |
| CANERTINIB | ChEMBL | Phase 3 | MAPK10 |
| DOVITINIB | ChEMBL | Phase 3 | MAPK10 |
| LESTAURTINIB | ChEMBL | Phase 3 | MAPK10 |
| LINIFANIB | ChEMBL | Phase 3 | MAPK10 |
| AT-9283 | ChEMBL | Phase 2 | MAPK10 |
| BAY-1161909 | ChEMBL | Phase 2 | MAPK10 |
| BENTAMAPIMOD | ChEMBL | Phase 2 | MAPK10 |
| BI-2536 | ChEMBL | Phase 2 | MAPK10 |
| CC-401 | ChEMBL | Phase 2 | MAPK10 |
| CC-90001 | ChEMBL | Phase 2 | MAPK10 |
| CEP-32496 | ChEMBL | Phase 2 | MAPK10 |
| CERDULATINIB | ChEMBL | Phase 2 | MAPK10 |
| DORAMAPIMOD | ChEMBL | Phase 2 | MAPK10 |
| FORETINIB | ChEMBL | Phase 2 | MAPK10 |
| MILCICLIB | ChEMBL | Phase 2 | MAPK10 |
| MK-2461 | ChEMBL | Phase 2 | MAPK10 |
| OSI-027 | ChEMBL | Phase 2 | MAPK10 |
| PAMAPIMOD | ChEMBL | Phase 2 | MAPK10 |
| PEXMETINIB | ChEMBL | Phase 2 | MAPK10 |
| PICTILISIB | ChEMBL | Phase 2 | MAPK10 |
| R-406 | ChEMBL | Phase 2 | MAPK10 |
| REBASTINIB | ChEMBL | Phase 2 | MAPK10 |
| REFAMETINIB | ChEMBL | Phase 2 | MAPK10 |
| SU-014813 | ChEMBL | Phase 2 | MAPK10 |
| TANZISERTIB | ChEMBL | Phase 2 | MAPK10 |
| TOZASERTIB | ChEMBL | Phase 2 | MAPK10 |
| VX-702 | ChEMBL | Phase 2 | MAPK10 |
| Binimetinib | PubChem | Approved | MAPK10 |
| Crizotinib | PubChem | Approved | MAPK10 |
| dacomitinib | PubChem | Approved | MAPK10 |
| Fostamatinib | PubChem | Approved | MAPK10 |
| Idelalisib | PubChem | Approved | MAPK10 |
| podofilox | PubChem | Approved | MAPK10 |
| regorafenib | PubChem | Approved | MAPK10 |
| Selumetinib | PubChem | Approved | MAPK10 |
| Trametinib | PubChem | Approved | MAPK10 |
Related Atlas pages
- Genes: MAPK10
- Diseases: hearing loss disorder
- Drugs: Afatinib, Gefitinib, Pazopanib, Abemaciclib, Axitinib, Erlotinib, Fedratinib, Filgotinib, Gilteritinib, Imatinib, Midostaurin, Momelotinib, Neratinib, Nilotinib, Nintedanib, Sunitinib, Alvocidib, Canertinib, Dovitinib, Lestaurtinib, Linifanib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Idelalisib, podofilox, regorafenib, Selumetinib, Trametinib