Brimonidine
drugOn this page
Also known as AGN-190342 FREE BASEBrimonidinaNSC-318825UK-14304UK-1430418 FREE BASESID11111939SID11113354SID26751556SID50104157SID85231282SID855898SID90340645SID104171261SID144203850SID170464941C0164800
Summary
Brimonidine (CHEMBL844) is an approved small-molecule adrenergic agonist (ATC S01GA07) targeting ADRA2A, ADRA2B, and ADRA2C; indicated across 8 conditions including eye allergy and glaucoma.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: S01GA07 (+2 more)
- Targets: 3 (ADRA2A, ADRA2B, ADRA2C)
- Indications: 8 conditions
- Clinical trials: 56
- Chemistry: 292.13 Da · C11H10BrN5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL844 |
| Name | Brimonidine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2435 |
| ChEBI | CHEBI:3175 |
| ATC | S01GA07, S01EA05, D11AX21 |
| Molecular formula | C11H10BrN5 |
| Molecular weight | 292.13 |
| InChIKey | XYLJNLCSTIOKRM-UHFFFAOYSA-N |
SMILES: C1CN=C(N1)NC2=C(C3=NC=CN=C3C=C2)Br
IUPAC name: 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine
Pharmacological roles (ChEBI): adrenergic agonist, antihypertensive agent, α-adrenergic agonist.
Also known as: AGN-190342 FREE BASE, Brimonidina, Brimonidine, NSC-318825, UK-14304, UK-1430418 FREE BASE, SID11111939, SID11113354, SID26751556, SID50104157, SID85231282, SID855898
Parent form; salt/anhydrous children: CHEMBL1200389, CHEMBL2062257
Patent coverage: 2,976 distinct patent families (11,912 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 11,518 (97%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Agonist | 8.9 | 0.1% | P08913 |
| ADRA2B | α2B-adrenoceptor | Agonist | 7.2 | 0.2% | P18089 |
| ADRA2C | α2C-adrenoceptor | Agonist | 6.88 | 0% | P18825 |
Broader ChEMBL bioactivity targets: 33 (assay-derived). Sample: Microtubule-associated protein tau, Lysine-specific demethylase 4E, Fructose-bisphosphate aldolase, Prelamin-A/C, RecQ-like DNA helicase BLM, 4’-phosphopantetheinyl transferase ffp, Ferritin light chain, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Endonuclease 4, Alpha-2A adrenergic receptor.
Bioactivity
ChEMBL activities: 52 potent at pChembl ≥ 5 of 77 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRA2A | 9.21 | EC50 | 0.62 | nM | CHEMBL_ACT_1233171 |
| ADRA2A | 9.07 | EC50 | 0.86 | nM | CHEMBL_ACT_16896925 |
| ADRA2A | 8.85 | Ki | 1.41 | nM | CHEMBL_ACT_2500590 |
| ADRA2A | 8.62 | AC50 | 2.4 | nM | CHEMBL_ACT_25221639 |
| ADRA2A | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_372491 |
| ADRA2A | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_825359 |
| ADRA2A | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_958214 |
| ADRA2A | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_253179 |
| ADRA2C | 8.47 | EC50 | 3.4 | nM | CHEMBL_ACT_958219 |
| P19328 | 8.44 | IC50 | 3.6 | nM | CHEMBL_ACT_166569 |
| ADRA2A | 8.39 | EC50 | 4.1 | nM | CHEMBL_ACT_958217 |
| BLM | 8.25 | Potency | 5.6 | nM | CHEMBL_ACT_4745854 |
| BLM | 8.25 | Potency | 5.6 | nM | CHEMBL_ACT_4917957 |
| ADRA2A | 8.17 | Ki | 6.76 | nM | CHEMBL_ACT_1233170 |
| ADRA2C | 8.1 | EC50 | 8 | nM | CHEMBL_ACT_16896935 |
| ADRA2C | 8.02 | EC50 | 9.55 | nM | CHEMBL_ACT_1233177 |
| P19328 | 7.52 | Ki | 30 | nM | CHEMBL_ACT_878961 |
| ADRA2B | 7.46 | Ki | 34.67 | nM | CHEMBL_ACT_1233173 |
| ADRA2C | 7.36 | Ki | 44 | nM | CHEMBL_ACT_958216 |
| P19328 | 7.28 | Ki | 52 | nM | CHEMBL_ACT_958215 |
| P19328 | 7.26 | EC50 | 55 | nM | CHEMBL_ACT_958218 |
| ADRA2C | 7.08 | Ki | 83.18 | nM | CHEMBL_ACT_1233176 |
| ADRA2A | 6.95 | Ki | 112 | nM | CHEMBL_ACT_7621257 |
| ADRA2B | 6.55 | EC50 | 281.8 | nM | CHEMBL_ACT_1233174 |
| ADRA2A | 6.53 | IC50 | 298 | nM | CHEMBL_ACT_7621256 |
| CYP3A4 | 6.4 | Potency | 398.1 | nM | CHEMBL_ACT_4973353 |
| CYP3A4 | 6.4 | Potency | 398.1 | nM | CHEMBL_ACT_5038578 |
| CYP3A4 | 6.4 | AC50 | 398.1 | nM | CHEMBL_ACT_6027211 |
| ADRA2B | 6.32 | Ki | 478 | nM | CHEMBL_ACT_7621259 |
| ADRA1A | 6.19 | AC50 | 644.8 | nM | CHEMBL_ACT_25230261 |
Target pathways
Aggregated over 3 target gene(s): ADRA2A, ADRA2B, ADRA2C.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signal Transduction | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signaling by GPCR | 3 | ADRA2A, ADRA2B, ADRA2C |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Amine ligand-binding receptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR downstream signalling | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenoceptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (i) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (z) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR ligand binding | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet activation, signaling and aggregation | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet Aggregation (Plug Formation) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Metabolism | 2 | ADRA2A, ADRA2C |
| Integration of energy metabolism | 2 | ADRA2A, ADRA2C |
| Metabolism of proteins | 2 | ADRA2A, ADRA2C |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | ADRA2A, ADRA2C |
| Regulation of insulin secretion | 2 | ADRA2A, ADRA2C |
| Surfactant metabolism | 2 | ADRA2A, ADRA2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| epidermal growth factor receptor signaling pathway | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| negative regulation of norepinephrine secretion | 3 |
| regulation of vasoconstriction | 3 |
| platelet activation | 3 |
| negative regulation of epinephrine secretion | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| adrenergic receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 3 |
| regulation of smooth muscle contraction | 3 |
| signal transduction | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| female pregnancy | 2 |
| negative regulation of insulin secretion | 2 |
Indications & clinical
Indications
8 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| eye allergy | 4 | MONDO:0005551 | EFO:0005751 |
| glaucoma | 4 | MONDO:0005041 | MONDO:0005041 |
| rosacea | 3 | MONDO:0006604 | EFO:1000760 |
| ocular hypertension | 3 | MONDO:0006875 | EFO:1001069 |
| diabetic retinopathy | 2 | MONDO:0005266 | EFO:0003770 |
| open-angle glaucoma | 2 | MONDO:0005338 | EFO:0004190 |
| dry eye syndrome | 2 | MONDO:0006733 | EFO:1000906 |
| presbyopia | 1 | MONDO:0001330 | MONDO:0001330 |
Clinical trials
Total trials: 56.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 20 |
| Not specified | 11 |
| PHASE3 | 10 |
| PHASE2 | 7 |
| EARLY_PHASE1 | 3 |
| PHASE1 | 3 |
| PHASE2/PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07390578 | PHASE4 | NOT_YET_RECRUITING | Upneeq vs. Lumify Ptosis |
| NCT00312416 | PHASE4 | COMPLETED | Effects of Topical Clonidine vs. Brimonidine on Choroidal Blood Flow and Intraocular Pressure During Isometric Exercise |
| NCT00347035 | PHASE4 | TERMINATED | INFLUENCE OF TOPICAL INDOMETHACIN ON HYPOTHENSIVE EFFECT OF BRIMONIDINE |
| NCT00457795 | PHASE4 | COMPLETED | 24-hour IOP-lowering Effect of Brimonidine 0.1% |
| NCT00466479 | PHASE4 | COMPLETED | Brimonidine vs ALTP in Progressing Human Glaucoma |
| NCT00800540 | PHASE4 | COMPLETED | Circadian Ocular Perfusion Pressure and Ocular Blood Flow |
| NCT00869141 | PHASE4 | COMPLETED | Earlier Intraocular Pressure Control After Ahmed Glaucoma Valve Implantation for Glaucoma |
| NCT00972257 | PHASE4 | COMPLETED | 24-hr Intraocular Pressure Control With Dorzolamide/Timolol vs the Brimonidine/Timolol Fixed Combination |
| NCT00981786 | PHASE4 | COMPLETED | 24-Hour Intraocular Pressure With Brinzolamide/Timolol Versus Brimonidine/Timolol |
| NCT01151904 | PHASE4 | TERMINATED | Study of Brimonidine and Timolol Ophthalmic Solution With Latanoprost Compared With Latanoprost in Glaucoma Patients |
| NCT01446497 | PHASE4 | UNKNOWN | Efficacy and Safety Study of Combigan and 0.5% Timoptic in Normal Tension Glaucoma |
| NCT02147691 | PHASE4 | COMPLETED | Finacea 15% and Brimonidine 0.33% Gel in the Treatment of Rosacea - A Pilot Study |
| NCT02249065 | PHASE4 | COMPLETED | Mirvaso in Use Study |
| NCT02616250 | PHASE4 | COMPLETED | MirvasO Soolantra Association In the Treatment of Moderate to Severe rosaCea. |
| NCT02761174 | PHASE4 | COMPLETED | Topical Brimonidine to Reduce Inflammation After IPL-treatment in Patients With Facial Telangiectasias |
| NCT03192826 | PHASE4 | COMPLETED | Brinzolamide/Brimonidine Combination vs Brimonidine 0.2% in the Prevention of IOP Rise After Nd-YAG Laser Capsulotomy |
| NCT03959176 | PHASE4 | COMPLETED | The Effect of Brimonidine |
| NCT05480098 | PHASE4 | WITHDRAWN | Brimonidine for Intraoperative Hemostasis |
| NCT06449352 | PHASE4 | COMPLETED | Effect of Netarsudil vs Brimonidine in NTG Patients on Latanoprost |
| NCT07431476 | PHASE4 | COMPLETED | Brimonidine 0.33% for Rosacea-Related Facial Erythema |
| NCT00168363 | PHASE3 | COMPLETED | Safety and Efficacy of Brimonidine in Patients With Glaucoma or Ocular Hypertension |
| NCT00332384 | PHASE3 | COMPLETED | Safety and Efficacy Study of Brimonidine/Timolol Fixed Combination in Patients With Glaucoma or Ocular Hypertension |
| NCT00332436 | PHASE3 | COMPLETED | Safety and Efficacy Study of Brimonidine/Timolol Fixed Combination in Patients With Glaucoma or Ocular Hypertension |
| NCT00651612 | PHASE3 | COMPLETED | Study to Evaluate Safety of Brimonidine/Timolol Fixed Combination in Glaucoma or Ocular Hypertension Patients |
| NCT00652106 | PHASE3 | COMPLETED | Safety and Efficacy Study of Brimonidine/Timolol Fixed Combination in Patients With Glaucoma or Ocular Hypertension |
| NCT01004900 | PHASE3 | UNKNOWN | Intraocular Pressure (IOP) Lowering Effect of Selective Laser Trabeculoplasty Versus Prostaglandin Analogues in Angle Closure Glaucoma |
| NCT01726075 | PHASE2/PHASE3 | COMPLETED | Trial to Assess the Efficacy of Neuroprotective Drugs Administered Topically to Prevent or Arrest Diabetic Retinopathy |
| NCT02289352 | PHASE3 | COMPLETED | Randomized, Double-blind, Multiple-site, Placebo-controlled, Parallel-design Study in Patients With Moderate to Severe Facial Erythema Associated With Rosacea |
| NCT02339584 | PHASE3 | COMPLETED | Efficacy and Safety of Brinzolamide/Brimonidine Fixed Combination BID Compared to Brinzolamide BID Plus Brimonidine BID in Subjects With Open-Angle Glaucoma (OAG) or Ocular Hypertension (OHT) |
| NCT02764411 | PHASE3 | TERMINATED | Onreltea (Brimonidine) Gel In Pediatric Patients With Capillary Malformations |
| NCT05656027 | PHASE3 | COMPLETED | Phase 3 Evaluation of the Safety and Efficacy of LNZ100 & LNZ101 for the Treatment of Presbyopia |
| NCT00317577 | PHASE2 | COMPLETED | Study of Medical Treatment of Low-Pressure (Normal Tension) Glaucoma |
| NCT00332345 | PHASE2 | COMPLETED | Safety and Efficacy Study of Brimonidine/Timolol Fixed Combination in Patients With Glaucoma or Ocular Hypertension |
| NCT00804921 | PHASE2 | COMPLETED | Effectiveness of Oral Acetazolamide, Brimonidine Tartarate, and Anterior Chamber Paracentesis in Intraocular Pressure (IOP) After Bevacizumab |
| NCT00864838 | PHASE2 | COMPLETED | Oral Acetazolamide, Brimonidine Tartarate, and Anterior Chamber Paracentesis for Ocular Hypertension Control After Intravitreal Bevacizumab |
| NCT01345448 | PHASE2 | UNKNOWN | Intraocular Pressure (IOP) Lowering Efficacy of Transdermal Brimonidine Therapy |
| NCT01863953 | PHASE2 | COMPLETED | A Safety and Efficacy Study of Fixed-Combination Bimatoprost and Brimonidine in Chronic Glaucoma or Ocular Hypertension |
| NCT02975557 | PHASE1/PHASE2 | TERMINATED | Brimonidine Eye Drops for Treatment of Ocular Graft-vs-Host Disease (oGVHD) |
| NCT03418727 | PHASE2 | COMPLETED | Dry Eye Disease Study With Brimonidine |
| NCT05001243 | PHASE1 | UNKNOWN | Comparison of a Compound With Pilocarpine and Brimonidine to Improve Near Vision in Healthy Presbyopic Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
607 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Almotriptan | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| NAPHAZOLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTHIAZIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DANAZOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DEXMEDETOMIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
Related Atlas pages
- Genes: ADRA2A, ADRA2B, ADRA2C
- Diseases: eye allergy, glaucoma, rosacea, ocular hypertension
- Drugs: Aclidinium Bromide, Afatinib, Almotriptan, Chenodiol, Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Naphazoline, Olanzapine, Olodaterol, Paliperidone, Pramipexole, Tamsulosin, Tegaserod, Acetophenazine, Alfuzosin, Amisulpride, Amitriptyline, Amoxapine, Apomorphine, Apraclonidine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benfluorex, Benperidol, Benzbromarone, Benzquinamide, Benzthiazide, Benztropine, Bithionol, Brexpiprazole, Bromocriptine, Bromperidol, Cabergoline, Candesartan Cilexetil, Cariprazine, Carvedilol, Chlorhexidine, Chloroquine, Chlorpromazine, Cinnarizine, Cisapride, Clemastine, Clomipramine, Clonidine, Clotrimazole, Cyproheptadine, Danazol, Darifenacin, Dexmedetomidine, Diethylstilbestrol, Dobutamine, Domperidone, Dothiepin, Doxazosin