Brivanib
drugOn this page
Also known as BMS-540215CPD 12BRIVANIB (BMS-540215)BMS 540215
Summary
Brivanib (CHEMBL377300) is a phase-3 clinical-stage small-molecule antineoplastic agent targeting FGFR1, FLT1, and KDR; indicated across 10 conditions including hepatocellular carcinoma and carcinoma.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 3 (FGFR1, FLT1, KDR)
- Indications: 10 conditions
- Clinical trials: 18
- Chemistry: 370.4 Da · C19H19FN4O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL377300 |
| Name | Brivanib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 11234052 |
| ChEBI | CHEBI:167686 |
| Molecular formula | C19H19FN4O3 |
| Molecular weight | 370.4 |
| InChIKey | WCWUXEGQKLTGDX-LLVKDONJSA-N |
SMILES: CC1=CC2=C(N1)C=CC(=C2F)OC3=NC=NN4C3=C(C(=C4)OC[C@@H](C)O)C
IUPAC name: (2R)-1-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl]oxypropan-2-ol
ChEBI definition: A secondary alcohol resulting from the hydrolysis of the carboxylic ester group of brivanib alaninate. It is a dual VEGFR-2/FGFR-1 kinase inhibitor whose alanine prodrug, brivanib alaninate is currently under development as an oral agent for the treatment of cancer.
Pharmacological roles (ChEBI): antineoplastic agent, EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor, angiogenesis inhibitor, apoptosis inducer, fibroblast growth factor receptor antagonist.
Other ChEBI roles (chemical / environmental): drug metabolite.
Also known as: BMS-540215, Brivanib, BRIVANIB, CPD 12, BRIVANIB (BMS-540215), BMS 540215
Patent coverage: 727 distinct patent families (1,721 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,643 (95%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| FGFR1 | fibroblast growth factor receptor 1 | Inhibition | 6.83 | 11.5% | P11362 |
| FLT1 | fms related receptor tyrosine kinase 1 | Inhibition | 6.42 | 0.1% | P17948 |
| KDR | kinase insert domain receptor | Inhibition | 7.6 | 1.1% | P35968 |
Broader ChEMBL bioactivity targets: 42 (assay-derived). Sample: STE20-related kinase adapter protein alpha, Macrophage colony-stimulating factor 1 receptor, Tyrosine-protein kinase ABL1, Vascular endothelial growth factor receptor 1, Platelet-derived growth factor receptor beta, Mast/stem cell growth factor receptor Kit, Vascular endothelial growth factor receptor 3, Platelet-derived growth factor receptor alpha, Epidermal growth factor receptor, Proto-oncogene tyrosine-protein kinase receptor Ret.
Bioactivity
ChEMBL activities: 77 potent at pChembl ≥ 5 of 84 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| KDR | 8.3 | Kd | 5 | nM | CHEMBL_ACT_7586145 |
| FLT1 | 8 | Kd | 10 | nM | CHEMBL_ACT_7586138 |
| PDGFRA | 7.96 | Kd | 11 | nM | CHEMBL_ACT_7587852 |
| KIT | 7.92 | Kd | 12 | nM | CHEMBL_ACT_7586077 |
| KIT | 7.77 | Kd | 17 | nM | CHEMBL_ACT_7586076 |
| KDR | 7.6 | IC50 | 25 | nM | CHEMBL_ACT_1699775 |
| KDR | 7.6 | IC50 | 25 | nM | CHEMBL_ACT_2164834 |
| KDR | 7.58 | IC50 | 26 | nM | CHEMBL_ACT_15458386 |
| KDR | 7.58 | IC50 | 26 | nM | CHEMBL_ACT_15462664 |
| KDR | 7.58 | Ki | 26 | nM | CHEMBL_ACT_1701293 |
| STK35 | 7.58 | Kd | 26 | nM | CHEMBL_ACT_7587976 |
| FGFR1 | 7.55 | IC50 | 28 | nM | CHEMBL_ACT_15462666 |
| FGFR1 | 7.55 | IC50 | 28 | nM | CHEMBL_ACT_15469024 |
| P35918 | 7.55 | Ki | 28 | nM | CHEMBL_ACT_1701768 |
| KIT | 7.46 | Kd | 35 | nM | CHEMBL_ACT_7586075 |
| KIT | 7.44 | Kd | 36 | nM | CHEMBL_ACT_7586070 |
| PDGFRB | 7.3 | Kd | 50 | nM | CHEMBL_ACT_7586160 |
| KIT | 7.27 | Kd | 54 | nM | CHEMBL_ACT_7586074 |
| FLT4 | 7.25 | Kd | 56 | nM | CHEMBL_ACT_7586139 |
| FLT1 | 7.22 | Ki | 60 | nM | CHEMBL_ACT_1701769 |
| P35918 | 7.05 | IC50 | 89 | nM | CHEMBL_ACT_1699820 |
| FGFR1 | 7 | Kd | 99 | nM | CHEMBL_ACT_7587954 |
| FGFR2 | 6.96 | Kd | 110 | nM | CHEMBL_ACT_7587953 |
| FGFR1 | 6.83 | IC50 | 148 | nM | CHEMBL_ACT_1699822 |
| FGFR3 | 6.82 | Kd | 150 | nM | CHEMBL_ACT_7586067 |
| FGFR3 | 6.8 | Kd | 160 | nM | CHEMBL_ACT_7586066 |
| DDR1 | 6.8 | Kd | 160 | nM | CHEMBL_ACT_7586135 |
| TNIK | 6.8 | Kd | 160 | nM | CHEMBL_ACT_7587913 |
| SLK | 6.77 | Kd | 170 | nM | CHEMBL_ACT_7587906 |
| EPHA6 | 6.72 | Kd | 190 | nM | CHEMBL_ACT_7586101 |
Target pathways
Aggregated over 3 target gene(s): FGFR1, FLT1, KDR.
Top Reactome pathways
29 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuropilin interactions with VEGF and VEGFR | 2 | FLT1, KDR |
| VEGF binds to VEGFR leading to receptor dimerization | 2 | FLT1, KDR |
| PI3K Cascade | 1 | FGFR1 |
| PIP3 activates AKT signaling | 1 | FGFR1 |
| Signaling by FGFR1 amplification mutants | 1 | FGFR1 |
| Signaling by activated point mutants of FGFR1 | 1 | FGFR1 |
| FGFR1b ligand binding and activation | 1 | FGFR1 |
| FGFR1c ligand binding and activation | 1 | FGFR1 |
| FGFR1c and Klotho ligand binding and activation | 1 | FGFR1 |
| Integrin cell surface interactions | 1 | KDR |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | FGFR1 |
| NCAM signaling for neurite out-growth | 1 | FGFR1 |
| VEGFA-VEGFR2 Pathway | 1 | KDR |
| Signal transduction by L1 | 1 | FGFR1 |
| VEGFR2 mediated cell proliferation | 1 | KDR |
| Phospholipase C-mediated cascade: FGFR1 | 1 | FGFR1 |
| Downstream signaling of activated FGFR1 | 1 | FGFR1 |
| SHC-mediated cascade:FGFR1 | 1 | FGFR1 |
| PI-3K cascade:FGFR1 | 1 | FGFR1 |
| FRS-mediated FGFR1 signaling | 1 | FGFR1 |
| Negative regulation of FGFR1 signaling | 1 | FGFR1 |
| Signaling by FGFR1 in disease | 1 | FGFR1 |
| RAF/MAP kinase cascade | 1 | FGFR1 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | FGFR1 |
| Signaling by plasma membrane FGFR1 fusions | 1 | FGFR1 |
| Signaling by membrane-tethered fusions of PDGFRA or PDGFRB | 1 | KDR |
| Epithelial-Mesenchymal Transition (EMT) during gastrulation | 1 | FGFR1 |
| Formation of paraxial mesoderm | 1 | FGFR1 |
| High laminar flow shear stress activates signaling by PIEZO1 and PECAM1:CDH5:KDR in endothelial cells | 1 | KDR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| angiogenesis | 3 |
| protein phosphorylation | 3 |
| positive regulation of cell population proliferation | 3 |
| cell migration | 3 |
| peptidyl-tyrosine phosphorylation | 3 |
| positive regulation of MAPK cascade | 3 |
| protein autophosphorylation | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| positive regulation of mesenchymal cell proliferation | 2 |
| mesenchymal cell proliferation | 2 |
| positive regulation of MAP kinase activity | 2 |
| positive regulation of blood vessel endothelial cell migration | 2 |
| calcium ion homeostasis | 2 |
| stem cell proliferation | 2 |
| positive regulation of stem cell proliferation | 2 |
Indications & clinical
Indications
10 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| carcinoma | 3 | MONDO:0004993 | EFO:0000313 |
| colorectal adenocarcinoma | 2 | MONDO:0005008 | EFO:0000365 |
| colorectal neoplasm | 2 | MONDO:0005335 | MONDO:0005575 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| ovarian cancer | 1 | MONDO:0008170 | MONDO:0008170 |
4 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 18.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 9 |
| PHASE3 | 4 |
| PHASE2 | 4 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00825955 | PHASE3 | COMPLETED | Comparison of Brivanib and Best Supportive Care to Placebo for Treatment of Liver Cancer for Those Subjects Who Have Failed Sorafenib Treatment |
| NCT00858871 | PHASE3 | COMPLETED | First Line Hepato Cellular Carcinoma (HCC) |
| NCT00908752 | PHASE3 | COMPLETED | Phase III Trans-Arterial Chemo-Embolization (TACE) Adjuvant HCC |
| NCT01108705 | PHASE3 | TERMINATED | Comparison of Brivanib and Best Supportive Care (BSC) With Placebo and BSC for Treatment of Liver Cancer in Asian Patients Who Have Failed Sorafenib Treatment |
| NCT00355238 | PHASE2 | COMPLETED | A Phase II Open Label Study of BMS-582664 in Locally Advanced or Metastatic Hepatocellular Cancer |
| NCT00594984 | PHASE1/PHASE2 | COMPLETED | Phase I/II Combination With Irinotecan- Erbitux |
| NCT00633789 | PHASE2 | COMPLETED | Phase II Study of Brivanib (BMS-582664) to Treat Multiple Tumor Types |
| NCT01367275 | PHASE2 | TERMINATED | Irinotecan Plus Brivanib in Metastatic Colorectal Cancer (CRC) Enriched for Elevated Levels of Plasma FGF |
| NCT03516071 | PHASE2 | COMPLETED | A Phase 2 Study of Brivanib in Chinese Patients With Previously Treated Advanced HCC |
| NCT00207051 | PHASE1 | COMPLETED | BMS-582664 in Combination With Erbitux in Patients With Advanced Gastrointestinal Malignancies |
| NCT00207103 | PHASE1 | COMPLETED | MAD in Cancer Patients: Safety of BMS-582664 in Patients With Advanced or Metastatic Solid Tumors |
| NCT00390936 | PHASE1 | COMPLETED | A Study of BMS-582664 in Patients With Advanced or Metastatic Solid Tumors |
| NCT00435669 | PHASE1 | COMPLETED | A Phase I Study to Determine Absorption, Distribution, Metabolism, and Elimination of a Single Radiolabeled Dose of Brivanib (BMS-582664) |
| NCT00437424 | PHASE1 | COMPLETED | A Study of Brivanib (BMS-582664) in Patients With Liver Cancer and Mild, Moderate or Severe Liver Dysfunction |
| NCT00437437 | PHASE1 | COMPLETED | A Phase I Study to Determine the Effect of Food on Brivanib (BMS-582664) |
| NCT01046864 | PHASE1 | COMPLETED | Combination of Brivanib With 5-Fluorouracil/Leucovorin (5FU/LV) and 5-Fluorouracil/Leucovorin/Irinotecan (FOLFIRI) |
| NCT01540461 | PHASE1 | COMPLETED | Determine the Pharmacokinetics and Safety of Brivanib in Chinese Subjects With Advanced Primary Liver Cancer (Hepatocellular Carcinoma: HCC) |
| NCT03895788 | PHASE1 | UNKNOWN | A Study of Niraparib in Combination With Brivanib in Recurrent Ovarian Cancer |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
189 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | FGFR1, FLT1, KDR |
| Gefitinib | ChEMBL + PubChem | Phase 4 (approved) | FGFR1, FLT1, KDR |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | FGFR1, FLT1, KDR |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | FGFR1, FLT1, KDR |
| AXITINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| DASATINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| LENVATINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| NINTEDANIB ESYLATE | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| PONATINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| SORAFENIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| SUNITINIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| VANDETANIB | ChEMBL | Phase 4 (approved) | FGFR1, FLT1, KDR |
| ALISERTIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| CEDIRANIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| DOVITINIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| LESTAURTINIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| LINIFANIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| MOTESANIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| ORANTINIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| SEMAXANIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| SURUFATINIB | ChEMBL | Phase 3 | FGFR1, FLT1, KDR |
| AT-9283 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| CENISERTIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| CEP-11981 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| DORAMAPIMOD | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| FORETINIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| ILORASERTIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| LUCITANIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| MK-2461 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| OSI-632 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| R-406 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| RAF-265 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| REBASTINIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| SU-014813 | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| TANDUTINIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| TOZASERTIB | ChEMBL | Phase 2 | FGFR1, FLT1, KDR |
| Afatinib | PubChem | Approved | FGFR1, FLT1, KDR |
| Selumetinib | PubChem | Approved | FGFR1, FLT1, KDR |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | FGFR1, KDR |
| ERDAFITINIB | ChEMBL | Phase 4 (approved) | FGFR1, KDR |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| FRUQUINTINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| FUTIBATINIB | ChEMBL | Phase 4 (approved) | FGFR1, KDR |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | FGFR1, KDR |
| PEXIDARTINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | FGFR1, KDR |
| CANERTINIB | ChEMBL | Phase 3 | FLT1, KDR |
| CEP-1347 | ChEMBL | Phase 3 | FLT1, KDR |
| DEFACTINIB | ChEMBL | Phase 3 | FLT1, KDR |
| VATALANIB | ChEMBL | Phase 3 | FLT1, KDR |
| AEE-788 | ChEMBL | Phase 2 | FLT1, KDR |
| AG-13958 | ChEMBL | Phase 2 | FGFR1, KDR |
Related Atlas pages
- Genes: FGFR1, FLT1, KDR
- Diseases: hepatocellular carcinoma, carcinoma
- Drugs: Crizotinib, Gefitinib, Pazopanib, Regorafenib, Axitinib, Cabozantinib, Dasatinib, Entrectinib, Fedratinib, Infigratinib, Lenvatinib, Midostaurin, Nintedanib, Ponatinib, Sorafenib, Sunitinib, Tivozanib, Vandetanib, Alisertib, Cediranib, Dovitinib, Lestaurtinib, Linifanib, Motesanib, Orantinib, Semaxanib, Surufatinib, Afatinib, Selumetinib, Brigatinib, Erdafitinib, Erlotinib, Fruquintinib, Futibatinib, Niclosamide, Pexidartinib, Quizartinib, Upadacitinib, Canertinib, CEP-1347, Defactinib, Vatalanib