Bupivacaine
drugOn this page
Also known as AnekainBR-003BucaineBupivacainaBupivacaine component of zynrelefBupivacaine liposomeExparelExparel liposomalLiposomal bupivacaineLIQ-865LIQ865PosimirRopivacaine hydrochloride impuritybupivacaine-SKY-0402SKY0402rac-bupivacaineSID160644527Bupivicaine
Summary
Bupivacaine (CHEMBL1098) is an approved small molecule (ATC N01BB01) targeting KCNJ6, KCNA5, and KCND3; indicated across 74 conditions including bone fracture and injury.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N01BB01 (+1 more)
- Targets: 4 (KCNJ6, KCNA5, KCND3…)
- Indications: 74 conditions
- Clinical trials: 1,218
- Chemistry: 288.4 Da · C18H28N2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1098 |
| Name | Bupivacaine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 2474 |
| ChEBI | CHEBI:77431 |
| ATC | N01BB01, N01BB51 |
| Molecular formula | C18H28N2O |
| Molecular weight | 288.4 |
| InChIKey | LEBVLXFERQHONN-UHFFFAOYSA-N |
SMILES: CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C
IUPAC name: 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide
ChEBI definition: A piperidinecarboxamide obtained by formal condensation of the carboxy group of N-butylpipecolic acid with the amino group of 2,6-dimethylaniline.
Also known as: Anekain, BR-003, Bucaine, Bupivacaina, Bupivacaine, Bupivacaine component of zynrelef, Bupivacaine liposome, Exparel, Exparel liposomal, Liposomal bupivacaine, LIQ-865, LIQ865
Parent form; salt/anhydrous children: CHEMBL1200396
Patent coverage: 10,327 distinct patent families (37,899 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| KCNJ6 | Kir3.2 | Antagonist | 4.2 | 0.1% | P48051 |
| KCNA5 | Kv1.5 | 5.4 | 0.2% | P22460 | |
| KCND3 | Kv4.3 | 4 | 5.5% | Q9UK17 | |
| SCN5A | Nav1.5 | Pore blocker | 4.16 | 0.2% | Q14524 |
Broader ChEMBL bioactivity targets: 5 (assay-derived). Sample: Sodium channel alpha subunits; brain (Types I, II, III), Potassium channel subfamily K member 3, Voltage-gated inwardly rectifying potassium channel KCNH2, Potassium channel subfamily K member 3, Potassium channel subfamily K member 9.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 5 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SCN1A | 5.27 | IC50 | 5400 | nM | CHEMBL_ACT_376599 |
Target pathways
Aggregated over 4 target gene(s): KCNJ6, KCNA5, KCND3, SCN5A.
Top Reactome pathways
22 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 3 | KCNA5, KCND3, KCNJ6 |
| Potassium Channels | 3 | KCNA5, KCND3, KCNJ6 |
| Muscle contraction | 3 | KCNA5, KCND3, SCN5A |
| Cardiac conduction | 3 | KCNA5, KCND3, SCN5A |
| Voltage gated Potassium channels | 2 | KCNA5, KCND3 |
| Neurotransmitter receptors and postsynaptic signal transmission | 1 | KCNJ6 |
| Transmission across Chemical Synapses | 1 | KCNJ6 |
| Developmental Biology | 1 | SCN5A |
| Activation of G protein gated Potassium channels | 1 | KCNJ6 |
| G protein gated Potassium channels | 1 | KCNJ6 |
| Inwardly rectifying K+ channels | 1 | KCNJ6 |
| L1CAM interactions | 1 | SCN5A |
| Axon guidance | 1 | SCN5A |
| Interaction between L1 and Ankyrins | 1 | SCN5A |
| Phase 3 - rapid repolarisation | 1 | KCNA5 |
| Phase 0 - rapid depolarisation | 1 | SCN5A |
| Phase 1 - inactivation of fast Na+ channels | 1 | KCND3 |
| Nervous system development | 1 | SCN5A |
| GABA receptor activation | 1 | KCNJ6 |
| GABA B receptor activation | 1 | KCNJ6 |
| Activation of GABAB receptors | 1 | KCNJ6 |
| Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits | 1 | KCNJ6 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 4 |
| monoatomic ion transmembrane transport | 4 |
| potassium ion transport | 3 |
| regulation of heart rate by cardiac conduction | 3 |
| transmembrane transport | 3 |
| action potential | 2 |
| protein homooligomerization | 2 |
| regulation of atrial cardiac muscle cell membrane repolarization | 2 |
| potassium ion transmembrane transport | 2 |
| atrial cardiac muscle cell action potential | 2 |
| potassium ion export across plasma membrane | 2 |
| regulation of monoatomic ion transmembrane transport | 1 |
| potassium ion import across plasma membrane | 1 |
| response to hypoxia | 1 |
| Notch signaling pathway | 1 |
Indications & clinical
Indications
74 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| bone fracture | 3 | MONDO:0005315 | EFO:0003931 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| chronic pancreatitis | 3 | MONDO:0005003 | EFO:0000342 |
| neoplasm | 3 | MONDO:0005070 | EFO:0000616 |
| exocrine pancreatic carcinoma | 3 | MONDO:0005192 | EFO:0002618 |
| rotator cuff syndrome | 3 | MONDO:0007028 | EFO:1001250 |
| liver disorder | 3 | MONDO:0005154 | EFO:0001421 |
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| hemorrhoid | 3 | MONDO:0004872 | EFO:0009552 |
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| urethral stricture | 3 | MONDO:0002127 | HP:0012227 |
| peritoneal neoplasm | 3 | MONDO:0006901 | MONDO:0002087 |
| radiculopathy | 3 | MONDO:0002959 | MONDO:0002959 |
| lung neoplasm | 3 | MONDO:0021117 | MONDO:0021117 |
| female reproductive organ cancer | 3 | MONDO:0001416 | EFO:1001331 |
| ileus | 3 | MONDO:0004567 | MONDO:0004567 |
| osteoarthritis | 3 | MONDO:0005178 | MONDO:0005178 |
| migraine disorder | 3 | MONDO:0005277 | MONDO:0005277 |
| pancreatic neoplasm | 3 | MONDO:0021040 | EFO:0003860 |
| radius fracture | 3 | MONDO:0005325 | EFO:0003957 |
| pain agnosia | 3 | MONDO:0000675 | EFO:1001484 |
| hypotensive disorder | 2 | MONDO:0005468 | EFO:0005251 |
| hip fracture | 2 | MONDO:0005327 | EFO:0003964 |
| osteoarthritis, hip | 2 | MONDO:0006629 | EFO:1000786 |
| hypospadias | 2 | MONDO:0005345 | EFO:0004209 |
| palmar fibromatosis | 2 | MONDO:0006345 | EFO:0004229 |
| appendicitis | 2 | MONDO:0005649 | EFO:0007149 |
| femoral neck fracture | 2 | MONDO:0043589 | EFO:1001792 |
| mucositis | 2 | MONDO:0020579 | EFO:1001898 |
| plantar fasciitis | 2 | MONDO:0004833 | EFO:1001909 |
| cleft palate | 2 | MONDO:0016064 | HP:0000175 |
| spinal stenosis | 2 | MONDO:0005965 | EFO:0007490 |
| blood coagulation disease | 2 | MONDO:0001531 | EFO:0009314 |
| pulpitis | 2 | MONDO:0006937 | EFO:1001139 |
| lacrimal apparatus disorder | 2 | MONDO:0001854 | HP:0009926 |
| atrial fibrillation | 2 | MONDO:0004981 | EFO:0000275 |
| musculoskeletal system disorder | 2 | MONDO:0002081 | EFO:0009676 |
| ptosis | 2 | MONDO:0000728 | MONDO:0000728 |
| complex regional pain syndrome | 2 | MONDO:0019369 | EFO:1001998 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| brain neoplasm | 1 | MONDO:0021211 | EFO:0003833 |
| intracranial vasospasm | 1 | MONDO:0006812 | EFO:1000994 |
| aorta coarctation | 1 | MONDO:0007345 | EFO:1001267 |
| sinusitis | 1 | MONDO:0005961 | EFO:0007486 |
| morbid obesity | 1 | MONDO:0005139 | EFO:0001074 |
| neuralgia | 0 | MONDO:0021667 | EFO:0005762 |
| soft tissue sarcoma | 0 | MONDO:0018078 | EFO:1001968 |
| post-traumatic stress disorder | 0 | MONDO:0005146 | EFO:0001358 |
| lung disorder | 0 | MONDO:0005275 | EFO:0003818 |
| subarachnoid hemorrhage | 0 | MONDO:0005099 | EFO:0000713 |
23 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 1,218.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 451 |
| Not specified | 428 |
| PHASE3 | 111 |
| PHASE2 | 104 |
| PHASE1 | 43 |
| PHASE2/PHASE3 | 40 |
| EARLY_PHASE1 | 29 |
| PHASE1/PHASE2 | 12 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02381353 | PHASE4 | ACTIVE_NOT_RECRUITING | Exparel Injection for Postoperative Orbital Pain |
| NCT03737292 | PHASE4 | RECRUITING | Liposomal Bupivacaine Versus Plain Bupivacaine After Intercostal Injections For Pain Management After Thoracoscopy |
| NCT03968822 | PHASE4 | ACTIVE_NOT_RECRUITING | Intralipid® 20% for Reversal of Local Anesthetics |
| NCT04003506 | PHASE4 | NOT_YET_RECRUITING | Effectiveness of Adductor Canal Block Using Liposomal Bupivacaine |
| NCT04575688 | PHASE4 | ENROLLING_BY_INVITATION | Periarticular Injection Versus Popliteal Block |
| NCT04577690 | PHASE4 | RECRUITING | PECS Study for CIED Implantation Surgery |
| NCT04680221 | PHASE4 | ACTIVE_NOT_RECRUITING | Stopping Opioid Overuse in Obstetrics to Halt Exposure Trial |
| NCT05285566 | PHASE4 | RECRUITING | Pain Control for Undergoing Costal Cartilage Harvesting |
| NCT05391971 | PHASE4 | ACTIVE_NOT_RECRUITING | Effects of Stellate Ganglion Block in Post-traumatic Stress Disorder |
| NCT05425979 | PHASE4 | ENROLLING_BY_INVITATION | Mepivacaine Versus Bupivacaine Onset Time in Ultrasound-guided Ankle Blocks |
| NCT05602636 | PHASE4 | RECRUITING | Analgesic Effect of Supraclavicular Block and Interscalene Analgesia Versus an Intercostobrachial Nerve Block Versus PCA in Forearm Surgery |
| NCT05605639 | PHASE4 | RECRUITING | Phrenic Nerve Infiltration in Neck Pain |
| NCT05972018 | PHASE4 | RECRUITING | Liposomal Bupivacaine/Bupivacaine in Rectus Sheath Blocks Versus Ropivacaine in Rectus Sheath Blocks And Catheters |
| NCT05996133 | PHASE4 | RECRUITING | Multifidus Cervicis Plane Block Vs. Sham Block For Posterior Cervical Spine Fusion Surgery |
| NCT06006624 | PHASE4 | ENROLLING_BY_INVITATION | Exparel vs Block for ACL Reconstruction |
| NCT06189781 | PHASE4 | RECRUITING | Pain Injection Versus Epidural Anesthesia for Hip Surgery in Pediatric Patients With Cerebral Palsy |
| NCT06252662 | PHASE4 | RECRUITING | Liposomal Bupivacaine Vs Bupivacaine with Dexmedetomidine in Erector Spinae Plane Blocks for Mastectomies |
| NCT06271707 | PHASE4 | RECRUITING | Stellate Ganglion Block |
| NCT06381401 | PHASE4 | RECRUITING | Bupivacaine 0.125% Versus Bupivacaine 0.25% in Superficial Cervical Plexus Block for Tympanomastoid Surgeries in Adults |
| NCT06416891 | PHASE4 | NOT_YET_RECRUITING | Effect of Adding Dexamethasone to Bupivacaine 0.25% in SCPB on Surgical Field Visibility During Tympanomastoid Surgery |
| NCT06432127 | PHASE4 | NOT_YET_RECRUITING | Role of Ultrasound Guide Greater Occipital Nerve Block at Second Cervical Vertebra in Migraine Headache Prophylaxis |
| NCT06465992 | PHASE4 | ENROLLING_BY_INVITATION | Liposomal Bupivacaine With Dexamethasone for Foot Surgery |
| NCT06474949 | PHASE4 | NOT_YET_RECRUITING | Local Anesthetic for Plateau Fractures |
| NCT06557018 | PHASE4 | RECRUITING | Efficacy and Safety of Liposomal Bupivacaine Using Periarticular Injection in Total Knee Arthroplasty |
| NCT06569953 | PHASE4 | RECRUITING | Efficacy and Safety of Liposomal Bupivacaine Injection for Paravertebral Nerve Block in the Treatment of Acute and Chronic Pain After Thoracoscopic Pneumonectomy: A Multicenter, Randomized, Double-blind, Controlled Clinical Trial |
| NCT06574022 | PHASE4 | RECRUITING | Post-mastectomy Recovery: Comparing Preoperative PECS-II Blocks With Intraoperative Pectoral Blocks |
| NCT06575010 | PHASE4 | ENROLLING_BY_INVITATION | Exparel v Dexamethasone in RCR |
| NCT06590402 | PHASE4 | RECRUITING | Anterior Femoral and Adductor Canal Nerve Blocks in Peds Knees |
| NCT06619340 | PHASE4 | ENROLLING_BY_INVITATION | EXPAREL IPSA Block in Knee Arthroplasty |
| NCT06644261 | PHASE4 | RECRUITING | Transvaginal Versus Fluoroscopy-guided Trans Gluteal Pudendal Nerve Block for Pudendal Neuralgia |
| NCT06653621 | PHASE4 | NOT_YET_RECRUITING | Effect of Bupivacaine Liposomes or Bupivacaine for Femoral Triangle or Adductor Block on Analgesia After Total Knee Replacement |
| NCT06677827 | PHASE4 | NOT_YET_RECRUITING | Effect of Adding Magnesium Sulphate as Adjuvant to Bupivacaine in Ultrasound Guided External Oblique Intercostal Plane Block in Upper Abdominal Cancer Surgery.to Assess the Total Postoperative Opioid Consumption in the First 24 h and Evaluate Post Operative VAS Score |
| NCT06685705 | PHASE4 | NOT_YET_RECRUITING | Comparative Study Between Intrathecal Magnesium Sulfate, Neostigmine and Fentanyl as Adjuvant for Bubivacaine in Postoperative Analgesia in Lower Abdominal Surgeries |
| NCT06694077 | PHASE4 | NOT_YET_RECRUITING | Suprazygomatic Maxillary Nerve Block for Management of Postoperative Pain in Adenotonsillectomy Patients |
| NCT06720337 | PHASE4 | NOT_YET_RECRUITING | Comparative Study Between the Analgesic Effect of Dexmedetomidine and Magnesium Sulfate as Adjuvant to Bupivacaine Using Ultrasound-Guided Transversus Abdominis Plane Block in Abdominal Hysterectomy : A Randomized Double-blinded Study |
| NCT06737341 | PHASE4 | NOT_YET_RECRUITING | Bupivacaine Liposomes or Bupivacaine for CMB on Postoperative Analgesia in Laparoscopic Hepatobiliary Pancreatic Surgery |
| NCT06747975 | PHASE4 | NOT_YET_RECRUITING | Preventative Effect of Combining Dexamethasone with Ondansetron on Postoperative Nausea, Vomiting and Shivering in Children Undergoing Caudal Anesthesia on Hypospadias Surgery |
| NCT06752525 | PHASE4 | NOT_YET_RECRUITING | Opioid Sparing Effect of Sphenopalatine Ganglion Block in Functional Endoscopic Sinus Surgery: a Randomized Controlled Clinical Trial. |
| NCT06752629 | PHASE4 | NOT_YET_RECRUITING | Comparison Between Dexmedetomidine and Fentanyl As an Adjuvant to Bupivacaine in the Paravertebral Nerve Block in Laparoscopic Cholecystectomy for Postoperative Analgesia: Randomized Comparative Clinical Trial. |
| NCT06783764 | PHASE4 | ACTIVE_NOT_RECRUITING | Comparative Study Between Combined Modified Pectoral Nerve Block (PECSΙΙ) and Transversus Thoracic Plane Block Versus Erector Spinae Plane Block for Post-operative Analgesia Following Breast Surgeries, (randomized Clinical Trial Study) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
143 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Belzutifan | PubChem | Approved | KCNA5, KCND3, SCN5A |
| DARIFENACIN | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| DARUNAVIR | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| DEFERASIROX | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| Diltiazem | ChEMBL + PubChem | Phase 4 (approved) | KCNA5, SCN5A |
| DULOXETINE | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| FLECAINIDE | ChEMBL + PubChem | Phase 4 (approved) | KCNA5, SCN5A |
| Lamotrigine | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| Lidocaine | ChEMBL + PubChem | Phase 4 (approved) | KCNA5, SCN5A |
| Moxifloxacin | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| NEBIVOLOL | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| Nelfinavir | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| Palonosetron | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| Propafenone | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| QUINIDINE | ChEMBL + PubChem | Phase 4 (approved) | KCNA5, SCN5A |
| Silodosin | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| SOLIFENACIN | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| SUNITINIB | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| TOLTERODINE | ChEMBL + PubChem | Phase 4 (approved) | KCND3, SCN5A |
| NIFEDIPINE | ChEMBL | Phase 4 (approved) | KCNA5, SCN5A |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | KCNA5, SCN5A |
| VERNAKALANT | ChEMBL | Phase 4 (approved) | KCNA5, SCN5A |
| Desvenlafaxine | PubChem | Approved | KCND3, SCN5A |
| Tadalafil | PubChem | Approved | KCND3, SCN5A |
| Dronedarone | ChEMBL + PubChem | Phase 4 (approved) | KCNA5 |
| VARDENAFIL | ChEMBL + PubChem | Phase 4 (approved) | KCND3 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | SCN5A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | SCN5A |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| ASENAPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | SCN5A |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | SCN5A |
| BENZONATATE | ChEMBL | Phase 4 (approved) | SCN5A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SCN5A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | SCN5A |
| CARBAMAZEPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | SCN5A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | SCN5A |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | SCN5A |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | SCN5A |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| DABIGATRAN ETEXILATE | ChEMBL | Phase 4 (approved) | SCN5A |
| DASATINIB | ChEMBL | Phase 4 (approved) | SCN5A |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | SCN5A |
| DIBUCAINE | ChEMBL | Phase 4 (approved) | SCN5A |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | SCN5A |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | SCN5A |
| DROPERIDOL | ChEMBL | Phase 4 (approved) | SCN5A |
| ETIDOCAINE | ChEMBL | Phase 4 (approved) | SCN5A |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | SCN5A |
| FELODIPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | SCN5A |
| FLUVOXAMINE | ChEMBL | Phase 4 (approved) | SCN5A |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | SCN5A |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | SCN5A |
| ISRADIPINE | ChEMBL | Phase 4 (approved) | SCN5A |
| LETERMOVIR | ChEMBL | Phase 4 (approved) | SCN5A |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | SCN5A |
| LOPINAVIR | ChEMBL | Phase 4 (approved) | SCN5A |
Related Atlas pages
- Genes: KCNJ6, KCNA5, KCND3, SCN5A
- Diseases: bone fracture, injury, breast neoplasm, chronic pancreatitis, neoplasm, exocrine pancreatic carcinoma, rotator cuff syndrome, liver disorder, non-small cell lung carcinoma, hemorrhoid, osteoarthritis, knee, urethral stricture, peritoneal neoplasm, radiculopathy, lung neoplasm, female reproductive organ cancer, ileus, osteoarthritis, migraine disorder, pancreatic neoplasm, radius fracture, pain agnosia
- Drugs: Belzutifan, Darifenacin, Darunavir, Deferasirox, Diltiazem, Duloxetine, Flecainide, Lamotrigine, Lidocaine, Moxifloxacin, Nebivolol, Nelfinavir, Paliperidone, Palonosetron, Propafenone, Quinidine, Silodosin, Solifenacin, Sunitinib, Tolterodine, Nifedipine, Sertindole, Vernakalant, Desvenlafaxine, Tadalafil, Dronedarone, Vardenafil, Amiodarone, Amitriptyline, Amlodipine, Asenapine, Astemizole, Bazedoxifene, Benzonatate, Bepridil, Candesartan Cilexetil, Carbamazepine, Carvedilol, Chlorpromazine, Cisapride, Clemastine, Clozapine, Dabigatran Etexilate, Dasatinib, Desipramine, Dibucaine, Diphenhydramine, Domperidone, Droperidol, Etidocaine, Fedratinib, Felodipine, Fluphenazine, Fluvoxamine, Haloperidol, Imipramine, Isradipine, Letermovir, Loperamide, Lopinavir