Bupropion
drugOn this page
Also known as AmfebutamoneBupropion extended releaseBupropion slow releaseBupropioneNSC-758686rac-bupropionSID90340803SID174006913(R/S)-Bupropion
Summary
Bupropion (CHEMBL894) is an approved small-molecule antidepressant (ATC N06AX12) targeting SLC6A2 and SLC6A3; indicated across 32 conditions including major depressive disorder and depressive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AX12
- Targets: 2 (SLC6A2, SLC6A3)
- Indications: 32 conditions
- Clinical trials: 213
- Chemistry: 239.74 Da · C13H18ClNO
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL894 |
| Name | Bupropion |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 444 |
| ChEBI | CHEBI:3219 |
| ATC | N06AX12 |
| Molecular formula | C13H18ClNO |
| Molecular weight | 239.74 |
| InChIKey | SNPPWIUOZRMYNY-UHFFFAOYSA-N |
SMILES: CC(C(=O)C1=CC(=CC=C1)Cl)NC(C)(C)C
IUPAC name: 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one
ChEBI definition: An aromatic ketone that is propiophenone carrying a tert-butylamino group at position 2 and a chloro substituent at position 3 on the phenyl ring.
Pharmacological roles (ChEBI): antidepressant.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Amfebutamone, Bupropion, Bupropion extended release, Bupropion slow release, Bupropione, NSC-758686, bupropion, rac-bupropion, SID90340803, BUPROPION, SID174006913, (R/S)-Bupropion
Parent form; salt/anhydrous children: CHEMBL1698, CHEMBL1201735
Patent coverage: 10,242 distinct patent families (36,982 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 36,037 (97%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC6A2 | NET | Inhibition | 6.36 | 0.4% | P23975 |
| SLC6A3 | DAT | Inhibition | 6.35 | 0.2% | Q01959 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Acetylcholine receptor; alpha1/beta1/delta/gamma, Neuronal acetylcholine receptor; alpha4/beta2, Neuronal acetylcholine receptor; alpha4/beta4, Neuronal acetylcholine receptor; alpha3/beta4, Neuronal acetylcholine receptor; alpha3/beta2, Sodium-dependent noradrenaline transporter, Sodium-dependent serotonin transporter, Histamine H1 receptor, Kappa-type opioid receptor, Sodium-dependent dopamine transporter.
Bioactivity
ChEMBL activities: 41 potent at pChembl ≥ 5 of 51 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SLC6A3 | 6.76 | Ki | 173 | nM | CHEMBL_ACT_27603236 |
| SLC6A3 | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_24965240 |
| P23977 | 6.43 | Ki | 371.5 | nM | CHEMBL_ACT_1246784 |
| SLC6A3 | 6.36 | Ki | 441 | nM | CHEMBL_ACT_2657847 |
| SLC6A2 | 6.35 | IC50 | 443 | nM | CHEMBL_ACT_2990800 |
| SLC6A3 | 6.26 | IC50 | 550 | nM | CHEMBL_ACT_15023467 |
| SLC6A3 | 6.18 | IC50 | 658 | nM | CHEMBL_ACT_3118271 |
| SLC6A3 | 6.18 | IC50 | 660 | nM | CHEMBL_ACT_3360058 |
| SLC6A3 | 6.18 | IC50 | 658 | nM | CHEMBL_ACT_6312626 |
| SLC6A3 | 6.08 | Ki | 821.4 | nM | CHEMBL_ACT_7602723 |
| SLC6A3 | 6.07 | AC50 | 842.8 | nM | CHEMBL_ACT_25124622 |
| SLC6A3 | 6.06 | Ki | 871 | nM | CHEMBL_ACT_2990786 |
| SLC6A3 | 6.03 | IC50 | 945 | nM | CHEMBL_ACT_2990784 |
| CHRNB2 | 6 | IC50 | 1000 | nM | CHEMBL_ACT_1484931 |
| SLC6A3 | 5.99 | IC50 | 1034 | nM | CHEMBL_ACT_7602722 |
| SLC6A3 | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_18030833 |
| SLC6A3 | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_18212988 |
| SLC6A3 | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_18667291 |
| SLC6A3 | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_19448672 |
| SLC6A2 | 5.84 | IC50 | 1450 | nM | CHEMBL_ACT_708463 |
| SLC6A2 | 5.8 | IC50 | 1600 | nM | CHEMBL_ACT_24965235 |
| SLC6A3 | 5.8 | IC50 | 1567 | nM | CHEMBL_ACT_2657848 |
| CHRNB4 | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_1484934 |
| CHRNB4 | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_15023472 |
| CHRNB4 | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_3359558 |
| ITGA5 | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_6312587 |
| SLC6A2 | 5.73 | IC50 | 1850 | nM | CHEMBL_ACT_3118287 |
| SLC6A2 | 5.73 | IC50 | 1850 | nM | CHEMBL_ACT_3360043 |
| SLC6A2 | 5.73 | IC50 | 1850 | nM | CHEMBL_ACT_6312613 |
| CYP2C19 | 5.7 | IC50 | 1998 | nM | CHEMBL_ACT_7602704 |
Target pathways
Aggregated over 2 target gene(s): SLC6A2, SLC6A3.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Disease | 2 | SLC6A2, SLC6A3 |
| Transport of small molecules | 2 | SLC6A2, SLC6A3 |
| R-HSA-425366 | 2 | SLC6A2, SLC6A3 |
| SLC-mediated transmembrane transport | 2 | SLC6A2, SLC6A3 |
| SLC-mediated transport of neurotransmitters | 2 | SLC6A2, SLC6A3 |
| SLC transporter disorders | 2 | SLC6A2, SLC6A3 |
| Disorders of transmembrane transporters | 2 | SLC6A2, SLC6A3 |
| Neurotransmitter clearance | 1 | SLC6A3 |
| Transmission across Chemical Synapses | 1 | SLC6A3 |
| Neuronal System | 1 | SLC6A3 |
| Dopamine clearance from the synaptic cleft | 1 | SLC6A3 |
| Defective neurotransmitter clearance by SLC6A3 causes Parkinsonism-dystonia infantile (PKDYS) | 1 | SLC6A3 |
| Defective SLC6A2 causes orthostatic intolerance (OI) | 1 | SLC6A2 |
| Defective transport of neurotransmitters by SLC6A3 causes Parkinsonism-dystonia infantile (PKDYS) | 1 | SLC6A3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| neurotransmitter transport | 2 |
| amino acid transport | 2 |
| response to xenobiotic stimulus | 2 |
| obsolete monoamine transport | 2 |
| sodium ion transmembrane transport | 2 |
| dopamine uptake involved in synaptic transmission | 2 |
| norepinephrine uptake | 2 |
| transmembrane transport | 2 |
| chemical synaptic transmission | 1 |
| obsolete norepinephrine transport | 1 |
| response to pain | 1 |
| neuron cellular homeostasis | 1 |
| catecholamine uptake | 1 |
| neurotransmitter reuptake | 1 |
| chloride transmembrane transport | 1 |
Indications & clinical
Indications
32 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| major depressive disorder | 4 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 4 | MONDO:0002050 | MONDO:0002050 |
| obesity disorder | 3 | MONDO:0011122 | EFO:0001073 |
| nicotine dependence | 3 | MONDO:0008575 | EFO:0003768 |
| attention deficit-hyperactivity disorder | 3 | MONDO:0007743 | EFO:0003888 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| Crohn disease | 2 | MONDO:0005011 | EFO:0000384 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| restless legs syndrome | 2 | MONDO:0005391 | EFO:0004270 |
| methamphetamine dependence | 2 | MONDO:0005419 | EFO:0004701 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0002046 |
| substance-related disorder | 2 | MONDO:0002494 | MONDO:0002491 |
| Huntington disease | 2 | MONDO:0007739 | MONDO:0007739 |
| B-cell chronic lymphocytic leukemia | 1 | MONDO:0004948 | EFO:0000095 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| physiological sexual disorder | 1 | MONDO:0002134 | EFO:0004714 |
| head and neck cancer | 1 | MONDO:0005627 | EFO:0006859 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| Alzheimer disease | 1 | MONDO:0004975 | MONDO:0004975 |
| type 2 diabetes mellitus | 1 | MONDO:0005148 | MONDO:0005148 |
| inborn mitochondrial metabolism disorder | 1 | MONDO:0004069 | MONDO:0044970 |
| bipolar disorder | 1 | MONDO:0004985 | MONDO:0004985 |
| sickle cell disease | 1 | MONDO:0011382 | MONDO:0011382 |
5 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 213.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 64 |
| PHASE1 | 39 |
| Not specified | 33 |
| PHASE3 | 26 |
| PHASE2 | 25 |
| PHASE2/PHASE3 | 13 |
| PHASE1/PHASE2 | 9 |
| EARLY_PHASE1 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04604509 | PHASE4 | RECRUITING | Nicotine Replacement Therapy, Counseling, Varenicline, and Bupropion for Smoking Cessation, the PISCES I Trial |
| NCT05273996 | PHASE4 | ACTIVE_NOT_RECRUITING | Predictors of Cognitive Outcomes in Geriatric Depression |
| NCT06223880 | PHASE4 | RECRUITING | A Study to Evaluate the Efficacy of AXS-05 Compared to Bupropion in Preventing the Relapse of Depressive Symptoms |
| NCT06254001 | PHASE4 | RECRUITING | Effectiveness of Combined Tobacco Treatment in Hospitalized Subjects |
| NCT06620562 | PHASE4 | RECRUITING | Improving Efficacity of Sleeve Gastrectomy With Naltrexone/Bupropion Extended-release Tablet |
| NCT07266545 | PHASE4 | RECRUITING | RNA Editing as a Biomarker of Antidepressant Response in Unipolar and Bipolar Depression (EDIT-ANDRE) |
| NCT00006170 | PHASE4 | COMPLETED | Bupropion and Weight Control for Smoking Cessation - 1 |
| NCT00044434 | PHASE4 | COMPLETED | Bupropion as a Smoking Cessation Aid in Alcoholics |
| NCT00106197 | PHASE4 | UNKNOWN | Hormone and Sleep Response to Antidepressant Treatment in Adolescents and Adults With Depression |
| NCT00132821 | PHASE4 | COMPLETED | Impact of Smoking Cessation on Sleep - 5 |
| NCT00177567 | PHASE4 | COMPLETED | Treatment of Geriatric Bipolar Mood Disorders: A Pilot Study |
| NCT00178828 | PHASE4 | COMPLETED | Dynamic Measures of Neurochemistry in Mood Disorders |
| NCT00186446 | PHASE4 | COMPLETED | Treatment of Nicotine Dependence and Acute Depression |
| NCT00296647 | PHASE4 | COMPLETED | Smoking Cessation Intervention: Effectiveness in Primary Care |
| NCT00296712 | PHASE4 | COMPLETED | Are Two Antidepressants a Good Initial Treatment for Depression? |
| NCT00296777 | PHASE4 | COMPLETED | Treatment of Depression Following Multiple Brain Tests |
| NCT00316160 | PHASE4 | COMPLETED | Sexual Functioning Study With Antidepressants |
| NCT00320697 | PHASE4 | COMPLETED | Smoking Relapse Prevention in Schizophrenia |
| NCT00320723 | PHASE4 | COMPLETED | Nicotine Replacement Therapy for Smoking Cessation in Schizophrenia |
| NCT00332644 | PHASE4 | COMPLETED | Smoking Cessation Medications: Efficacy, Mechanisms and Algorithms |
| NCT00404755 | PHASE4 | COMPLETED | Dichotic Listening as a Predictor of Medication Response in Depression |
| NCT00429169 | PHASE4 | TERMINATED | Paroxetine/Bupropion in Suicide Attempters/Ideators With Major Depression |
| NCT00449007 | PHASE4 | TERMINATED | Fluoxetine and Bupropion to Treat Patients With Depression and Alcoholism |
| NCT00495352 | PHASE4 | COMPLETED | The Pharmacogenetic Study , Readiness to Change, and Pharmacological Intervention for Smoking Cessation in Schizophrenia |
| NCT00511134 | PHASE4 | TERMINATED | Study of Lunesta Versus Placebo for Sleep Problems Related to Smoking Cessation and Zyban |
| NCT00519428 | PHASE4 | COMPLETED | Does Dual Therapy Hasten Antidepressant Response? |
| NCT00611975 | PHASE4 | COMPLETED | Effect of Antidepressants on Sex Hormone Levels and Sexual Functioning |
| NCT00770666 | PHASE4 | COMPLETED | Combination Medications vs. Patch Alone for Medically-Ill Smokers |
| NCT00846339 | PHASE4 | COMPLETED | PET Imaging Study on Occupancy of Dopamine D2 Receptors and Genotypes After Bupropion Administration |
| NCT00926835 | PHASE4 | TERMINATED | Effect of Antidepressants on the Treatment for Korean Major Depressive Disorder Patients |
| NCT00936299 | PHASE4 | COMPLETED | Bupropion for ADHD in Adolescents With Substance Use Disorder |
| NCT01023659 | PHASE4 | COMPLETED | Distribution of Bupropion and Varenicline to Increase Smoking Cessation Attempts |
| NCT01330043 | PHASE4 | COMPLETED | Extended Treatment for Smoking Cessation |
| NCT01477931 | PHASE4 | COMPLETED | Interventional Study of Wellbutrin XL in Major Depressive Disorder With Atypical Features |
| NCT01541475 | PHASE4 | COMPLETED | Neuroimaging Study of Bupropion Treatment in Patients With Major Depressive Disorder |
| NCT01583023 | PHASE4 | UNKNOWN | Using Repetitive Transcranial Magnetic Stimulation (rTMS) for the Treatment of Bipolar Depression |
| NCT01621022 | PHASE4 | COMPLETED | Bupropion Alone or Combined With Nicotine Gum |
| NCT01716221 | PHASE4 | COMPLETED | An Objective Double-blind Evaluation of Bupropion and Citalopram in an Individual With Friedreich Ataxia |
| NCT01764867 | PHASE4 | UNKNOWN | Algorithm Guided Treatment Strategies for Major Depressive Disorder |
| NCT01942187 | PHASE4 | WITHDRAWN | A Comparison of Medication Augmentation and PST in the Treatment of Depression in Older Adults |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 34 clinical and 116 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
585 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| DACOMITINIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| Idelalisib | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| Olodaterol | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| TAFENOQUINE | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| UMECLIDINIUM | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| VORAPAXAR | ChEMBL + PubChem | Phase 4 (approved) | SLC6A2, SLC6A3 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AMINOCAPROIC ACID | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENOXINATE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENZIODARONE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BENZYL BENZOATE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CARBINOXAMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CETIRIZINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CHLORPHENTERMINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CINACALCET | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | SLC6A2, SLC6A3 |
Related Atlas pages
- Genes: SLC6A2, SLC6A3
- Diseases: major depressive disorder, depressive disorder, obesity disorder, nicotine dependence, attention deficit-hyperactivity disorder, anxiety, dementia
- Drugs: Afatinib, Amitriptyline, Crizotinib, Dacomitinib, Idelalisib, Olodaterol, Pimavanserin, Regorafenib, Tafenoquine, Umeclidinium, Vorapaxar, Acetophenazine, Aminocaproic Acid, Amiodarone, Amlodipine, Amodiaquine, Amoxapine, Aripiprazole, Asenapine, Astemizole, Atomoxetine, Azelastine, Bazedoxifene, Benfluorex, Benoxinate, Benperidol, Benziodarone, Benzphetamine, Benztropine, Benzydamine, Benzyl Benzoate, Bepridil, Bexarotene, Bithionol, Bosutinib, Brexpiprazole, Bromhexine, Bromodiphenhydramine, Bromperidol, Brompheniramine, Cabergoline, Calcitriol, Candesartan Cilexetil, Cannabidiol, Carbinoxamine, Carvedilol, Caspofungin, Celecoxib, Cetirizine, Chlorhexidine, Chlorpheniramine, Chlorphentermine, Chlorpromazine, Chlorprothixene, Cinacalcet, Cinnarizine, Citalopram, Clemastine, Clomiphene