Buspirone
drugOn this page
Also known as BCI-024BuspironaGen-buspironeSID11110857SID11112732SID11113821SID26751994SID90340780SID104171117BuspironBuspinoneSID144203643SID144212688SID170464909
Summary
Buspirone (CHEMBL49) is an approved small-molecule anxiolytic drug (ATC N05BE01) targeting HTR7 and HTR1A; indicated across 20 conditions including anxiety and dementia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05BE01
- Targets: 2 (HTR7, HTR1A)
- Indications: 20 conditions
- Clinical trials: 54
- Chemistry: 385.5 Da · C21H31N5O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL49 |
| Name | Buspirone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2477 |
| ChEBI | CHEBI:3223 |
| ATC | N05BE01 |
| Molecular formula | C21H31N5O2 |
| Molecular weight | 385.5 |
| InChIKey | QWCRAEMEVRGPNT-UHFFFAOYSA-N |
SMILES: C1CCC2(C1)CC(=O)N(C(=O)C2)CCCCN3CCN(CC3)C4=NC=CC=N4
IUPAC name: 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione
ChEBI definition: An azaspiro compound that is 8-azaspiro[4.5]decane-7,9-dione substituted at the nitrogen atom by a 4-(piperazin-1-yl)butyl group which in turn is substituted by a pyrimidin-2-yl group at the N4 position.
Pharmacological roles (ChEBI): anxiolytic drug, sedative, serotonergic agonist, EC 3.4.21.26 (prolyl oligopeptidase) inhibitor.
Also known as: BCI-024, Buspirona, Buspirone, Gen-buspirone, buspirone, SID11110857, SID11112732, SID11113821, SID26751994, SID90340780, SID104171117, Buspiron
Parent form; salt/anhydrous children: CHEMBL1200399
Patent coverage: 6,273 distinct patent families (23,063 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR7 | 5-HT7 receptor | Antagonist | 6.4 | 0.8% | P34969 |
| HTR1A | 5-HT1A receptor | Partial agonist | 8 | 0% | P08908 |
Broader ChEMBL bioactivity targets: 41 (assay-derived). Sample: Solute carrier family 22 member 2, Multidrug and toxin extrusion protein 1, Multidrug and toxin extrusion protein 2, 5-hydroxytryptamine receptor 2B, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Adrenergic receptor alpha-2, Dopamine receptor, Serotonin 2 (5-HT2) receptor, Adrenergic receptor alpha-1.
Bioactivity
ChEMBL activities: 171 potent at pChembl ≥ 5 of 194 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR1A | 8.51 | Ki | 3.1 | nM | CHEMBL_ACT_159622 |
| P19327 | 8.42 | Ki | 3.8 | nM | CHEMBL_ACT_2287026 |
| HTR1A | 8.4 | Ki | 4 | nM | CHEMBL_ACT_18858923 |
| HTR1A | 8.32 | Ki | 4.78 | nM | CHEMBL_ACT_18168816 |
| HTR1A | 8.3 | Ki | 5.01 | nM | CHEMBL_ACT_22404436 |
| HTR1A | 8.3 | Ki | 5.01 | nM | CHEMBL_ACT_22781486 |
| HTR1A | 8.3 | Ki | 5.01 | nM | CHEMBL_ACT_24845262 |
| HTR1A | 8.3 | Ki | 5 | nM | CHEMBL_ACT_27894149 |
| P19327 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_307664 |
| P19327 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_340294 |
| HTR1A | 8.18 | Ki | 6.6 | nM | CHEMBL_ACT_328488 |
| P19327 | 8.15 | IC50 | 7.13 | nM | CHEMBL_ACT_1307834 |
| P19327 | 8.15 | Ki | 7 | nM | CHEMBL_ACT_749624 |
| HTR1A | 8.07 | Ki | 8.6 | nM | CHEMBL_ACT_749639 |
| HTR1A | 8.05 | Ki | 8.9 | nM | CHEMBL_ACT_18700518 |
| P19327 | 8.03 | Ki | 9.3 | nM | CHEMBL_ACT_749633 |
| P19327 | 8.03 | Ki | 9.31 | nM | CHEMBL_ACT_7607088 |
| P19327 | 8 | Ki | 10 | nM | CHEMBL_ACT_1134306 |
| HTR1A | 8 | Kd | 10 | nM | CHEMBL_ACT_2930079 |
| P19327 | 8 | Ki | 10 | nM | CHEMBL_ACT_792400 |
| P19327 | 8 | Ki | 10 | nM | CHEMBL_ACT_896540 |
| P19327 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_102327 |
| P19327 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_1521984 |
| HTR1A | 7.92 | Ki | 12 | nM | CHEMBL_ACT_13375491 |
| P19327 | 7.91 | Ki | 12.3 | nM | CHEMBL_ACT_889350 |
| DRD2 | 7.89 | Ki | 13 | nM | CHEMBL_ACT_159623 |
| DRD2 | 7.89 | Ki | 13 | nM | CHEMBL_ACT_1718526 |
| P19327 | 7.89 | IC50 | 12.8 | nM | CHEMBL_ACT_53362 |
| P19327 | 7.89 | IC50 | 12.8 | nM | CHEMBL_ACT_742814 |
| P19327 | 7.86 | Ki | 13.8 | nM | CHEMBL_ACT_1250634 |
Target pathways
Aggregated over 2 target gene(s): HTR7, HTR1A.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | HTR1A, HTR7 |
| Signaling by GPCR | 2 | HTR1A, HTR7 |
| Class A/1 (Rhodopsin-like receptors) | 2 | HTR1A, HTR7 |
| Amine ligand-binding receptors | 2 | HTR1A, HTR7 |
| Serotonin receptors | 2 | HTR1A, HTR7 |
| GPCR ligand binding | 2 | HTR1A, HTR7 |
| GPCR downstream signalling | 1 | HTR7 |
| G alpha (s) signalling events | 1 | HTR7 |
| RHOBTB3 ATPase cycle | 1 | HTR7 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| chemical synaptic transmission | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| G protein-coupled serotonin receptor signaling pathway | 2 |
| smooth muscle contraction | 1 |
| adenylate cyclase-activating serotonin receptor signaling pathway | 1 |
| circadian rhythm | 1 |
| blood circulation | 1 |
| vasoconstriction | 1 |
| behavioral fear response | 1 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 1 |
| serotonin receptor signaling pathway | 1 |
| gamma-aminobutyric acid signaling pathway | 1 |
| positive regulation of cell population proliferation | 1 |
Indications & clinical
Indications
20 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| anxiety | 4 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| Parkinson disease | 3 | MONDO:0005180 | MONDO:0005180 |
| generalized anxiety disorder | 3 | MONDO:0001942 | EFO:1001892 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| autism spectrum disorder | 2 | MONDO:0005258 | EFO:0003756 |
| autism | 2 | MONDO:0005260 | EFO:0003758 |
| attention deficit-hyperactivity disorder | 2 | MONDO:0007743 | EFO:0003888 |
| physiological sexual disorder | 2 | MONDO:0002134 | EFO:0004714 |
| spinal cord injury | 2 | MONDO:0043797 | EFO:1001919 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| gastroparesis | 2 | MONDO:0006769 | EFO:1000948 |
| major depressive disorder | 2 | MONDO:0002009 | MONDO:0002009 |
| dyspepsia | 1 | MONDO:0002268 | EFO:0008533 |
| systemic sclerosis | 0 | MONDO:0005100 | EFO:0000717 |
4 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 54.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 18 |
| PHASE4 | 15 |
| PHASE3 | 6 |
| Not specified | 5 |
| PHASE1/PHASE2 | 4 |
| PHASE1 | 3 |
| EARLY_PHASE1 | 2 |
| PHASE2/PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04118387 | PHASE4 | RECRUITING | Central Sleep Apnea : Physiologic Mechanisms to Inform Treatment |
| NCT04400266 | PHASE4 | RECRUITING | Buspirone and Melatonin for Depression Following Traumatic Brain Injury |
| NCT05629325 | PHASE4 | RECRUITING | Buspirone for Weak or Absent Esophageal Peristalsis |
| NCT07439042 | PHASE4 | NOT_YET_RECRUITING | Buspirone for Anxiety in Autistic Youth |
| NCT00021528 | PHASE4 | COMPLETED | Sequenced Treatment Alternatives to Relieve Depression (STAR*D) |
| NCT00326235 | PHASE4 | COMPLETED | Effects of Buspirone in Opiate Withdrawal |
| NCT00334360 | PHASE4 | COMPLETED | Dexmed/Buspirone Synergism on Shivering |
| NCT00875836 | PHASE4 | COMPLETED | Buspirone Treatment for Marijuana Dependence |
| NCT01546896 | PHASE4 | WITHDRAWN | Effects of Buspar on Depressive Symptom Improvement and Neuroprotection in Patients With Anxiety Disorder |
| NCT01821690 | PHASE4 | COMPLETED | Buspirone for the Treatment of Traumatic Brain Injury (TBI) Irritability and Aggression |
| NCT02273154 | PHASE4 | UNKNOWN | Randomized,Controlled and Open-label Study of Buspirone add-on Treatment in Patients With Major Depression Disorder |
| NCT02483598 | PHASE4 | TERMINATED | Mechanistic Investigation Of Intestinal Cytochrome p450 3A4 Following Roux-en-Y Surgery And Its Effect on Plasma Concentrations of Buspirone |
| NCT03444831 | PHASE4 | COMPLETED | Buspirone Plus Omeprazole for Functional Dyspepsia |
| NCT03538431 | PHASE4 | COMPLETED | Improving Driving in Young People With Autism Spectrum Disorders |
| NCT04807517 | PHASE4 | COMPLETED | Buspirone Treatment of Anxiety in Williams Syndrome |
| NCT00178971 | PHASE3 | COMPLETED | Serotonin 1A Agonists and Cognition in Schizophrenia |
| NCT00746954 | PHASE3 | TERMINATED | Buspirone as a Potential Treatment for Recurrent Central Apnea |
| NCT00873509 | PHASE2/PHASE3 | COMPLETED | Buspirone in the Treatment of 2-6 Year Old Children With Autistic Disorder |
| NCT01833312 | PHASE3 | TERMINATED | Cooling Plus Best Medical Treatment Versus Best Medical Treatment Alone for Acute Ischaemic Stroke |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT02617017 | PHASE3 | COMPLETED | Buspirone Treatment of Iatrogenic Dyskinesias in Advanced Parkinson’ Disease |
| NCT05430217 | PHASE3 | COMPLETED | Efficacy and Safety of Buspirone, Sustained-release Tablets, 15 mg in Patients With Autonomic Dysfunction Syndrome Accompanied by Vertigo |
| NCT02313194 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Spinal Cord Neuromodulation for Spinal Cord Injury |
| NCT04458324 | PHASE2 | ACTIVE_NOT_RECRUITING | Hybrid Functional Electrical Stimulation Exercise to Prevent Cardiopulmonary Declines in High-level Spinal Cord Injury |
| NCT05511909 | PHASE2 | RECRUITING | Evaluating Buspirone to Treat Opioid Withdrawal |
| NCT00149617 | PHASE2 | COMPLETED | Effectiveness of Buspirone and Motivational Enhancement Therapy for the Treatment of Marijuana Dependence - 1 |
| NCT00166621 | PHASE1/PHASE2 | COMPLETED | Early Pharmacotherapy Aimed at Neuroplasticity in Autism : Safety and Efficacy |
| NCT00174226 | PHASE2 | COMPLETED | Treatment of Adult ADHD With Atomoxetine or Atomoxetine and Buspar |
| NCT00360191 | PHASE2 | COMPLETED | A Placebo-Controlled Trial of Buspirone for Treatment of Marijuana Dependence |
| NCT00705003 | PHASE2 | COMPLETED | Efficacy and Safety Study of a Combination Product [Drug:BCI-024 (Buspirone) and Drug:BCI-049 (Melatonin)] to Treat Major Depressive Disorder (MDD) |
| NCT01267292 | PHASE2 | COMPLETED | Psychopharmacology for Cocaine Dependence - Buspirone |
| NCT01395953 | PHASE2 | WITHDRAWN | Double-blind Trial of Buspirone for the Treatment of Anxiety in Youth With Autism Spectrum Disorders |
| NCT01496612 | PHASE2 | TERMINATED | Buspirone Therapy for Localized Epilepsy |
| NCT01641159 | PHASE2 | COMPLETED | Study of Buspirone for Relapse-Prevention in Adults With Cocaine Dependence |
| NCT01699828 | PHASE1/PHASE2 | COMPLETED | Exploring Occupancy of Dopamine D3 Receptor by Buspirone in Humans Using PET |
| NCT02101203 | PHASE2 | COMPLETED | Lybridos in Pre-and Postmenopausal Women With Hypoactive Sexual Desire Disorder |
| NCT02132832 | PHASE2 | COMPLETED | Buspirone, Stress, and Attentional Bias to Marijuana Cues |
| NCT02458469 | PHASE2 | COMPLETED | Role of Enhancing Serotonin Receptors Activity for Sleep Apnea Treatment in Patients With SCI |
| NCT02803749 | PHASE2 | COMPLETED | Buspirone in Parkinson’s Disease |
| NCT03432065 | PHASE2 | WITHDRAWN | A Pilot Study of Buspirone for the Treatment of Anxiety in Youth with Autism Spectrum Disorders |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 1 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
423 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BREXPIPRAZOLE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR7 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR7 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR7 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CLONIDINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| FROVATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| LURASIDONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| MIRTAZAPINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| PERPHENAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| QUETIAPINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| SILODOSIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| SUMATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| TAMSULOSIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| THIOTHIXENE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| VILAZODONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR7 |
| BRILAROXAZINE | ChEMBL | Phase 3 | HTR1A, HTR7 |
| IDALOPIRDINE | ChEMBL | Phase 3 | HTR1A, HTR7 |
| INTEPIRDINE | ChEMBL | Phase 3 | HTR1A, HTR7 |
| NALUZOTAN | ChEMBL | Phase 3 | HTR1A, HTR7 |
| OXITRIPTAN | ChEMBL | Phase 3 | HTR1A, HTR7 |
| SEROTONIN | ChEMBL | Phase 3 | HTR1A, HTR7 |
| ULOTARONT | ChEMBL | Phase 3 | HTR1A, HTR7 |
| ADOPRAZINE | ChEMBL | Phase 2 | HTR1A, HTR7 |
| AZAPERONE | ChEMBL | Phase 2 | HTR1A, HTR7 |
| CHLOROPHENYLPIPERAZINE | ChEMBL | Phase 2 | HTR1A, HTR7 |
| FANANSERIN | ChEMBL | Phase 2 | HTR1A, HTR7 |
| GSK163090 | ChEMBL | Phase 2 | HTR1A, HTR7 |
| IPSAPIRONE | ChEMBL | Phase 2 | HTR1A, HTR7 |
| JNJ-18038683 FREE BASE | ChEMBL | Phase 2 | HTR1A, HTR7 |
| LYSERGIDE | ChEMBL | Phase 2 | HTR1A, HTR7 |
Related Atlas pages
- Genes: HTR7, HTR1A
- Diseases: anxiety, dementia, depressive disorder, Parkinson disease, generalized anxiety disorder
- Drugs: Brexpiprazole, Dihydroergotamine, Pramipexole, Amoxapine, Aripiprazole, Astemizole, Cariprazine, Carvedilol, Chlorpromazine, Cinacalcet, Cisapride, Clonidine, Clozapine, Cyproheptadine, Dibenzepin, Doxepin, Fluphenazine, Frovatriptan, Haloperidol, Imipramine, Ketanserin, Loxapine, Lurasidone, Methysergide, Mianserin, Mirtazapine, Nefazodone, Olanzapine, Perphenazine, Phenylephrine, Promazine, Quetiapine, Risperidone, Ritonavir, Salmeterol, Silodosin, Sorafenib, Sumatriptan, Tamsulosin, Tegaserod, Thioridazine, Thiothixene, Vilazodone, Vortioxetine, Ziprasidone, Brilaroxazine, Idalopirdine, Intepirdine, Naluzotan, Oxitriptan, Serotonin, Ulotaront