Capsaicin
drugOn this page
Also known as ALGRX 4975ALGRX-4975AusanilAxsainCapsaicinaCapsaicineCapzasin-hpCntx-4975DolenonFEMA NO. 3404MiotonNgx-1998NGX-4010NSC-56353OvocapQutenzaRatden pe 40Togarashi orenjiTrans-capsaicin
Summary
Capsaicin (CHEMBL294199) is an approved small-molecule non-narcotic analgesic (ATC N01BX04) targeting TRPV1, KCNA1, and KCNA2; indicated across 41 conditions including arthritic joint disease and frozen shoulder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N01BX04 (+1 more)
- Targets: 6 (TRPV1, KCNA1, KCNA2…)
- Indications: 41 conditions
- Clinical trials: 137
- Chemistry: 305.4 Da · C18H27NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL294199 |
| Name | Capsaicin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 1548943 |
| ChEBI | CHEBI:3374 |
| ATC | N01BX04, M02AB01 |
| Molecular formula | C18H27NO3 |
| Molecular weight | 305.4 |
| InChIKey | YKPUWZUDDOIDPM-SOFGYWHQSA-N |
SMILES: CC(C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)O)OC
IUPAC name: (E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide
Pharmacological roles (ChEBI): non-narcotic analgesic, voltage-gated sodium channel blocker, TRPV1 agonist.
Also known as: ALGRX 4975, ALGRX-4975, Ausanil, Axsain, Capsaicin, Capsaicina, Capsaicine, Capzasin-hp, Cntx-4975, Dolenon, FEMA NO. 3404, Mioton
Patent coverage: 19,060 distinct patent families (52,939 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 52,501 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TRPV1 | TRPV1 | Agonist | 7.5 | 0.3% | Q8NER1 |
| KCNA1 | Kv1.1 | 4.5 | 0% | Q09470 | |
| KCNA2 | Kv1.2 | Pore blocker | 4.4 | 0.7% | P16389 |
| KCNA7 | Kv1.7 | 4.6 | 0.5% | Q96RP8 | |
| KCNC1 | Kv3.1 | 3.8 | 1.7% | P48547 | |
| CFTR | CFTR | Potentiation | 0.1% | P13569 |
Broader ChEMBL bioactivity targets: 30 (assay-derived). Sample: Transient receptor potential cation channel subfamily M member 8, Microtubule-associated protein tau, Nuclear receptor ROR-gamma, Survival motor neuron protein, Prelamin-A/C, Inositol monophosphatase 1, 4’-phosphopantetheinyl transferase ffp, Menin/Histone-lysine N-methyltransferase MLL, Vanilloid receptor, Polyunsaturated fatty acid 5-lipoxygenase.
Bioactivity
ChEMBL activities: 58 potent at pChembl ≥ 5 of 86 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| TRPV1 | 8.6 | EC50 | 2.51 | nM | CHEMBL_ACT_3292346 |
| TRPV1 | 8.41 | EC50 | 3.9 | nM | CHEMBL_ACT_8032045 |
| TRPV1 | 8.3 | EC50 | 5 | nM | CHEMBL_ACT_25536712 |
| TRPV1 | 8.28 | EC50 | 5.3 | nM | CHEMBL_ACT_15161504 |
| TRPV1 | 8.28 | EC50 | 5.3 | nM | CHEMBL_ACT_22772984 |
| TRPV1 | 8.22 | Ki | 6 | nM | CHEMBL_ACT_3597070 |
| TRPV1 | 8.14 | EC50 | 7.2 | nM | CHEMBL_ACT_19190324 |
| TRPV1 | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_15161499 |
| TRPV1 | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_22772989 |
| TRPV1 | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_25536741 |
| O35433 | 7.72 | IC50 | 19 | nM | CHEMBL_ACT_3597072 |
| TRPV1 | 7.7 | EC50 | 19.95 | nM | CHEMBL_ACT_1204433 |
| TRPV1 | 7.7 | EC50 | 20 | nM | CHEMBL_ACT_2528363 |
| DRD3 | 7.64 | AC50 | 23 | nM | CHEMBL_ACT_25194183 |
| TRPV1 | 7.59 | EC50 | 25.9 | nM | CHEMBL_ACT_19148118 |
| TRPV1 | 7.54 | EC50 | 29 | nM | CHEMBL_ACT_24785206 |
| O35433 | 7.52 | EC50 | 30 | nM | CHEMBL_ACT_509493 |
| TRPV1 | 7.4 | EC50 | 40 | nM | CHEMBL_ACT_1951532 |
| TRPV1 | 7.4 | EC50 | 40 | nM | CHEMBL_ACT_3074188 |
| O35433 | 7.35 | EC50 | 44.8 | nM | CHEMBL_ACT_19148123 |
| TRPV1 | 7.35 | EC50 | 44.8 | nM | CHEMBL_ACT_22994496 |
| O35433 | 7.35 | EC50 | 44.8 | nM | CHEMBL_ACT_2389124 |
| O35433 | 7.35 | EC50 | 44.8 | nM | CHEMBL_ACT_998806 |
| TRPV1 | 6.7 | EC50 | 200 | nM | CHEMBL_ACT_29059684 |
| O35433 | 6.52 | EC50 | 300 | nM | CHEMBL_ACT_786105 |
| O35433 | 6.52 | EC50 | 300 | nM | CHEMBL_ACT_848468 |
| O35433 | 6.52 | EC50 | 300 | nM | CHEMBL_ACT_88485 |
| O35433 | 6.52 | EC50 | 300 | nM | CHEMBL_ACT_93421 |
| O35433 | 6.52 | EC50 | 300 | nM | CHEMBL_ACT_950964 |
| TRPV1 | 6.5 | IC50 | 313 | nM | CHEMBL_ACT_25706563 |
Target pathways
Aggregated over 6 target gene(s): TRPV1, KCNA1, KCNA2, KCNA7, KCNC1, CFTR.
Top Reactome pathways
15 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 4 | KCNA1, KCNA2, KCNA7, KCNC1 |
| Potassium Channels | 4 | KCNA1, KCNA2, KCNA7, KCNC1 |
| Voltage gated Potassium channels | 4 | KCNA1, KCNA2, KCNA7, KCNC1 |
| TRP channels | 1 | TRPV1 |
| ABC-family protein mediated transport | 1 | CFTR |
| RHO GTPases regulate CFTR trafficking | 1 | CFTR |
| Defective CFTR causes cystic fibrosis | 1 | CFTR |
| Ub-specific processing proteases | 1 | CFTR |
| Cargo recognition for clathrin-mediated endocytosis | 1 | CFTR |
| Clathrin-mediated endocytosis | 1 | CFTR |
| RHOQ GTPase cycle | 1 | CFTR |
| Chaperone Mediated Autophagy | 1 | CFTR |
| Late endosomal microautophagy | 1 | CFTR |
| Aggrephagy | 1 | CFTR |
| Developmental Lineage of Pancreatic Ductal Cells | 1 | CFTR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 6 |
| monoatomic ion transmembrane transport | 6 |
| transmembrane transport | 6 |
| action potential | 4 |
| protein homooligomerization | 4 |
| potassium ion transmembrane transport | 4 |
| potassium ion transport | 4 |
| sensory perception of pain | 2 |
| neuronal action potential | 2 |
| corpus callosum development | 2 |
| optic nerve development | 2 |
| regulation of presynaptic membrane potential | 2 |
| negative regulation of transcription by RNA polymerase II | 1 |
| fever generation | 1 |
| diet induced thermogenesis | 1 |
Indications & clinical
Indications
41 indications (13 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| arthritic joint disease | 4 | MONDO:0005578 | EFO:0005856 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| disease of the tendon | 4 | MONDO:0100010 | EFO:1001434 |
| neuralgia | 4 | MONDO:0021667 | EFO:0005762 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| diabetic neuropathy | 3 | MONDO:0006626 | EFO:1000783 |
| head and neck cancer | 3 | MONDO:0005627 | EFO:0006859 |
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| peripheral nervous system disorder | 3 | MONDO:0003620 | EFO:0009387 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| herpes zoster | 3 | MONDO:0005609 | EFO:0006510 |
| common cold | 3 | MONDO:0005709 | EFO:0009364 |
| peripheral neuropathy | 3 | MONDO:0005244 | EFO:0003100 |
| pulmonary arterial hypertension | 2 | MONDO:0015924 | EFO:0001361 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| myofascial pain syndrome | 2 | MONDO:0006862 | EFO:1001054 |
| neuroma | 2 | MONDO:0002173 | EFO:0009619 |
| epicondylitis | 2 | MONDO:0001875 | EFO:1001896 |
| cardiovascular disorder | 2 | MONDO:0004995 | EFO:0000319 |
| pulmonary hypertension | 2 | MONDO:0005149 | MONDO:0005149 |
| stroke disorder | 1 | MONDO:0005098 | EFO:0000712 |
| brain injury | 0 | MONDO:0043510 | MONDO:0043510 |
| amyotrophic lateral sclerosis | 0 | MONDO:0004976 | MONDO:0004976 |
| migraine disorder | 0 | MONDO:0005277 | MONDO:0005277 |
17 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 137.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 49 |
| PHASE2 | 25 |
| PHASE4 | 17 |
| PHASE3 | 15 |
| PHASE1 | 13 |
| EARLY_PHASE1 | 11 |
| PHASE1/PHASE2 | 4 |
| PHASE2/PHASE3 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00176969 | PHASE4 | COMPLETED | Response of Topical Capsaicin in Alopecia Areata |
| NCT00655811 | PHASE4 | COMPLETED | Ethnic Differences in Response to Topical Capsaicin: A Psychophysical Study on Healthy Subjects |
| NCT00697034 | PHASE4 | TERMINATED | Effects of Capsaicin on the Structure, Distribution, and Function of Cutaneous Small Nerve Fibers in Psoriatic Skin |
| NCT00771511 | PHASE4 | WITHDRAWN | Cervical Capsaicin for Labor Induction and Pain Relief |
| NCT01223820 | PHASE4 | COMPLETED | Neuro-immunological Analysis of Idiopathic Rhinitis Patients and Controls Treated With Capsaicin. |
| NCT01252160 | PHASE4 | COMPLETED | Safety and Effectiveness of Repeated Administration of QUTENZA Patches for Treatment of Pain Caused by Nerve Damage |
| NCT01416116 | PHASE4 | COMPLETED | Method of Pre-treatment for Application of QUTENZA Capsaicin 8% Patch |
| NCT01704339 | PHASE4 | UNKNOWN | Qutenza for Critical Ischaemia in End Stage Renal Failure |
| NCT01713426 | PHASE4 | COMPLETED | A Study to Compare QUTENZA With Pregabalin for the Treatment of Peripheral Neuropathic Pain (PNP) After 8 Weeks of Treatment |
| NCT01862523 | PHASE4 | COMPLETED | Mechanisms of Capsaicin Treatment in Idiopathic Rhinitis Patients and Controls |
| NCT01974037 | PHASE4 | COMPLETED | Capsaicin on Salty Gustatory Cortices |
| NCT02288156 | PHASE4 | COMPLETED | Elaboration of Patient-friendly Treatment Strategy With Capsaicin Nasal Spray in Patients With Idiopathic Rhinitis |
| NCT03124407 | PHASE4 | COMPLETED | Osteoarthritis Knee Pain Relief Study of 0.25% 920-CGS-200 |
| NCT03348735 | PHASE4 | TERMINATED | Localized Neuropathic Pain: Topical Treatment Versus Systemic Treatment |
| NCT04238208 | PHASE4 | COMPLETED | The Efficacy and Safety Profile of Capsaicin 8% Patch Versus 5% Lidocaine Patch in Males With Diabetic Neuropathy |
| NCT04283292 | PHASE4 | COMPLETED | Capsaicin for the Treatment of Cannabinoid Hyperemesis Syndrome |
| NCT05298202 | PHASE4 | COMPLETED | The Influence of Capsaicin Gel During Exercise Within the Heat |
| NCT05840562 | PHASE3 | RECRUITING | Capsaicin 179 mg Patch Versus Oral Duloxetine in Patients With Chemotherapy-induced Peripheral Neuropathy |
| NCT05997979 | PHASE3 | RECRUITING | Analgesic Effectiveness of Capsaicin 8% Cutaneous Patch in Children |
| NCT00003610 | PHASE3 | COMPLETED | Capsaicin Lozenges in Treating Patients With Mucositis Caused by Radiation Therapy |
| NCT00115310 | PHASE3 | COMPLETED | Study of NGX-4010 for the Treatment of Postherpetic Neuralgia |
| NCT00300222 | PHASE3 | COMPLETED | Study of NGX-4010 for the Treatment of Postherpetic Neuralgia |
| NCT00321672 | PHASE3 | COMPLETED | Study of NGX-4010 for the Treatment of Painful HIV-Associated Neuropathy |
| NCT00993070 | PHASE2/PHASE3 | COMPLETED | Efficacy and Safety Study of Topical Capsaicin in Painful Diabetic Neuropathy |
| NCT01231750 | PHASE3 | TERMINATED | Efficacy of Topical Capsaicin Cream for Stable Angina |
| NCT01478607 | PHASE3 | COMPLETED | A Study to Evaluate the Long-term Safety of Repeated QUTENZA Administration for Treatment of Pain Caused by Nerve Damage in Diabetic Patients |
| NCT01533428 | PHASE3 | COMPLETED | A Study to Evaluate Efficacy and Safety of a Single Application of Capsaicin 8%Transdermal Delivery System Compared to Placebo in Reducing Pain Intensity in Subjects With Painful Diabetic Peripheral Neuropathy (PDPN) |
| NCT02700815 | PHASE3 | COMPLETED | Capsaicin + Diclofenac Gel in Acute Back Pain or Neck Pain |
| NCT02823912 | PHASE2/PHASE3 | UNKNOWN | Capsaicin Effect on Cytokines Profile in Dyslipidemia |
| NCT02854670 | PHASE2/PHASE3 | TERMINATED | A Study of the Effects of Topical Capsaicin in the Treatment of Provoked Vestibulodynia |
| NCT03153813 | PHASE3 | TERMINATED | Capsaicin Patches In Knee Osteoarthritis In Obese Patients |
| NCT03794388 | PHASE3 | COMPLETED | Evaluation in the Treatment of Neuropathic Pain Post Breast Surgery |
| NCT04967664 | PHASE3 | COMPLETED | Comparison of Qutenza (8% Capsaicin) With a Low-dose Capsaicin for Treatment of Nerve Pain After Surgery |
| NCT05029297 | PHASE3 | COMPLETED | Study With Two Capsaicin Topic Treatments in Diabetic Neuropathy. |
| NCT05093478 | PHASE3 | COMPLETED | The Prevalence of Local Immunoglobulin E (IgE) Elevation and Its Effect on Intranasal Capsaicin Therapy in the Non-allergic Rhinitis Population |
| NCT06807164 | PHASE2 | RECRUITING | Serratus Plane Block (SPB) Versus Capsaïcine Versus Botox-A for Chronic Neuropathic Pain in Post-mastectomy Syndrome |
| NCT00004316 | PHASE1/PHASE2 | COMPLETED | Phase I/II Randomized, Placebo-Controlled Study of Capsaicin for Interstitial Cystitis and Vulvar Vestibulitis |
| NCT00008476 | PHASE2 | COMPLETED | Capsaicin to Control Pain Following Third Molar Extraction |
| NCT00034710 | PHASE2 | COMPLETED | Pilot Study of High-Dose Capsaicin Patches to Treat Postherpetic Neuralgia Pain |
| NCT00130949 | PHASE2 | COMPLETED | ALGRX 4975 in the Treatment of Tennis Elbow |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
42 molecules share ≥1 primary target. Top 42 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Flecainide | PubChem | Approved | KCNA1, KCNA7 |
| DALFAMPRIDINE | ChEMBL + PubChem | Phase 4 (approved) | KCNA1 |
| IVACAFTOR | ChEMBL + PubChem | Phase 4 (approved) | CFTR |
| NIFEDIPINE | ChEMBL + PubChem | Phase 4 (approved) | KCNA1 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | TRPV1 |
| ELEXACAFTOR | ChEMBL | Phase 4 (approved) | CFTR |
| GLYBURIDE | ChEMBL | Phase 4 (approved) | CFTR |
| LUMACAFTOR | ChEMBL | Phase 4 (approved) | CFTR |
| PROPOFOL | ChEMBL | Phase 4 (approved) | TRPV1 |
| TEZACAFTOR | ChEMBL | Phase 4 (approved) | CFTR |
| CORTISONE | ChEMBL + PubChem | Phase 3 (approved) | KCNA1 |
| BAMOCAFTOR | ChEMBL | Phase 3 | CFTR |
| BERGAPTEN | ChEMBL | Phase 3 | KCNA2 |
| CANNABINOL | ChEMBL | Phase 3 | TRPV1 |
| FRAMYCETIN | ChEMBL | Phase 3 | TRPV1 |
| QUERCETIN | ChEMBL | Phase 3 | CFTR |
| RESINIFERATOXIN | ChEMBL | Phase 3 | TRPV1 |
| RUTIN | ChEMBL | Phase 3 | CFTR |
| ZUCAPSAICIN | ChEMBL | Phase 3 | TRPV1 |
| CANNABIDIVARIN | ChEMBL | Phase 2 | TRPV1 |
| CANNABIGEROL | ChEMBL | Phase 2 | TRPV1 |
| GALICAFTOR | ChEMBL | Phase 2 | CFTR |
| GENISTEIN | ChEMBL | Phase 2 | CFTR |
| GLPG-2737 | ChEMBL | Phase 2 | CFTR |
| ICENTICAFTOR | ChEMBL | Phase 2 | CFTR |
| ILEPCIMIDE | ChEMBL | Phase 2 | TRPV1 |
| JTS-653 | ChEMBL | Phase 2 | TRPV1 |
| MAVATREP | ChEMBL | Phase 2 | TRPV1 |
| NAVOCAFTOR | ChEMBL | Phase 2 | CFTR |
| NGD-8243 | ChEMBL | Phase 2 | TRPV1 |
| OLVANIL | ChEMBL | Phase 2 | TRPV1 |
| PIPERINE | ChEMBL | Phase 2 | TRPV1 |
| RISELCAFTOR | ChEMBL | Phase 2 | CFTR |
| SB-705498 | ChEMBL | Phase 2 | TRPV1 |
| TETRAHYDROCANNABIVARIN | ChEMBL | Phase 2 | TRPV1 |
| TETRYLAMMONIUM | ChEMBL | Phase 2 | KCNA1 |
| Amiodarone | PubChem | Approved | KCNA7 |
| Diltiazem | PubChem | Approved | KCNA1 |
| methoxsalen | PubChem | Approved | KCNA1 |
| Quinidine | PubChem | Approved | KCNA7 |
| Tadalafil | PubChem | Approved | CFTR |
| Verapamil | PubChem | Approved | KCNA7 |
Related Atlas pages
- Genes: TRPV1, KCNA1, KCNA2, KCNA7, KCNC1, CFTR
- Diseases: arthritic joint disease, frozen shoulder, disease of the tendon, neuralgia, osteoarthritis, diabetic neuropathy, head and neck cancer, osteoarthritis, knee, peripheral nervous system disorder, breast neoplasm, herpes zoster, common cold, peripheral neuropathy
- Drugs: Flecainide, Dalfampridine, Ivacaftor, Nifedipine, Cannabidiol, Elexacaftor, Glyburide, Lumacaftor, Propofol, Tezacaftor, Cortisone, Bamocaftor, Bergapten, Cannabinol, Framycetin, Quercetin, Resiniferatoxin, Rutin, Zucapsaicin, Amiodarone, Diltiazem, methoxsalen, Quinidine, Tadalafil, Verapamil