Celecoxib
drugOn this page
Also known as CelebrexCelecoxib component of consensiCelecoxib component of seglentisCelebraDFN-15DFN15ElyxybNSC-719627NSC-758624OnsenalSC-58635SID17389545CelecoxibeSID49665790SID26747363SID49666478SID535138SID124890934SID144204686
Summary
Celecoxib (CHEMBL118) is an approved small-molecule non-narcotic analgesic (ATC M01AH01) targeting PTGS1, PTGS2, and CA12; indicated across 117 conditions including ankylosing spondylitis and juvenile idiopathic arthritis; with CIViC clinical evidence for 3 variant-indication associations (e.g. COX2 Overexpression in her2-receptor negative breast cancer).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01AH01 (+1 more)
- Targets: 3 (PTGS1, PTGS2, CA12)
- Indications: 117 conditions
- Clinical trials: 499
- Precision-oncology evidence (CIViC): 3 variant–indication associations
- Chemistry: 381.4 Da · C17H14F3N3O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL118 |
| Name | Celecoxib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2662 |
| ChEBI | CHEBI:41423 |
| ATC | M01AH01, L01XX33 |
| Molecular formula | C17H14F3N3O2S |
| Molecular weight | 381.4 |
| InChIKey | RZEKVGVHFLEQIL-UHFFFAOYSA-N |
SMILES: CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F
IUPAC name: 4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide
ChEBI definition: A member of the class of pyrazoles that is 1H-pyrazole which is substituted at positions 1, 3 and 5 by 4-sulfamoylphenyl, trifluoromethyl and p-tolyl groups, respectively. A cyclooxygenase-2 inhibitor, it is used in the treatment of arthritis.
Pharmacological roles (ChEBI): non-narcotic analgesic, cyclooxygenase 2 inhibitor, geroprotector, non-steroidal anti-inflammatory drug.
Also known as: Celebrex, Celecoxib, Celecoxib component of consensi, Celecoxib component of seglentis, Celebra, DFN-15, DFN15, Elyxyb, NSC-719627, NSC-758624, Onsenal, SC-58635
Parent form; salt/anhydrous children: CHEMBL395268, CHEMBL1801594
Patent coverage: 27,749 distinct patent families (112,844 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS1 | COX-1 | Inhibition | 4.82 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 6.52 | 0% | P35354 |
| CA12 | carbonic anhydrase 12 | Inhibition | 7.74 | 0.2% | O43570 |
Broader ChEMBL bioactivity targets: 62 (assay-derived). Sample: Cytochrome c oxidase subunit 2, Prelamin-A/C, cGMP-specific 3’,5’-cyclic phosphodiesterase, Protein deacetylase HDAC6, Alpha-2B adrenergic receptor, Thyrotropin receptor, Equilibrative nucleoside transporter 1, Carbonic anhydrase 2, D(1A) dopamine receptor, Histone deacetylase.
Bioactivity
ChEMBL activities: 511 potent at pChembl ≥ 5 of 717 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PTGS2 | 9.33 | Ki | 0.47 | nM | CHEMBL_ACT_23150712 |
| Q05769 | 9.29 | IC50 | 0.51 | nM | CHEMBL_ACT_2539030 |
| PTGS2 | 9.28 | IC50 | 0.52 | nM | CHEMBL_ACT_2234764 |
| PTGS2 | 9.28 | IC50 | 0.52 | nM | CHEMBL_ACT_2234795 |
| P22437 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_36227 |
| PTGS2 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_774626 |
| PTGS2 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_876569 |
| PTGS2 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_877100 |
| PTGS2 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_997132 |
| PTGS2 | 8.66 | IC50 | 2.2 | nM | CHEMBL_ACT_1760998 |
| Q05769 | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_23150850 |
| Q05769 | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_23150854 |
| P05979 | 8.43 | IC50 | 3.7 | nM | CHEMBL_ACT_1760997 |
| PTGS2 | 8.32 | IC50 | 4.8 | nM | CHEMBL_ACT_18136961 |
| PTGS2 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_1610388 |
| PTGS2 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_23305828 |
| PTGS2 | 8.17 | IC50 | 6.8 | nM | CHEMBL_ACT_1610389 |
| PTGS2 | 8.15 | IC50 | 7 | nM | CHEMBL_ACT_18241968 |
| Q05769 | 8.06 | IC50 | 8.7 | nM | CHEMBL_ACT_14569696 |
| Q05769 | 8.03 | IC50 | 9.3 | nM | CHEMBL_ACT_36226 |
| PTGS2 | 8 | IC50 | 10 | nM | CHEMBL_ACT_6168012 |
| PTGS2 | 7.99 | IC50 | 10.25 | nM | CHEMBL_ACT_25034798 |
| PTGS2 | 7.95 | IC50 | 11.2 | nM | CHEMBL_ACT_19097395 |
| PTGS2 | 7.92 | IC50 | 12 | nM | CHEMBL_ACT_18469610 |
| PTGS2 | 7.91 | IC50 | 12.2 | nM | CHEMBL_ACT_24709480 |
| PTGS1 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_25022353 |
| CA9 | 7.83 | Ki | 14.8 | nM | CHEMBL_ACT_24686249 |
| PTGS2 | 7.82 | IC50 | 15 | nM | CHEMBL_ACT_25724885 |
| PTGS2 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_15246373 |
| CA9 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_1614182 |
Target pathways
Aggregated over 3 target gene(s): PTGS1, PTGS2, CA12.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| COX reactions | 1 | PTGS1 |
| Metabolism | 1 | CA12 |
| Reversible hydration of carbon dioxide | 1 | CA12 |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| regulation of blood pressure | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| lipid metabolic process | 2 |
| fatty acid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
| embryo implantation | 1 |
| response to nematode | 1 |
| response to selenium ion | 1 |
Indications & clinical
Indications
117 indications (18 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| ankylosing spondylitis | 4 | MONDO:0005306 | EFO:0003898 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
| colorectal neoplasm | 4 | MONDO:0005335 | EFO:0004142 |
| peptic ulcer disease | 4 | MONDO:0004247 | HP:0004398 |
| stroke disorder | 4 | MONDO:0005098 | EFO:0000712 |
| spondylitis | 4 | MONDO:0003937 | MONDO:0003937 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| migraine disorder | 4 | MONDO:0005277 | MONDO:0005277 |
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| gout | 3 | MONDO:0005393 | EFO:0004274 |
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| colorectal adenoma | 3 | MONDO:0005484 | EFO:0005406 |
| nicotine dependence | 3 | MONDO:0008575 | EFO:0003768 |
| osteoarthritis, hip | 3 | MONDO:0006629 | EFO:1000786 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| exocrine pancreatic carcinoma | 3 | MONDO:0005192 | EFO:0002618 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| colonic neoplasm | 3 | MONDO:0005401 | EFO:0004288 |
| head and neck cancer | 3 | MONDO:0005627 | EFO:0006859 |
| postpartum depression | 3 | MONDO:0005929 | EFO:0007453 |
| rectal cancer | 3 | MONDO:0006519 | EFO:1000657 |
| colon carcinoma | 3 | MONDO:0002032 | EFO:1001950 |
| colorectal carcinoma | 3 | MONDO:0024331 | EFO:1001951 |
| macular degeneration | 3 | MONDO:0003004 | EFO:0009606 |
| colorectal adenocarcinoma | 3 | MONDO:0005008 | EFO:0000365 |
| influenza | 3 | MONDO:0005812 | EFO:0007328 |
| pharyngitis | 3 | MONDO:0002258 | MONDO:0002258 |
| lung neoplasm | 3 | MONDO:0021117 | MONDO:0008903 |
| rectal neoplasm | 3 | MONDO:0002165 | MONDO:0044937 |
| hand-foot syndrome | 3 | MONDO:0700048 | EFO:1001893 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| subacute thyroiditis | 3 | MONDO:0006982 | EFO:1001194 |
| nasopharyngeal carcinoma | 3 | MONDO:0015459 | MONDO:0015459 |
| preeclampsia | 2 | MONDO:0005081 | EFO:0000668 |
| benign prostatic hyperplasia | 2 | MONDO:0010811 | EFO:0000284 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| monoclonal gammopathy | 2 | MONDO:0004960 | EFO:0000203 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| sarcoma | 2 | MONDO:0005089 | EFO:0000691 |
| ovarian carcinoma | 2 | MONDO:0005140 | EFO:0001075 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| medulloblastoma | 2 | MONDO:0007959 | EFO:0002939 |
| ovarian neoplasm | 2 | MONDO:0021068 | EFO:0003893 |
| temporomandibular joint disorder | 2 | MONDO:0005473 | EFO:0005279 |
| neuralgia | 2 | MONDO:0021667 | EFO:0005762 |
| stomatitis | 2 | MONDO:0004842 | EFO:1001904 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| spinal muscular atrophy | 2 | MONDO:0001516 | EFO:0008525 |
| rotator cuff syndrome | 2 | MONDO:0007028 | EFO:1001250 |
| central nervous system neoplasm | 2 | MONDO:0006130 | EFO:1000158 |
| brain cancer | 2 | MONDO:0001657 | MONDO:0001657 |
| peritoneal neoplasm | 2 | MONDO:0006901 | MONDO:0002087 |
| papilloma | 2 | MONDO:0002363 | MONDO:0002363 |
| uterine cancer | 2 | MONDO:0002715 | MONDO:0002715 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| oral cavity squamous cell carcinoma | 2 | MONDO:0004958 | EFO:0000199 |
| obsessive-compulsive disorder | 2 | MONDO:0008114 | EFO:0004242 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| chronic hepatitis B virus infection | 2 | MONDO:0005366 | EFO:0004239 |
| intracerebral hemorrhage | 2 | MONDO:0013792 | EFO:0005669 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| lymphangioleiomyomatosis | 2 | MONDO:0011705 | MONDO:0011705 |
| neurofibromatosis type 1 | 2 | MONDO:0018975 | MONDO:0018975 |
| dysplasia of cervix | 2 | MONDO:0006736 | MONDO:0042487 |
| paraganglioma | 2 | MONDO:0000448 | EFO:1000453 |
| tonsillitis | 2 | MONDO:0001039 | MONDO:0001039 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| long COVID-19 | 2 | MONDO:0100233 | MONDO:0100233 |
| oral cavity neoplasm | 1 | MONDO:0021245 | EFO:0003868 |
| cervical adenocarcinoma | 1 | MONDO:0005153 | EFO:0001416 |
| hepatocellular carcinoma | 1 | MONDO:0007256 | EFO:0000182 |
| neuroblastoma | 1 | MONDO:0005072 | EFO:0000621 |
| orthostatic hypotension | 1 | MONDO:0005469 | EFO:0005252 |
| actinic keratosis | 1 | MONDO:0005173 | EFO:0002496 |
| breast carcinoma in situ | 1 | MONDO:0004658 | MONDO:0004658 |
| Wilson disease | 1 | MONDO:0010200 | MONDO:0010200 |
| tuberculosis | 1 | MONDO:0018076 | MONDO:0018076 |
| bone fracture | 1 | MONDO:0005315 | EFO:0003931 |
| triple-negative breast carcinoma | 1 | MONDO:0005494 | EFO:0005537 |
| myositis disease | 1 | MONDO:0021167 | EFO:0000783 |
| anti-neutrophil antibody associated vasculitis | 1 | MONDO:0005435 | EFO:0004826 |
| obesity disorder | 0 | MONDO:0011122 | EFO:0001073 |
| major depressive disorder | 0 | MONDO:0002009 | MONDO:0002009 |
25 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 499.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 156 |
| PHASE4 | 92 |
| PHASE3 | 85 |
| PHASE1 | 75 |
| Not specified | 49 |
| PHASE1/PHASE2 | 24 |
| PHASE2/PHASE3 | 9 |
| EARLY_PHASE1 | 9 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04147013 | PHASE4 | ACTIVE_NOT_RECRUITING | Effect of Celecoxib on Postoperative Analgesia and Disease Severity in AERD Patients with CRS |
| NCT05488847 | PHASE4 | ACTIVE_NOT_RECRUITING | Opioid-Free Pain Protocol After Shoulder Arthroplasty |
| NCT06245109 | PHASE4 | RECRUITING | Brain-Based and Clinical Phenotyping of Pain Pharmacotherapy in Knee Osteoarthritis |
| NCT06379425 | PHASE4 | RECRUITING | Impact of Preoperative Opioid-free Multimodal Analgesia on Time to Trial of Void in Ambulatory Urogynecologic Surgeries |
| NCT06699966 | PHASE4 | NOT_YET_RECRUITING | Stony Brook Medicine Anti-Inflammatory Trial |
| NCT00137033 | PHASE4 | COMPLETED | Celebrex Low Dose ASA Study Examining the Incidence of Gastroduodenal Ulcers in a Healthy Population |
| NCT00139776 | PHASE4 | COMPLETED | Study Of Continuous Use Of Celecoxib Vs. Usual or Intermittent Use |
| NCT00141102 | PHASE4 | COMPLETED | Study Of Celecoxib Or Diclofenac And Omeprazole For Gastrointestinal (GI) Safety In High GI Risk Patients With Arthritis |
| NCT00174317 | PHASE4 | COMPLETED | Celecoxib Versus Diclofenac In The Treatment Of Osteoarthritis Of The Hip |
| NCT00177866 | PHASE4 | TERMINATED | Safety of Celecoxib in Patients With Crohn’s Disease |
| NCT00194090 | PHASE4 | COMPLETED | Efficacy of Celecoxib vs Placebo to Prevent Pain in a Paced Walk |
| NCT00261586 | PHASE4 | COMPLETED | A Safety Trial to Compare Different Analgesics in Combination With Low Dose Aspirin to Study Their Bleeding Properties and Their Effects on the Stomach |
| NCT00290901 | PHASE4 | COMPLETED | Celebrex vs Tramadol in the Treatment of Chronic Lower Back Pain. |
| NCT00292721 | PHASE4 | COMPLETED | Effects of Celecoxib After Percutaneous Coronary Intervention |
| NCT00304317 | PHASE4 | WITHDRAWN | Celecoxib (Celebrex) in the Management of Acute Renal Colic |
| NCT00346216 | PHASE4 | COMPLETED | Prospective Randomized Evaluation Of Celecoxib Integrated Safety Vs Ibuprofen Or Naproxen |
| NCT00359151 | PHASE4 | TERMINATED | Celebrex Total Knee Arthroplasty Study |
| NCT00373685 | PHASE4 | COMPLETED | GI-Reasons- A Trial Of GI Safety Of Celecoxib Compared With Non-Selective Nonsteroidal Antiinflammatory Drugs (NSAIDS) |
| NCT00446797 | PHASE4 | COMPLETED | Open Label Comparative Study On Celecoxib Efficacy And Safety Vs Non-Selective NSAID In Acute Pain Due To Ankle Sprain |
| NCT00447759 | PHASE4 | COMPLETED | The Standard Care Versus Celecoxib Outcome Trial |
| NCT00471341 | PHASE4 | COMPLETED | Effect of Celecoxib on Markers of Vascular Inflammation |
| NCT00473980 | PHASE4 | COMPLETED | Preoperative Non-steroidal Anti-inflammatory Drugs(NSAID) to Colorectal Cancer Patients |
| NCT00484718 | PHASE4 | TERMINATED | Measuring Gait And Self-Reported Pain In Patients With Osteoarthritis Of The Knee Using Placebo/Oxycodone/Celecoxib. |
| NCT00500279 | PHASE4 | UNKNOWN | Effects of Celecoxib On Restenosis After Coronary Intervention and Evolution of Atherosclerosis Trial |
| NCT00520338 | PHASE4 | COMPLETED | Celecoxib for Reducing Morphine Requirement After Thyroid Surgery: A Randomized Controlled Trial |
| NCT00565500 | PHASE4 | COMPLETED | Celecoxib, Ibuprofen and the Antiplatelet Effect of Aspirin |
| NCT00598234 | PHASE4 | COMPLETED | Perioperative Pain Control With Celecoxib (Celebrex) in Total Knee Arthroplasty |
| NCT00620867 | PHASE4 | COMPLETED | Efficacy and Safety of Celecoxib Versus Ibuprofen in the Treatment of Osteoarthritis of the Knee (United States) |
| NCT00624559 | PHASE4 | COMPLETED | The Role of COX-2 Inhibition in Salt Sensitivity of Blood Pressure |
| NCT00630929 | PHASE4 | COMPLETED | Efficacy and Safety of Celecoxib Versus Ibuprofen in the Treatment of Osteoarthritis of the Knee (Europe) |
| NCT00633386 | PHASE4 | COMPLETED | Effect of Celecoxib Versus Placebo Before and After Knee Surgery on the Overall Use of Analgesics After Surgery |
| NCT00633438 | PHASE4 | COMPLETED | Effect of Celecoxib Versus Placebo Before and After Knee Surgery on Overall Use of Analgesics After Surgery |
| NCT00638807 | PHASE4 | COMPLETED | Safety and Efficacy of Celecoxib Versus Placebo in the Treatment of Knee Osteoarthritis in Patients Who Were Unresponsive to Naproxen and Ibuprofen |
| NCT00640432 | PHASE4 | COMPLETED | Safety And Efficacy Of Celecoxib Versus Sodium Diclofenac In The Treatment Of Acute Low Back Pain |
| NCT00640627 | PHASE4 | COMPLETED | Efficacy and Safety of Celecoxib Versus Placebo in the Treatment of Patients With Osteoarthritis of the Knee Who Were Unresponsive to Naproxen and Ibuprofen |
| NCT00640809 | PHASE4 | COMPLETED | Comparison of Small Bowel Lesions Associated With Celecoxib Versus Ibuprofen Plus Omeprazole |
| NCT00643799 | PHASE4 | COMPLETED | Safety and Efficacy of Celecoxib Versus Naproxen in the 6-month Treatment of Knee Osteoarthritis |
| NCT00664690 | PHASE4 | WITHDRAWN | Effect of Celecoxib on Transitional Pain After Outpatient Surgery |
| NCT00687388 | PHASE4 | WITHDRAWN | The Clinical Efficacy of Non-steroidal Anti-inflammation Drugs in Patients With Benign Prostatic Hyperplasia |
| NCT00778193 | PHASE4 | COMPLETED | Effect of Naproxen, Aspirin, Celecoxib, or Clopidogrel on the Healing of Stomach and Intestinal Ulcers |
Clinical evidence (CIViC)
Variant × indication × effect (3 predictive associations from 3 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| COX2 Overexpression | Her2-receptor Negative Breast Cancer | Sensitivity/Response | Celecoxib | CIViC B | EID10155 |
| PIK3CA Mutation | Head And Neck Squamous Cell Carcinoma | Sensitivity/Response | Aspirin + Sulindac + Celecoxib | CIViC B | EID7185 |
| CTNNB1 T41A | Desmoid Tumor | Sensitivity/Response | Celecoxib | CIViC C | EID6048 |
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for celecoxib, flurbiprofen, ibuprofen, l | CPIC | CYP2C9 | yes | yes |
PharmGKB also curates 6 clinical and 48 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
459 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| VALDECOXIB | ChEMBL | Phase 4 (approved) | CA12, PTGS1, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | CA12, PTGS1, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | CA12, PTGS1, PTGS2 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | CA12, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| INDAPAMIDE | ChEMBL | Phase 4 (approved) | CA12, PTGS2 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SULPIRIDE | ChEMBL | Phase 4 (approved) | CA12, PTGS1 |
| SUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| QUERCETIN | ChEMBL | Phase 3 | CA12, PTGS2 |
| THIMEROSAL | ChEMBL | Phase 3 | CA12, PTGS1 |
| CIMICOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| DERACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| DITIOCARB | ChEMBL | Phase 2 | CA12, PTGS1 |
| ENOFELAST | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FIROCOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
Related Atlas pages
- Genes: PTGS1, PTGS2, CA12
- Diseases: ankylosing spondylitis, juvenile idiopathic arthritis, rheumatoid arthritis, neoplasm, rheumatic disorder, colorectal neoplasm, peptic ulcer disease, stroke disorder, spondylitis, osteoarthritis, migraine disorder, breast carcinoma, osteoarthritis, knee, gout, non-small cell lung carcinoma, hypertensive disorder, colorectal adenoma, nicotine dependence, osteoarthritis, hip, injury, exocrine pancreatic carcinoma, breast neoplasm, colonic neoplasm, head and neck cancer, postpartum depression, rectal cancer, colon carcinoma, colorectal carcinoma, macular degeneration, colorectal adenocarcinoma, influenza, pharyngitis, lung neoplasm, rectal neoplasm, hand-foot syndrome, depressive disorder, Alzheimer disease, bipolar disorder, subacute thyroiditis, nasopharyngeal carcinoma, Her2-receptor negative breast cancer, head and neck squamous cell carcinoma, desmoid tumor
- Drugs: Valdecoxib, Curcumin, Resveratrol, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Capsaicin, Captopril, Carprofen, Cianidanol, Dexibuprofen, Dexketoprofen, Diclofenac, Diethylstilbestrol, Dobutamine, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ibuprofen, Indapamide, Indomethacin, Ketorolac, Levodopa, Loxoprofen, Lumiracoxib, Meclofenamic Acid, Mefenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Oxaprozin, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Sulpiride, Suprofen, Tegaserod, Telotristat, Tolmetin, Troglitazone, Vortioxetine, Quercetin, Thimerosal
- Biomarker genes: CTNNB1