CEP-1347
drugOn this page
Also known as KT-1575KT-7515KT7515Indolocarbazole analogueNA
Summary
Cep-1347 (CHEMBL290352) is a phase-3 clinical-stage small molecule targeting MAP3K10, MAP3K11, and MAP3K12; indicated across 1 condition including parkinson disease.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 4 (MAP3K10, MAP3K11, MAP3K12…)
- Indications: 1 condition
- Clinical trials: 1
- Chemistry: 615.8 Da · C33H33N3O5S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL290352 |
| Name | CEP-1347 |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 9917013 |
| Molecular formula | C33H33N3O5S2 |
| Molecular weight | 615.8 |
| InChIKey | SCMLRESZJCKCTC-KMYQRJGFSA-N |
SMILES: CCSCC1=CC2=C(C=C1)N3[C@H]4C[C@@]([C@](O4)(N5C6=C(C=C(C=C6)CSCC)C7=C8CNC(=O)C8=C2C3=C75)C)(C(=O)OC)O
IUPAC name: methyl (15S,16R,18R)-10,23-bis(ethylsulfanylmethyl)-16-hydroxy-15-methyl-3-oxo-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8(13),9,11,20(25),21,23,26-nonaene-16-carboxylate
Also known as: Cep-1347, KT-1575, KT-7515, KT7515, Indolocarbazole analogue, CEP-1347, NA
Patent coverage: 153 distinct patent families (359 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 338 (94%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MAP3K10 | mitogen-activated protein kinase kinase kinase 10 | Inhibition | 8.7 | 0.2% | Q02779 |
| MAP3K11 | mitogen-activated protein kinase kinase kinase 11 | Inhibition | 8.22 | 8.7% | Q16584 |
| MAP3K12 | mitogen-activated protein kinase kinase kinase 12 | Inhibition | 6.94 | 0.3% | Q12852 |
| MAP3K9 | mitogen-activated protein kinase kinase kinase 9 | Inhibition | 9 | 0.1% | P80192 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Vascular endothelial growth factor receptor 1, Vascular endothelial growth factor receptor 3, Mitogen-activated protein kinase kinase kinase 11, Vascular endothelial growth factor receptor 2, Mitogen-activated protein kinase kinase kinase 9, Mitogen-activated protein kinase kinase kinase 10, Protein delta homolog 1.
Bioactivity
ChEMBL activities: 19 potent at pChembl ≥ 5 of 19 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MAP3K10 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_13476493 |
| MAP3K11 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_13476474 |
| MAP3K11 | 7.64 | IC50 | 23 | nM | CHEMBL_ACT_18550755 |
| MAP3K11 | 7.64 | IC50 | 23.1 | nM | CHEMBL_ACT_215499 |
| MAP3K11 | 7.64 | IC50 | 23 | nM | CHEMBL_ACT_25521010 |
| MAP3K9 | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_18550759 |
| MAP3K9 | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_215497 |
| MAP3K9 | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_2379701 |
| MAP3K9 | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_25516697 |
| FLT4 | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_2379813 |
| KDR | 7.37 | IC50 | 43 | nM | CHEMBL_ACT_2379812 |
| MAP3K10 | 7.29 | IC50 | 51 | nM | CHEMBL_ACT_18550757 |
| MAP3K10 | 7.29 | IC50 | 51 | nM | CHEMBL_ACT_215498 |
| MAP3K10 | 7.29 | IC50 | 51 | nM | CHEMBL_ACT_25516698 |
| MAP3K11 | 7.19 | IC50 | 64 | nM | CHEMBL_ACT_2379720 |
| MAP3K9 | 7.14 | IC50 | 72 | nM | CHEMBL_ACT_2379739 |
| DLK1 | 6.94 | IC50 | 114 | nM | CHEMBL_ACT_18550760 |
| DLK1 | 6.94 | IC50 | 114 | nM | CHEMBL_ACT_2379753 |
| FLT1 | 6.68 | IC50 | 209 | nM | CHEMBL_ACT_2379700 |
Target pathways
Aggregated over 4 target gene(s): MAP3K10, MAP3K11, MAP3K12, MAP3K9.
Top Reactome pathways
18 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | MAP3K11 |
| Disease | 1 | MAP3K11 |
| Signaling by Rho GTPases | 1 | MAP3K11 |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | MAP3K11 |
| RAF activation | 1 | MAP3K11 |
| RAF/MAP kinase cascade | 1 | MAP3K11 |
| MAPK family signaling cascades | 1 | MAP3K11 |
| MAPK1/MAPK3 signaling | 1 | MAP3K11 |
| Signaling by moderate kinase activity BRAF mutants | 1 | MAP3K11 |
| Signaling by RAS mutants | 1 | MAP3K11 |
| Paradoxical activation of RAF signaling by kinase inactive BRAF | 1 | MAP3K11 |
| Oncogenic MAPK signaling | 1 | MAP3K11 |
| RHO GTPase cycle | 1 | MAP3K11 |
| CDC42 GTPase cycle | 1 | MAP3K11 |
| RHOG GTPase cycle | 1 | MAP3K11 |
| RHOV GTPase cycle | 1 | MAP3K11 |
| Signaling downstream of RAS mutants | 1 | MAP3K11 |
| Signaling by Rho GTPases, Miro GTPases and RHOBTB3 | 1 | MAP3K11 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein autophosphorylation | 4 |
| protein phosphorylation | 4 |
| JNK cascade | 3 |
| positive regulation of apoptotic process | 3 |
| apoptotic process | 2 |
| signal transduction | 2 |
| positive regulation of JUN kinase activity | 2 |
| positive regulation of JNK cascade | 2 |
| MAPK cascade | 2 |
| smoothened signaling pathway | 1 |
| peptidyl-serine phosphorylation | 1 |
| peptidyl-threonine phosphorylation | 1 |
| obsolete negative regulation of DNA-binding transcription factor activity | 1 |
| negative regulation of DNA-templated transcription | 1 |
| microtubule-based process | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2/PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00040404 | PHASE2/PHASE3 | TERMINATED | Safety and Efficacy Study of CEP-1347 in the Treatment of Parkinson’s Disease |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
86 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Axitinib | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Bosutinib | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| MIDOSTAURIN | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| NERATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Ruxolitinib | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Sunitinib | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| DOVITINIB | ChEMBL | Phase 3 | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| LESTAURTINIB | ChEMBL | Phase 3 | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| FORETINIB | ChEMBL | Phase 2 | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| TOZASERTIB | ChEMBL | Phase 2 | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Abemaciclib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Acalabrutinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Afatinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Duvelisib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Erlotinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Gefitinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Idelalisib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Imatinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Lapatinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Nilotinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Quizartinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Selumetinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Sorafenib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| Vandetanib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12, MAP3K9 |
| R-406 | ChEMBL | Phase 2 | MAP3K10, MAP3K11, MAP3K9 |
| SU-014813 | ChEMBL | Phase 2 | MAP3K11, MAP3K12, MAP3K9 |
| Tofacitinib | PubChem | Approved | MAP3K10, MAP3K11, MAP3K12 |
| ALVOCIDIB | ChEMBL | Phase 3 | MAP3K10, MAP3K9 |
| DEFACTINIB | ChEMBL | Phase 3 | MAP3K11, MAP3K9 |
| REBASTINIB | ChEMBL | Phase 2 | MAP3K11, MAP3K9 |
| Cobimetinib | PubChem | Approved | MAP3K11, MAP3K9 |
| Momelotinib | PubChem | Approved | MAP3K11, MAP3K9 |
| Osimertinib | PubChem | Approved | MAP3K11, MAP3K9 |
| Sirolimus | PubChem | Approved | MAP3K11, MAP3K9 |
| BRIGATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K9 |
| CAPIVASERTIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K11 |
| DABRAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K11 |
| DASATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K10 |
| ENCORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K11 |
| FOSTAMATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K11 |
| GILTERITINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP3K11 |
| CRENOLANIB | ChEMBL | Phase 3 | MAP3K11 |
| ORANTINIB | ChEMBL | Phase 3 | MAP3K11 |
| RUBOXISTAURIN | ChEMBL | Phase 3 | MAP3K9 |
| ADAVOSERTIB | ChEMBL | Phase 2 | MAP3K11 |
| APITOLISIB | ChEMBL | Phase 2 | MAP3K9 |
| AT-9283 | ChEMBL | Phase 2 | MAP3K11 |
| BERZOSERTIB | ChEMBL | Phase 2 | MAP3K9 |
| BMS-690514 | ChEMBL | Phase 2 | MAP3K11 |
| CERDULATINIB | ChEMBL | Phase 2 | MAP3K9 |
| MILCICLIB | ChEMBL | Phase 2 | MAP3K11 |
| RAF-265 | ChEMBL | Phase 2 | MAP3K11 |
| SILMITASERTIB | ChEMBL | Phase 2 | MAP3K11 |
| UCN-01 | ChEMBL | Phase 2 | MAP3K11 |
| Alectinib | PubChem | Approved | MAP3K11 |
| Alpelisib | PubChem | Approved | MAP3K11 |
Related Atlas pages
- Genes: MAP3K10, MAP3K11, MAP3K12, MAP3K9
- Drugs: Axitinib, Bosutinib, Crizotinib, Fedratinib, Midostaurin, Neratinib, Pazopanib, Ruxolitinib, Sunitinib, Nintedanib, Dovitinib, Lestaurtinib, Abemaciclib, Acalabrutinib, Afatinib, Duvelisib, Erlotinib, Gefitinib, Idelalisib, Imatinib, Lapatinib, Nilotinib, Quizartinib, Selumetinib, Sorafenib, Vandetanib, Tofacitinib, Alvocidib, Defactinib, Cobimetinib, Momelotinib, Osimertinib, Sirolimus, Brigatinib, Capivasertib, Dabrafenib, Dasatinib, Encorafenib, Fostamatinib, Gilteritinib, Crenolanib, Orantinib, Ruboxistaurin, Alectinib, Alpelisib