Cephalothin
drugOn this page
Also known as CefalotinCefalotinaCefalotineCephalotinSID29215241SID90341219CefalothinSID47193756SID170465101SID144205132
Summary
Cephalothin (CHEMBL617) is an approved small-molecule antimicrobial agent (ATC J01DB03) targeting SLC22A8 and SLC22A11; indicated across 1 condition including bacterial infectious disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: J01DB03
- Targets: 2 (SLC22A8, SLC22A11)
- Indications: 1 condition
- Chemistry: 396.4 Da · C16H16N2O6S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL617 |
| Name | Cephalothin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 6024 |
| ChEBI | CHEBI:124991 |
| ATC | J01DB03 |
| Molecular formula | C16H16N2O6S2 |
| Molecular weight | 396.4 |
| InChIKey | XIURVHNZVLADCM-IUODEOHRSA-N |
SMILES: CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CC3=CC=CS3)SC1)C(=O)O
IUPAC name: (6R,7R)-3-(acetyloxymethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
ChEBI definition: A semisynthetic, first-generation cephalosporin antibiotic with acetoxymethyl and (2-thienylacetyl)nitrilo moieties at positions 3 and 7, respectively, of the core structure. Administered parenterally during surgery and to treat a wide spectrum of blood infections.
Pharmacological roles (ChEBI): antimicrobial agent, antibacterial drug.
Also known as: Cefalotin, Cefalotina, Cefalotine, cephalothin, Cephalothin, Cephalotin, SID29215241, SID90341219, Cefalothin, SID47193756, CEFALOTINE, SID170465101
Parent form; salt/anhydrous children: CHEMBL1632
Patent coverage: 7,159 distinct patent families (24,927 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC22A8 | Organic anion transporter 3 | Inhibition | 7.59 | 0.3% | Q8TCC7 |
| SLC22A11 | Organic anion transporter 4 | Inhibition | 6.7 | 0.2% | Q9NSA0 |
Broader ChEMBL bioactivity targets: 13 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Microtubule-associated protein tau, Fructose-bisphosphate aldolase, 4’-phosphopantetheinyl transferase ffp, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Solute carrier family 22 member 6, Organic anion transporter 3, Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 1, DNA (cytosine-5)-methyltransferase 1, Organic anion transporter 3.
Bioactivity
ChEMBL activities: 5 potent at pChembl ≥ 5 of 14 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SLC22A8 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_11002249 |
| SLC22A11 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_11002276 |
| SLC22A6 | 6.66 | Ki | 220 | nM | CHEMBL_ACT_11002268 |
| CTDSP1 | 5.55 | IC50 | 2786 | nM | CHEMBL_ACT_6963814 |
| DNMT1 | 5.14 | IC50 | 7280 | nM | CHEMBL_ACT_10221419 |
Target pathways
Aggregated over 2 target gene(s): SLC22A8, SLC22A11.
Top Reactome pathways
7 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transport of small molecules | 2 | SLC22A11, SLC22A8 |
| R-HSA-425366 | 2 | SLC22A11, SLC22A8 |
| SLC-mediated transmembrane transport | 2 | SLC22A11, SLC22A8 |
| R-HSA-549132 | 2 | SLC22A11, SLC22A8 |
| Organic anion transport by SLC22 transporters | 2 | SLC22A11, SLC22A8 |
| Drug ADME | 1 | SLC22A8 |
| Ciprofloxacin ADME | 1 | SLC22A8 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 2 |
| obsolete organic anion transport | 2 |
| prostaglandin transport | 2 |
| inorganic anion transport | 2 |
| transmembrane transport | 2 |
| response to toxic substance | 1 |
| transport across blood-brain barrier | 1 |
| lipid transport | 1 |
| xenobiotic transport | 1 |
| urate metabolic process | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| bacterial infectious disease | 4 | MONDO:0005113 | EFO:0000771 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
58 molecules share ≥1 primary target. Top 58 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMINOHIPPURIC ACID | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CEFAZOLIN | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CEFOTAXIME | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CEFTRIAXONE | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CIMETIDINE | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| INDOMETHACIN | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| PENICILLIN G | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| PHENYLBUTAZONE | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| PIROXICAM | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| PRAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| PROBENECID | ChEMBL + PubChem | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CEFAMANDOLE | ChEMBL | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CEFOPERAZONE | ChEMBL | Phase 4 (approved) | SLC22A11, SLC22A8 |
| CEPHALORIDINE | ChEMBL | Phase 4 (approved) | SLC22A11, SLC22A8 |
| ROLOFYLLINE | ChEMBL | Phase 3 | SLC22A11, SLC22A8 |
| Bumetanide | PubChem | Approved | SLC22A11, SLC22A8 |
| caprylic acid | PubChem | Approved | SLC22A11, SLC22A8 |
| Diclofenac | PubChem | Approved | SLC22A11, SLC22A8 |
| Dinoprost | PubChem | Approved | SLC22A11, SLC22A8 |
| dinoprostone | PubChem | Approved | SLC22A11, SLC22A8 |
| Furosemide | PubChem | Approved | SLC22A11, SLC22A8 |
| Ketoprofen | PubChem | Approved | SLC22A11, SLC22A8 |
| Linagliptin | PubChem | Approved | SLC22A11, SLC22A8 |
| Methotrexate | PubChem | Approved | SLC22A11, SLC22A8 |
| Salicylic Acid | PubChem | Approved | SLC22A11, SLC22A8 |
| Zidovudine | PubChem | Approved | SLC22A11, SLC22A8 |
| CEFADROXIL | ChEMBL + PubChem | Phase 4 (approved) | SLC22A8 |
| LESINURAD | ChEMBL | Phase 4 (approved) | SLC22A11 |
| PAMIPARIB | ChEMBL | Phase 3 | SLC22A8 |
| BETAMIPRON | ChEMBL | Phase 2 | SLC22A8 |
| OCTANOIC ACID | ChEMBL | Phase 2 | SLC22A8 |
| VERINURAD | ChEMBL | Phase 2 | SLC22A11 |
| ZONAMPANEL | ChEMBL | Phase 2 | SLC22A8 |
| Acyclovir | PubChem | Approved | SLC22A8 |
| Adefovir | PubChem | Approved | SLC22A8 |
| Ampicillin | PubChem | Approved | SLC22A8 |
| Aztreonam | PubChem | Approved | SLC22A8 |
| cefaclor | PubChem | Approved | SLC22A8 |
| Cefoxitin | PubChem | Approved | SLC22A8 |
| Ceftazidime | PubChem | Approved | SLC22A8 |
| Ceftiofur | PubChem | Approved | SLC22A8 |
| Cefuroxime | PubChem | Approved | SLC22A8 |
| cephalexin | PubChem | Approved | SLC22A8 |
| Cloxacillin | PubChem | Approved | SLC22A8 |
| Dicloxacillin | PubChem | Approved | SLC22A8 |
| Ertugliflozin | PubChem | Approved | SLC22A8 |
| Estradiol | PubChem | Approved | SLC22A11 |
| Famotidine | PubChem | Approved | SLC22A8 |
| Ganciclovir | PubChem | Approved | SLC22A8 |
| Nafcillin | PubChem | Approved | SLC22A8 |
| Oxacillin | PubChem | Approved | SLC22A8 |
| Penciclovir | PubChem | Approved | SLC22A8 |
| Penicillin V | PubChem | Approved | SLC22A8 |
| Quinidine | PubChem | Approved | SLC22A8 |
| Tenofovir | PubChem | Approved | SLC22A8 |
| Uric Acid | PubChem | Approved | SLC22A8 |
| Valacyclovir | PubChem | Approved | SLC22A8 |
| Valproic Acid | PubChem | Approved | SLC22A8 |
Related Atlas pages
- Genes: SLC22A8, SLC22A11
- Diseases: bacterial infectious disease
- Drugs: Aminohippuric Acid, Cefazolin, Cefotaxime, Ceftriaxone, Cimetidine, Indomethacin, Penicillin G, Phenylbutazone, Piroxicam, Pravastatin, Probenecid, Cefamandole, Cefoperazone, Cephaloridine, Rolofylline, Bumetanide, Diclofenac, Dinoprost, dinoprostone, Furosemide, Ketoprofen, Linagliptin, Methotrexate, Salicylic Acid, Zidovudine, Cefadroxil, Lesinurad, Pamiparib, Acyclovir, Adefovir, Ampicillin, Aztreonam, cefaclor, Cefoxitin, Ceftazidime, Cefuroxime, cephalexin, Cloxacillin, Dicloxacillin, Ertugliflozin, Estradiol, Famotidine, Ganciclovir, Nafcillin, Oxacillin, Penciclovir, Penicillin V, Quinidine, Tenofovir, Valacyclovir, Valproic Acid