Ceritinib
drugOn this page
Also known as Ceritinib[mi]LDK-378LDK378Zykadia4MKCPD 15LDK 378CERITINIB (LDK378)LDK378/ CERITINIBCeritinib
Summary
Ceritinib (CHEMBL2403108) is an approved small-molecule antineoplastic agent (ATC L01ED02) targeting INSR, IGF1R, and FLT3; indicated across 13 conditions including non-small cell lung carcinoma and neoplasm; with CIViC clinical evidence for 33 variant-indication associations (e.g. ALK Fusion in lung non-small cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01ED02
- Targets: 5 (INSR, IGF1R, FLT3…)
- Indications: 13 conditions
- Clinical trials: 45
- Precision-oncology evidence (CIViC): 33 variant–indication associations
- Chemistry: 558.1 Da · C28H36ClN5O3S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2403108 |
| Name | Ceritinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 57379345 |
| ChEBI | CHEBI:78432 |
| ATC | L01ED02 |
| Molecular formula | C28H36ClN5O3S |
| Molecular weight | 558.1 |
| InChIKey | VERWOWGGCGHDQE-UHFFFAOYSA-N |
SMILES: CC1=CC(=C(C=C1C2CCNCC2)OC(C)C)NC3=NC=C(C(=N3)NC4=CC=CC=C4S(=O)(=O)C(C)C)Cl
IUPAC name: 5-chloro-2-N-(5-methyl-4-piperidin-4-yl-2-propan-2-yloxyphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine
ChEBI definition: A member of the class of aminopyrimidines that is 2,6-diamino-5-chloropyrimidine in which the amino groups at positions 2 and 6 are respectively carrying 2-methoxy-4-(piperidin-4-yl)-5-methylphenyl and 2-(isopropylsulfonyl)phenyl substituents. Used for the treatment of ALK-positive metastatic non-small cell lung cancer.
Pharmacological roles (ChEBI): antineoplastic agent, EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor.
Also known as: Ceritinib, Ceritinib[mi], LDK-378, LDK378, Zykadia, CERITINIB, 4MK, CPD 15, LDK 378, ZYKADIA, CERITINIB[MI], CERITINIB (LDK378)
Parent form; salt/anhydrous children: CHEMBL4468931, CHEMBL4476089, CHEMBL4542506
Patent coverage: 3,701 distinct patent families (8,551 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 8,010 (94%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| INSR | Insulin receptor | Inhibition | 8.15 | 0.8% | P06213 |
| IGF1R | Insulin-like growth factor I receptor | Inhibition | 8.1 | 19% | P08069 |
| FLT3 | fms related receptor tyrosine kinase 3 | Inhibition | 7.22 | 0.9% | P36888 |
| ALK | ALK receptor tyrosine kinase | Inhibition | 9.7 | 0.8% | Q9UM73 |
| TSSK1B | testis specific serine kinase 1B | Inhibition | 7.64 | 0.3% | Q9BXA7 |
Broader ChEMBL bioactivity targets: 53 (assay-derived). Sample: Tyrosine-protein kinase ABL1, Mast/stem cell growth factor receptor Kit, Insulin-like growth factor 1 receptor, Receptor-type tyrosine-protein kinase FLT3, Insulin receptor, Platelet-derived growth factor receptor alpha, Epidermal growth factor receptor, Proto-oncogene tyrosine-protein kinase ROS, Proto-oncogene tyrosine-protein kinase receptor Ret, NPM/ALK (Nucleophosmin/ALK tyrosine kinase receptor).
Bioactivity
ChEMBL activities: 197 potent at pChembl ≥ 5 of 205 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ALK | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_13367230 |
| ALK | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_13374067 |
| ALK | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_24815754 |
| ALK | 9.6 | IC50 | 0.25 | nM | CHEMBL_ACT_23239917 |
| ROS1 | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_18761175 |
| ROS1 | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_26314130 |
| ALK | 9.21 | IC50 | 0.61 | nM | CHEMBL_ACT_22775264 |
| ROS1 | 9.15 | Ki | 0.7 | nM | CHEMBL_ACT_18761174 |
| ROS1 | 9.15 | Ki | 0.7 | nM | CHEMBL_ACT_26314019 |
| ALK | 9.08 | IC50 | 0.83 | nM | CHEMBL_ACT_24853442 |
| ALK | 9 | IC50 | 1 | nM | CHEMBL_ACT_26776982 |
| ALK | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_22775388 |
| ALK | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_24853429 |
| ALK | 8.89 | Kd | 1.3 | nM | CHEMBL_ACT_18415018 |
| ALK | 8.85 | IC50 | 1.4 | nM | CHEMBL_ACT_17952575 |
| ALK | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_17952579 |
| ALK | 8.8 | IC50 | 1.6 | nM | CHEMBL_ACT_22775392 |
| EML4 | 8.75 | IC50 | 1.79 | nM | CHEMBL_ACT_29088286 |
| ALK | 8.72 | IC50 | 1.9 | nM | CHEMBL_ACT_22775384 |
| ROS1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_16808349 |
| ALK | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_17952581 |
| ROS1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_18332200 |
| ALK | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_19026264 |
| ROS1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_22416681 |
| ALK | 8.68 | IC50 | 2.1 | nM | CHEMBL_ACT_22820304 |
| ALK | 8.66 | IC50 | 2.2 | nM | CHEMBL_ACT_13367201 |
| ROS1 | 8.66 | IC50 | 2.2 | nM | CHEMBL_ACT_22927955 |
| ALK | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_16808329 |
| ALK | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_19026255 |
| ALK | 8.62 | IC50 | 2.4 | nM | CHEMBL_ACT_22416952 |
Target pathways
Aggregated over 5 target gene(s): INSR, IGF1R, FLT3, ALK, TSSK1B.
Top Reactome pathways
56 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 2 | FLT3, INSR |
| Signal Transduction | 2 | ALK, INSR |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | FLT3, INSR |
| Signaling by Receptor Tyrosine Kinases | 2 | ALK, INSR |
| PI3K Cascade | 1 | FLT3 |
| Disease | 1 | ALK |
| Negative regulation of the PI3K/AKT network | 1 | INSR |
| Signaling by ALK | 1 | ALK |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | FLT3 |
| Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R) | 1 | IGF1R |
| IRS-related events triggered by IGF1R | 1 | IGF1R |
| SHC-related events triggered by IGF1R | 1 | IGF1R |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | ALK |
| RAF/MAP kinase cascade | 1 | FLT3 |
| IRS activation | 1 | INSR |
| Signal attenuation | 1 | INSR |
| Insulin receptor signalling cascade | 1 | INSR |
| Signaling by Insulin receptor | 1 | INSR |
| Insulin receptor recycling | 1 | INSR |
| Intracellular signaling by second messengers | 1 | INSR |
| Extra-nuclear estrogen signaling | 1 | IGF1R |
| FLT3 Signaling | 1 | FLT3 |
| STAT5 Activation | 1 | FLT3 |
| Signaling by ALK in cancer | 1 | ALK |
| ALK mutants bind TKIs | 1 | ALK |
| Drug resistance of ALK mutants | 1 | ALK |
| FLT3 mutants bind TKIs | 1 | FLT3 |
| STAT5 activation downstream of FLT3 ITD mutants | 1 | FLT3 |
| KW2449-resistant FLT3 mutants | 1 | FLT3 |
| semaxanib-resistant FLT3 mutants | 1 | FLT3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 5 |
| protein autophosphorylation | 4 |
| cell surface receptor protein tyrosine kinase signaling pathway | 4 |
| positive regulation of cell population proliferation | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| insulin receptor signaling pathway | 2 |
| positive regulation of cell migration | 2 |
| positive regulation of protein-containing complex disassembly | 2 |
| dendritic spine maintenance | 2 |
| amyloid-beta clearance | 2 |
| signal transduction | 2 |
| peptidyl-tyrosine autophosphorylation | 2 |
| regulation of apoptotic process | 2 |
| positive regulation of receptor internalization | 1 |
Indications & clinical
Indications
13 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| non-small cell lung carcinoma | 4 | MONDO:0005233 | EFO:0003060 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| cholangiocarcinoma | 2 | MONDO:0019087 | EFO:0005221 |
| inflammatory myofibroblastic tumor | 2 | MONDO:0015798 | MONDO:0015798 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 45.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 17 |
| PHASE1 | 15 |
| Not specified | 6 |
| PHASE3 | 3 |
| PHASE1/PHASE2 | 2 |
| PHASE4 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02584933 | PHASE4 | ACTIVE_NOT_RECRUITING | Roll-over Study to Allow Access to Certinib (LDK378) for Patients Who Are on Ceritinib Treatment in a Novartis-sponsored Study |
| NCT01828099 | PHASE3 | COMPLETED | LDK378 Versus Chemotherapy in Previously Untreated Patients With ALK Rearranged Non-small Cell Lung Cancer |
| NCT01828112 | PHASE3 | COMPLETED | LDK378 Versus Chemotherapy in ALK Rearranged (ALK Positive) Patients Previously Treated With Chemotherapy (Platinum Doublet) and Crizotinib |
| NCT03784014 | PHASE3 | COMPLETED | Molecular Profiling of Advanced Soft-tissue Sarcomas |
| NCT02559778 | PHASE2 | RECRUITING | Pediatric Precision Laboratory Advanced Neuroblastoma Therapy |
| NCT06813079 | PHASE2 | NOT_YET_RECRUITING | Using Tumor Models to Determine Treatments |
| NCT01685060 | PHASE2 | COMPLETED | LDK378 in Adult Patients With ALK-activated NSCLC Previously Treated With Chemotherapy and Crizotinib |
| NCT01685138 | PHASE2 | COMPLETED | LDK378 in Crizotinib naïve Adult Patients With ALK-activated Non-small Cell Lung Cancer |
| NCT01964157 | PHASE2 | UNKNOWN | An Open-label, Multicenter, Phase II Study of LDK378 in Patients With Non-small Cell Lung Cancer Harboring ROS1 Rearrangement |
| NCT02040870 | PHASE1/PHASE2 | COMPLETED | LDK378 in Adult Chinese Patients With ALK-rearranged (ALK-positive) Advanced Non-small Cell Lung Cancer (NSCLC) Previously Treated With Crizotinib |
| NCT02186821 | PHASE2 | TERMINATED | Ceritinib (LDK378) for Patients Whose Tumors Have Aberrations in ALK or ROS1 (SIGNATURE) |
| NCT02276027 | PHASE2 | COMPLETED | A Phase II, Open Label, Multiple Arm Study of AUY922, BYL719, INC280, LDK378 and MEK162 in Chinese Patients With Advanced Non-small Cell Lung Cancer |
| NCT02289144 | PHASE2 | WITHDRAWN | Ceritinib in Mutation and Oncogene Directed Therapy in Thyroid Cancer |
| NCT02336451 | PHASE2 | COMPLETED | A Phase II Study to Evaluate the Efficacy and Safety of Oral Ceritinib in Patients With ALK-positive NSCLC Metastatic to the Brain and/or to Leptomeninges |
| NCT02343679 | PHASE2 | WITHDRAWN | Novartis PhII Ceritinib (LDK378) in R/R ALK+ Hem Malignancies |
| NCT02374489 | PHASE2 | TERMINATED | A Phase II Trial of LDK378 in ROS1 and /or ALK Over-expressed Advanced Intrahepatic or Hilar Cholangiocarcinoma |
| NCT02450903 | PHASE2 | COMPLETED | LDK378 in Patients With ALK Positive NSCLC Previously Treated With Alectinib. |
| NCT02465528 | PHASE2 | TERMINATED | Ceritinib Rare Indications Study in ALK+ Tumors |
| NCT02513667 | PHASE2 | TERMINATED | Ceritinib in Combination With Stereotactic Ablative Radiation Metastatic Lung Adenocarcinoma |
| NCT02587650 | PHASE2 | TERMINATED | Capmatinib, Ceritinib, Regorafenib, or Entrectinib in Treating Patients With BRAF/NRAS Wild-Type Stage III-IV Melanoma |
| NCT02638909 | PHASE2 | TERMINATED | Study of Oral Ceritinib in Patients With ALK and ROS1 Activated Gastrointestinal Malignancies |
| NCT02729961 | PHASE1/PHASE2 | WITHDRAWN | Ceritinib With Brentuximab Vedotin in Treating Patients With ALK-Positive Anaplastic Large Cell Lymphoma |
| NCT03737994 | PHASE2 | TERMINATED | Targeted Treatment for ALK Positive Patients Who Have Previously Been Treated for Non-squamous Non-small Cell Lung Cancer |
| NCT02321501 | PHASE1 | ACTIVE_NOT_RECRUITING | Ceritinib and Everolimus in Treating Patients With Locally Advanced or Metastatic Solid Tumors or Stage IIIB-IV Non-small Cell Lung Cancer |
| NCT02393625 | PHASE1 | ACTIVE_NOT_RECRUITING | Study of Safety and Efficacy of Ceritinib in Combination With Nivolumab in Patients With ALK-positive Non-small Cell Lung Cancer |
| NCT03611738 | PHASE1 | ACTIVE_NOT_RECRUITING | Ceritinib Plus Docetaxel in ALK-Negative, EGFR WT Advanced NSCLC |
| NCT01283516 | PHASE1 | COMPLETED | A Dose Escalation/Expansion Study of LDK378 in Patients With Tumors Characterized by Genetic Abnormalities in Anaplastic Lymphoma Kinase |
| NCT01634763 | PHASE1 | COMPLETED | Study of Safety and Preliminary Efficacy for LDK378 in Japanese Patients With Genetic Alterations in Anaplastic Lymphoma Kinase (ALK) |
| NCT01742286 | PHASE1 | COMPLETED | Phase I Study of LDK378 in Pediatric, Malignancies With a Genetic Alteration in Anaplastic Lymphoma Kinase (ALK) |
| NCT01772797 | PHASE1 | COMPLETED | Phase Ib Study of LDK378 and AUY922 in ALK-rearranged Non-small Cell Lung Cancer |
| NCT01950481 | PHASE1 | COMPLETED | Effect of Hepatic Impairment on LDK378 Pharmacokinetics |
| NCT02227940 | PHASE1 | COMPLETED | Ceritinib and Combination Chemotherapy in Treating Patients With Advanced Solid Tumors or Locally Advanced or Metastatic Pancreatic Cancer |
| NCT02292550 | PHASE1 | COMPLETED | Study of Safety and Efficacy of LEE011 and Ceritinib in Patients With ALK-positive Non-small Cell Lung Cancer. |
| NCT02299505 | PHASE1 | COMPLETED | Pharmacokinetic and Safety Study of Lower Doses of Ceritinib Taken With a Low-fat Meal Versus 750 mg of Ceritinib in the Fasted State in Adult Patients With (ALK-positive) Metastatic Non-small Cell Lung Cancer (NSCLC) |
| NCT02422589 | PHASE1 | COMPLETED | A Phase I, Multi-center, Open Label, Drug-drug Interaction Study to Assess the Effect of Ceritinib on the Pharmacokinetics of Warfarin and Midazolam in Patients With ALK-positive Advanced Tumors |
| NCT02780128 | PHASE1 | TERMINATED | Next Generation Personalized Neuroblastoma Therapy |
| NCT03087448 | PHASE1 | TERMINATED | Ceritinib + Trametinib in Patients With Advanced ALK-Positive Non-Small Cell Lung Cancer (NSCLC) |
| NCT03501368 | PHASE1 | COMPLETED | Study of Trametinib + Ceritinib in Patients With Unresectable Melanoma |
| NCT02605746 | EARLY_PHASE1 | COMPLETED | Preoperative Ceritinib (LDK378) in Glioblastoma Multiforme and CNS Metastasis |
| NCT05467189 | Not specified | RECRUITING | Antineoplastic Drugs in Elderly Patients |
Clinical evidence (CIViC)
Variant × indication × effect (33 predictive associations from 40 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| ALK Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC A | EID11190 +3 |
| ALK Fusion | Inflammatory Myofibroblastic Tumor | Sensitivity/Response | Ceritinib | CIViC B | EID11291 +1 |
| ALK Mutation | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC B | EID1237 |
| ROS1 Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC B | EID11334 |
| ALK I1171 | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC C | EID1284 +2 |
| ALK Fusion AND ALK L1196M | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC C | EID2343 +1 |
| ALK Fusion | Anaplastic Large Cell Lymphoma | Sensitivity/Response | Ceritinib | CIViC C | EID7546 |
| ALK I1171T | Neuroblastoma | Sensitivity/Response | Ceritinib | CIViC C | EID9404 |
| ALK S1206Y AND v::ALK Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC C | EID2865 |
| CD72::ROS1 Fusion | Lung Adenocarcinoma | Sensitivity/Response | Ceritinib | CIViC C | EID1248 |
| EML4::ALK Fusion AND ALK F1245C | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC C | EID1338 |
| STRN::ALK Fusion | Colon Adenocarcinoma | Sensitivity/Response | Ceritinib | CIViC C | EID5952 |
| EML4::ALK Fusion AND ALK C1156Y | Lung Non-small Cell Carcinoma | Resistance | Ceritinib + Luminespib + Crizotinib | CIViC C | EID841 |
| EML4::ALK Fusion AND ALK G1202del | Lung Non-small Cell Carcinoma | Resistance | Ceritinib | CIViC C | EID7599 |
| ALK Alternative Transcript (ATI) | Melanoma | Sensitivity/Response | Ceritinib + Crizotinib + Alectinib + ALK Inhibitor ASP3026 + Entrectinib | CIViC D | EID7484 |
| ALK G1269A AND v::ALK Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC D | EID1342 |
| ALK G1269A AND v::ALK Fusion | Cancer | Sensitivity/Response | Ceritinib | CIViC D | EID1355 |
| EML4::ALK Fusion AND ALK L1196M | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC D | EID1341 |
| EML4::ALK Fusion AND ALK L1196M | Cancer | Sensitivity/Response | Brigatinib + Lorlatinib + Alectinib + Ceritinib | CIViC D | EID7597 |
| EML4::ALK Fusion AND ALK S1206Y | Cancer | Sensitivity/Response | Ceritinib | CIViC D | EID1343 |
| EML4::ALK Fusion AND ALK V1180L | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC D | EID1289 |
| EML4::ALK e6::e20 | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ceritinib | CIViC D | EID1340 |
| ALK F1174L AND NPM1::ALK Fusion | Anaplastic Large Cell Lymphoma | Resistance | Ceritinib | CIViC D | EID12658 |
| EML4::ALK Fusion AND ABCB1 Overexpression | Lung Adenocarcinoma | Resistance | Ceritinib + Crizotinib | CIViC D | EID7869 |
| EML4::ALK Fusion AND ALK C1156Y | Cancer | Resistance | Lorlatinib + Alectinib + Ceritinib + Brigatinib | CIViC D | EID7609 |
| EML4::ALK Fusion AND ALK G1202R | Lung Non-small Cell Carcinoma | Resistance | Ceritinib | CIViC D | EID1345 |
| EML4::ALK Fusion AND ALK G1202R AND ALK L1196M | Cancer | Resistance | Brigatinib + Crizotinib + Lorlatinib + Alectinib + Ceritinib | CIViC D | EID7592 |
| EML4::ALK Fusion AND ALK G1202R AND ALK L1198F | Cancer | Resistance | Alectinib + Lorlatinib + Brigatinib + Ceritinib | CIViC D | EID7595 |
| EML4::ALK Fusion AND ALK I1171S | Cancer | Resistance | Ceritinib | CIViC D | EID12657 |
| NPM1::ALK Fusion AND ALK I1171S | Cancer | Resistance | Ceritinib | CIViC D | EID12660 |
+3 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
135 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| Gefitinib | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| Pazopanib | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| SUNITINIB | ChEMBL | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR, TSSK1B |
| LESTAURTINIB | ChEMBL | Phase 3 | ALK, FLT3, IGF1R, INSR, TSSK1B |
| CENISERTIB | ChEMBL | Phase 2 | ALK, FLT3, IGF1R, INSR, TSSK1B |
| R-406 | ChEMBL | Phase 2 | ALK, FLT3, IGF1R, INSR, TSSK1B |
| Idelalisib | PubChem | Approved | ALK, FLT3, IGF1R, INSR, TSSK1B |
| Selumetinib | PubChem | Approved | ALK, FLT3, IGF1R, INSR, TSSK1B |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | ALK, FLT3, IGF1R, INSR |
| DOVITINIB | ChEMBL | Phase 3 | ALK, FLT3, INSR, TSSK1B |
| BMS-754807 | ChEMBL | Phase 2 | ALK, FLT3, IGF1R, INSR |
| FORETINIB | ChEMBL | Phase 2 | ALK, FLT3, IGF1R, INSR |
| ILORASERTIB | ChEMBL | Phase 2 | ALK, FLT3, IGF1R, INSR |
| TOZASERTIB | ChEMBL | Phase 2 | ALK, FLT3, IGF1R, INSR |
| belumosudil | PubChem | Approved | ALK, IGF1R, INSR, TSSK1B |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, TSSK1B |
| Fostamatinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, IGF1R, INSR |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, IGF1R, INSR |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, INSR, TSSK1B |
| VANDETANIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, FLT3, TSSK1B |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | ALK, FLT3, TSSK1B |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | ALK, FLT3, INSR |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | ALK, FLT3, TSSK1B |
| LINIFANIB | ChEMBL | Phase 3 | ALK, FLT3, INSR |
| LINSITINIB | ChEMBL | Phase 3 | FLT3, IGF1R, INSR |
| QUERCETIN | ChEMBL | Phase 3 | ALK, FLT3, IGF1R |
| OSI-632 | ChEMBL | Phase 2 | ALK, FLT3, INSR |
| SU-014813 | ChEMBL | Phase 2 | ALK, FLT3, INSR |
| Binimetinib | PubChem | Approved | FLT3, IGF1R, INSR |
| dacomitinib | PubChem | Approved | FLT3, IGF1R, INSR |
| Trametinib | PubChem | Approved | FLT3, IGF1R, INSR |
| ABEMACICLIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, TSSK1B |
| DASATINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, TSSK1B |
| LAPATINIB | ChEMBL + PubChem | Phase 4 (approved) | INSR, TSSK1B |
| QUIZARTINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, TSSK1B |
| RUXOLITINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, TSSK1B |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | ALK, FLT3 |
| NERATINIB | ChEMBL | Phase 4 (approved) | FLT3, INSR |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | ALK, INSR |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | ALK, FLT3 |
| ALVOCIDIB | ChEMBL | Phase 3 | ALK, FLT3 |
| CANERTINIB | ChEMBL | Phase 3 | ALK, FLT3 |
| CEDIRANIB | ChEMBL | Phase 3 | ALK, FLT3 |
| SEMAXANIB | ChEMBL | Phase 3 | ALK, FLT3 |
| BEMCENTINIB | ChEMBL | Phase 2 | ALK, FLT3 |
| BI-2536 | ChEMBL | Phase 2 | ALK, FLT3 |
| CEP-11981 | ChEMBL | Phase 2 | ALK, FLT3 |
| ELLAGIC ACID | ChEMBL | Phase 2 | IGF1R, INSR |
| PELITINIB | ChEMBL | Phase 2 | ALK, FLT3 |
| Belzutifan | PubChem | Approved | FLT3, INSR |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ALK |
| AXITINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| IBRUTINIB | ChEMBL | Phase 4 (approved) | FLT3 |
Related Atlas pages
- Genes: INSR, IGF1R, FLT3, ALK, TSSK1B
- Diseases: non-small cell lung carcinoma, neoplasm, soft tissue sarcoma, inflammatory myofibroblastic tumor, anaplastic large cell lymphoma, neuroblastoma, lung adenocarcinoma, colon adenocarcinoma, melanoma, cancer
- Drugs: Afatinib, Crizotinib, Fedratinib, Gefitinib, Pazopanib, Brigatinib, Nintedanib, Sunitinib, Lestaurtinib, Idelalisib, Selumetinib, Entrectinib, Dovitinib, belumosudil, Erlotinib, Fostamatinib, Regorafenib, Sorafenib, Vandetanib, Bosutinib, Infigratinib, Midostaurin, Linifanib, Linsitinib, Quercetin, Binimetinib, dacomitinib, Trametinib, Abemaciclib, Dasatinib, Lapatinib, Quizartinib, Ruxolitinib, Gilteritinib, Neratinib, Osimertinib, Palbociclib, Alvocidib, Canertinib, Cediranib, Semaxanib, Belzutifan, Alectinib, Axitinib, Cabozantinib, Filgotinib, Ibrutinib