Clidinium
drug drugOn this page
Also known as Clidinium cationClidinium ionCLIDINIUM BROMIDE
Summary
Clidinium (CHEMBL620) is an approved small molecule targeting CHRM2.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (CHRM2)
- Chemistry: 352.4 Da · C22H26NO3+
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL620 |
| Name | Clidinium |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 2784 |
| Molecular formula | C22H26NO3+ |
| Molecular weight | 352.4 |
| InChIKey | HOOSGZJRQIVJSZ-UHFFFAOYSA-N |
SMILES: C[N+]12CCC(CC1)C(C2)OC(=O)C(C3=CC=CC=C3)(C4=CC=CC=C4)O
IUPAC name: (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-hydroxy-2,2-diphenylacetate
Also known as: Clidinium cation, Clidinium ion, clidinium, CLIDINIUM, CLIDINIUM BROMIDE, Clidinium
Parent form; salt/anhydrous children: CHEMBL1200950
Patent coverage: 28 distinct patent families (42 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CHRM2 | M2 receptor | Antagonist | 9.6 | 0% | P08172 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Muscarinic acetylcholine receptor M4, Muscarinic acetylcholine receptor M5, Muscarinic acetylcholine receptor M2, Muscarinic acetylcholine receptor M1, Sodium-dependent serotonin transporter, Voltage-gated inwardly rectifying potassium channel KCNH2, Muscarinic acetylcholine receptor M3.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 7 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CHRM3 | 8.72 | AC50 | 1.9 | nM | CHEMBL_ACT_25137300 |
| CHRM1 | 8.51 | AC50 | 3.1 | nM | CHEMBL_ACT_25136101 |
| CHRM2 | 8.49 | AC50 | 3.2 | nM | CHEMBL_ACT_25195410 |
| CHRM4 | 8.33 | AC50 | 4.7 | nM | CHEMBL_ACT_25144473 |
| CHRM5 | 8.17 | AC50 | 6.8 | nM | CHEMBL_ACT_25137483 |
| KCNH2 | 5.89 | AC50 | 1300 | nM | CHEMBL_ACT_25118778 |
Target pathways
Aggregated over 1 target gene(s): CHRM2.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | CHRM2 |
| Membrane Trafficking | 1 | CHRM2 |
| Signaling by GPCR | 1 | CHRM2 |
| Class A/1 (Rhodopsin-like receptors) | 1 | CHRM2 |
| Amine ligand-binding receptors | 1 | CHRM2 |
| GPCR downstream signalling | 1 | CHRM2 |
| Muscarinic acetylcholine receptors | 1 | CHRM2 |
| G alpha (i) signalling events | 1 | CHRM2 |
| GPCR ligand binding | 1 | CHRM2 |
| Vesicle-mediated transport | 1 | CHRM2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | CHRM2 |
| Clathrin-mediated endocytosis | 1 | CHRM2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of smooth muscle contraction | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 1 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-inhibiting G protein-coupled acetylcholine receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled acetylcholine receptor signaling pathway | 1 |
| G protein-coupled acetylcholine receptor signaling pathway | 1 |
| chemical synaptic transmission | 1 |
| nervous system development | 1 |
| regulation of heart contraction | 1 |
| response to virus | 1 |
| presynaptic modulation of chemical synaptic transmission | 1 |
| signal transduction | 1 |
Indications & clinical
Indications
0 indication records carry no mapped disease name (EFO/MeSH-only); none shown.
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
389 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | CHRM2 |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | CHRM2 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | CHRM2 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | CHRM2 |
| ACETYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ACLIDINIUM BROMIDE | ChEMBL | Phase 4 (approved) | CHRM2 |
| AMBENONIUM | ChEMBL | Phase 4 (approved) | CHRM2 |
| AMDINOCILLIN PIVOXIL | ChEMBL | Phase 4 (approved) | CHRM2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ANISOTROPINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ATROPINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| AXITINIB | ChEMBL | Phase 4 (approved) | CHRM2 |
| AZATADINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | CHRM2 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BETHANECHOL | ChEMBL | Phase 4 (approved) | CHRM2 |
| BIPERIDEN | ChEMBL | Phase 4 (approved) | CHRM2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | CHRM2 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | CHRM2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | CHRM2 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | CHRM2 |
| CANRENONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CARBACHOL | ChEMBL | Phase 4 (approved) | CHRM2 |
| CARBAMOYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CARBETAPENTANE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CARBINOXAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| CEVIMELINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLOROPROCAINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | CHRM2 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CLOPIDOGREL | ChEMBL | Phase 4 (approved) | CHRM2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | CHRM2 |
| COPANLISIB | ChEMBL | Phase 4 (approved) | CHRM2 |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | CHRM2 |
| CYCLOPENTOLATE | ChEMBL | Phase 4 (approved) | CHRM2 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DAPIPRAZOLE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | CHRM2 |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | CHRM2 |
| DEXAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | CHRM2 |
| DEXBROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DEXCHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| DICYCLOMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIMENHYDRINATE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIPHEMANIL | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIPHENIDOL | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIPHENYLPYRALINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DIPYRIDAMOLE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DOFETILIDE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DONEPEZIL | ChEMBL | Phase 4 (approved) | CHRM2 |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| DOXYLAMINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DRONEDARONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| DYCLONINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| EBASTINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | CHRM2 |
| EDARAVONE | ChEMBL | Phase 4 (approved) | CHRM2 |
| ELETRIPTAN | ChEMBL | Phase 4 (approved) | CHRM2 |
| EPHEDRINE | ChEMBL | Phase 4 (approved) | CHRM2 |
| EPIRUBICIN | ChEMBL | Phase 4 (approved) | CHRM2 |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | CHRM2 |
| ETHOPROPAZINE | ChEMBL | Phase 4 (approved) | CHRM2 |
Related Atlas pages
- Genes: CHRM2
- Drugs: Afatinib, Chenodiol, Pimavanserin, Acetylcholine, Aclidinium Bromide, Ambenonium, Amdinocillin Pivoxil, Amiodarone, Amitriptyline, Amodiaquine, Amoxapine, Anisotropine, Aripiprazole, Asenapine, Astemizole, Atropine, Axitinib, Azatadine, Azelastine, Bazedoxifene, Benperidol, Benzbromarone, Benztropine, Benzydamine, Bethanechol, Biperiden, Bosutinib, Bromocriptine, Bromodiphenhydramine, Brompheniramine, Cabozantinib, Candesartan Cilexetil, Cannabidiol, Canrenone, Carbachol, Carbenoxolone, Carbetapentane, Carbinoxamine, Cariprazine, Caspofungin, Cevimeline, Chlorhexidine, Chlormadinone, Chloroprocaine, Chloroquine, Chlorpheniramine, Chlorpromazine, Chlorprothixene, Cinnarizine, Citalopram, Clemastine, Clomiphene, Clomipramine, Clopidogrel, Clotrimazole, Clozapine, Cobimetinib, Copanlisib, Cyclizine, Cyclobenzaprine, Cyclofenil, Cyclopentolate, Cyproheptadine, Dapiprazole, Darifenacin, Dequalinium, Desipramine, Desloratadine, Desogestrel, Dexamethasone Phosphoric Acid, Dexbrompheniramine, Dibenzepin, Dicyclomine, Diethylstilbestrol, Dimenhydrinate, Diphemanil, Diphenhydramine, Diphenidol, Diphenylpyraline, Dipyridamole, Dofetilide, Donepezil, Dothiepin, Doxazosin, Doxepin, Doxylamine, Dronedarone, Drospirenone, Dyclonine, Ebastine, Econazole, Edaravone, Eletriptan, Ephedrine, Epirubicin, Erlotinib, Ethopropazine