Clomipramine
drugOn this page
Also known as AnapramineChlorimipramineClomicalmClomipraminaNSC-169865SID11110978SID11110979SID11113368SID26751616SID90340575ClomipramineSID104171137SID50100206SID50104278SID124879726SID144203668SID170464702
Summary
Clomipramine (CHEMBL415) is an approved small-molecule serotonergic antagonist (ATC N06AA04) targeting ADRA1A, KCNJ6, and KCNJ5; indicated across 7 conditions including depressive disorder and obsessive-compulsive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AA04
- Targets: 6 (ADRA1A, KCNJ6, KCNJ5…)
- Indications: 7 conditions
- Clinical trials: 10
- Chemistry: 314.9 Da · C19H23ClN2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL415 |
| Name | Clomipramine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2801 |
| ChEBI | CHEBI:47780 |
| ATC | N06AA04 |
| Molecular formula | C19H23ClN2 |
| Molecular weight | 314.9 |
| InChIKey | GDLIGKIOYRNHDA-UHFFFAOYSA-N |
SMILES: CN(C)CCCN1C2=CC=CC=C2CCC3=C1C=C(C=C3)Cl
IUPAC name: 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine
ChEBI definition: A dibenzoazepine that is 10,11-dihydro-5H-dibenzo[b,f]azepine which is substituted by chlorine at position 3 and in which the hydrogen attached to the nitrogen is replaced by a 3-(dimethylamino)propyl group. One of the more sedating tricyclic antidepressants, it is used as the hydrochloride salt for the treatment of depression as well as obsessive-compulsive disorder and phobias.
Pharmacological roles (ChEBI): serotonergic antagonist, serotonergic drug, serotonin uptake inhibitor, EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor, antidepressant, anticoronaviral agent.
Also known as: Anapramine, Chlorimipramine, Clomicalm, Clomipramina, Clomipramine, NSC-169865, clomipramine, SID11110978, SID11110979, SID11113368, SID26751616, SID90340575
Parent form; salt/anhydrous children: CHEMBL1200710
Patent coverage: 7,246 distinct patent families (27,385 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 27,246 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA1A | α1A-adrenoceptor | Antagonist | 8.1 | P35348 | |
| KCNJ6 | Kir3.2 | Antagonist | 4.4 | 0.1% | P48051 |
| KCNJ5 | Kir3.4 | Antagonist | 3.6 | 0% | P48544 |
| SLC6A2 | NET | Inhibition | 7.42 | 0.4% | P23975 |
| SLC6A3 | DAT | Inhibition | 5.66 | 0.2% | Q01959 |
| SLC6A4 | SERT | Inhibition | 9.55 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 68 (assay-derived). Sample: Nuclear receptor ROR-gamma, Inositol monophosphatase 1, Thrombopoietin, Muscarinic acetylcholine receptor M4, 5-hydroxytryptamine receptor 2B, Trypanothione reductase, Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Histamine H2 receptor.
Bioactivity
ChEMBL activities: 119 potent at pChembl ≥ 5 of 154 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P43140 | 10.4 | IC50 | 0.04 | nM | CHEMBL_ACT_777159 |
| SLC6A4 | 10.33 | Ki | 0.05 | nM | CHEMBL_ACT_7710549 |
| SLC6A4 | 10.06 | IC50 | 0.09 | nM | CHEMBL_ACT_7710548 |
| P31390 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_777160 |
| SLC6A4 | 9.55 | Ki | 0.28 | nM | CHEMBL_ACT_15702503 |
| SLC6A4 | 8.92 | AC50 | 1.2 | nM | CHEMBL_ACT_25151035 |
| P08909 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_777158 |
| P08909 | 8.08 | Ki | 8.3 | nM | CHEMBL_ACT_716832 |
| HRH1 | 8.01 | Ki | 9.83 | nM | CHEMBL_ACT_7710427 |
| SLC6A4 | 8 | AC50 | 10 | nM | CHEMBL_ACT_25149838 |
| CHRM4 | 7.89 | Ki | 13 | nM | CHEMBL_ACT_7710461 |
| ADRA1A | 7.81 | AC50 | 15.4 | nM | CHEMBL_ACT_25218600 |
| HTR2C | 7.75 | Ki | 18 | nM | CHEMBL_ACT_7710541 |
| HTR2A | 7.72 | Ki | 19 | nM | CHEMBL_ACT_7710537 |
| P31652 | 7.7 | IC50 | 20 | nM | CHEMBL_ACT_413768 |
| CHRM1 | 7.66 | Ki | 22 | nM | CHEMBL_ACT_7710455 |
| HTR2C | 7.47 | IC50 | 34 | nM | CHEMBL_ACT_7710540 |
| CHRM3 | 7.44 | Ki | 36 | nM | CHEMBL_ACT_7710459 |
| CHRM5 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_7710463 |
| DRD3 | 7.41 | AC50 | 39.3 | nM | CHEMBL_ACT_25194239 |
| P43140 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_7708269 |
| ADRA1A | 7.35 | AC50 | 44.5 | nM | CHEMBL_ACT_25137629 |
| ADRA2B | 7.34 | Ki | 46 | nM | CHEMBL_ACT_7708277 |
| DRD3 | 7.33 | Ki | 47 | nM | CHEMBL_ACT_7708347 |
| P19328 | 7.29 | Ki | 51 | nM | CHEMBL_ACT_716830 |
| CHRM5 | 7.28 | IC50 | 53 | nM | CHEMBL_ACT_7710462 |
| P61169 | 7.25 | Ki | 56 | nM | CHEMBL_ACT_716828 |
| SLC6A2 | 7.23 | AC50 | 59.1 | nM | CHEMBL_ACT_25145708 |
| SLC6A2 | 7.19 | IC50 | 64.6 | nM | CHEMBL_ACT_13468996 |
| HRH1 | 7.18 | AC50 | 66 | nM | CHEMBL_ACT_25211993 |
Target pathways
Aggregated over 6 target gene(s): ADRA1A, KCNJ6, KCNJ5, SLC6A2, SLC6A3, SLC6A4.
Top Reactome pathways
33 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transmission across Chemical Synapses | 4 | KCNJ5, KCNJ6, SLC6A3, SLC6A4 |
| Neuronal System | 4 | KCNJ5, KCNJ6, SLC6A3, SLC6A4 |
| SLC-mediated transport of neurotransmitters | 3 | SLC6A2, SLC6A3, SLC6A4 |
| Neurotransmitter clearance | 2 | SLC6A3, SLC6A4 |
| Neurotransmitter receptors and postsynaptic signal transmission | 2 | KCNJ5, KCNJ6 |
| Activation of G protein gated Potassium channels | 2 | KCNJ5, KCNJ6 |
| G protein gated Potassium channels | 2 | KCNJ5, KCNJ6 |
| Inwardly rectifying K+ channels | 2 | KCNJ5, KCNJ6 |
| Potassium Channels | 2 | KCNJ5, KCNJ6 |
| Disease | 2 | SLC6A2, SLC6A3 |
| Transport of small molecules | 2 | SLC6A2, SLC6A3 |
| R-HSA-425366 | 2 | SLC6A2, SLC6A3 |
| SLC-mediated transmembrane transport | 2 | SLC6A2, SLC6A3 |
| SLC transporter disorders | 2 | SLC6A2, SLC6A3 |
| Disorders of transmembrane transporters | 2 | SLC6A2, SLC6A3 |
| GABA receptor activation | 2 | KCNJ5, KCNJ6 |
| GABA B receptor activation | 2 | KCNJ5, KCNJ6 |
| Activation of GABAB receptors | 2 | KCNJ5, KCNJ6 |
| Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits | 2 | KCNJ5, KCNJ6 |
| Signal Transduction | 1 | ADRA1A |
| Signaling by GPCR | 1 | ADRA1A |
| Class A/1 (Rhodopsin-like receptors) | 1 | ADRA1A |
| Amine ligand-binding receptors | 1 | ADRA1A |
| Dopamine clearance from the synaptic cleft | 1 | SLC6A3 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| GPCR downstream signalling | 1 | ADRA1A |
| Adrenoceptors | 1 | ADRA1A |
| G alpha (q) signalling events | 1 | ADRA1A |
| G alpha (12/13) signalling events | 1 | ADRA1A |
| GPCR ligand binding | 1 | ADRA1A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| response to xenobiotic stimulus | 4 |
| neurotransmitter transport | 3 |
| amino acid transport | 3 |
| obsolete monoamine transport | 3 |
| sodium ion transmembrane transport | 3 |
| transmembrane transport | 3 |
| potassium ion transport | 2 |
| regulation of monoatomic ion transmembrane transport | 2 |
| potassium ion import across plasma membrane | 2 |
| monoatomic ion transport | 2 |
| monoatomic ion transmembrane transport | 2 |
| dopamine uptake involved in synaptic transmission | 2 |
| norepinephrine uptake | 2 |
| neurotransmitter reuptake | 2 |
| MAPK cascade | 1 |
Indications & clinical
Indications
7 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| depressive disorder | 4 | MONDO:0002050 | MONDO:0002050 |
| obsessive-compulsive disorder | 3 | MONDO:0008114 | EFO:0004242 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| premature ejaculation | 3 | MONDO:0001780 | EFO:0803321 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 10.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 3 |
| Not specified | 3 |
| PHASE2 | 2 |
| PHASE4 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00564564 | PHASE4 | COMPLETED | Quetiapine Augmentation Versus Clomipramine Augmentation of SSRI for Obsessive-compulsive Disorder Patients |
| NCT00254735 | PHASE3 | COMPLETED | Quetiapine Augmentation in Severe Obsessive Compulsive Disorder |
| NCT01439984 | PHASE3 | COMPLETED | Trial of PED-1 in Male Patients With Premature Ejaculation |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT00004310 | PHASE2 | UNKNOWN | Phase II Randomized Study of Intravenous Versus Oral Clomipramine in Patients With Obsessive Compulsive Disorder |
| NCT01203202 | PHASE2 | COMPLETED | Phase 2 Trial of PED-1 and PED-2 in Male Patients With Premature Ejaculation |
| NCT00913952 | PHASE1 | COMPLETED | To Demonstrate the Relative Bioavailability of Geneva and Basel (Anafranil) 25 mg Clomipramine Hydrochloride Capsules Under Fed and Fasted Conditions |
| NCT01404871 | Not specified | COMPLETED | Predicting Medication Response in Obsessive Compulsive Disorder |
| NCT01575158 | Not specified | COMPLETED | Citalopram vs Clomipramine vs Placebo in Recurrent Depression |
| NCT01896349 | Not specified | UNKNOWN | Interpersonal Psychotherapy for Treatment Resistant Depression |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (3) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for clomipramine and CYP2D6 | DPWG | CYP2D6 | yes | yes |
| Annotation of CPIC Guideline for clomipramine and CYP2C19, CYP2D6 | CPIC | CYP2C19;CYP2D6 | yes | yes |
| Annotation of DPWG Guideline for clomipramine and CYP2C19 | DPWG | CYP2C19 | yes |
PharmGKB also curates 8 clinical and 60 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
857 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, KCNJ5, SLC6A2, SLC6A3, SLC6A4 |
| MEFLOQUINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, KCNJ5, SLC6A2, SLC6A3, SLC6A4 |
| PROPAFENONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, KCNJ5, SLC6A2, SLC6A3, SLC6A4 |
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| PYRAZINAMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| Tadalafil | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| Vorapaxar | ChEMBL + PubChem | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DRONEDARONE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| DULOXETINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | ADRA1A, SLC6A2, SLC6A3, SLC6A4 |
Related Atlas pages
- Genes: ADRA1A, KCNJ6, KCNJ5, SLC6A2, SLC6A3, SLC6A4
- Diseases: depressive disorder, obsessive-compulsive disorder, anxiety, dementia, premature ejaculation
- Drugs: Imipramine, Mefloquine, Propafenone, Aclidinium Bromide, Afatinib, Amitriptyline, Chenodiol, Crizotinib, Dihydroergotamine, Olodaterol, Pimavanserin, Podofilox, Propoxyphene, Pyrazinamide, Regorafenib, Tadalafil, Vorapaxar, Acetophenazine, Amiodarone, Amoxapine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benfluorex, Benzphetamine, Benztropine, Benzydamine, Bepridil, Bosutinib, Brexpiprazole, Bromperidol, Cabergoline, Calcitriol, Carvedilol, Chlorhexidine, Chlorpheniramine, Chlorpromazine, Chlorprothixene, Cinnarizine, Citalopram, Clemastine, Clomiphene, Cobimetinib, Cyproheptadine, Dequalinium, Desipramine, Desloratadine, Diethylstilbestrol, Diphenhydramine, Dobutamine, Domperidone, Dothiepin, Doxazosin, Dronedarone, Duloxetine, Ebastine, Epalrestat