Clonidine
drugOn this page
Also known as Catapres-tts-1Catapres-tts-2Catapres-tts-3Catarpres-ttsClonidinaClonidine extended releaseClorpresCombipresNexiclon xrST-155BSSID11110984SID11110985SID11113648SID26751841SID104171138SID90341662SID170464900SID144203669
Summary
Clonidine (CHEMBL134) is an approved small molecule (ATC C02AC01) targeting ADRA2A; indicated across 38 conditions including hypertensive disorder and neuralgia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C02AC01 (+2 more)
- Targets: 1 (ADRA2A)
- Indications: 38 conditions
- Clinical trials: 176
- Chemistry: 230.09 Da · C9H9Cl2N3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL134 |
| Name | Clonidine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 2803 |
| ChEBI | CHEBI:3757 |
| ATC | C02AC01, N02CX02, S01EA04 |
| Molecular formula | C9H9Cl2N3 |
| Molecular weight | 230.09 |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-N |
SMILES: C1CN=C(N1)NC2=C(C=CC=C2Cl)Cl
IUPAC name: N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine
Also known as: Catapres-tts-1, Catapres-tts-2, Catapres-tts-3, Catarpres-tts, Clonidina, Clonidine, Clonidine extended release, Clorpres, Combipres, Nexiclon xr, ST-155BS, clonidine
Parent form; salt/anhydrous children: CHEMBL1705
Patent coverage: 27,244 distinct patent families (97,993 SureChEMBL compound mentions), from 2 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Partial agonist | 7.6 | 0.1% | P08913 |
Broader ChEMBL bioactivity targets: 36 (assay-derived). Sample: Prelamin-A/C, Inositol monophosphatase 1, Ferritin light chain, Multidrug and toxin extrusion protein 1, Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Histamine H2 receptor, Alpha-2B adrenergic receptor, Solute carrier family 22 member 1.
Bioactivity
ChEMBL activities: 120 potent at pChembl ≥ 5 of 134 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRA2A | 9.54 | EC50 | 0.29 | nM | CHEMBL_ACT_25982814 |
| ADRA2A | 9.5 | EC50 | 0.32 | nM | CHEMBL_ACT_25982816 |
| P22909 | 9.41 | Ki | 0.39 | nM | CHEMBL_ACT_1005004 |
| P22909 | 9.41 | Ki | 0.39 | nM | CHEMBL_ACT_203998 |
| P19328 | 8.82 | Ki | 1.5 | nM | CHEMBL_ACT_559502 |
| P19328 | 8.77 | Ki | 1.7 | nM | CHEMBL_ACT_1079539 |
| ADRA1A | 8.77 | AC50 | 1.7 | nM | CHEMBL_ACT_25208564 |
| P19328 | 8.74 | Ki | 1.8 | nM | CHEMBL_ACT_1003012 |
| Q28838 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_644453 |
| P19328 | 8.6 | Ki | 2.51 | nM | CHEMBL_ACT_15186170 |
| P19328 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_16758669 |
| P19328 | 8.51 | IC50 | 3.1 | nM | CHEMBL_ACT_156766 |
| ADRA2A | 8.42 | Ki | 3.8 | nM | CHEMBL_ACT_15197906 |
| ADRA2A | 8.42 | Ki | 3.8 | nM | CHEMBL_ACT_38525 |
| ADRA2A | 8.42 | Ki | 3.8 | nM | CHEMBL_ACT_772445 |
| P19328 | 8.41 | IC50 | 3.9 | nM | CHEMBL_ACT_1003013 |
| ADRA2A | 8.36 | EC50 | 4.4 | nM | CHEMBL_ACT_38529 |
| P19328 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_540834 |
| ADRA2B | 8.21 | Ki | 6.17 | nM | CHEMBL_ACT_1293879 |
| ADRA2A | 8.1 | Ki | 7.94 | nM | CHEMBL_ACT_1293878 |
| ADRA2A | 8.09 | EC50 | 8.13 | nM | CHEMBL_ACT_1293884 |
| ADRA1A | 8.08 | AC50 | 8.3 | nM | CHEMBL_ACT_25229712 |
| ADRA2A | 8.08 | EC50 | 8.32 | nM | CHEMBL_ACT_3556444 |
| P19328 | 8.08 | Ki | 8.3 | nM | CHEMBL_ACT_38526 |
| P19328 | 8.08 | Ki | 8.3 | nM | CHEMBL_ACT_772446 |
| ADRA2A | 8.06 | Ki | 8.71 | nM | CHEMBL_ACT_10964098 |
| P19328 | 8.06 | Ki | 8.7 | nM | CHEMBL_ACT_2488323 |
| P19328 | 8.06 | Ki | 8.7 | nM | CHEMBL_ACT_5129903 |
| NISCH | 8.05 | Ki | 8.9 | nM | CHEMBL_ACT_772448 |
| ADRA2C | 8.03 | Ki | 9.33 | nM | CHEMBL_ACT_10964112 |
Target pathways
Aggregated over 1 target gene(s): ADRA2A.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 1 | ADRA2A |
| Metabolism | 1 | ADRA2A |
| Signal Transduction | 1 | ADRA2A |
| Integration of energy metabolism | 1 | ADRA2A |
| Signaling by GPCR | 1 | ADRA2A |
| Class A/1 (Rhodopsin-like receptors) | 1 | ADRA2A |
| Amine ligand-binding receptors | 1 | ADRA2A |
| GPCR downstream signalling | 1 | ADRA2A |
| Adrenoceptors | 1 | ADRA2A |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 1 | ADRA2A |
| Metabolism of proteins | 1 | ADRA2A |
| Adrenaline,noradrenaline inhibits insulin secretion | 1 | ADRA2A |
| G alpha (i) signalling events | 1 | ADRA2A |
| G alpha (z) signalling events | 1 | ADRA2A |
| Regulation of insulin secretion | 1 | ADRA2A |
| GPCR ligand binding | 1 | ADRA2A |
| Surfactant metabolism | 1 | ADRA2A |
| Platelet activation, signaling and aggregation | 1 | ADRA2A |
| Platelet Aggregation (Plug Formation) | 1 | ADRA2A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| positive regulation of cytokine production | 1 |
| DNA replication | 1 |
| epidermal growth factor receptor signaling pathway | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 1 |
| Ras protein signal transduction | 1 |
| Rho protein signal transduction | 1 |
| female pregnancy | 1 |
| positive regulation of cell population proliferation | 1 |
| negative regulation of norepinephrine secretion | 1 |
| regulation of vasoconstriction | 1 |
| actin cytoskeleton organization | 1 |
| platelet activation | 1 |
| positive regulation of cell migration | 1 |
Indications & clinical
Indications
38 indications (5 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| neuralgia | 4 | MONDO:0021667 | EFO:0005762 |
| migraine disorder | 4 | MONDO:0005277 | MONDO:0005277 |
| neoplasm | 4 | MONDO:0005070 | MONDO:0004992 |
| glaucoma | 4 | MONDO:0005041 | MONDO:0005041 |
| attention deficit-hyperactivity disorder | 3 | MONDO:0007743 | EFO:0003888 |
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| neonatal abstinence syndrome | 3 | MONDO:0005566 | EFO:0005799 |
| hyperemesis gravidarum | 3 | MONDO:0006791 | EFO:1000971 |
| scoliosis | 3 | MONDO:0005392 | EFO:0004273 |
| delirium | 3 | MONDO:0045057 | EFO:0009267 |
| post-traumatic stress disorder | 3 | MONDO:0005146 | EFO:0001358 |
| male reproductive organ cancer | 3 | MONDO:0005836 | EFO:0007355 |
| pituitary dwarfism | 3 | MONDO:0006909 | EFO:1001109 |
| anxiety | 2 | MONDO:0011918 | EFO:0005230 |
| opiate dependence | 2 | MONDO:0005530 | EFO:0005611 |
| autism spectrum disorder | 2 | MONDO:0005258 | EFO:0003756 |
| diabetic neuropathy | 2 | MONDO:0006626 | EFO:1000783 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| brain injury | 2 | MONDO:0043510 | MONDO:0043510 |
| stomatitis | 2 | MONDO:0004842 | EFO:1001904 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| musculoskeletal system disorder | 2 | MONDO:0002081 | EFO:0009676 |
| atopic eczema | 1 | MONDO:0004980 | EFO:0000274 |
| heroin dependence | 1 | MONDO:0005367 | EFO:0004240 |
| orthostatic hypotension | 1 | MONDO:0005469 | EFO:0005252 |
| postural orthostatic tachycardia syndrome | 1 | MONDO:0011479 | EFO:1000645 |
| brain ischemia | 1 | MONDO:0005299 | MONDO:0005299 |
9 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 176.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 51 |
| Not specified | 41 |
| PHASE2 | 30 |
| PHASE3 | 23 |
| PHASE1 | 12 |
| PHASE1/PHASE2 | 9 |
| PHASE2/PHASE3 | 6 |
| EARLY_PHASE1 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03092011 | PHASE4 | ACTIVE_NOT_RECRUITING | Treatment of Neonatal Abstinence Syndrome With Clonidine Versus Morphine as Primary Therapy |
| NCT03121261 | PHASE4 | ACTIVE_NOT_RECRUITING | The Effect of Local Anesthetic and Clonidine on the Cutaneous Silent Period During Spinal Anesthesia |
| NCT05824832 | PHASE4 | RECRUITING | Buprenorphine, Clonidine, and Dexamethasone on Duration of Brachial Plexus Blocks for Upper Extremity Surgery |
| NCT07313371 | PHASE4 | RECRUITING | Efficacy of Clonidine in Reducing Craving in Inpatients With Cocaine and Crack Use Disorder |
| NCT07567495 | PHASE4 | NOT_YET_RECRUITING | Adding Dexmedetomidine or Clonidine to Spinal Anesthesia for Cesarean Delivery |
| NCT00370838 | PHASE4 | COMPLETED | Comparison of Keppra and Clonidine in the Treatment of Tics |
| NCT00535925 | PHASE4 | COMPLETED | Nephropathy In Type 2 Diabetes and Cardio-renal Events |
| NCT00661895 | PHASE4 | COMPLETED | Black Education and Treatment of Hypertension (BEAT HTN) |
| NCT00858845 | PHASE4 | COMPLETED | Using Clonidine to Improve Leg Weakness in People With Heart Failure |
| NCT00860899 | PHASE4 | COMPLETED | Postoperative Pain and SIRS After Preoperative Analgesia With Clonidine or Levobupivacaine |
| NCT00860925 | PHASE4 | COMPLETED | PeriOperative ISchemic Evaluation-2 Pilot |
| NCT00959062 | PHASE4 | COMPLETED | Adjunctive Clonidine in the Sedation of Mechanically Ventilated Children |
| NCT00983125 | PHASE4 | COMPLETED | Systematic Clonidine for Epidural Analgesia in Labour |
| NCT01052623 | PHASE4 | UNKNOWN | Status of Growth Hormone/ Insulin-like Growth Factor-1 (GH/IGF-1) Axis and Growth Failure in Ataxia Telangiectasia (AT) |
| NCT01075490 | PHASE4 | UNKNOWN | Neonatal Spinal Anesthesia: Effects of the Addition of Clonidine |
| NCT01112878 | PHASE4 | WITHDRAWN | Oral Clonidine & Gabapentin: Improving Recovery and Pain Management After Outpatient With Major Orthopedic Surgery |
| NCT01139996 | PHASE4 | TERMINATED | Use of Transdermal Clonidine in Trauma Patients |
| NCT01619436 | PHASE4 | COMPLETED | The Effect of Clonidine in Glycemia During Coronary Artery Bypass Graft With Cardiopulmonary By-pass |
| NCT01643434 | PHASE4 | UNKNOWN | Resistant Hypertension Optimal Treatment |
| NCT01734551 | PHASE4 | COMPLETED | NAS Treatment - Opiate Versus Non-Opiate |
| NCT01761916 | PHASE4 | COMPLETED | Clonidine Versus Captopril for Treatment of Postpartum Very High Blood Pressure |
| NCT01785693 | PHASE4 | COMPLETED | Interest of a Bi-truncal Nerve Block (Femoral + Sciatic) Extended, Systematically Associated With General Anesthesia, in the Femoropopliteal Bypass: Study of Post-operative Analgesia and Peripheral Circulation Downstream |
| NCT01846221 | PHASE4 | COMPLETED | Comparison of Epidural Fentanyl and Clonidine for Breakthrough Pain |
| NCT01902108 | PHASE4 | COMPLETED | Added Value of Local Clonidine for Spine Postoperative Pain Control, in Addition to Bupivacaine |
| NCT01931215 | PHASE4 | COMPLETED | Transversus Abdominis Plane (TAP) Block Versus Intrathecal Morphine for Caesarean Section - Randomised Controlled Trial |
| NCT02067078 | PHASE4 | COMPLETED | Protracted Effect of Combined Nerve Blocks After Total Knee Arthroplasty |
| NCT02177461 | PHASE4 | COMPLETED | Telmisartan Compared With Enalapril in Elderly Patients With Blood Hypertension |
| NCT02361476 | PHASE4 | COMPLETED | Does Intraoperative Clonidine Reduce Post Operative Agitation in Children? |
| NCT02365727 | PHASE4 | WITHDRAWN | Exparel vs Exparel Plus ACB in TKAs |
| NCT02365961 | PHASE4 | COMPLETED | Hip Scope Fascia-iliaca (FI) Block Study |
| NCT02543801 | PHASE4 | COMPLETED | A Clinical Trial of Two Periarticular Multimodal Drug Injections in Total Hip and Knee Arthroplasty |
| NCT02570503 | PHASE4 | TERMINATED | Postoperative Pain Control After Periarticular Injection During Total Knee Arthroplasty |
| NCT02773602 | PHASE4 | UNKNOWN | Dexamethasone or Clonidine as Adjuncts to Ropivacaine for Caudal Analgesia on Analgesia Duration in Children |
| NCT03017430 | PHASE4 | COMPLETED | Pregabalin for Opiate Withdrawal Syndrome |
| NCT03018171 | PHASE4 | UNKNOWN | Intrathecal Clonidine Addiction for Combined Spinal Epidural Analgesia During Labor |
| NCT03057015 | PHASE4 | UNKNOWN | Addition of Clonidine to Ropivacaine in Adductor Canal Block |
| NCT03065933 | PHASE4 | TERMINATED | An Extended-Release Form of Clonidine as an Anti-Manic Agent: An Add-on, Open-Label Study |
| NCT03109795 | PHASE4 | TERMINATED | Anxiety-mediated Impairments in Large Elastic Artery Function and the Autonomic Nervous System |
| NCT03119038 | PHASE4 | WITHDRAWN | Efficacy of Intraoperative Injections on Postoperative Pain Control During Total Hip Replacement |
| NCT03124082 | PHASE4 | UNKNOWN | OFA - Opioid Free Anesthesia |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for clonidine and CYP2D6 | DPWG | CYP2D6 |
PharmGKB also curates 2 clinical and 7 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
458 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| NAPHAZOLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A |
| AMIODARONE | ChEMBL | Phase 4 (approved) | ADRA2A |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| ANTAZOLINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A |
| ATRACURIUM | ChEMBL | Phase 4 (approved) | ADRA2A |
| AURANOFIN | ChEMBL | Phase 4 (approved) | ADRA2A |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENZIODARONE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENZTHIAZIDE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BISACODYL | ChEMBL | Phase 4 (approved) | ADRA2A |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ADRA2A |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | ADRA2A |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BRIMONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A |
| BUFLOMEDIL | ChEMBL | Phase 4 (approved) | ADRA2A |
| BUTENAFINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | ADRA2A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRA2A |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CHLORZOXAZONE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA2A |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A |
Related Atlas pages
- Genes: ADRA2A
- Diseases: hypertensive disorder, neuralgia, migraine disorder, neoplasm, glaucoma, attention deficit-hyperactivity disorder, cardiovascular disorder, neonatal abstinence syndrome, hyperemesis gravidarum, scoliosis, delirium, post-traumatic stress disorder, male reproductive organ cancer, pituitary dwarfism
- Drugs: Aclidinium Bromide, Chenodiol, Crizotinib, Desloratadine, Dihydroergotamine, Naphazoline, Olodaterol, Paliperidone, Pramipexole, Tamsulosin, Acetophenazine, Alfuzosin, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amoxapine, Antazoline, Apomorphine, Apraclonidine, Aripiprazole, Asenapine, Astemizole, Atracurium, Auranofin, Azelastine, Bazedoxifene, Benfluorex, Benperidol, Benzbromarone, Benziodarone, Benzquinamide, Benzthiazide, Benztropine, Benzydamine, Bexarotene, Bisacodyl, Bithionol, Bosutinib, Brexpiprazole, Brimonidine, Bromocriptine, Bromodiphenhydramine, Bromperidol, Buflomedil, Butenafine, Cabergoline, Cabozantinib, Candesartan Cilexetil, Carbenoxolone, Cariprazine, Carvedilol, Chlorhexidine, Chloroquine, Chlorpromazine, Chlorprothixene, Chlorzoxazone, Cinnarizine, Cisapride