Colchicine
drugOn this page
Also known as (-)-colchicineColchcineColchicine component of col-probenecidColchicine component of colbenemidColchicine component of mitigareColchicine component of proben-cColchicinumColchineosColchisolColcrysGloperbaLodocoMitigareNSC-757colchichinecoichicineSID11114044SID17389095SID17389096
Summary
Colchicine (CHEMBL107) is an approved small-molecule anti-inflammatory agent (ATC M04AC01) targeting BRD4, TUBB, and GLRA1; indicated across 42 conditions including gout and familial mediterranean fever.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M04AC01
- Targets: 6 (BRD4, TUBB, GLRA1…)
- Indications: 42 conditions
- Clinical trials: 231
- Chemistry: 399.4 Da · C22H25NO6
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL107 |
| Name | Colchicine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 6167 |
| ChEBI | CHEBI:27882 |
| ATC | M04AC01 |
| Molecular formula | C22H25NO6 |
| Molecular weight | 399.4 |
| InChIKey | IAKHMKGGTNLKSZ-INIZCTEOSA-N |
SMILES: CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC
IUPAC name: N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide
ChEBI definition: A colchicine that has (S)-configuration. It is a secondary metabolite, has anti-inflammatory properties and is used to treat gout, crystal-induced joint inflammation, familial Mediterranean fever, and many other conditions.
Pharmacological roles (ChEBI): mutagen, anti-inflammatory agent, gout suppressant.
Also known as: (-)-colchicine, Colchcine, Colchicine, Colchicine component of col-probenecid, Colchicine component of colbenemid, Colchicine component of mitigare, Colchicine component of proben-c, Colchicinum, Colchineos, Colchisol, Colcrys, Gloperba
Patent coverage: 35,013 distinct patent families (93,932 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 93,858 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| BRD4 | bromodomain containing 4 | Inhibition | 4.7 | 94.7% (common-essential) | O60885 |
| TUBB | tubulin beta class I | Inhibition | 7.96 | P07437 | |
| GLRA1 | glycine receptor α1 subunit | Antagonist | 3.5 | 0.3% | P23415 |
| GLRA2 | glycine receptor α2 subunit | Antagonist | 4.2 | 0.4% | P23416 |
| Glycine Receptor (All subtypes) | Inhibition | ||||
| TAS2R4 | TAS2R4 | Agonist | 2.99 | 0% | Q9NYW5 |
| TAS2R46 | TAS2R46 | Agonist | 2.8 | 2.2% | P59540 |
Broader ChEMBL bioactivity targets: 30 (assay-derived). Sample: Prelamin-A/C, Ferritin light chain, Thrombopoietin, Geminin, Endonuclease 4, Ras-related protein Rab-9A, 5-hydroxytryptamine receptor 2B, Thyrotropin receptor, Beta-lactamase, Solute carrier family 22 member 3.
Bioactivity
ChEMBL activities: 146 potent at pChembl ≥ 5 of 162 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P02550 | 8.79 | Ki | 1.61 | nM | CHEMBL_ACT_12159388 |
| TUBB4A | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_25872982 |
| P02550 | 8.17 | IC50 | 6.7 | nM | CHEMBL_ACT_16562094 |
| LMNA | 8.05 | Potency | 8.9 | nM | CHEMBL_ACT_3626577 |
| GMNN | 7.4 | Potency | 39.8 | nM | CHEMBL_ACT_5061236 |
| P15917 | 7.3 | Potency | 50.1 | nM | CHEMBL_ACT_4659592 |
| TUBB4A | 7.24 | Kd | 58 | nM | CHEMBL_ACT_18357215 |
| LMNA | 7.15 | Potency | 70.8 | nM | CHEMBL_ACT_4402409 |
| P15917 | 7 | Potency | 100 | nM | CHEMBL_ACT_4633042 |
| SLC22A3 | 6.92 | Ki | 120 | nM | CHEMBL_ACT_11002258 |
| LMNA | 6.9 | Potency | 125.9 | nM | CHEMBL_ACT_3645019 |
| TUBB4A | 6.72 | IC50 | 190 | nM | CHEMBL_ACT_22750673 |
| TUBB4A | 6.7 | EC50 | 200 | nM | CHEMBL_ACT_22930733 |
| TUBB4A | 6.44 | IC50 | 360 | nM | CHEMBL_ACT_15203083 |
| TUBB4A | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_1766796 |
| THPO | 6.3 | Potency | 501.2 | nM | CHEMBL_ACT_4805572 |
| THPO | 6.3 | Potency | 501.2 | nM | CHEMBL_ACT_5070323 |
| Q27957 | 6.12 | EC50 | 750 | nM | CHEMBL_ACT_12563896 |
| Q6B856 | 6.11 | Ki | 780 | nM | CHEMBL_ACT_539983 |
| Q6B856 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_1044136 |
| Q6B856 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_1098989 |
| Q6B856 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_329353 |
| P02550 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_380041 |
| CYP2D6 | 6.1 | Potency | 794.3 | nM | CHEMBL_ACT_4969891 |
| CYP2D6 | 6.1 | AC50 | 794.3 | nM | CHEMBL_ACT_6050298 |
| Q6B856 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_906404 |
| Q6B856 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_943855 |
| Q6B856 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_988362 |
| P08482 | 6.05 | Potency | 891.3 | nM | CHEMBL_ACT_4803398 |
| TUBB4A | 5.98 | IC50 | 1050 | nM | CHEMBL_ACT_2003745 |
Target pathways
Aggregated over 6 target gene(s): BRD4, TUBB, GLRA1, GLRA2, TAS2R4, TAS2R46.
Top Reactome pathways
35 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neurotransmitter receptors and postsynaptic signal transmission | 2 | GLRA1, GLRA2 |
| Signal Transduction | 2 | TAS2R4, TAS2R46 |
| Disease | 2 | BRD4, TUBB |
| Signaling by GPCR | 2 | TAS2R4, TAS2R46 |
| GPCR downstream signalling | 2 | TAS2R4, TAS2R46 |
| G alpha (i) signalling events | 2 | TAS2R4, TAS2R46 |
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 2 | TAS2R4, TAS2R46 |
| GPCR ligand binding | 2 | TAS2R4, TAS2R46 |
| Infectious disease | 2 | BRD4, TUBB |
| Potential therapeutics for SARS | 2 | BRD4, TUBB |
| SARS-CoV Infections | 2 | BRD4, TUBB |
| Sensory Perception | 2 | TAS2R4, TAS2R46 |
| Sensory perception of taste | 2 | TAS2R4, TAS2R46 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 2 | TAS2R4, TAS2R46 |
| Viral Infection Pathways | 2 | BRD4, TUBB |
| Cell Cycle | 1 | TUBB |
| Innate Immune System | 1 | TUBB |
| Immune System | 1 | TUBB |
| Organelle biogenesis and maintenance | 1 | TUBB |
| Regulation of PLK1 Activity at G2/M Transition | 1 | TUBB |
| Loss of Nlp from mitotic centrosomes | 1 | TUBB |
| Recruitment of mitotic centrosome proteins and complexes | 1 | TUBB |
| Loss of proteins required for interphase microtubule organization from the centrosome | 1 | TUBB |
| Centrosome maturation | 1 | TUBB |
| Recruitment of NuMA to mitotic centrosomes | 1 | TUBB |
| Mitotic G2-G2/M phases | 1 | TUBB |
| Cilium Assembly | 1 | TUBB |
| Anchoring of the basal body to the plasma membrane | 1 | TUBB |
| Neutrophil degranulation | 1 | TUBB |
| Mitotic Prometaphase | 1 | TUBB |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 2 |
| chloride transport | 2 |
| neuropeptide signaling pathway | 2 |
| cellular response to amino acid stimulus | 2 |
| cellular response to zinc ion | 2 |
| cellular response to ethanol | 2 |
| chloride transmembrane transport | 2 |
| monoatomic ion transmembrane transport | 2 |
| excitatory postsynaptic potential | 2 |
| detection of chemical stimulus involved in sensory perception of bitter taste | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| sensory perception of taste | 2 |
| chromatin remodeling | 1 |
| regulation of transcription by RNA polymerase II | 1 |
Indications & clinical
Indications
42 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| gout | 4 | MONDO:0005393 | EFO:0004274 |
| familial Mediterranean fever | 4 | MONDO:0018088 | MONDO:0018088 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| atrial fibrillation | 3 | MONDO:0004981 | EFO:0000275 |
| pericarditis | 3 | MONDO:0005904 | EFO:0007427 |
| proliferative vitreoretinopathy | 3 | MONDO:0700115 | EFO:1001129 |
| primary biliary cholangitis | 3 | MONDO:0005388 | EFO:1001486 |
| vasculitis | 3 | MONDO:0018882 | EFO:0006803 |
| ST-elevation myocardial infarction | 3 | MONDO:0041656 | EFO:0008585 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| lung disorder | 3 | MONDO:0005275 | EFO:0003818 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| asthma | 3 | MONDO:0004979 | MONDO:0004979 |
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| ischemia reperfusion injury | 3 | MONDO:0005203 | EFO:0002687 |
| canker sore | 2 | MONDO:0005318 | EFO:0003938 |
| acute coronary syndrome | 2 | MONDO:0005542 | EFO:0005672 |
| Behcet disease | 2 | MONDO:0007191 | EFO:0003780 |
| vascular disorder | 2 | MONDO:0005385 | EFO:0004264 |
| diabetic kidney disease | 2 | MONDO:0005016 | EFO:0000401 |
| chronic hepatitis C virus infection | 2 | MONDO:0005354 | EFO:0004220 |
| heart disorder | 2 | MONDO:0005267 | EFO:0003777 |
| cholangiocarcinoma | 2 | MONDO:0019087 | EFO:0005221 |
| viral pneumonia | 2 | MONDO:0006012 | EFO:0007541 |
| chronic kidney disease | 2 | MONDO:0005300 | EFO:0003884 |
| hypertensive disorder | 2 | MONDO:0005044 | EFO:0000537 |
| atherosclerosis | 2 | MONDO:0005311 | EFO:0003914 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| osteoarthritis, knee | 2 | MONDO:0005416 | EFO:0004616 |
| cirrhosis of liver | 1 | MONDO:0005155 | EFO:0001422 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| peripheral arterial disease | 0 | MONDO:0005386 | EFO:0004265 |
8 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 231.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 58 |
| PHASE2 | 55 |
| PHASE4 | 47 |
| PHASE1 | 27 |
| Not specified | 27 |
| PHASE2/PHASE3 | 10 |
| EARLY_PHASE1 | 4 |
| PHASE1/PHASE2 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04875702 | PHASE4 | RECRUITING | Treat-to-Target Serum Urate Versus Treat-to-Avoid Symptoms in Gout |
| NCT05618353 | PHASE4 | RECRUITING | The Peri-OPerative COlchicine to Reduce Negative Events (POPCORN) Trial |
| NCT05850091 | PHASE4 | RECRUITING | Polygenic Risk-based Detection of Subclinical Coronary Atherosclerosis and Intervention With Statin and Colchicine |
| NCT06090890 | PHASE4 | RECRUITING | Anti-inflammatory Therapy for Recurrent In-stent Restenosis |
| NCT06286423 | PHASE4 | RECRUITING | Colchicine in Acutely Decompensated HFREF |
| NCT06396858 | PHASE4 | NOT_YET_RECRUITING | Anti-inflammatory and Anti-thrombotic Therapy With colcHicine and Low Dose Rivaroxaban for Major Adverse Cardiovascular Events Reduction in Ischemic Stroke |
| NCT06543082 | PHASE4 | RECRUITING | MACT (Mono Antiplatelet and Colchicine Therapy) Prospective Multicenter Study |
| NCT06765356 | PHASE4 | ACTIVE_NOT_RECRUITING | Pragmatic Evaluation of a Pentaspline Pulsed Field Ablation System to Treat Atrial Fibrillation and Related Arrhythmias |
| NCT06798714 | PHASE4 | RECRUITING | The Effect of Colchicine on the Occurrence of Atrial Fibrillation After Cardiac Surgery |
| NCT06802926 | PHASE4 | RECRUITING | Pilot Trial of Colchicine for Graft Failure in CABG |
| NCT07287345 | PHASE4 | RECRUITING | Colchicine’s Effect on Inflammatory Markers |
| NCT07462325 | PHASE4 | NOT_YET_RECRUITING | Proteomic and Inflammatory Omics Changes With Colchicine Therapy in Coronary Heart Disease |
| NCT00179413 | PHASE4 | COMPLETED | Study of Long-term Peg Intron vs. Colchicine in Non-responders. |
| NCT00235079 | PHASE4 | COMPLETED | Study of Colchicine to Treat and Prevent Recurrent Pericarditis After Failure of Conventional Treatment. |
| NCT01084278 | PHASE4 | COMPLETED | Healthy and Renal Impairment Study of Colcrys (Colchicine, USP) |
| NCT01112982 | PHASE4 | COMPLETED | An Assessment of Chronic Synovial-Based Inflammation and Its Role With Serum Urate Levels. |
| NCT01173107 | PHASE4 | COMPLETED | A Pilot Study for PK/PD Parameter of Colchicine in Chronic Kidney Disease Patient. |
| NCT01451645 | PHASE4 | COMPLETED | Efficacy and Safety of Colchicine for the Prevention of Gout Flares During the Initiation of Allopurinol |
| NCT01601132 | PHASE4 | COMPLETED | Drug Interaction Study of Colchicine and Theophylline |
| NCT01709981 | PHASE4 | COMPLETED | Anti-inflammatory Effects of Colchicine in PCI |
| NCT01906749 | PHASE4 | UNKNOWN | Colchicine for Acute Coronary Syndromes |
| NCT01994226 | PHASE4 | COMPLETED | Colchicine Or Naproxen Treatment for ACute gouT |
| NCT02060552 | PHASE4 | COMPLETED | Immune Molecular and Inflammatory Cytokines Dysfunction Analysis in Gout Patients With Different Urate Levels |
| NCT02122484 | PHASE4 | COMPLETED | Colchicine in Coronary Artery Bypass Graft (CABG) |
| NCT02140372 | PHASE4 | COMPLETED | Anti-platelet Effects of Colchicine in Healthy Volunteers |
| NCT02260206 | PHASE4 | COMPLETED | Impact of Colchicine Therapy on Arrhythmia Recurrence After Acute Pericardial Effusion |
| NCT02281305 | PHASE4 | UNKNOWN | Post-MI PET Scan Imaging of Inflammation |
| NCT02500641 | PHASE4 | COMPLETED | Intensive Urate Lowering Therapy of Febuxostat Compared to Allopurinol on Cardiovascular Risk in Patients With Gout |
| NCT02602028 | PHASE4 | COMPLETED | The Comparison of the Efficacy of Once and Twice Daily Colchicine Dosage in Pediatric Patients With FMF |
| NCT02926248 | PHASE4 | SUSPENDED | Effect of Colchicine on Range of Motion After Manipulation Under Anesthesia for the Stiff Total Knee Replacement |
| NCT03226899 | PHASE4 | TERMINATED | A Phase 4 Safety and Efficacy Study to Evaluate Lesinurad 200 mg in Participants With Gout and Renal Impairment |
| NCT04224545 | PHASE4 | COMPLETED | COlchicine in Cardiac Surgery |
| NCT04382443 | PHASE4 | COMPLETED | Oral Colchicine in Argentina to Prevent Restenosis |
| NCT04601883 | PHASE4 | COMPLETED | Colchicine as Treatment for People With Hand Osteoarthritis |
| NCT04818489 | PHASE4 | UNKNOWN | Colchicine and Post-COVID-19 Pulmonary Fibrosis |
| NCT04848857 | PHASE4 | COMPLETED | Colchicine for the Stability of Coronary Plaque in Acute Coronary Syndrome (COLOCT) |
| NCT04949516 | PHASE4 | COMPLETED | Mono Antiplatelet and Colchicine Therapy |
| NCT05130892 | PHASE4 | COMPLETED | Effect of Inflammasome Inhibitor on hsCRP in Patients After PCI |
| NCT05168137 | PHASE4 | UNKNOWN | Efficacy and Safety of Low-Dose Colchicine on Surrogate Markers of Cardiovascular Events in People Living With HIV Receiving Antiretroviral Therapy |
| NCT05246072 | PHASE4 | COMPLETED | Effect of Combined Use of Ivermectin and Colchicine in COVID-19 Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 2 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
64 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | TAS2R4, TAS2R46 |
| MOLIBRESIB | ChEMBL | Phase 2 | BRD4, TUBB |
| ADAPALENE | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| CANNABIDIOL | ChEMBL + PubChem | Phase 4 (approved) | GLRA2 |
| CHOLECALCIFEROL | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| CINACALCET | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| DRONABINOL | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| DUTASTERIDE | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| GLYCINE | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| MEFLOQUINE | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | TUBB |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| RISPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| SULINDAC | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| TELMISARTAN | ChEMBL + PubChem | Phase 4 (approved) | GLRA1 |
| VINBLASTINE | ChEMBL + PubChem | Phase 4 (approved) | TUBB |
| ACETAMINOPHEN | ChEMBL | Phase 4 (approved) | BRD4 |
| ALPRAZOLAM | ChEMBL | Phase 4 (approved) | BRD4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | GLRA1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | BRD4 |
| DEXTROMETHORPHAN | ChEMBL | Phase 4 (approved) | TAS2R46 |
| DOCETAXEL | ChEMBL | Phase 4 (approved) | TUBB |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | BRD4 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | GLRA1 |
| LENALIDOMIDE | ChEMBL | Phase 4 (approved) | BRD4 |
| LEVOFLOXACIN | ChEMBL | Phase 4 (approved) | TUBB |
| NITROXOLINE | ChEMBL | Phase 4 (approved) | BRD4 |
| NORFLOXACIN | ChEMBL | Phase 4 (approved) | BRD4 |
| NOSCAPINE | ChEMBL | Phase 4 (approved) | TUBB |
| PACLITAXEL | ChEMBL | Phase 4 (approved) | TUBB |
| PANOBINOSTAT | ChEMBL | Phase 4 (approved) | BRD4 |
| ROMIDEPSIN | ChEMBL | Phase 4 (approved) | BRD4 |
| TIRBANIBULIN | ChEMBL | Phase 4 (approved) | TUBB |
| VINCRISTINE | ChEMBL | Phase 4 (approved) | TUBB |
| VINORELBINE | ChEMBL | Phase 4 (approved) | TUBB |
| VORINOSTAT | ChEMBL | Phase 4 (approved) | BRD4 |
| APABETALONE | ChEMBL | Phase 3 | BRD4 |
| DINACICLIB | ChEMBL | Phase 3 | BRD4 |
| PATUPILONE | ChEMBL | Phase 3 | TUBB |
| PELABRESIB | ChEMBL | Phase 3 | BRD4 |
| TACEDINALINE | ChEMBL | Phase 3 | BRD4 |
| VOLASERTIB | ChEMBL | Phase 3 | BRD4 |
| 7-ETHYL-10-HYDROXYCAMPTOTHECIN | ChEMBL | Phase 2 | BRD4 |
| ABT-751 | ChEMBL | Phase 2 | TUBB |
| ALOBRESIB | ChEMBL | Phase 2 | BRD4 |
| AMREDOBRESIB | ChEMBL | Phase 2 | BRD4 |
| BI-2536 | ChEMBL | Phase 2 | BRD4 |
| BIRABRESIB | ChEMBL | Phase 2 | BRD4 |
| CLOXYQUIN | ChEMBL | Phase 2 | BRD4 |
| DOLASTATIN-10 | ChEMBL | Phase 2 | TUBB |
| EZOBRESIB | ChEMBL | Phase 2 | BRD4 |
| FRUCTOSE | ChEMBL | Phase 2 | GLRA1 |
| INDIBULIN | ChEMBL | Phase 2 | TUBB |
| MAYTANSINE | ChEMBL | Phase 2 | TUBB |
| MIVEBRESIB | ChEMBL | Phase 2 | BRD4 |
| NOCODAZOLE | ChEMBL | Phase 2 | TUBB |
| PARBENDAZOLE | ChEMBL | Phase 2 | TUBB |
| SF-1126 | ChEMBL | Phase 2 | BRD4 |
| .gamma.-aminobutyric acid | PubChem | Approved | GLRA1 |
Related Atlas pages
- Genes: BRD4, TUBB, GLRA1, GLRA2, TAS2R4, TAS2R46
- Diseases: gout, familial Mediterranean fever, myocardial infarction, atrial fibrillation, pericarditis, proliferative vitreoretinopathy, primary biliary cholangitis, vasculitis, ST-elevation myocardial infarction, severe acute respiratory syndrome, lung disorder, coronary artery disorder, heart failure, asthma, cardiovascular disorder, plasma cell myeloma, ischemia reperfusion injury
- Drugs: Isoproterenol, Adapalene, Cannabidiol, Cholecalciferol, Cinacalcet, Dronabinol, Dutasteride, Glycine, Mefloquine, Pimozide, Podofilox, Regorafenib, Risperidone, Sulindac, Telmisartan, Vinblastine, Acetaminophen, Alprazolam, Astemizole, Belinostat, Dextromethorphan, Docetaxel, Fedratinib, Fluspirilene, Lenalidomide, Levofloxacin, Nitroxoline, Norfloxacin, Noscapine, Paclitaxel, Panobinostat, Romidepsin, Tirbanibulin, Vincristine, Vinorelbine, Apabetalone, Dinaciclib, Patupilone, Pelabresib, Tacedinaline, Volasertib