Corticosterone
drugOn this page
Also known as Kendall's compound bNSC-9705Reichstein's substance hcorticostereoneSID17389502SID855741SID90341091SID56423132SID26751495SID144204430SID170466845SID144208564SID144213947C0164554
Summary
Corticosterone (CHEMBL110739) is a phase-3 clinical-stage small molecule targeting NR3C1 and NR3C2; indicated across 1 condition including osteoarthritis, hip.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (NR3C1, NR3C2)
- Indications: 1 condition
- Clinical trials: 1
- Chemistry: 346.5 Da · C21H30O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL110739 |
| Name | Corticosterone |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 5753 |
| ChEBI | CHEBI:16827 |
| Molecular formula | C21H30O4 |
| Molecular weight | 346.5 |
| InChIKey | OMFXVFTZEKFJBZ-HJTSIMOOSA-N |
SMILES: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C)O
IUPAC name: (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
ChEBI definition: A 21-hydroxy steroid that consists of pregn-4-ene substituted by hydroxy groups at positions 11 and 21 and oxo groups at positions 3 and 20. Corticosterone is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands.
Other ChEBI roles (chemical / environmental): human metabolite, mouse metabolite.
Also known as: Corticosterone, Kendall’s compound b, NSC-9705, Reichstein’s substance h, corticosterone, corticostereone, SID17389502, SID855741, SID90341091, SID56423132, SID26751495, SID144204430
Patent coverage: 8,441 distinct patent families (28,274 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR3C1 | Glucocorticoid receptor | Agonist | 7.2 | 0.9% | P04150 |
| NR3C2 | Mineralocorticoid receptor | Agonist | 0% | P08235 |
Broader ChEMBL bioactivity targets: 20 (assay-derived). Sample: Survival motor neuron protein, Thrombopoietin, Solute carrier family 22 member 2, Solute carrier family 22 member 2, Solute carrier family 22 member 3, Solute carrier organic anion transporter family member 1A1, Mineralocorticoid receptor, Solute carrier family 22 member 1, Solute carrier family 22 member 3, Corticosteroid-binding globulin.
Bioactivity
ChEMBL activities: 25 potent at pChembl ≥ 5 of 33 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C2 | 9.3 | Kd | 0.5 | nM | CHEMBL_ACT_18033281 |
| SERPINA6 | 7.88 | Ki | 13.18 | nM | CHEMBL_ACT_950012 |
| NFKB1 | 7.7 | Potency | 20 | nM | CHEMBL_ACT_3675702 |
| NFKB1 | 7.7 | Potency | 20 | nM | CHEMBL_ACT_4588884 |
| HIF1A | 7.2 | Potency | 63.1 | nM | CHEMBL_ACT_4128768 |
| HIF1A | 7.2 | Potency | 63.1 | nM | CHEMBL_ACT_4518561 |
| SERPINA6 | 7.2 | Ki | 63.1 | nM | CHEMBL_ACT_955302 |
| SLC22A3 | 6.54 | IC50 | 290 | nM | CHEMBL_ACT_11000855 |
| Q9R0W2 | 6.41 | Ki | 390 | nM | CHEMBL_ACT_11002280 |
| Q9R0W2 | 6.38 | Ki | 420 | nM | CHEMBL_ACT_11002283 |
| Q9R0W2 | 6.34 | Ki | 460 | nM | CHEMBL_ACT_11002288 |
| SHBG | 6.34 | Kd | 457.1 | nM | CHEMBL_ACT_2155684 |
| Q9R0W2 | 6.22 | Ki | 605 | nM | CHEMBL_ACT_11002299 |
| SMN1 | 6.05 | Potency | 891.3 | nM | CHEMBL_ACT_3875073 |
| THPO | 5.9 | Potency | 1259 | nM | CHEMBL_ACT_4805508 |
| THPO | 5.9 | Potency | 1259 | nM | CHEMBL_ACT_5070259 |
| SLC22A3 | 5.8 | IC50 | 1600 | nM | CHEMBL_ACT_24930910 |
| MAPK1 | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_4524576 |
| Q9R0W2 | 5.4 | IC50 | 4000 | nM | CHEMBL_ACT_11001760 |
| Q9R0W2 | 5.38 | IC50 | 4200 | nM | CHEMBL_ACT_11001468 |
| O88446 | 5.31 | IC50 | 4900 | nM | CHEMBL_ACT_11001726 |
| P46720 | 5.28 | Ki | 5300 | nM | CHEMBL_ACT_11003170 |
| SLC22A1 | 5.15 | Ki | 7020 | nM | CHEMBL_ACT_11003243 |
| CYP3A4 | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_4973400 |
| CYP3A4 | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_5038625 |
Target pathways
Aggregated over 2 target gene(s): NR3C1, NR3C2.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 2 | NR3C1, NR3C2 |
| Nuclear Receptor transcription pathway | 2 | NR3C1, NR3C2 |
| SUMOylation of intracellular receptors | 2 | NR3C1, NR3C2 |
| Cellular responses to stress | 1 | NR3C2 |
| SUMOylation | 1 | NR3C2 |
| SUMO E3 ligases SUMOylate target proteins | 1 | NR3C2 |
| Metabolism of proteins | 1 | NR3C2 |
| Post-translational protein modification | 1 | NR3C2 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| Cellular responses to stimuli | 1 | NR3C2 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| signal transduction | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
| negative regulation of transcription by RNA polymerase II | 1 |
| regulation of gluconeogenesis | 1 |
| chromatin organization | 1 |
| apoptotic process | 1 |
| chromosome segregation | 1 |
| glucocorticoid metabolic process | 1 |
| response to wounding | 1 |
| gene expression | 1 |
| microglia differentiation | 1 |
| adrenal gland development | 1 |
| regulation of glucocorticoid biosynthetic process | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| osteoarthritis, hip | 3 | MONDO:0006629 | EFO:1000786 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01079455 | PHASE3 | UNKNOWN | Comparison of Hyaluronic Acid and Corticosteroid Intra-articular Injections for the Treatment of Osteoarthritis of the Hip |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
179 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ENZALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| EPLERENONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUDROCORTISONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE BUTYRATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| PREDNISOLONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| ASOPRISNIL | ChEMBL | Phase 3 | NR3C1, NR3C2 |
| BALCINRENONE | ChEMBL | Phase 3 | NR3C1, NR3C2 |
| METRIBOLONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| ONAPRISTONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| STANOLONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| TUROFEXORATE ISOPROPYL | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| APREPITANT | ChEMBL | Phase 4 (approved) | NR3C1 |
| AURANOFIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEFLAZACORT | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR3C1 |
Related Atlas pages
- Genes: NR3C1, NR3C2
- Diseases: osteoarthritis, hip
- Drugs: Enzalutamide, Eplerenone, Fludrocortisone, Budesonide, Dexamethasone, Fluticasone Furoate, Fluticasone Propionate, Hydrocortisone, Hydrocortisone Butyrate, Medroxyprogesterone, Mifepristone, Prednisolone, Progesterone, Spironolactone, Asoprisnil, Balcinrenone, Fulvestrant, Podofilox, Regorafenib, Acenocoumarol, Alclometasone Dipropionate, Amcinonide, Amiodarone, Aprepitant, Auranofin, Bazedoxifene, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Phosphoric Acid, Betamethasone Valerate, Butoconazole, Candesartan Cilexetil, Canrenone, Chlormadinone, Ciclesonide, Clobetasol Propionate, Clofazimine, Clotrimazole, Cortisone, Danazol, Daunorubicin, Deflazacort, Desogestrel, Desonide, Desoximetasone, Desoxycorticosterone Pivalate, Dextrothyroxine, Dienestrol, Diethylstilbestrol, Diflorasone Diacetate, Doxorubicin, Drospirenone, Econazole, Efavirenz