Cyclosporine
drugOn this page
Also known as ANTIBIOTIC S-7481F1AtopicaCapimuneCapsorinCequaCiclosporinCiclosporin aCiclosporinaCiclosporineCiclosporinumCyclosporinCyclosporin aCyclosporine aCyclosporine microemulsionmodifiedDeximuneEquoralGengrafIkervis
Summary
Cyclosporine (CHEMBL160) is an approved protein antifungal agent (ATC S01XA18) targeting SLCO1B1, SLCO1B3, and FPR1; indicated across 133 conditions including psoriasis and immune system disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Protein
- ATC class: S01XA18 (+1 more)
- Targets: 7 (SLCO1B1, SLCO1B3, FPR1…)
- Indications: 133 conditions
- Clinical trials: 642
- Chemistry: 1202.6 Da · C62H111N11O12
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL160 |
| Name | Cyclosporine |
| Type | Protein |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5284373 |
| ChEBI | CHEBI:4031 |
| ATC | S01XA18, L04AD01 |
| Molecular formula | C62H111N11O12 |
| Molecular weight | 1202.6 |
| InChIKey | PMATZTZNYRCHOR-CGLBZJNRSA-N |
SMILES: CC[C@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N1)[C@@H]([C@H](C)C/C=C/C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C
IUPAC name: (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
ChEBI definition: A cyclic nonribosomal peptide of eleven amino acids; an immunosuppressant drug widely used in post-allogeneic organ transplant to reduce the activity of the patient’s immune system, and therefore the risk of organ rejection. Also causes reversible inhibition of immunocompetent lymphocytes in the G0- and G1-phase of the cell cycle.
Pharmacological roles (ChEBI): antifungal agent, antirheumatic drug, dermatologic drug, immunosuppressive agent, carcinogenic agent, anti-asthmatic drug, EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor, anticoronaviral agent, geroprotector.
Other ChEBI roles (chemical / environmental): metabolite.
Also known as: ANTIBIOTIC S-7481F1, Atopica, Capimune, Capsorin, Cequa, Ciclosporin, Ciclosporin a, Ciclosporina, Ciclosporine, Ciclosporinum, Cyclosporin, Cyclosporin a
Patent coverage: 44,532 distinct patent families (168,247 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLCO1B1 | OATP1B1 | Inhibition | 7.29 | 0% | Q9Y6L6 |
| SLCO1B3 | OATP1B3 | Inhibition | 6.1 | 0% | Q9NPD5 |
| FPR1 | FPR1 | Antagonist | 6.3 | 0% | P21462 |
| PPIA | peptidylprolyl isomerase A | Inhibition | 7.76 | 80% | P62937 |
| PPID | peptidylprolyl isomerase D | Inhibition | 8 | 0.1% | Q08752 |
| ABCG2 | ABCG2 | Inhibition | 6.3 | 0.1% | Q9UNQ0 |
| SLC10A1 | Sodium/bile acid and sulphated solute cotransporter 1 | Inhibition | 5.12 | 0.1% | Q14973 |
Broader ChEMBL bioactivity targets: 56 (assay-derived). Sample: Microtubule-associated protein tau, Ubiquitin carboxyl-terminal hydrolase 2, Survival motor neuron protein, Prelamin-A/C, RecQ-like DNA helicase BLM, Ferritin light chain, NPC intracellular cholesterol transporter 1, Geminin, Endonuclease 4, Peripheral myelin protein 22.
Bioactivity
ChEMBL activities: 208 potent at pChembl ≥ 5 of 235 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PPIA | 8.82 | Ki | 1.5 | nM | CHEMBL_ACT_26930158 |
| PPIA | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_613788 |
| PPID | 8.59 | Ki | 2.58 | nM | CHEMBL_ACT_16584541 |
| PPIA | 8.58 | Ki | 2.64 | nM | CHEMBL_ACT_3388832 |
| PPID | 8.44 | IC50 | 3.6 | nM | CHEMBL_ACT_16584539 |
| PPIA | 8.43 | IC50 | 3.7 | nM | CHEMBL_ACT_3397089 |
| PPP3CA | 8.4 | Kd | 4 | nM | CHEMBL_ACT_185493 |
| PPIF | 8.3 | Ki | 5 | nM | CHEMBL_ACT_29064090 |
| P04351 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_64919 |
| FKBP1B | 8.22 | Ki | 6 | nM | CHEMBL_ACT_1023967 |
| PPIA | 8.22 | Kd | 6 | nM | CHEMBL_ACT_25072959 |
| PPIA | 8.17 | Ki | 6.7 | nM | CHEMBL_ACT_17956133 |
| PPIA | 8.15 | Ki | 7 | nM | CHEMBL_ACT_24864744 |
| PPID | 8.15 | Ki | 7 | nM | CHEMBL_ACT_5293745 |
| PPIA | 8.14 | IC50 | 7.2 | nM | CHEMBL_ACT_16437268 |
| PPIA | 8.12 | Kd | 7.6 | nM | CHEMBL_ACT_7850159 |
| PPID | 8.09 | Ki | 8.2 | nM | CHEMBL_ACT_16576386 |
| PPIA | 8.08 | IC50 | 8.33 | nM | CHEMBL_ACT_3520915 |
| PPIB | 8.06 | IC50 | 8.78 | nM | CHEMBL_ACT_3520935 |
| PPIA | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_287452 |
| PPIA | 8.05 | Ki | 9 | nM | CHEMBL_ACT_29064081 |
| PPIA | 8.05 | Kd | 9 | nM | CHEMBL_ACT_3397091 |
| PPIA | 8.03 | IC50 | 9.3 | nM | CHEMBL_ACT_7850162 |
| PPIA | 8.02 | IC50 | 9.6 | nM | CHEMBL_ACT_14526331 |
| PPIA | 8.01 | IC50 | 9.7 | nM | CHEMBL_ACT_17697784 |
| PPIB | 8.01 | Kd | 9.8 | nM | CHEMBL_ACT_2451861 |
| PPIA | 8.01 | Ki | 9.79 | nM | CHEMBL_ACT_5294576 |
| PPIA | 8 | Kd | 10 | nM | CHEMBL_ACT_12204722 |
| PPIA | 8 | Kd | 10 | nM | CHEMBL_ACT_12204723 |
| PPIA | 8 | Kd | 10 | nM | CHEMBL_ACT_12204724 |
Target pathways
Aggregated over 7 target gene(s): SLCO1B1, SLCO1B3, FPR1, PPIA, PPID, ABCG2, SLC10A1.
Top Reactome pathways
54 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 3 | ABCG2, SLCO1B1, SLCO1B3 |
| Recycling of bile acids and salts | 3 | SLC10A1, SLCO1B1, SLCO1B3 |
| Metabolism of porphyrins | 3 | ABCG2, SLCO1B1, SLCO1B3 |
| Heme degradation | 3 | ABCG2, SLCO1B1, SLCO1B3 |
| Transport of small molecules | 3 | ABCG2, SLCO1B1, SLCO1B3 |
| Metabolism of lipids | 3 | ABCG2, SLCO1B1, SLCO1B3 |
| Drug ADME | 3 | ABCG2, SLCO1B1, SLCO1B3 |
| Disease | 2 | SLCO1B1, SLCO1B3 |
| Bile acid and bile salt metabolism | 2 | SLCO1B1, SLCO1B3 |
| Transport of vitamins, nucleosides, and related molecules | 2 | SLCO1B1, SLCO1B3 |
| SLC-mediated transmembrane transport | 2 | SLCO1B1, SLCO1B3 |
| SLC transporter disorders | 2 | SLCO1B1, SLCO1B3 |
| Disorders of transmembrane transporters | 2 | SLCO1B1, SLCO1B3 |
| Neutrophil degranulation | 2 | FPR1, PPIA |
| Organic anion transport by SLCO transporters | 2 | SLCO1B1, SLCO1B3 |
| Metabolism of steroids | 2 | SLCO1B1, SLCO1B3 |
| Atorvastatin ADME | 2 | SLCO1B1, SLCO1B3 |
| Platelet degranulation | 1 | PPIA |
| Developmental Biology | 1 | ABCG2 |
| Uncoating of the HIV Virion | 1 | PPIA |
| Budding and maturation of HIV virion | 1 | PPIA |
| Integration of provirus | 1 | PPIA |
| Early Phase of HIV Life Cycle | 1 | PPIA |
| Minus-strand DNA synthesis | 1 | PPIA |
| Plus-strand DNA synthesis | 1 | PPIA |
| Sphingolipid de novo biosynthesis | 1 | ABCG2 |
| Binding and entry of HIV virion | 1 | PPIA |
| Assembly Of The HIV Virion | 1 | PPIA |
| APOBEC3G mediated resistance to HIV-1 infection | 1 | PPIA |
| Heme biosynthesis | 1 | ABCG2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| lipid transport | 4 |
| transmembrane transport | 4 |
| monoatomic ion transport | 3 |
| obsolete organic anion transport | 3 |
| bile acid and bile salt transport | 3 |
| xenobiotic metabolic process | 2 |
| heme catabolic process | 2 |
| sodium-independent organic anion transport | 2 |
| protein peptidyl-prolyl isomerization | 2 |
| protein folding | 2 |
| apoptotic process | 2 |
| viral release from host cell | 2 |
| lipid droplet organization | 2 |
| positive regulation of viral genome replication | 2 |
| positive regulation of protein secretion | 2 |
Indications & clinical
Indications
133 indications (9 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psoriasis | 4 | MONDO:0005083 | EFO:0000676 |
| immune system disorder | 4 | MONDO:0005046 | EFO:0000540 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| eye disorder | 4 | MONDO:0005328 | EFO:0003966 |
| keratoconjunctivitis | 4 | MONDO:0004768 | MONDO:0004768 |
| corneal disorder | 4 | MONDO:0000942 | EFO:0009464 |
| keratitis | 4 | MONDO:0003085 | EFO:0009449 |
| conjunctivitis | 4 | MONDO:0003799 | EFO:0009450 |
| atopic eczema | 3 | MONDO:0004980 | EFO:0000274 |
| lymphoma | 3 | MONDO:0005062 | EFO:0000574 |
| aplastic anemia | 3 | MONDO:0015909 | HP:0001915 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| graft versus host disease | 3 | MONDO:0013730 | EFO:0004599 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| focal segmental glomerulosclerosis | 3 | MONDO:0100313 | EFO:0004236 |
| membranous glomerulonephritis | 3 | MONDO:0005376 | EFO:0004254 |
| dry eye syndrome | 3 | MONDO:0006733 | EFO:1000906 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| atopic conjunctivitis | 3 | MONDO:0005642 | EFO:0007141 |
| chronic hepatitis C virus infection | 3 | MONDO:0005354 | EFO:0004220 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| autoimmune thrombocytopenic purpura | 3 | MONDO:0008558 | EFO:0007160 |
| bronchiolitis obliterans syndrome | 3 | MONDO:0015265 | EFO:0007183 |
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | EFO:0000183 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| chronic myeloid leukemia | 3 | MONDO:0011996 | EFO:0000339 |
| juvenile dermatomyositis | 3 | MONDO:0008054 | EFO:0000557 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| Stevens-Johnson syndrome | 3 | MONDO:0018229 | EFO:0004276 |
| autoimmune hepatitis | 3 | MONDO:0016264 | EFO:0005676 |
| lupus nephritis | 3 | MONDO:0005556 | EFO:0005761 |
| non-Hodgkin lymphoma | 3 | MONDO:0018908 | EFO:0005952 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| Waldenstrom macroglobulinemia | 3 | MONDO:0100280 | EFO:0009441 |
| cardiac arrest | 3 | MONDO:0000745 | EFO:0009492 |
| mantle cell lymphoma | 3 | MONDO:0018876 | EFO:1001469 |
| kidney failure | 3 | MONDO:0001106 | EFO:1002048 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| pure red-cell aplasia | 3 | MONDO:0001705 | MONDO:0001705 |
| skin neoplasm | 3 | MONDO:0002531 | MONDO:0002898 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| thrombotic thrombocytopenic purpura | 3 | MONDO:0018896 | MONDO:0018896 |
| Behcet disease | 3 | MONDO:0007191 | EFO:0003780 |
| retinal vasculitis | 3 | MONDO:0006950 | EFO:1001156 |
| acute myocardial infarction | 3 | MONDO:0004781 | EFO:0008583 |
| autoimmune hemolytic anemia | 3 | MONDO:0020108 | EFO:1001264 |
| type 1 diabetes mellitus | 3 | MONDO:0005147 | MONDO:0005147 |
| membranoproliferative glomerulonephritis | 3 | MONDO:0002461 | MONDO:0018904 |
| colorectal neoplasm | 3 | MONDO:0005335 | MONDO:0005575 |
| hepatitis C virus infection | 2 | MONDO:0005231 | EFO:0003047 |
| pterygium | 2 | MONDO:0005085 | EFO:0000678 |
| leprosy | 2 | MONDO:0005124 | EFO:0001054 |
| diabetes mellitus | 2 | MONDO:0005015 | EFO:0000400 |
| periodontitis | 2 | MONDO:0005076 | EFO:0000649 |
| abdominal aortic aneurysm | 2 | MONDO:0005350 | EFO:0004214 |
| acute kidney injury | 2 | MONDO:0002492 | HP:0001919 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| sarcoma | 2 | MONDO:0005089 | EFO:0000691 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| liver disorder | 2 | MONDO:0005154 | EFO:0001421 |
| lymphoid neoplasm | 2 | MONDO:0005157 | EFO:0001642 |
| lung disorder | 2 | MONDO:0005275 | EFO:0003818 |
| mast cell leukemia | 2 | MONDO:0020334 | EFO:0007359 |
| tropical spastic paraparesis | 2 | MONDO:0008039 | EFO:0007527 |
| B-cell prolymphocytic leukemia | 2 | MONDO:0019461 | EFO:1000102 |
| T-cell prolymphocytic leukemia | 2 | MONDO:0019468 | EFO:1000560 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| interstitial cystitis | 2 | MONDO:0018301 | EFO:0008507 |
| myocarditis | 2 | MONDO:0004496 | EFO:0009609 |
| myositis disease | 2 | MONDO:0021167 | EFO:0000783 |
| lacrimal apparatus disorder | 2 | MONDO:0001854 | HP:0009926 |
| fallopian tube neoplasm | 2 | MONDO:0021092 | MONDO:0002158 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| follicular lymphoma | 2 | MONDO:0018906 | MONDO:0018906 |
| brain injury | 2 | MONDO:0043510 | MONDO:0043510 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | EFO:0000694 |
| ischemia reperfusion injury | 2 | MONDO:0005203 | EFO:0002687 |
| myelodysplastic/myeloproliferative disease | 2 | MONDO:0020077 | MONDO:0020077 |
| retinoblastoma | 2 | MONDO:0008380 | MONDO:0008380 |
| familial lipoprotein lipase deficiency | 2 | MONDO:0009387 | MONDO:0009387 |
| Leber hereditary optic neuropathy | 2 | MONDO:0010788 | MONDO:0010788 |
| chronic granulomatous disease | 2 | MONDO:0018305 | MONDO:0018305 |
| hematopoietic and lymphoid system neoplasm | 2 | MONDO:0002334 | MONDO:0044881 |
| glaucoma | 2 | MONDO:0005041 | MONDO:0005041 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| Tako-tsubo cardiomyopathy | 2 | MONDO:0019018 | EFO:1002000 |
| renal artery obstruction | 2 | MONDO:0006945 | HP:0001920 |
| chronic obstructive pulmonary disease | 1 | MONDO:0005002 | EFO:0000341 |
| renal cell carcinoma | 1 | MONDO:0005086 | EFO:0000681 |
| venous thromboembolism | 1 | MONDO:0005399 | EFO:0004286 |
| urticaria | 1 | MONDO:0005492 | EFO:0005531 |
| aspergillosis | 1 | MONDO:0005657 | EFO:0007157 |
| beta thalassemia | 1 | MONDO:0019402 | Orphanet:848 |
| brain neoplasm | 1 | MONDO:0021211 | EFO:0003833 |
| Sezary syndrome | 1 | MONDO:0017844 | EFO:1000785 |
| mycosis fungoides | 1 | MONDO:0009691 | EFO:1001051 |
| uveitis | 1 | MONDO:0020283 | EFO:1001231 |
| respiratory syncytial virus infectious disease | 1 | MONDO:0001577 | EFO:1001413 |
| myeloproliferative neoplasm | 1 | MONDO:0020076 | EFO:0002428 |
| neutropenia | 1 | MONDO:0001475 | MONDO:0001475 |
| type 2 diabetes mellitus | 1 | MONDO:0005148 | MONDO:0005148 |
| sickle cell disease | 1 | MONDO:0011382 | MONDO:0011382 |
| DiGeorge syndrome | 1 | MONDO:0008564 | MONDO:0018923 |
| osteogenesis imperfecta | 1 | MONDO:0019019 | MONDO:0019019 |
| mucopolysaccharidosis | 1 | MONDO:0019249 | MONDO:0019249 |
| Fanconi anemia | 1 | MONDO:0019391 | MONDO:0019391 |
| hereditary angioedema | 1 | MONDO:0019623 | MONDO:0019623 |
| neuroepithelial neoplasm | 0 | MONDO:0021193 | MONDO:0021193 |
18 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 642.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 233 |
| PHASE4 | 105 |
| PHASE3 | 95 |
| PHASE1 | 77 |
| Not specified | 62 |
| PHASE1/PHASE2 | 48 |
| PHASE2/PHASE3 | 16 |
| EARLY_PHASE1 | 6 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04239859 | PHASE4 | NOT_YET_RECRUITING | Outcomes With Treatment and Withdraw of Secukinumab in Patients With Plaque Psoriasis |
| NCT04537689 | PHASE4 | RECRUITING | Outcomes With Treatment and Withdraw of Ixekizumab in Patients With Plaque Psoriasis |
| NCT05839314 | PHASE4 | RECRUITING | Effect of Huaier Granule on the Treatment of Idiopathic Membranous Nephropathy |
| NCT05867329 | PHASE4 | RECRUITING | Feasibility Pilot Sequential Multiple Assignment Randomized Trial (SMART) for Acute Severe Ulcerative Colitis |
| NCT06364319 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Anti-CD25 rhMAb in the Treatment of Steroid-Refractory cGVHD |
| NCT06424639 | PHASE4 | NOT_YET_RECRUITING | Luspatercept Plus CsA vs CsA for the Treatment of Newly Diagnosed Non-Transfusion-Dependent NSAA |
| NCT06525948 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of rhTPO in Combination With Cyclosporine Versus Cyclosporine Alone in the Treatment of TD-NSAA |
| NCT07352566 | PHASE4 | NOT_YET_RECRUITING | Utilization of a Microdevice for Psoriasis and Atopic Dermatitis |
| NCT07368595 | PHASE4 | NOT_YET_RECRUITING | Comparison of Conjunctival Goblet Cell Density in Dry Eye Patients Treated With Cyclosporine 0.1% Dissolved in Perfluorobutylpentane (Vevye®) or Generic 0.05% Cyclosporine Emulsion for 8 Weeks |
| NCT07381556 | PHASE4 | RECRUITING | Cyclosporine Or Methotrexate for Pediatric Alopecia Areata: Routine Clinical Care Effectiveness Study |
| NCT00048165 | PHASE4 | COMPLETED | A Study to Evaluate the Efficacy and Safety of Zenapax in Combination With CellCept, Cyclosporine, and Corticosteroids in Patients Undergoing Cardiac Transplantation |
| NCT00087581 | PHASE4 | COMPLETED | Study of Therapeutic Monitoring of Mycophenolate Mofetil (MMF/CellCept) After Kidney Transplantation |
| NCT00118742 | PHASE4 | COMPLETED | Liver Spare the Nephron (STN) Study - A Study of CellCept (Mycophenolate Mofetil) and Sirolimus in Recipients of a Liver Transplant |
| NCT00123331 | PHASE4 | COMPLETED | Rapamycin Use in Calcineurin Inhibitor (CNI)-Free Immunosuppression for Stabilization/Improvement of Renal Function After Heart Transplantation |
| NCT00139009 | PHASE4 | COMPLETED | Intracellular and Renal/Myocardial Tissue Concentrations of Cyclosporine A (CsA) and Rejection Frequency Following Transplantation |
| NCT00139035 | PHASE4 | COMPLETED | Effects of Cyclosporine A on Pancreatic Insulin Secretion |
| NCT00149994 | PHASE4 | COMPLETED | Cyclosporine A C-2h Monitoring Versus Tacrolimus C-0h Monitoring in de Novo Liver Transplant Recipients |
| NCT00150085 | PHASE4 | TERMINATED | Safety and Efficacy of Converting Maintenance Kidney and Liver Transplant Recipients With Abnormal Glucose Metabolism From Tacrolimus to Cyclosporine Micro-emulsion |
| NCT00154193 | PHASE4 | COMPLETED | Nordic Study in Cardiac and Lung Transplantation: Outcome in Relation to Cyclosporine Microemulsion C2 Levels |
| NCT00154310 | PHASE4 | COMPLETED | Efficacy and Safety of Everolimus With Enteric-Coated Mycophenolate Sodium (EC-MPS) in a Cyclosporine Microemulsion-free Regimen Compared to Standard Therapy in de Novo Renal Transplant Patients |
| NCT00159159 | PHASE4 | UNKNOWN | LOW CYCLO: Study Evaluating the Benefit of Two Doses of Ciclosporine in de Novo Cardiac Transplant |
| NCT00160966 | PHASE4 | COMPLETED | Impact of Immunosuppressive Regimens on Polyomavirus-related Transplant Nephropathy |
| NCT00163657 | PHASE4 | COMPLETED | Study of Liver Transplant For End-Stage Liver Disease Caused By Chronic Hepatitis C Infection |
| NCT00166816 | PHASE4 | UNKNOWN | The Pharmacokinetics of Sirolimus When Combined With Cyclosporine or Tacrolimus in Renal Transplant Patients |
| NCT00166842 | PHASE4 | UNKNOWN | Sirolimus Blood Concentrations on Conversion From Oral Solution to Tablets |
| NCT00171496 | PHASE4 | COMPLETED | Evaluation of Cyclosporine Microemulsion and Tacrolimus on the Rate of New Onset Diabetes Mellitus in Kidney Transplantation Recipients |
| NCT00171509 | PHASE4 | COMPLETED | Efficacy and Safety of Cyclosporine Microemulsion Given Once a Day in Adult Stable Liver Transplant Recipients |
| NCT00171743 | PHASE4 | COMPLETED | Efficacy and Safety of Cyclosporine Microemulsion in Diabetic Adult Stable Liver Transplant Recipients |
| NCT00182559 | PHASE4 | COMPLETED | The Vienna Prograf and Endothelial Progenitor Cell Study |
| NCT00195468 | PHASE4 | COMPLETED | Study Comparing Cyclosporine Dose Reduction vs. Cyclosporine Elimination in Kidney Transplant Recipients Taking Sirolimus |
| NCT00200551 | PHASE4 | COMPLETED | A Study of Mycophenolate Mofetil and Cyclosporin, Without Concomitant Corticosteroids, After a First Renal Transplant |
| NCT00209859 | PHASE4 | COMPLETED | Methotrexate and Cyclosporine in Treatment of Early Rheumatoid Arthritis |
| NCT00260208 | PHASE4 | TERMINATED | Liver Fibrosis in Patients Transplanted for Hepatitis C Receiving Either Cyclosporine Microemulsion or Tacrolimus |
| NCT00264355 | PHASE4 | COMPLETED | Metabolic Pattern of Cyclosporine A and Acute Renal Failure |
| NCT00296296 | PHASE4 | COMPLETED | Immunosuppression Impact on the Metabolic Control of Kidney Transplant With Pre-Existing Type 2 Diabetes (DM) |
| NCT00348335 | PHASE4 | COMPLETED | Efficacy of Topical Cyclosporin for Ocular Rosacea |
| NCT00349440 | PHASE4 | COMPLETED | Efficacy of Cyclosporine for the Prevention and Treatment of Dry Eye Symptoms Following LASIK or Photorefractive Keratectomy |
| NCT00349583 | PHASE4 | COMPLETED | Efficacy of Topical Cyclosporine Versus Tears for Improving Visual Outcomes Following Multifocal IOL Implantation |
| NCT00383396 | PHASE4 | COMPLETED | Efficacy of Topical Cyclosporine 0.05% in the Prevention of Ocular Surface Inflammation Secondary to Pterygia |
| NCT00399061 | PHASE4 | COMPLETED | Efficacy of Optive Versus Systane Concomitant With Restasis (Cyclosporine A) for the Treatment of Dry Eye Symptoms |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
285 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Caspofungin | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLC10A1, SLCO1B1, SLCO1B3 |
| RITONAVIR | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLC10A1, SLCO1B1, SLCO1B3 |
| SULFASALAZINE | ChEMBL | Phase 4 (approved) | ABCG2, SLC10A1, SLCO1B1, SLCO1B3 |
| ALISPORIVIR | ChEMBL | Phase 3 | ABCG2, PPIA, SLCO1B1, SLCO1B3 |
| chenodiol | PubChem | Approved | FPR1, SLC10A1, SLCO1B1, SLCO1B3 |
| Deoxycholic Acid | PubChem | Approved | FPR1, SLC10A1, SLCO1B1, SLCO1B3 |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| CANDESARTAN CILEXETIL | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| Ezetimibe | ChEMBL + PubChem | Phase 4 (approved) | SLC10A1, SLCO1B1, SLCO1B3 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| VERAPAMIL | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| ATORVASTATIN | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| ELTROMBOPAG | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| LOSARTAN | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B1, SLCO1B3 |
| FASIGLIFAM | ChEMBL | Phase 3 | SLC10A1, SLCO1B1, SLCO1B3 |
| GENISTEIN | ChEMBL | Phase 2 | ABCG2, SLCO1B1, SLCO1B3 |
| Bumetanide | PubChem | Approved | SLC10A1, SLCO1B1, SLCO1B3 |
| Folic Acid | PubChem | Approved | ABCG2, SLCO1B1, SLCO1B3 |
| Linagliptin | PubChem | Approved | ABCG2, SLCO1B1, SLCO1B3 |
| Methotrexate | PubChem | Approved | ABCG2, SLCO1B1, SLCO1B3 |
| Olmesartan | PubChem | Approved | SLC10A1, SLCO1B1, SLCO1B3 |
| Etravirine | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLCO1B1 |
| FUROSEMIDE | ChEMBL + PubChem | Phase 4 (approved) | ABCG2, SLC10A1 |
| HYDROXYZINE PAMOATE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| PRAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| VINBLASTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| BETA CAROTENE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CLARITHROMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DICLOXACILLIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DIGOXIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ESTOLATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ETHYLSUCCINATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| GEMFIBROZIL | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| LANSOPRAZOLE | ChEMBL | Phase 4 (approved) | ABCG2, PPIA |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B3 |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| NONOXYNOL 9 | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| PACLITAXEL | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| RIFAMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| SIROLIMUS | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B1 |
| TACROLIMUS | ChEMBL | Phase 4 (approved) | ABCG2, SLCO1B1 |
| TELITHROMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| VINCRISTINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CURCUMIN | ChEMBL + PubChem | Phase 3 (approved) | ABCG2, SLC10A1 |
| ADMILPARANT | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| GOSSYPOL | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| PAMIPARIB | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| SILIBININ | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| SILYBIN A | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| GLYCYRRHIZIN | ChEMBL + PubChem | Phase 2 (approved) | SLCO1B1, SLCO1B3 |
| BMS-986020 | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3 |
| CLESACOSTAT | ChEMBL | Phase 2 | ABCG2, SLCO1B1 |
| ENOXOLONE | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3 |
| SILICRISTIN | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3 |
Related Atlas pages
- Genes: SLCO1B1, SLCO1B3, FPR1, PPIA, PPID, ABCG2, SLC10A1
- Diseases: psoriasis, immune system disorder, rheumatoid arthritis, eye disorder, keratoconjunctivitis, corneal disorder, keratitis, conjunctivitis, atopic eczema, lymphoma, aplastic anemia, myelodysplastic syndrome, graft versus host disease, myocardial infarction, focal segmental glomerulosclerosis, membranous glomerulonephritis, dry eye syndrome, chronic kidney disease, atopic conjunctivitis, chronic hepatitis C virus infection, acute myeloid leukemia, autoimmune thrombocytopenic purpura, bronchiolitis obliterans syndrome, hepatocellular carcinoma, Hodgkins lymphoma, acute lymphoblastic leukemia, chronic myeloid leukemia, juvenile dermatomyositis, leukemia, plasma cell myeloma, heart disorder, Stevens-Johnson syndrome, autoimmune hepatitis, lupus nephritis, non-Hodgkin lymphoma, diffuse large B-cell lymphoma, Waldenstrom macroglobulinemia, cardiac arrest, mantle cell lymphoma, kidney failure, kidney disorder, pure red-cell aplasia, skin neoplasm, breast neoplasm, thrombotic thrombocytopenic purpura, Behcet disease, retinal vasculitis, acute myocardial infarction, autoimmune hemolytic anemia, type 1 diabetes mellitus, membranoproliferative glomerulonephritis, colorectal neoplasm
- Drugs: Caspofungin, Ritonavir, Sulfasalazine, Alisporivir, chenodiol, Deoxycholic Acid, Atazanavir, Candesartan Cilexetil, Erlotinib, Ezetimibe, Rifampin, Verapamil, Atorvastatin, Eltrombopag, Losartan, Telmisartan, Fasiglifam, Bumetanide, Folic Acid, Linagliptin, Methotrexate, Olmesartan, Etravirine, Furosemide, Hydroxyzine Pamoate, Pravastatin, Tannic Acid, Vinblastine, Beta Carotene, Carbenoxolone, Clarithromycin, Dicloxacillin, Digoxin, Erythromycin Estolate, Erythromycin Ethylsuccinate, Gemfibrozil, Indomethacin, Lansoprazole, Mitoxantrone, Mometasone Furoate, NONOXYNOL 9, Paclitaxel, Rifamycin, Sirolimus, Tacrolimus, Telithromycin, Vincristine, Curcumin, Admilparant, Gossypol, Pamiparib, Silibinin