Cyclothiazide
drugOn this page
Also known as AnhydronCiclotiazidaFluidilNSC-758431SID26751850SID50104549SID85230990SID90341445SID56424127SID104171141SID50104550SID144203675SID170465274
Summary
Cyclothiazide (CHEMBL61593) is an approved small-molecule diuretic (ATC C03AA09) targeting GRIA1, GRIA2, and GRIA3; indicated across 1 condition including cardiovascular disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C03AA09
- Targets: 5 (GRIA1, GRIA2, GRIA3…)
- Indications: 1 condition
- Chemistry: 389.9 Da · C14H16ClN3O4S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL61593 |
| Name | Cyclothiazide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 2910 |
| ChEBI | CHEBI:31448 |
| ATC | C03AA09 |
| Molecular formula | C14H16ClN3O4S2 |
| Molecular weight | 389.9 |
| InChIKey | BOCUKUHCLICSIY-UHFFFAOYSA-N |
SMILES: C1C2CC(C1C=C2)C3NC4=CC(=C(C=C4S(=O)(=O)N3)S(=O)(=O)N)Cl
IUPAC name: 3-(2-bicyclo[2.2.1]hept-5-enyl)-6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide
ChEBI definition: 3,4-Dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide substituted at positions 3, 5 and 6 by a 2-norbornen-5-yl group, chlorine, and a sulfonamide group, respectively. A thiazide diuretic, it has been used in the management of hypertension and oedema.
Pharmacological roles (ChEBI): diuretic, antihypertensive agent.
Also known as: Anhydron, Ciclotiazida, Cyclothiazide, Fluidil, NSC-758431, cyclothiazide, SID26751850, SID50104549, SID85230990, SID90341445, CYCLOTHIAZIDE, SID56424127
Patent coverage: 1,248 distinct patent families (4,410 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GRIA1 | GluA1 | Positive | 4.72 | 0.1% | P42261 |
| GRIA2 | GluA2 | Positive | 5.65 | 0% | P42262 |
| GRIA3 | GluA3 | Positive | 4.86 | 0% | P42263 |
| GRIA4 | GluA4 | Positive | 5.41 | 0.2% | P48058 |
| SLC12A3 | Na-Cl symporter | Inhibition | 0.2% | P55017 |
Broader ChEMBL bioactivity targets: 14 (assay-derived). Sample: Prelamin-A/C, ATP-dependent DNA helicase Q1, RecQ-like DNA helicase BLM, Ferritin light chain, Histone-lysine N-methyltransferase 2A, Thyroid hormone receptor beta, Glutamate receptor 1, Glutamate receptor ionotropic, AMPA, Muscarinic acetylcholine receptor M1, Glutamate receptor 4.
Bioactivity
ChEMBL activities: 13 potent at pChembl ≥ 5 of 21 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| THRB | 6.85 | Potency | 141.3 | nM | CHEMBL_ACT_4019088 |
| GRIA1 | 6 | EC50 | 1000 | nM | CHEMBL_ACT_3266569 |
| GRIA1 | 5.7 | EC50 | 2000 | nM | CHEMBL_ACT_3266654 |
| GRIA2 | 5.65 | EC50 | 2240 | nM | CHEMBL_ACT_3266657 |
| GRIA4 | 5.42 | EC50 | 3800 | nM | CHEMBL_ACT_1770033 |
| GRIA4 | 5.42 | EC50 | 3800 | nM | CHEMBL_ACT_943396 |
| P19490 | 5.21 | IC50 | 6100 | nM | CHEMBL_ACT_249628 |
| LMNA | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4403424 |
| GRIA1 | 5.18 | EC50 | 6600 | nM | CHEMBL_ACT_3266650 |
| GRIA2 | 5.12 | EC50 | 7600 | nM | CHEMBL_ACT_16458051 |
| P19491 | 5.12 | EC50 | 7600 | nM | CHEMBL_ACT_2374468 |
| LMNA | 5.05 | Potency | 8912 | nM | CHEMBL_ACT_3651750 |
| GRIA1 | 5 | EC50 | 10000 | nM | CHEMBL_ACT_3266655 |
Target pathways
Aggregated over 5 target gene(s): GRIA1, GRIA2, GRIA3, GRIA4, SLC12A3.
Top Reactome pathways
17 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Activation of AMPA receptors | 4 | GRIA1, GRIA2, GRIA3, GRIA4 |
| Trafficking of GluR2-containing AMPA receptors | 4 | GRIA1, GRIA2, GRIA3, GRIA4 |
| Unblocking of NMDA receptors, glutamate binding and activation | 4 | GRIA1, GRIA2, GRIA3, GRIA4 |
| Trafficking of AMPA receptors | 3 | GRIA1, GRIA3, GRIA4 |
| Synaptic adhesion-like molecules | 3 | GRIA1, GRIA3, GRIA4 |
| Long-term potentiation | 2 | GRIA1, GRIA2 |
| Disease | 1 | SLC12A3 |
| COPII-mediated vesicle transport | 1 | GRIA1 |
| Transport of small molecules | 1 | SLC12A3 |
| R-HSA-425393 | 1 | SLC12A3 |
| SLC-mediated transmembrane transport | 1 | SLC12A3 |
| Cation-coupled Chloride cotransporters | 1 | SLC12A3 |
| Defective SLC12A3 causes Gitelman syndrome (GS) | 1 | SLC12A3 |
| SLC transporter disorders | 1 | SLC12A3 |
| Disorders of transmembrane transporters | 1 | SLC12A3 |
| Cargo concentration in the ER | 1 | GRIA1 |
| MECP2 regulates neuronal receptors and channels | 1 | GRIA2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 5 |
| synaptic transmission, glutamatergic | 4 |
| modulation of chemical synaptic transmission | 4 |
| monoatomic ion transmembrane transport | 4 |
| ionotropic glutamate receptor signaling pathway | 4 |
| regulation of postsynaptic membrane potential | 4 |
| regulation of presynaptic membrane potential | 3 |
| signal transduction | 2 |
| chemical synaptic transmission | 2 |
| long-term synaptic potentiation | 2 |
| calcium-mediated signaling | 2 |
| glutamate receptor signaling pathway | 2 |
| regulation of receptor recycling | 1 |
| synapse assembly | 1 |
| long-term memory | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
7 molecules share ≥1 primary target. Top 7 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| GLUTAMIC ACID | ChEMBL + PubChem | Phase 3 (approved) | GRIA1, GRIA2, GRIA3, GRIA4 |
| KAINIC ACID | ChEMBL | Phase 2 | GRIA1, GRIA2, GRIA3, GRIA4 |
| SELFOTEL | ChEMBL | Phase 2 | GRIA1, GRIA2, GRIA3, GRIA4 |
| TEZAMPANEL | ChEMBL | Phase 2 | GRIA1, GRIA2, GRIA3, GRIA4 |
| PERAMPANEL | ChEMBL + PubChem | Phase 4 (approved) | GRIA1, GRIA3 |
| FARAMPATOR | ChEMBL | Phase 2 | GRIA3, GRIA4 |
| MIBAMPATOR | ChEMBL | Phase 2 | GRIA4 |
Related Atlas pages
- Genes: GRIA1, GRIA2, GRIA3, GRIA4, SLC12A3
- Diseases: cardiovascular disorder
- Drugs: Glutamic Acid, Perampanel