Dabrafenib
drugOn this page
Also known as GSK-2118436GSK-2118436AGsk2118436GSK2118436ATafinlarSID174006404DabrafenibDABRAFENIB (GSK2118436)
Summary
Dabrafenib (CHEMBL2028663) is an approved small-molecule antineoplastic agent (ATC L01EC02) targeting BRAF; indicated across 22 conditions including neoplasm and melanoma; with CIViC clinical evidence for 75 variant-indication associations (e.g. BRAF V600E in melanoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EC02
- Targets: 1 (BRAF)
- Indications: 22 conditions
- Clinical trials: 138
- Precision-oncology evidence (CIViC): 75 variant–indication associations
- Chemistry: 519.6 Da · C23H20F3N5O2S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2028663 |
| Name | Dabrafenib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 44462760 |
| ChEBI | CHEBI:75045 |
| ATC | L01EC02 |
| Molecular formula | C23H20F3N5O2S2 |
| Molecular weight | 519.6 |
| InChIKey | BFSMGDJOXZAERB-UHFFFAOYSA-N |
SMILES: CC(C)(C)C1=NC(=C(S1)C2=NC(=NC=C2)N)C3=C(C(=CC=C3)NS(=O)(=O)C4=C(C=CC=C4F)F)F
IUPAC name: N-[3-[5-(2-aminopyrimidin-4-yl)-2-tert-butyl-1,3-thiazol-4-yl]-2-fluorophenyl]-2,6-difluorobenzenesulfonamide
ChEBI definition: An organofluorine compound and antineoplastic agent, used as its mesylate salt in treatment of metastatic melanoma.
Pharmacological roles (ChEBI): antineoplastic agent, B-Raf inhibitor, anticoronaviral agent.
Also known as: Dabrafenib, GSK-2118436, GSK-2118436A, Gsk2118436, GSK2118436A, Tafinlar, DABRAFENIB, SID174006404, dabrafenib, Dabrafenib; Tafinlar, DABRAFENIB (GSK2118436), Dabrafenib (GSK2118436)
Parent form; salt/anhydrous children: CHEMBL2105729
Patent coverage: 5,107 distinct patent families (12,430 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 11,720 (94%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| BRAF | B-Raf proto-oncogene, serine/threonine kinase | Inhibition | 8.49 | 8.6% | P15056 |
Broader ChEMBL bioactivity targets: 55 (assay-derived). Sample: Serine/threonine-protein kinase/endoribonuclease IRE1, Serine/threonine-protein kinase A-Raf, Receptor-interacting serine/threonine-protein kinase 3, Tyrosine-protein kinase Fyn, Tyrosine-protein kinase ABL1, RAF proto-oncogene serine/threonine-protein kinase, Dual serine/threonine and tyrosine protein kinase, Tyrosine-protein kinase Yes, GTPase KRas, Calcium/calmodulin-dependent protein kinase type IV.
Bioactivity
ChEMBL activities: 91 potent at pChembl ≥ 5 of 93 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| BRAF | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_16577174 |
| BRAF | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_22885302 |
| BRAF | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_24882866 |
| BRAF | 9.22 | IC50 | 0.6 | nM | CHEMBL_ACT_25708394 |
| BRAF | 9.19 | IC50 | 0.65 | nM | CHEMBL_ACT_26027115 |
| BRAF | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_12691522 |
| BRAF | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_18745643 |
| BRAF | 9.15 | IC50 | 0.71 | nM | CHEMBL_ACT_18745826 |
| BRAF | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_22892178 |
| BRAF | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_22929313 |
| BRAF | 9.15 | EC50 | 0.7 | nM | CHEMBL_ACT_24882829 |
| BRAF | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_29065633 |
| BRAF | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_18528065 |
| BRAF | 9 | IC50 | 1 | nM | CHEMBL_ACT_16577212 |
| BRAF | 9 | IC50 | 1 | nM | CHEMBL_ACT_16578214 |
| RIPK3 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_19146734 |
| BRAF | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_26023197 |
| BRAF | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_26023196 |
| BRAF | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_26027106 |
| BRAF | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_12691436 |
| BRAF | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_12691510 |
| BRAF | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_18528064 |
| BRAF | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_18946042 |
| RAF1 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_25708393 |
| BRAF | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_25874433 |
| RAF1 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_26027101 |
| BRAF | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_15605136 |
| BRAF | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_12691441 |
| BRAF | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_16673781 |
| BRAF | 8.01 | IC50 | 9.7 | nM | CHEMBL_ACT_15605028 |
Target pathways
Aggregated over 1 target gene(s): BRAF.
Top Reactome pathways
39 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Spry regulation of FGF signaling | 1 | BRAF |
| Signal Transduction | 1 | BRAF |
| Disease | 1 | BRAF |
| Signaling by NTRKs | 1 | BRAF |
| Prolonged ERK activation events | 1 | BRAF |
| Frs2-mediated activation | 1 | BRAF |
| ARMS-mediated activation | 1 | BRAF |
| Signaling by NTRK1 (TRKA) | 1 | BRAF |
| Signalling to ERKs | 1 | BRAF |
| Signalling to p38 via RIT and RIN | 1 | BRAF |
| Signaling by FGFR | 1 | BRAF |
| Negative regulation of FGFR1 signaling | 1 | BRAF |
| Negative regulation of FGFR2 signaling | 1 | BRAF |
| Negative regulation of FGFR3 signaling | 1 | BRAF |
| Negative regulation of FGFR4 signaling | 1 | BRAF |
| Signaling by FGFR1 | 1 | BRAF |
| Signaling by FGFR2 | 1 | BRAF |
| Signaling by FGFR3 | 1 | BRAF |
| Signaling by FGFR4 | 1 | BRAF |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | BRAF |
| RAF activation | 1 | BRAF |
| RAF/MAP kinase cascade | 1 | BRAF |
| MAP2K and MAPK activation | 1 | BRAF |
| Negative feedback regulation of MAPK pathway | 1 | BRAF |
| Negative regulation of MAPK pathway | 1 | BRAF |
| MAPK family signaling cascades | 1 | BRAF |
| MAPK1/MAPK3 signaling | 1 | BRAF |
| Signaling by moderate kinase activity BRAF mutants | 1 | BRAF |
| Signaling by high-kinase activity BRAF mutants | 1 | BRAF |
| Signaling by RAS mutants | 1 | BRAF |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| MAPK cascade | 1 |
| myeloid progenitor cell differentiation | 1 |
| protein phosphorylation | 1 |
| epidermal growth factor receptor signaling pathway | 1 |
| visual learning | 1 |
| animal organ morphogenesis | 1 |
| positive regulation of gene expression | 1 |
| negative regulation of fibroblast migration | 1 |
| positive regulation of D-glucose transmembrane transport | 1 |
| synaptic vesicle exocytosis | 1 |
| thyroid gland development | 1 |
| T cell differentiation in thymus | 1 |
| positive regulation of peptidyl-serine phosphorylation | 1 |
| substrate adhesion-dependent cell spreading | 1 |
| somatic stem cell population maintenance | 1 |
Indications & clinical
Indications
22 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| melanoma | 3 | MONDO:0005105 | EFO:0000756 |
| cutaneous melanoma | 3 | MONDO:0005012 | EFO:0000389 |
| thyroid gland papillary carcinoma | 3 | MONDO:0005075 | EFO:0000641 |
| metastatic melanoma | 3 | MONDO:0005191 | EFO:0002617 |
| thyroid gland carcinoma | 3 | MONDO:0015075 | EFO:0002892 |
| ameloblastoma | 3 | MONDO:0017795 | MONDO:0017795 |
| thyroid gland follicular carcinoma | 2 | MONDO:0005034 | EFO:0000501 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| Erdheim-Chester disease | 2 | MONDO:0018153 | EFO:1000926 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| undifferentiated carcinoma | 2 | MONDO:0005617 | EFO:0006772 |
| craniopharyngioma | 2 | MONDO:0018907 | EFO:1000209 |
| thyroid gland undifferentiated (anaplastic) carcinoma | 2 | MONDO:0006468 | EFO:1000595 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| brain neoplasm | 1 | MONDO:0021211 | EFO:0003833 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| glioma | 1 | MONDO:0021042 | MONDO:0100342 |
3 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 138.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 60 |
| PHASE1 | 31 |
| Not specified | 19 |
| PHASE1/PHASE2 | 13 |
| PHASE3 | 10 |
| PHASE4 | 3 |
| PHASE2/PHASE3 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03340506 | PHASE4 | RECRUITING | Dabrafenib and/or Trametinib Rollover Study |
| NCT03975829 | PHASE4 | RECRUITING | Pediatric Long-Term Follow-up and Rollover Study |
| NCT07010393 | PHASE4 | NOT_YET_RECRUITING | Genotype-Driven Neoadjuvant Therapy for Locally Advanced Thyroid Cancer: A Real-World Cohort Study |
| NCT04940052 | PHASE3 | ACTIVE_NOT_RECRUITING | Study of Efficacy and Safety of Dabrafenib in Combination With Trametinib in Previously Treated Patients With Metastatic, Radio-active Iodine Refractory BRAF V600E Mutation Positive Differentiated Thyroid Cancer |
| NCT06475989 | PHASE3 | RECRUITING | Study of Targeted Therapy vs. Chemotherapy in Patients With Thyroid Cancer |
| NCT06819605 | PHASE2/PHASE3 | NOT_YET_RECRUITING | Neoadjuvant Therapy With Conservative Surgery vs. Up-front Conservative Surgery for BRAF V600E-Mutated Ameloblastoma |
| NCT07440290 | PHASE2/PHASE3 | NOT_YET_RECRUITING | DETERMINE Trial Treatment Arm 07: Dabrafenib in Combination With Trametinib in Adult, Paediatric and Teenage/Young Adult Patients With BRAF V600 Mutation-Positive Cancers. |
| NCT01227889 | PHASE3 | COMPLETED | A Study Comparing GSK2118436 to Dacarbazine (DTIC) in Previously Untreated Subjects With BRAF Mutation Positive Advanced (Stage III) or Metastatic (Stage IV) Melanoma |
| NCT01584648 | PHASE3 | COMPLETED | A Study Comparing Trametinib and Dabrafenib Combination Therapy to Dabrafenib Monotherapy in Subjects With BRAF-mutant Melanoma |
| NCT01597908 | PHASE3 | COMPLETED | Dabrafenib Plus Trametinib vs Vemurafenib Alone in Unresectable or Metastatic BRAF V600E/K Cutaneous Melanoma |
| NCT01682083 | PHASE3 | COMPLETED | Dabrafenib With Trametinib in the Adjuvant Treatment of High-risk BRAF V600 Mutation-positive Melanoma (COMBI-AD). |
| NCT02967692 | PHASE3 | TERMINATED | A Study of the Anti-PD1 Antibody PDR001, in Combination With Dabrafenib and Trametinib in Advanced Melanoma |
| NCT03551626 | PHASE3 | COMPLETED | Study of Dabrafenib+Trametinib in the Adjuvant Treatment of Stage III BRAF V600+ Melanoma After Complete Resection to Evaluate the Impact on Pyrexia Related Outcomes |
| NCT03784014 | PHASE3 | COMPLETED | Molecular Profiling of Advanced Soft-tissue Sarcomas |
| NCT06264778 | PHASE3 | UNKNOWN | Exploration of Fenestration Decompression Combined With Dalafenib in the Treatment of BRAF Mutant Ameloblastoma |
| NCT01972347 | PHASE2 | ACTIVE_NOT_RECRUITING | Neoadjuvant Dabrafenib + Trametinib for AJCC Stage IIIB-C BRAF V600 Mutation Positive Melanoma |
| NCT01989585 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Testing the Addition of Navitoclax to the Combination of Dabrafenib and Trametinib in People Who Have BRAF Mutant Melanoma |
| NCT02231775 | PHASE2 | ACTIVE_NOT_RECRUITING | Dabrafenib and Trametinib Before and After Surgery in Treating Patients With Stage IIIB-C Melanoma With BRAF V600 Mutation |
| NCT02465060 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Patients With Advanced Refractory Solid Tumors, Lymphomas, or Multiple Myeloma (The MATCH Screening Trial) |
| NCT02910700 | PHASE2 | ACTIVE_NOT_RECRUITING | Nivolumab With Trametinib and Dabrafenib, or Encorafenib and Binimetinib in Treating Patients With BRAF Mutated Metastatic or Unresectable Stage III-IV Melanoma |
| NCT02925234 | PHASE2 | RECRUITING | The Drug Rediscovery Protocol (DRUP Trial) |
| NCT03149029 | PHASE2 | ACTIVE_NOT_RECRUITING | Abbreviated MAPK Targeted Therapy Plus Pembrolizumab in Melanoma |
| NCT03563729 | PHASE2 | RECRUITING | Melanoma Metastasized to the Brain and Steroids |
| NCT04116541 | PHASE2 | RECRUITING | A Study Evaluating the Activity of Anti-cancer Treatments Targeting Tumor Molecular Alterations/Characteristics in Advanced / Metastatic Tumors. |
| NCT04201457 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | A Trial of Dabrafenib, Trametinib and Hydroxychloroquine for Patients With Recurrent LGG or HGG With a BRAF Aberration |
| NCT04238624 | PHASE2 | ACTIVE_NOT_RECRUITING | Study of Cemiplimab Combined With Dabrafenib and Trametinib in People With Anaplastic Thyroid Cancer |
| NCT04544111 | PHASE2 | ACTIVE_NOT_RECRUITING | PDR001 Combination Therapy for Radioiodine-Refractory Thyroid Cancer |
| NCT04675710 | PHASE2 | ACTIVE_NOT_RECRUITING | Pembrolizumab, Dabrafenib, and Trametinib Before Surgery for the Treatment of BRAF-Mutated Anaplastic Thyroid Cancer |
| NCT05159245 | PHASE2 | RECRUITING | The Finnish National Study to Facilitate Patient Access to Targeted Anti-cancer Drugs |
| NCT05525273 | PHASE2 | RECRUITING | Treatment of BRAF ( B-Rapidly Accelerated Fibrosarcoma) Mutated Papillary Craniopharyngioma |
| NCT06054191 | PHASE2 | NOT_YET_RECRUITING | Neoadjuvant and Adjuvant Targeted Treatment in NSCLC With BRAF V600 or MET Exon 14 Mutations |
| NCT06079333 | PHASE2 | RECRUITING | NEO- and Adjuvant Targeted Therapy in Braf-mutated Anaplastic Cancer of the Thyroid (NEO-ATACT Study) |
| NCT06119789 | PHASE2 | RECRUITING | Precision Cancer Therapy in Rare Cancers |
| NCT06362694 | PHASE2 | RECRUITING | Study of the Rechallenge Concept in Patients With BRAF-positive Anaplastic Thyroid Cancer After Progression on Anti-BRAF Therapy |
| NCT06482086 | PHASE2 | RECRUITING | Efficacy of Organoid-Based Drug Screening to Guide Treatment for Locally Advanced Thyroid Cancer |
| NCT06563999 | PHASE2 | RECRUITING | Neoadjuvant Umbrella Trial for Patients With Unresectable Stage III NSCLC Harboring Rare Mutations. |
| NCT06653517 | PHASE2 | RECRUITING | Clinical Study of Neoadjuvant Targeted Therapy for Ameloblastoma |
| NCT06712875 | PHASE1/PHASE2 | RECRUITING | MAPK Inhibition Combined With Anti-PD1 Therapy for BRAF-altered Pediatric Gliomas |
| NCT06739395 | PHASE2 | RECRUITING | Precision Medicine Trial Based on Molecular Matching Therapy for Patients With Standard Treatment Exhaustion |
| NCT07110246 | PHASE2 | RECRUITING | Dabrafenib and Trametinib for BRAF V600 Mutant Low-Grade Gliomas |
Clinical evidence (CIViC)
Variant × indication × effect (75 predictive associations from 89 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| BRAF V600E | Melanoma | Sensitivity/Response | Dabrafenib | CIViC A | EID11244 +5 |
| BRAF V600E | Pleomorphic Xanthoastrocytoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID11312 +1 |
| BRAF V600 | Skin Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID1411 |
| BRAF V600E | Pilocytic Astrocytoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID11313 |
| BRAF V600E | Solid Tumor | Sensitivity/Response | Trametinib + Dabrafenib | CIViC A | EID12161 |
| BRAF V600E | Low Grade Glioma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID12162 |
| BRAF V600E | Lung Non-small Cell Carcinoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID3017 |
| BRAF V600K | Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6939 +2 |
| BRAF V600 | Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6180 +1 |
| BRAF V600E | Cholangiocarcinoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID7453 +1 |
| BRAF V600E | Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6178 +1 |
| BRAF V600E | Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID6938 +1 |
| BRAF V600K | Melanoma | Sensitivity/Response | Dabrafenib | CIViC B | EID2505 +1 |
| BRAF K601E | Skin Melanoma | Sensitivity/Response | Dabrafenib | CIViC B | EID2812 |
| BRAF V600 | Melanoma | Sensitivity/Response | Dabrafenib | CIViC B | EID1407 |
| BRAF V600 | Colorectal Cancer | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID1415 |
| BRAF V600 | Childhood Low-grade Glioma | Sensitivity/Response | Dabrafenib | CIViC B | EID8034 |
| BRAF V600 | Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID93 |
| BRAF V600D | Melanoma | Sensitivity/Response | Dabrafenib | CIViC B | EID94 |
| BRAF V600E | Langerhans-cell Histiocytosis | Sensitivity/Response | Dabrafenib | CIViC B | EID11303 |
| BRAF V600E | Cancer | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID11672 |
| BRAF V600E | Skin Melanoma | Sensitivity/Response | Dabrafenib | CIViC B | EID2146 |
| BRAF V600E | Skin Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID3758 |
| BRAF V600E | Colorectal Cancer | Sensitivity/Response | Panitumumab + Dabrafenib + Trametinib | CIViC B | EID6123 |
| BRAF V600E | Anaplastic Thyroid Carcinoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6975 |
| BRAF V600E | Biliary Tract Cancer | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID7264 |
| BRAF V600E | Ovarian Cancer | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID7454 |
| BRAF V600E | Papillary Thyroid Carcinoma | Sensitivity/Response | Dabrafenib | CIViC B | EID7761 |
| BRAF V600E | Papillary Thyroid Carcinoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID7762 |
| BRAF V600K | Skin Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID4181 |
+45 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
47 molecules share ≥1 primary target. Top 47 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | BRAF |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | BRAF |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | BRAF |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | BRAF |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | BRAF |
| DASATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | BRAF |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| IMATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| NILOTINIB | ChEMBL | Phase 4 (approved) | BRAF |
| PONATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | BRAF |
| SORAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| TOVORAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| VEMURAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| AVUTOMETINIB | ChEMBL | Phase 3 | BRAF |
| MASITINIB | ChEMBL | Phase 3 | BRAF |
| MOTESANIB | ChEMBL | Phase 3 | BRAF |
| NAPORAFENIB | ChEMBL | Phase 3 | BRAF |
| QUERCETIN | ChEMBL | Phase 3 | BRAF |
| BAFETINIB | ChEMBL | Phase 2 | BRAF |
| BELVARAFENIB | ChEMBL | Phase 2 | BRAF |
| BRIMARAFENIB | ChEMBL | Phase 2 | BRAF |
| CEP-32496 | ChEMBL | Phase 2 | BRAF |
| DORAMAPIMOD | ChEMBL | Phase 2 | BRAF |
| ELLAGIC ACID | ChEMBL | Phase 2 | BRAF |
| EXARAFENIB | ChEMBL | Phase 2 | BRAF |
| FORETINIB | ChEMBL | Phase 2 | BRAF |
| LIFIRAFENIB | ChEMBL | Phase 2 | BRAF |
| MIRDAMETINIB | ChEMBL | Phase 2 | BRAF |
| PEXMETINIB | ChEMBL | Phase 2 | BRAF |
| R-406 | ChEMBL | Phase 2 | BRAF |
| RAF-265 | ChEMBL | Phase 2 | BRAF |
| REBASTINIB | ChEMBL | Phase 2 | BRAF |
| TG100-115 | ChEMBL | Phase 2 | BRAF |
| TINLORAFENIB | ChEMBL | Phase 2 | BRAF |
| XL-281 | ChEMBL | Phase 2 | BRAF |
| Afatinib | PubChem | Approved | BRAF |
| Binimetinib | PubChem | Approved | BRAF |
| Crizotinib | PubChem | Approved | BRAF |
| dacomitinib | PubChem | Approved | BRAF |
| Fostamatinib | PubChem | Approved | BRAF |
| Idelalisib | PubChem | Approved | BRAF |
| Selumetinib | PubChem | Approved | BRAF |
| Trametinib | PubChem | Approved | BRAF |
Related Atlas pages
- Genes: BRAF
- Diseases: neoplasm, melanoma, cutaneous melanoma, thyroid gland papillary carcinoma, metastatic melanoma, thyroid gland carcinoma, ameloblastoma, pleomorphic xanthoastrocytoma, pilocytic astrocytoma, low grade glioma, cholangiocarcinoma, colorectal carcinoma, childhood low-grade glioma, Langerhans cell histiocytosis specific to childhood, cancer, thyroid gland undifferentiated (anaplastic) carcinoma, biliary tract cancer, ovarian carcinoma
- Drugs: Gefitinib, Pazopanib, Regorafenib, Abemaciclib, Cobimetinib, Dasatinib, Encorafenib, Erlotinib, Fedratinib, Imatinib, Infigratinib, Nilotinib, Ponatinib, Ruxolitinib, Sorafenib, Tovorafenib, Vemurafenib, Avutometinib, Masitinib, Motesanib, Naporafenib, Quercetin, Afatinib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Idelalisib, Selumetinib, Trametinib
- Biomarker genes: AKT1, NF1