Dasatinib Anhydrous
drugOn this page
Also known as BMS-354825Dasatinib (anhydrous)Dasatinib accordDasatinib accordpharmaDasatinibSprycel
Summary
Dasatinib Anhydrous (CHEMBL1421) is an approved small-molecule antineoplastic agent (ATC L01EA02) targeting ABL1, SIK1, and SIK2; indicated across 87 conditions including chronic myeloid leukemia and acute lymphoblastic leukemia; with CIViC clinical evidence for 223 variant-indication associations (e.g. BCR::ABL1 Fusion in b-lymphoblastic leukemia/lymphoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EA02
- Targets: 5 (ABL1, SIK1, SIK2…)
- Indications: 87 conditions
- Clinical trials: 316
- Precision-oncology evidence (CIViC): 223 variant–indication associations
- Chemistry: 488 Da · C22H26ClN7O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1421 |
| Name | Dasatinib Anhydrous |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3062316 |
| ChEBI | CHEBI:49375 |
| ATC | L01EA02 |
| Molecular formula | C22H26ClN7O2S |
| Molecular weight | 488 |
| InChIKey | ZBNZXTGUTAYRHI-UHFFFAOYSA-N |
SMILES: CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=CC(=NC(=N3)C)N4CCN(CC4)CCO
IUPAC name: N-(2-chloro-6-methylphenyl)-2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide
ChEBI definition: An aminopyrimidine that is 2-methylpyrimidine which is substituted at position 4 by the primary amino group of 2-amino-1,3-thiazole-5-carboxylic acid and at position 6 by a 4-(2-hydroxyethyl)piperazin-1-yl group, and in which the carboxylic acid group has been formally condensed with 2-chloro-6-methylaniline to afford the corresponding amide. A multi-targeted kinase inhibitor, it is used, particularly as the monohydrate, for the treatment of chronic, accelerated, or myeloid or lymphoid blast phase chronic myeloid leukemia. Note that the name ‘dasatinib’ is used to refer to the monohydrate (USAN) as well as to anhydrous dasatinib (INN).
Pharmacological roles (ChEBI): antineoplastic agent, tyrosine kinase inhibitor, anticoronaviral agent.
Also known as: BMS-354825, Dasatinib (anhydrous), Dasatinib accord, Dasatinib accordpharma, Dasatinib anhydrous, DASATINIB ANHYDROUS, Dasatinib, Sprycel, DASATINIB
Parent form; salt/anhydrous children: CHEMBL5314601, CHEMBL5416410
Patent coverage: 14,539 distinct patent families (55,003 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 54,779 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ABL1 | ABL proto-oncogene 1, non-receptor tyrosine kinase | Inhibition | 10.49 | 1.2% | P00519 |
| SIK1 | salt inducible kinase 1 | Inhibition | 8.52 | 1% | P57059 |
| SIK2 | salt inducible kinase 2 | Inhibition | 8.52 | 0.5% | Q9H0K1 |
| SIK3 | SIK family kinase 3 | Inhibition | 8 | 1.3% | Q9Y2K2 |
| SRC | SRC proto-oncogene, non-receptor tyrosine kinase | Inhibition | 9.1 | 3.7% | P12931 |
Broader ChEMBL bioactivity targets: 33 (assay-derived). Sample: Tyrosine-protein kinase Fyn, Macrophage colony-stimulating factor 1 receptor, Tyrosine-protein kinase ABL1, Mast/stem cell growth factor receptor Kit, Epidermal growth factor receptor, Proto-oncogene tyrosine-protein kinase receptor Ret, Ephrin type-A receptor 2, Tyrosine-protein kinase Yes, Bcr/Abl fusion protein, Myelin transcription factor 1.
Bioactivity
ChEMBL activities: 129 potent at pChembl ≥ 5 of 129 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ABL1 | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_26325627 |
| ABL1 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_26325612 |
| EPHA3 | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_26216933 |
| ABL1 | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_26325600 |
| ABL1 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_26325606 |
| ABL1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26276632 |
| ABL1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26325630 |
| ABL1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26325636 |
| ABL1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26325639 |
| ABL1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26325723 |
| ABL1 | 9.22 | IC50 | 0.6 | nM | CHEMBL_ACT_26325594 |
| ABL1 | 9.22 | IC50 | 0.6 | nM | CHEMBL_ACT_26325615 |
| ABL1 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_26276620 |
| ABL1 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_26325633 |
| ABL1 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_26325597 |
| ABL1 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_26325642 |
| SRC | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_26325645 |
| ABL1 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_26325699 |
| P00520 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_26325824 |
| SRC | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_29127162 |
| ABL1 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_26325618 |
| ABL1 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_26325624 |
| ABL1 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_26325702 |
| ABL1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_26276828 |
| ABL1 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_26276616 |
| ABL1 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_26276825 |
| ABL1 | 8.94 | IC50 | 1.15 | nM | CHEMBL_ACT_26325729 |
| EPHA8 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_26216948 |
| ABL1 | 8.85 | IC50 | 1.4 | nM | CHEMBL_ACT_26325714 |
| ABL1 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_26325717 |
Target pathways
Aggregated over 5 target gene(s): ABL1, SIK1, SIK2, SIK3, SRC.
Top Reactome pathways
156 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 2 | ABL1, SRC |
| Developmental Biology | 2 | ABL1, SRC |
| Signal Transduction | 2 | ABL1, SRC |
| Disease | 2 | ABL1, SRC |
| Immune System | 2 | ABL1, SRC |
| Signaling by Rho GTPases | 2 | ABL1, SRC |
| Generic Transcription Pathway | 2 | ABL1, SRC |
| Signaling by ROBO receptors | 2 | ABL1, SRC |
| Axon guidance | 2 | ABL1, SRC |
| Infectious disease | 2 | ABL1, SRC |
| Cyclin D associated events in G1 | 2 | ABL1, SRC |
| RNA Polymerase II Transcription | 2 | ABL1, SRC |
| Gene expression (Transcription) | 2 | ABL1, SRC |
| Transcriptional regulation by RUNX2 | 2 | ABL1, SRC |
| Transcriptional regulation by RUNX1 | 2 | ABL1, SRC |
| RUNX2 regulates osteoblast differentiation | 2 | ABL1, SRC |
| RUNX2 regulates bone development | 2 | ABL1, SRC |
| FCGR3A-mediated phagocytosis | 2 | ABL1, SRC |
| Nervous system development | 2 | ABL1, SRC |
| Signaling by Rho GTPases, Miro GTPases and RHOBTB3 | 2 | ABL1, SRC |
| Neurotransmitter receptors and postsynaptic signal transmission | 1 | SRC |
| Transmission across Chemical Synapses | 1 | SRC |
| Neuronal System | 1 | SRC |
| Signaling by ERBB2 | 1 | SRC |
| Signaling by ERBB4 | 1 | SRC |
| Nuclear signaling by ERBB4 | 1 | SRC |
| Downregulation of ERBB4 signaling | 1 | SRC |
| PIP3 activates AKT signaling | 1 | SRC |
| Cytokine Signaling in Immune system | 1 | SRC |
| Spry regulation of FGF signaling | 1 | SRC |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| intracellular signal transduction | 5 |
| protein phosphorylation | 5 |
| protein autophosphorylation | 3 |
| epidermal growth factor receptor signaling pathway | 2 |
| integrin-mediated signaling pathway | 2 |
| substrate adhesion-dependent cell spreading | 2 |
| Fc-gamma receptor signaling pathway involved in phagocytosis | 2 |
| ephrin receptor signaling pathway | 2 |
| cellular response to hydrogen peroxide | 2 |
| positive regulation of ERK1 and ERK2 cascade | 2 |
| cellular response to transforming growth factor beta stimulus | 2 |
| cell adhesion | 2 |
| regulation of cell differentiation | 2 |
| negative regulation of transcription by RNA polymerase II | 2 |
| cell differentiation | 2 |
Indications & clinical
Indications
87 indications (9 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| chronic myeloid leukemia | 4 | MONDO:0011996 | EFO:0000339 |
| acute lymphoblastic leukemia | 4 | MONDO:0004967 | EFO:0000220 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| lymphoid leukemia | 4 | MONDO:0005402 | EFO:0004289 |
| childhood malignant neoplasm | 4 | MONDO:0006517 | EFO:1000654 |
| blast phase chronic myelogenous leukemia, BCR-ABL1 positive | 4 | MONDO:0006115 | EFO:1000131 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| prostate adenocarcinoma | 3 | MONDO:0005082 | EFO:0000673 |
| metastatic prostate carcinoma | 3 | MONDO:0004956 | EFO:0000196 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| squamous cell lung carcinoma | 2 | MONDO:0005097 | EFO:0000708 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| metastatic melanoma | 2 | MONDO:0005191 | EFO:0002617 |
| malignant pleural mesothelioma | 2 | MONDO:0005112 | EFO:0000770 |
| diffuse large B-cell lymphoma | 2 | MONDO:0018905 | EFO:0000403 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| mesothelioma | 2 | MONDO:0005065 | EFO:0000588 |
| acquired polycythemia vera | 2 | MONDO:0009891 | EFO:0002429 |
| breast neoplasm | 2 | MONDO:0021100 | EFO:0003869 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| cholangiocarcinoma | 2 | MONDO:0019087 | EFO:0005221 |
| chronic kidney disease | 2 | MONDO:0005300 | EFO:0003884 |
| gliosarcoma | 2 | MONDO:0016681 | EFO:1001465 |
| head and neck squamous cell carcinoma | 2 | MONDO:0010150 | EFO:0000181 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| pineoblastoma | 2 | MONDO:0016722 | EFO:1000475 |
| brain neoplasm | 2 | MONDO:0021211 | EFO:0003833 |
| diffuse intrinsic pontine glioma | 2 | MONDO:0006033 | EFO:1000026 |
| rectal cancer | 2 | MONDO:0006519 | EFO:1000657 |
| adenoid cystic carcinoma | 2 | MONDO:0004971 | MONDO:0003175 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| colonic neoplasm | 2 | MONDO:0005401 | MONDO:0021063 |
| glioma | 2 | MONDO:0021042 | MONDO:0100342 |
| brain disorder | 2 | MONDO:0005560 | EFO:0005774 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| breast carcinoma | 2 | MONDO:0004989 | EFO:0000305 |
| gastrointestinal stromal tumor | 2 | MONDO:0011719 | MONDO:0011719 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000180 |
| squamous cell carcinoma | 2 | MONDO:0005096 | EFO:0000707 |
| obesity disorder | 2 | MONDO:0011122 | EFO:0001073 |
| triple-negative breast carcinoma | 2 | MONDO:0005494 | EFO:0005537 |
| paraganglioma | 2 | MONDO:0000448 | EFO:1000453 |
| non-Hodgkin lymphoma | 1 | MONDO:0018908 | EFO:0005952 |
| Hodgkins lymphoma | 1 | MONDO:0004952 | EFO:0000183 |
| MALT lymphoma | 1 | MONDO:0007650 | EFO:0000191 |
| myelodysplastic syndrome | 1 | MONDO:0018881 | EFO:0000198 |
| angioimmunoblastic T-cell lymphoma | 1 | MONDO:0004977 | EFO:0000255 |
| Burkitt lymphoma | 1 | MONDO:0007243 | EFO:0000309 |
| idiopathic pulmonary fibrosis | 1 | MONDO:0800504 | EFO:0000768 |
| rhabdomyosarcoma | 1 | MONDO:0005212 | EFO:0002918 |
| anaplastic large cell lymphoma | 1 | MONDO:0020325 | EFO:0003032 |
| head and neck cancer | 1 | MONDO:0005627 | EFO:0006859 |
| Sezary syndrome | 1 | MONDO:0017844 | EFO:1000785 |
| mycosis fungoides | 1 | MONDO:0009691 | EFO:1001051 |
| mantle cell lymphoma | 1 | MONDO:0018876 | EFO:1001469 |
| scleroderma | 1 | MONDO:0019340 | EFO:1001993 |
| Waldenstrom macroglobulinemia | 1 | MONDO:0100280 | EFO:0009441 |
| central nervous system neoplasm | 1 | MONDO:0006130 | EFO:1000158 |
| peritoneal neoplasm | 1 | MONDO:0006901 | MONDO:0002087 |
| fallopian tube neoplasm | 1 | MONDO:0021092 | MONDO:0002158 |
| myeloid leukemia | 1 | MONDO:0004643 | MONDO:0004643 |
| ovarian cancer | 1 | MONDO:0008170 | MONDO:0008170 |
| follicular lymphoma | 1 | MONDO:0018906 | MONDO:0018906 |
| nasal cavity and paranasal sinus lethal midline granuloma | 1 | MONDO:0006828 | MONDO:0019472 |
| Alzheimer disease | 1 | MONDO:0004975 | MONDO:0004975 |
| peripheral T-cell lymphoma, not otherwise specified | 1 | MONDO:0004964 | EFO:0000211 |
| colorectal neoplasm | 1 | MONDO:0005335 | MONDO:0005575 |
| endometrium neoplasm | 0 | MONDO:0021251 | MONDO:0011962 |
13 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 316.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 157 |
| PHASE1 | 70 |
| PHASE1/PHASE2 | 34 |
| Not specified | 21 |
| PHASE3 | 14 |
| PHASE4 | 10 |
| PHASE2/PHASE3 | 6 |
| EARLY_PHASE1 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03844360 | PHASE4 | RECRUITING | Dose Individualization of Antineoplastic Drugs and Anti-Infective Drug in Children With Hematoplastic Disease |
| NCT04877522 | PHASE4 | RECRUITING | Asciminib Roll-over Study |
| NCT05944783 | PHASE4 | NOT_YET_RECRUITING | Bioequivalence Studies of Dasatinib 100 Mg |
| NCT07046182 | PHASE4 | ACTIVE_NOT_RECRUITING | Clinical Study of CEP+Dasatinib + Azacytidine in First-line Treatment of. Angioimmunoblastoma Foresight |
| NCT01660906 | PHASE4 | COMPLETED | Phase IV, Open-label, Multicenter Study of Dasatinib in Chronic-Phase Chronic Myeloid Leukemia (CP-CML) Patients With Chronic, Low-grade Non-Hematologic Toxicity to Imatinib |
| NCT02690922 | PHASE4 | UNKNOWN | Low-dose Chemotherapy Combine With Tyrosine Kinase Inhibitor to Treat ph+ Acute Lymphoblastic Leukemia Patients |
| NCT03216070 | PHASE4 | UNKNOWN | Low-dose Dasatinib as First-line Treatment for Chronic Myeloid Leukemia |
| NCT04155411 | PHASE4 | UNKNOWN | Dose Reduced Dasatinib (70 mg Daily) as First-line Treatment for Newly Diagnosed CML-CP |
| NCT04925141 | PHASE4 | COMPLETED | A Study of Dasatinib as First-line Treatment for Newly Diagnosed Chronic-Phase Chronic Myeloid Leukemia (CML-CP) |
| NCT04933526 | PHASE4 | UNKNOWN | The Efficacy and Safety of Switching to Flumatinib Versus Dasatinib After Imatinib-related Low-grade Adverse Events in CML-CP Patients |
| NCT03020030 | PHASE3 | ACTIVE_NOT_RECRUITING | Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Children and Adolescents |
| NCT03117751 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | Total Therapy XVII for Newly Diagnosed Patients With Acute Lymphoblastic Leukemia and Lymphoma |
| NCT04530565 | PHASE3 | ACTIVE_NOT_RECRUITING | Testing the Use of Steroids and Tyrosine Kinase Inhibitors With Blinatumomab or Chemotherapy for Newly Diagnosed BCR-ABL-Positive Acute Lymphoblastic Leukemia in Adults |
| NCT04971226 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study of Oral Asciminib Versus Other TKIs in Adult Patients With Newly Diagnosed Ph+ CML-CP |
| NCT05653258 | PHASE2/PHASE3 | RECRUITING | Single Nuclei RNA-seq to Map Adipose Cellular Populations and Senescent Cells in Older Subjects |
| NCT06855810 | PHASE2/PHASE3 | RECRUITING | Newly-diagnosed Pediatric T-cell ALL Protocol |
| NCT00123474 | PHASE3 | COMPLETED | Chronic Myelogenous Leukemia (CML) - Follow on: Study of BMS-354825 in Subjects With CML |
| NCT00123487 | PHASE3 | COMPLETED | Advanced Chronic Myelogenous Leukemia (CML) - Follow On: Study of BMS-354825 in Subjects With CML |
| NCT00349518 | PHASE2/PHASE3 | WITHDRAWN | Study of Dasatinib in Imatinib Resistant or Intolerant Subjects With Chronic or Advanced Phase CML or Philadelphia Chromosome Positive ALL |
| NCT00362466 | PHASE3 | TERMINATED | A Study of Dasatinib vs. High-Dose Imatinib (600 mg) in Patients With Chronic Phase Chronic Myeloid Leukemia (CML) Who Failed to Achieve Complete Cytogenetic Response After 3-18 Months of Imatinib Therapy |
| NCT00481247 | PHASE3 | COMPLETED | A Phase III Study of Dasatinib vs Imatinib in Patients With Newly Diagnosed Chronic Phase Chronic Myeloid Leukemia |
| NCT00549848 | PHASE3 | COMPLETED | Total Therapy Study XVI for Newly Diagnosed Patients With Acute Lymphoblastic Leukemia |
| NCT00720109 | PHASE2/PHASE3 | COMPLETED | Dasatinib and Combination Chemotherapy in Treating Young Patients With Newly Diagnosed Acute Lymphoblastic Leukemia |
| NCT00744497 | PHASE3 | COMPLETED | Randomized Study Comparing Docetaxel Plus Dasatinib to Docetaxel Plus Placebo in Castration-resistant Prostate Cancer |
| NCT01460693 | PHASE3 | COMPLETED | Comparison of Imatinib Versus Dasatinib in Patients With Newly-diagnosed Chronic Phase Chronic Myeloid Leukaemia |
| NCT02013648 | PHASE3 | COMPLETED | Randomized Phase III Study of Intensive Chemotherapy With or Without Dasatinib (Sprycel™) |
| NCT02326311 | PHASE3 | COMPLETED | Optimization of TKIs Treatment and Quality of Life in Ph+ CML Patients ≥60 Years in Deep Molecular Response |
| NCT02883049 | PHASE3 | COMPLETED | Combination Chemotherapy in Treating Young Patients With Newly Diagnosed High-Risk B Acute Lymphoblastic Leukemia and Ph-Like TKI Sensitive Mutations |
| NCT02890784 | PHASE3 | COMPLETED | Dasatinib Holiday for Improved Tolerability |
| NCT03564470 | PHASE2/PHASE3 | UNKNOWN | Precision Diagnosis Directing HDACi and TKI Target Therapy for Adult Ph-like ALL |
| NCT00070499 | PHASE2 | ACTIVE_NOT_RECRUITING | Imatinib Mesylate or Dasatinib in Treating Patients With Previously Untreated Chronic Phase Chronic Myelogenous Leukemia |
| NCT00792948 | PHASE2 | ACTIVE_NOT_RECRUITING | Combination Chemotherapy With or Without Donor Stem Cell Transplant in Treating Patients With Acute Lymphoblastic Leukemia |
| NCT01990196 | PHASE2 | ACTIVE_NOT_RECRUITING | Neoadjuvant Phase 2 Study Comparing the Effects of AR Inhibition With/Without SRC or MEK Inhibition in Prostate Cancer |
| NCT02143414 | PHASE2 | ACTIVE_NOT_RECRUITING | Blinatumomab and Combination Chemotherapy or Dasatinib, Prednisone, and Blinatumomab in Treating Older Patients With Acute Lymphoblastic Leukemia |
| NCT02465060 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Patients With Advanced Refractory Solid Tumors, Lymphomas, or Multiple Myeloma (The MATCH Screening Trial) |
| NCT02559778 | PHASE2 | RECRUITING | Pediatric Precision Laboratory Advanced Neuroblastoma Therapy |
| NCT02689440 | PHASE2 | ACTIVE_NOT_RECRUITING | Dasatinib and Venetoclax in Treating Patients With Philadelphia Chromosome Positive or BCR-ABL1 Positive Early Chronic Phase Chronic Myelogenous Leukemia |
| NCT03297606 | PHASE2 | RECRUITING | Canadian Profiling and Targeted Agent Utilization Trial (CAPTUR) |
| NCT03516279 | PHASE2 | ACTIVE_NOT_RECRUITING | Pembrolizumab and Dasatinib, Imatinib Mesylate, or Nilotinib in Treating Patients With Chronic Myeloid Leukemia and Persistently Detectable Minimal Residual Disease |
| NCT03654768 | PHASE2 | ACTIVE_NOT_RECRUITING | Testing the Addition of Ruxolitinib to the Usual Treatment (Tyrosine Kinase Inhibitors) for Chronic Myeloid Leukemia |
Clinical evidence (CIViC)
Variant × indication × effect (223 predictive associations from 297 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| BCR::ABL1 Fusion | B-lymphoblastic Leukemia/lymphoma | Sensitivity/Response | Dasatinib | CIViC A | EID11235 |
| BCR::ABL1 Fusion | Chronic Myeloid Leukemia | Sensitivity/Response | Nilotinib + Dasatinib | CIViC A | EID261 |
| BCR::ABL1 Fusion AND ABL1 Mutation | Acute Lymphoblastic Leukemia | Sensitivity/Response | Dasatinib | CIViC A | EID11341 |
| BCR::ABL1 Fusion AND ABL1 TKD Mutation | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC A | EID11342 |
| ABL1 I418S | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC B | EID4715 |
| ARID1A Loss OR ARID1A Wildtype | Ovarian Clear Cell Carcinoma | Sensitivity/Response | Dasatinib | CIViC B | EID11789 |
| ETV6::ABL1 Fusion | Myeloid Neoplasm | Sensitivity/Response | Imatinib + Dasatinib + Nilotinib | CIViC B | EID11326 |
| KIT Mutation | Core Binding Factor Acute Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC B | EID8576 |
| BCR::ABL1 Fusion AND ABL1 F317L | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID6309 +6 |
| BCR::ABL1 Fusion AND ABL1 T315I | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4365 +5 |
| BCR::ABL1 Fusion AND ABL1 Y253H | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4335 +3 |
| BCR::ABL1 Fusion AND ABL1 E255V | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4447 +2 |
| BCR::ABL1 Fusion AND ABL1 E355G | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4403 +2 |
| BCR::ABL1 Fusion AND ABL1 F359V | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID3819 +2 |
| BCR::ABL1 Fusion AND ABL1 M244V | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4302 +2 |
| BCR::ABL1 Fusion AND ABL1 M351T | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4396 +2 |
| BCR::ABL1 Fusion AND ABL1 E255K | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4350 +1 |
| BCR::ABL1 Fusion AND ABL1 E459K | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID6310 +1 |
| BCR::ABL1 Fusion AND ABL1 F359I | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4532 +1 |
| BCR::ABL1 Fusion AND ABL1 F486S | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4571 +1 |
| BCR::ABL1 Fusion AND ABL1 G250E | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4316 +1 |
| BCR::ABL1 Fusion AND ABL1 H396R | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID4413 +1 |
| BCR::ABL1 Fusion AND ABL1 L248V | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID6308 +1 |
| ABL1 TKD Mutation | Chronic Myeloid Leukemia | Resistance | Dasatinib | CIViC B | EID6311 |
| BCR::ABL1 Fusion AND ABL1 H396R | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC C | EID4414 +3 |
| BCR::ABL1 Fusion AND ABL1 Y253F | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC C | EID4343 +3 |
| BCR::ABL1 Fusion AND ABL1 E255K | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC C | EID4351 +2 |
| BCR::ABL1 Fusion AND ABL1 H396P | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC C | EID4556 +2 |
| BCR::ABL1 Fusion AND ABL1 Y253H | Chronic Myeloid Leukemia | Sensitivity/Response | Dasatinib | CIViC C | EID4333 +2 |
| RCSD1::ABL1 Fusion | B-lymphoblastic Leukemia/lymphoma | Sensitivity/Response | Dasatinib | CIViC C | EID9164 +2 |
+193 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 5 clinical and 8 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
159 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| BOSUTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| IMATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| LAPATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| MIDOSTAURIN | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| NERATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| NILOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| PONATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| SUNITINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| VANDETANIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3, SRC |
| LESTAURTINIB | ChEMBL | Phase 3 | ABL1, SIK1, SIK2, SIK3, SRC |
| Idelalisib | PubChem | Approved | ABL1, SIK1, SIK2, SIK3, SRC |
| Selumetinib | PubChem | Approved | ABL1, SIK1, SIK2, SIK3, SRC |
| AXITINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3 |
| CABOZANTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| CERITINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| dacomitinib | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| ENTRECTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| IBRUTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| QUIZARTINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| RUXOLITINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK2, SIK3 |
| TIRBANIBULIN | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3, SRC |
| TIVOZANIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK3, SRC |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | ABL1, SIK1, SIK2, SRC |
| CANERTINIB | ChEMBL | Phase 3 | ABL1, SIK2, SIK3, SRC |
| SARACATINIB | ChEMBL | Phase 3 | ABL1, SIK2, SIK3, SRC |
| AT-9283 | ChEMBL | Phase 2 | ABL1, SIK2, SIK3, SRC |
| FORETINIB | ChEMBL | Phase 2 | ABL1, SIK1, SIK2, SRC |
| MILCICLIB | ChEMBL | Phase 2 | ABL1, SIK2, SIK3, SRC |
| OSI-632 | ChEMBL | Phase 2 | ABL1, SIK2, SIK3, SRC |
| R-406 | ChEMBL | Phase 2 | ABL1, SIK1, SIK2, SRC |
| SU-014813 | ChEMBL | Phase 2 | ABL1, SIK1, SIK2, SRC |
| TOZASERTIB | ChEMBL | Phase 2 | ABL1, SIK1, SIK2, SRC |
| Binimetinib | PubChem | Approved | ABL1, SIK2, SIK3, SRC |
| Fostamatinib | PubChem | Approved | ABL1, SIK2, SIK3, SRC |
| BRIGATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SRC |
| DABRAFENIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3 |
| LENVATINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3 |
| TOFACITINIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK1, SIK3 |
| TOVORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | ABL1, SIK2, SIK3 |
| CEDIRANIB | ChEMBL | Phase 3 | ABL1, SIK2, SRC |
| DOVITINIB | ChEMBL | Phase 3 | ABL1, SIK2, SRC |
| BMS-690514 | ChEMBL | Phase 2 | ABL1, SIK2, SRC |
| DANUSERTIB | ChEMBL | Phase 2 | ABL1, SIK2, SRC |
| PELITINIB | ChEMBL | Phase 2 | ABL1, SIK2, SRC |
| Acalabrutinib | PubChem | Approved | SIK1, SIK2, SIK3 |
| Duvelisib | PubChem | Approved | SIK1, SIK2, SIK3 |
| Sirolimus | PubChem | Approved | SIK1, SIK2, SIK3 |
| Trametinib | PubChem | Approved | ABL1, SIK2, SIK3 |
| MOMELOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SIK2, SIK3 |
| RIBOCICLIB | ChEMBL + PubChem | Phase 4 (approved) | SIK2, SIK3 |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | ABL1, SRC |
| ALISERTIB | ChEMBL | Phase 3 | ABL1, SRC |
Related Atlas pages
- Genes: ABL1, SIK1, SIK2, SIK3, SRC
- Diseases: chronic myeloid leukemia, acute lymphoblastic leukemia, neoplasm, lymphoid leukemia, childhood malignant neoplasm, blast phase chronic myelogenous leukemia, BCR-ABL1 positive, leukemia, acute myeloid leukemia, prostate adenocarcinoma, metastatic prostate carcinoma, B-cell acute lymphoblastic leukemia, myeloid neoplasm, core binding factor acute myeloid leukemia
- Drugs: Afatinib, Bosutinib, Crizotinib, Erlotinib, Fedratinib, Gefitinib, Imatinib, Lapatinib, Midostaurin, Neratinib, Nilotinib, Pazopanib, Ponatinib, Sorafenib, Sunitinib, Vandetanib, Lestaurtinib, Idelalisib, Selumetinib, Axitinib, Cabozantinib, Ceritinib, dacomitinib, Entrectinib, Ibrutinib, Quizartinib, Regorafenib, Ruxolitinib, Tirbanibulin, Tivozanib, Nintedanib, Canertinib, Saracatinib, Binimetinib, Fostamatinib, Brigatinib, Dabrafenib, Lenvatinib, Tofacitinib, Tovorafenib, Cediranib, Dovitinib, Acalabrutinib, Duvelisib, Sirolimus, Trametinib, Momelotinib, Ribociclib, Infigratinib, Alisertib
- Biomarker genes: ARID1A, DDR2, IDH1, KIT, PDGFRA, RET