Dexamethasone
drugOn this page
Also known as Aeroseb-dexDecadermDecadronDecadron-75DecasprayDexa-sineDexacortalDexacortinDexacortisylDexafreeDexametasonaDexamethasone component of ciprodexDexamethasone component of dexacidinDexamethasone component of dexasporinDexamethasone component of maxitrolDexamethasone component of tobradexDexamethasone component of tobradex stDexamethasone intensolDexamethasone metasulfobenzoate sodium
Summary
Dexamethasone (CHEMBL384467) is an approved small-molecule immunosuppressive agent (ATC A01AC02) targeting NR1I2, NR3C1, and NR3C2; indicated across 315 conditions including eye disorder and neoplasm; with CIViC clinical evidence for 3 variant-indication associations (e.g. NUP214::ABL1 Fusion in b-lymphoblastic leukemia/lymphoma, bcr-abl1–like).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A01AC02 (+10 more)
- Targets: 3 (NR1I2, NR3C1, NR3C2)
- Indications: 315 conditions
- Clinical trials: 2,730
- Precision-oncology evidence (CIViC): 3 variant–indication associations
- Chemistry: 392.5 Da · C22H29FO5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL384467 |
| Name | Dexamethasone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5743 |
| ChEBI | CHEBI:41879 |
| ATC | A01AC02, R01AD03, S02BA06, S03BA01, D07AB19, D10AA03, S01CB01, C05AA09, D07XB05, H02AB02, S01BA01 |
| Molecular formula | C22H29FO5 |
| Molecular weight | 392.5 |
| InChIKey | UREBDLICKHMUKA-CXSFZGCWSA-N |
SMILES: C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C
IUPAC name: (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
ChEBI definition: A fluorinated steroid that is 9-fluoropregna-1,4-diene substituted by hydroxy groups at positions 11, 17 and 21, a methyl group at position 16 and oxo groups at positions 3 and 20. It is a synthetic member of the class of glucocorticoids.
Pharmacological roles (ChEBI): immunosuppressive agent, anti-inflammatory drug, adrenergic agent, antiemetic, antineoplastic agent.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Aeroseb-dex, Decaderm, Decadron, Decadron-75, Decaspray, Dexa-sine, Dexacortal, Dexacortin, Dexacortisyl, Dexafree, Dexametasona, Dexamethasone
Patent coverage: 80,451 distinct patent families (279,102 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR1I2 | Pregnane X receptor | Agonist | 6.1 | 0.3% | O75469 |
| NR3C1 | Glucocorticoid receptor | Agonist | 9 | 0.9% | P04150 |
| NR3C2 | Mineralocorticoid receptor | Agonist | 9 | 0% | P08235 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Androgen receptor, Thyrotropin receptor, Inhibitor of nuclear factor kappa-B kinase subunit beta, Mineralocorticoid receptor, Glucocorticoid receptor, Progesterone receptor, Nuclear factor NF-kappa-B complex, Beta-2 adrenergic receptor, Nuclear receptor subfamily 1 group I member 2, Androgen receptor.
Bioactivity
ChEMBL activities: 145 potent at pChembl ≥ 5 of 154 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C1 | 10 | EC50 | 0.1 | nM | CHEMBL_ACT_18936145 |
| NR3C1 | 10 | ED50 | 0.1 | nM | CHEMBL_ACT_2150545 |
| NR3C1 | 9.7 | EC50 | 0.2 | nM | CHEMBL_ACT_1926290 |
| NR3C2 | 9.44 | Ki | 0.36 | nM | CHEMBL_ACT_13934672 |
| NR3C1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_13845428 |
| NR3C1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_14566761 |
| NFKB1 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26133933 |
| CHUK | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26133934 |
| IKBKB | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_26133935 |
| NR3C1 | 9.29 | IC50 | 0.51 | nM | CHEMBL_ACT_3470274 |
| NR3C1 | 9.29 | IC50 | 0.51 | nM | CHEMBL_ACT_3502454 |
| NR3C1 | 9.29 | IC50 | 0.51 | nM | CHEMBL_ACT_7851069 |
| NR3C1 | 9.16 | Ki | 0.69 | nM | CHEMBL_ACT_13934696 |
| NR3C1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_14988559 |
| NR3C1 | 9 | EC50 | 1 | nM | CHEMBL_ACT_1601065 |
| NR3C1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_1977908 |
| NR3C1 | 9 | EC50 | 1 | nM | CHEMBL_ACT_2539896 |
| NR3C1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_2715556 |
| NR3C1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_5199312 |
| NR3C1 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_13439189 |
| NR3C1 | 8.96 | EC50 | 1.1 | nM | CHEMBL_ACT_13440450 |
| NR3C1 | 8.96 | EC50 | 1.1 | nM | CHEMBL_ACT_13452331 |
| NR3C1 | 8.96 | EC50 | 1.1 | nM | CHEMBL_ACT_15024338 |
| NR3C1 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_2517716 |
| NR3C1 | 8.96 | EC50 | 1.1 | nM | CHEMBL_ACT_2518486 |
| NR3C1 | 8.96 | EC50 | 1.1 | nM | CHEMBL_ACT_2986119 |
| NR3C1 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_3252326 |
| NR3C1 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_6275754 |
| NR3C1 | 8.96 | EC50 | 1.1 | nM | CHEMBL_ACT_6276405 |
| NR3C1 | 8.93 | IC50 | 1.18 | nM | CHEMBL_ACT_1733236 |
Target pathways
Aggregated over 3 target gene(s): NR1I2, NR3C1, NR3C2.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 3 | NR1I2, NR3C1, NR3C2 |
| SUMOylation of intracellular receptors | 3 | NR1I2, NR3C1, NR3C2 |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 2 | NR3C1, NR3C2 |
| Cellular responses to stress | 1 | NR3C2 |
| SUMOylation | 1 | NR3C2 |
| SUMO E3 ligases SUMOylate target proteins | 1 | NR3C2 |
| Metabolism of proteins | 1 | NR3C2 |
| Post-translational protein modification | 1 | NR3C2 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| Cellular responses to stimuli | 1 | NR3C2 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of DNA-templated transcription | 3 |
| signal transduction | 3 |
| negative regulation of transcription by RNA polymerase II | 2 |
| gene expression | 2 |
| negative regulation of DNA-templated transcription | 2 |
| positive regulation of DNA-templated transcription | 2 |
| positive regulation of transcription by RNA polymerase II | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
| xenobiotic metabolic process | 1 |
| steroid metabolic process | 1 |
| positive regulation of gene expression | 1 |
| cell differentiation | 1 |
| intracellular receptor signaling pathway | 1 |
| xenobiotic catabolic process | 1 |
Indications & clinical
Indications
315 indications (78 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| eye disorder | 4 | MONDO:0005328 | EFO:0005752 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| acne | 4 | MONDO:0011438 | EFO:0003894 |
| Crohn disease | 4 | MONDO:0005011 | EFO:0000384 |
| diabetic retinopathy | 4 | MONDO:0005266 | EFO:0003770 |
| gout | 4 | MONDO:0005393 | EFO:0004274 |
| psoriasis | 4 | MONDO:0005083 | EFO:0000676 |
| ulcerative colitis | 4 | MONDO:0005101 | EFO:0000729 |
| Stevens-Johnson syndrome | 4 | MONDO:0018229 | EFO:0004276 |
| contact dermatitis | 4 | MONDO:0005480 | EFO:0005319 |
| meningeal tuberculosis | 4 | MONDO:0006042 | EFO:1000039 |
| erythema multiforme | 4 | MONDO:0006545 | EFO:1000694 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| mycosis fungoides | 4 | MONDO:0009691 | EFO:1001051 |
| peptic ulcer disease | 4 | MONDO:0004247 | HP:0004398 |
| leukemia | 4 | MONDO:0005059 | EFO:0000565 |
| ankylosing spondylitis | 4 | MONDO:0005306 | EFO:0003898 |
| allergic rhinitis | 4 | MONDO:0011786 | EFO:0005854 |
| trichinellosis | 4 | MONDO:0019444 | EFO:0007520 |
| dermatitis herpetiformis | 4 | MONDO:0015614 | EFO:1000684 |
| seborrheic dermatitis | 4 | MONDO:0006608 | EFO:1000764 |
| sympathetic ophthalmia | 4 | MONDO:0019198 | EFO:1001205 |
| tenosynovitis | 4 | MONDO:0004855 | EFO:1001435 |
| non-autoimmune hemolytic anemia | 4 | MONDO:0021559 | EFO:0005558 |
| autoimmune thrombocytopenic purpura | 4 | MONDO:0008558 | EFO:0007160 |
| eosinophilic pneumonia | 4 | MONDO:0005749 | EFO:0007257 |
| iritis | 4 | MONDO:0006814 | EFO:1000997 |
| posterior uveitis | 4 | MONDO:0006918 | EFO:1001119 |
| atopic eczema | 4 | MONDO:0004980 | EFO:0000274 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| nephrotic syndrome | 4 | MONDO:0005377 | EFO:0004255 |
| aplastic anemia | 4 | MONDO:0015909 | HP:0001915 |
| lymphoma | 4 | MONDO:0005062 | EFO:0000574 |
| atopic conjunctivitis | 4 | MONDO:0005642 | EFO:0007141 |
| optic neuritis | 4 | MONDO:0005885 | EFO:0007405 |
| pulmonary tuberculosis | 4 | MONDO:0006052 | EFO:1000049 |
| thrombocytopenia | 4 | MONDO:0002049 | HP:0001873 |
| pneumonia | 4 | MONDO:0005249 | EFO:0003106 |
| psoriatic arthritis | 4 | MONDO:0011849 | EFO:0003778 |
| pemphigus vulgaris | 4 | MONDO:0008219 | EFO:0004719 |
| subacute thyroiditis | 4 | MONDO:0006982 | EFO:1001194 |
| ophthalmic herpes zoster | 4 | MONDO:0005883 | EFO:0007403 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| hypercalcemia disease | 4 | MONDO:0001566 | HP:0003072 |
| adrenal gland hyperfunction | 4 | MONDO:0006640 | EFO:1000797 |
| seasonal allergic rhinitis | 4 | MONDO:0005324 | EFO:0003956 |
| synovitis | 4 | MONDO:0002400 | EFO:0008997 |
| keratitis | 4 | MONDO:0003085 | EFO:0009449 |
| exfoliative dermatitis | 4 | MONDO:0043233 | EFO:0009456 |
| hemorrhoid | 4 | MONDO:0004872 | EFO:0009552 |
| myocarditis | 4 | MONDO:0004496 | EFO:0009609 |
| epicondylitis | 4 | MONDO:0001875 | EFO:1001896 |
| iridocyclitis | 4 | MONDO:0004773 | HP:0001094 |
| chorioretinitis | 4 | MONDO:0004674 | HP:0012424 |
| choroiditis | 4 | MONDO:0001280 | MONDO:0001280 |
| dermatitis | 4 | MONDO:0002406 | MONDO:0002406 |
| chronic primary adrenal insufficiency | 4 | MONDO:0015129 | MONDO:0015128 |
| pemphigus | 4 | MONDO:0006594 | EFO:1000749 |
| bursitis | 4 | MONDO:0002471 | MONDO:0002471 |
| type III hypersensitivity disease | 4 | MONDO:0007004 | EFO:1001222 |
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| multiple sclerosis | 4 | MONDO:0005301 | MONDO:0005301 |
| congenital adrenal hyperplasia | 4 | MONDO:0018479 | MONDO:0008728 |
| sarcoidosis | 4 | MONDO:0019338 | MONDO:0019338 |
| adrenal gland disorder | 4 | MONDO:0005495 | EFO:0005539 |
| uveitis | 4 | MONDO:0020283 | EFO:1001231 |
| herpes simplex infectious disease | 4 | MONDO:0004609 | EFO:1002022 |
| systemic lupus erythematosus | 4 | MONDO:0007915 | MONDO:0007915 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| prostate carcinoma | 3 | MONDO:0005159 | EFO:0001663 |
| bronchiolitis | 3 | MONDO:0002465 | HP:0011950 |
| cirrhosis of liver | 3 | MONDO:0005155 | EFO:0001422 |
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| HELLP syndrome | 3 | MONDO:0008585 | EFO:0007297 |
| acute respiratory distress syndrome | 3 | MONDO:0006502 | EFO:1000637 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| ovarian carcinoma | 3 | MONDO:0005140 | EFO:0001075 |
| congenital heart disease | 3 | MONDO:0005453 | EFO:0005207 |
| urinary tract infection | 3 | MONDO:0100338 | EFO:0003103 |
| mantle cell lymphoma | 3 | MONDO:0018876 | EFO:1001469 |
| pelvic organ prolapse | 3 | MONDO:0000082 | EFO:0004710 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| B-cell acute lymphoblastic leukemia | 3 | MONDO:0004947 | EFO:0000094 |
| neoplasm of mature B-cells | 3 | MONDO:0004949 | EFO:0000096 |
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | EFO:0000183 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| colorectal adenocarcinoma | 3 | MONDO:0005008 | EFO:0000365 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| prostate adenocarcinoma | 3 | MONDO:0005082 | EFO:0000673 |
| sarcoma | 3 | MONDO:0005089 | EFO:0000691 |
| small cell lung carcinoma | 3 | MONDO:0008433 | EFO:0000702 |
| malaria | 3 | MONDO:0005136 | EFO:0001068 |
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| smoldering plasma cell myeloma | 3 | MONDO:0005235 | EFO:0003073 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| bacterial vaginosis | 3 | MONDO:0005316 | EFO:0003932 |
| focal segmental glomerulosclerosis | 3 | MONDO:0100313 | EFO:0004236 |
| lymphoid leukemia | 3 | MONDO:0005402 | EFO:0004289 |
| otitis media | 3 | MONDO:0005441 | EFO:0004992 |
| non-Hodgkin lymphoma | 3 | MONDO:0018908 | EFO:0005952 |
| plasmacytoma | 3 | MONDO:0005615 | EFO:0006738 |
| cysticercosis | 3 | MONDO:0015484 | EFO:0007231 |
| anterior uveitis | 3 | MONDO:0006651 | EFO:1000811 |
| proliferative vitreoretinopathy | 3 | MONDO:0700115 | EFO:1001129 |
| rotator cuff syndrome | 3 | MONDO:0007028 | EFO:1001250 |
| perennial allergic rhinitis | 3 | MONDO:0024332 | EFO:1001417 |
| precursor T-cell acute lymphoblastic leukemia | 3 | MONDO:0020512 | EFO:1001830 |
| amyloidosis | 3 | MONDO:0019065 | EFO:1001875 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| sciatica | 3 | MONDO:0024333 | HP:0011868 |
| herpes simplex encephalitis | 3 | MONDO:0012521 | Orphanet:1930 |
| Meniere disease | 3 | MONDO:0007972 | EFO:0006862 |
| lichen planus, oral | 3 | MONDO:0043923 | EFO:0008517 |
| viral conjunctivitis | 3 | MONDO:0043541 | EFO:0008571 |
| neuralgia | 3 | MONDO:0021667 | EFO:0009430 |
| Waldenstrom macroglobulinemia | 3 | MONDO:0100280 | EFO:0009441 |
| blepharitis | 3 | MONDO:0004785 | EFO:0009536 |
| otitis externa | 3 | MONDO:0004795 | EFO:0009560 |
| strabismus | 3 | MONDO:0003432 | HP:0000486 |
| acute erythroid leukemia | 3 | MONDO:0017858 | EFO:0000218 |
| acute monocytic leukemia | 3 | MONDO:0007896 | EFO:0000221 |
| acute myelomonocytic leukemia M4 | 3 | MONDO:0018871 | EFO:0000223 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| acute megakaryoblastic leukemia | 3 | MONDO:0018872 | EFO:0003025 |
| acute myeloblastic leukemia without maturation | 3 | MONDO:0005224 | EFO:0003027 |
| myelodysplastic syndrome with single lineage dysplasia | 3 | MONDO:0005272 | EFO:0003802 |
| myelodysplastic syndrome with excess blasts | 3 | MONDO:0019454 | EFO:0003811 |
| ovarian neoplasm | 3 | MONDO:0021068 | EFO:0003893 |
| anemia | 3 | MONDO:0002280 | EFO:0004272 |
| viral pneumonia | 3 | MONDO:0006012 | EFO:0007541 |
| chronic myelomonocytic leukemia | 3 | MONDO:0020311 | EFO:1001779 |
| nephrosis | 3 | MONDO:0002331 | MONDO:0002331 |
| ovarian cancer | 3 | MONDO:0008170 | MONDO:0008170 |
| graft versus host disease | 3 | MONDO:0013730 | MONDO:0013730 |
| specific language disorder | 3 | MONDO:0016226 | MONDO:0016226 |
| acute biphenotypic leukemia | 3 | MONDO:0020322 | MONDO:0019460 |
| nasal cavity and paranasal sinus lethal midline granuloma | 3 | MONDO:0006828 | MONDO:0019472 |
| atrioventricular block | 3 | MONDO:0000465 | MONDO:0000465 |
| leiomyoma | 3 | MONDO:0001572 | MONDO:0001572 |
| follicular lymphoma | 3 | MONDO:0018906 | MONDO:0018906 |
| adult acute respiratory distress syndrome | 3 | MONDO:0100130 | MONDO:0100130 |
| mastoiditis | 3 | MONDO:0000748 | HP:0000265 |
| subarachnoid hemorrhage | 3 | MONDO:0005099 | EFO:0000713 |
| male reproductive organ cancer | 3 | MONDO:0005836 | EFO:0007355 |
| primary progressive multiple sclerosis | 3 | MONDO:0000451 | EFO:0008520 |
| corneal edema | 3 | MONDO:0006712 | EFO:1000879 |
| cataract | 3 | MONDO:0005129 | MONDO:0005129 |
| allergic disease | 3 | MONDO:0005271 | MONDO:0005271 |
| migraine disorder | 3 | MONDO:0005277 | MONDO:0005277 |
| sickle cell disease | 3 | MONDO:0011382 | MONDO:0011382 |
| ovarian hyperstimulation syndrome | 3 | MONDO:0011972 | MONDO:0011972 |
| bronchopulmonary dysplasia | 3 | MONDO:0019091 | MONDO:0019091 |
| hereditary amyloidosis | 3 | MONDO:0018634 | MONDO:0019438 |
| obstructive sleep apnea syndrome | 3 | MONDO:0007147 | EFO:0003918 |
| influenza | 3 | MONDO:0005812 | EFO:0007328 |
| glaucoma | 3 | MONDO:0005041 | MONDO:0005041 |
| metastatic prostate carcinoma | 3 | MONDO:0004956 | EFO:0000196 |
| plasma cell neoplasm | 3 | MONDO:0004959 | EFO:0000200 |
| respiratory failure | 3 | MONDO:0021113 | EFO:0009686 |
| female reproductive organ cancer | 3 | MONDO:0001416 | EFO:1001331 |
| colorectal neoplasm | 3 | MONDO:0005335 | MONDO:0005575 |
| wet macular degeneration | 2 | MONDO:0005417 | EFO:0004683 |
| retinal vein occlusion | 2 | MONDO:0006951 | EFO:1001157 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| lichen planus | 2 | MONDO:0006572 | EFO:1000726 |
| nervous system disorder | 2 | MONDO:0005071 | EFO:0000618 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| head and neck squamous cell carcinoma | 2 | MONDO:0010150 | EFO:0000181 |
| peripheral T-cell lymphoma, not otherwise specified | 2 | MONDO:0004964 | EFO:0000211 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| congestive heart failure | 2 | MONDO:0005009 | EFO:0000373 |
| mesothelioma | 2 | MONDO:0005065 | EFO:0000588 |
| myxoid liposarcoma | 2 | MONDO:0013280 | EFO:0000613 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| age-related macular degeneration | 2 | MONDO:0005150 | EFO:0001365 |
| lymphoid neoplasm | 2 | MONDO:0005157 | EFO:0001642 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| hearing loss disorder | 2 | MONDO:0005365 | EFO:0004238 |
| plasma cell leukemia | 2 | MONDO:0018689 | EFO:0006475 |
| appendicitis | 2 | MONDO:0005649 | EFO:0007149 |
| Cryptococcal meningitis | 2 | MONDO:0005723 | EFO:0007228 |
| leptospirosis | 2 | MONDO:0005825 | EFO:0007344 |
| rectal cancer | 2 | MONDO:0006519 | EFO:1000657 |
| dry eye syndrome | 2 | MONDO:0006733 | EFO:1000906 |
| immunoglobulin A vasculitis | 2 | MONDO:0019167 | EFO:1000965 |
| intermediate uveitis | 2 | MONDO:0006806 | EFO:1000986 |
| intracranial hypertension | 2 | MONDO:0006810 | EFO:1000992 |
| POEMS syndrome | 2 | MONDO:0017364 | EFO:1001115 |
| sensorineural hearing loss disorder | 2 | MONDO:0020678 | EFO:1001176 |
| plantar fasciitis | 2 | MONDO:0004833 | EFO:1001909 |
| intrahepatic cholangiocarcinoma | 2 | MONDO:0003210 | EFO:1001961 |
| urothelial carcinoma | 2 | MONDO:0040679 | EFO:0008528 |
| pulmonary fibrosis | 2 | MONDO:0002771 | EFO:0009448 |
| squamous cell lung carcinoma | 2 | MONDO:0005097 | EFO:0000708 |
| cholangiocarcinoma | 2 | MONDO:0019087 | EFO:0005221 |
| oral cavity cancer | 2 | MONDO:0005515 | EFO:0005570 |
| T-cell leukemia | 2 | MONDO:0005525 | EFO:0005592 |
| cerebral toxoplasmosis | 2 | MONDO:0005697 | EFO:0007200 |
| blast phase chronic myelogenous leukemia, BCR-ABL1 positive | 2 | MONDO:0006115 | EFO:1000131 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| gastric neoplasm | 2 | MONDO:0021085 | MONDO:0001056 |
| brain cancer | 2 | MONDO:0001657 | MONDO:0001657 |
| glomerulonephritis | 2 | MONDO:0002462 | MONDO:0002462 |
| radiculopathy | 2 | MONDO:0002959 | MONDO:0002959 |
| intestinal obstruction | 2 | MONDO:0004565 | MONDO:0004565 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| Castleman disease | 2 | MONDO:0015564 | MONDO:0015564 |
| hematopoietic and lymphoid system neoplasm | 2 | MONDO:0002334 | MONDO:0044881 |
| pure red-cell aplasia | 2 | MONDO:0001705 | MONDO:0001705 |
| thrombotic thrombocytopenic purpura | 2 | MONDO:0018896 | MONDO:0018896 |
| meningitis | 2 | MONDO:0021108 | MONDO:0021108 |
| endocrine gland neoplasm | 2 | MONDO:0002082 | EFO:0003769 |
| breast carcinoma in situ | 2 | MONDO:0004658 | MONDO:0004658 |
| sinus histiocytosis with massive lymphadenopathy | 2 | MONDO:0006412 | MONDO:0006412 |
| tuberculosis | 2 | MONDO:0018076 | MONDO:0018076 |
| immune system disorder | 2 | MONDO:0005046 | EFO:0000540 |
| heart failure | 2 | MONDO:0005252 | EFO:0003144 |
| obstructive lung disease | 2 | MONDO:0002267 | HP:0006536 |
| gastric adenocarcinoma | 2 | MONDO:0005036 | EFO:0000503 |
| reproductive system disorder | 2 | MONDO:0005039 | EFO:0000512 |
| lung carcinoma | 2 | MONDO:0005138 | EFO:0001071 |
| Lassa fever | 2 | MONDO:0005820 | EFO:0007338 |
| CD4+/CD56+ hematodermic neoplasm | 2 | MONDO:0019467 | EFO:0010580 |
| tonsillitis | 2 | MONDO:0001039 | MONDO:0001039 |
| pharyngitis | 2 | MONDO:0002258 | MONDO:0002258 |
| optic papillitis | 2 | MONDO:0006879 | MONDO:0004037 |
| nasopharyngeal carcinoma | 2 | MONDO:0015459 | MONDO:0015459 |
| choroidal neovascularization | 2 | MONDO:0810000 | MONDO:0810000 |
| Graves disease | 1 | MONDO:0005364 | EFO:0004237 |
| primary cutaneous T-cell non-Hodgkin lymphoma | 1 | MONDO:0000607 | EFO:0002913 |
| rheumatic disorder | 1 | MONDO:0005554 | EFO:0005755 |
| head and neck cancer | 1 | MONDO:0005627 | EFO:0006859 |
| brain edema | 1 | MONDO:0006684 | EFO:1000845 |
| aorta coarctation | 1 | MONDO:0007345 | EFO:1001267 |
| vitiligo | 1 | MONDO:0008661 | EFO:0004208 |
| osteoarthritis, knee | 1 | MONDO:0005416 | EFO:0004616 |
| lacrimal apparatus disorder | 1 | MONDO:0001854 | HP:0009926 |
| scleritis | 1 | MONDO:0001718 | MONDO:0001718 |
| adrenocortical insufficiency | 1 | MONDO:0000004 | EFO:0009491 |
| radius fracture | 1 | MONDO:0005325 | EFO:0003957 |
| sinusitis | 1 | MONDO:0005961 | EFO:0007486 |
| retinopathy of prematurity | 1 | MONDO:0006952 | EFO:1001158 |
| anaphylaxis | 1 | MONDO:0100053 | MONDO:0100053 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| pulpitis | 1 | MONDO:0006937 | EFO:1001139 |
| ileus | 1 | MONDO:0004567 | MONDO:0004567 |
| esophageal squamous cell carcinoma | 1 | MONDO:0005580 | EFO:0005922 |
| croup | 1 | MONDO:0005722 | EFO:0007227 |
| hairy cell leukemia | 1 | MONDO:0018935 | EFO:1000956 |
| keratoconus | 1 | MONDO:0015486 | MONDO:0015486 |
| tooth disorder | 0 | MONDO:0006999 | EFO:1001216 |
| hypertensive disorder | 0 | MONDO:0005044 | EFO:0000537 |
| alcohol abuse | 0 | MONDO:0002046 | MONDO:0007079 |
| vestibular neuronitis | 0 | MONDO:0006008 | EFO:0007537 |
54 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 2,730.
Phase distribution
(phase/status distribution below is over 1,600 sampled trials of the 2,730 total).
| Phase | Trials |
|---|---|
| PHASE3 | 532 |
| PHASE2 | 456 |
| PHASE4 | 432 |
| PHASE1/PHASE2 | 111 |
| PHASE2/PHASE3 | 69 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01553214 | PHASE4 | RECRUITING | Improving White Blood Cell Collection From Healthy Donors |
| NCT03829371 | PHASE4 | ACTIVE_NOT_RECRUITING | STUDY COMPARING TWO STANDARD TREATMENTS IN AUTOLOGOUS STEM CELL TRANSPLANTATION INELIGIBLE POPULATION AFFECTED BY MULTIPLE MYELOMA |
| NCT04025840 | PHASE4 | ACTIVE_NOT_RECRUITING | Perioperative Epidural Block and Dexamethasone in Pancreatic Cancer Surgery |
| NCT04150614 | PHASE4 | RECRUITING | BMT-08: A Comparative Effectiveness Study of Transdermal Granisetron to Ondansetron |
| NCT04182997 | PHASE4 | RECRUITING | Subjective Intraoperative Use of Epidural Steroid Administration Following Discectomy |
| NCT04205916 | PHASE4 | RECRUITING | A Trial Evaluating Patient Preference of Dropless vs Drops Post Cataract Surgery |
| NCT04432012 | PHASE4 | RECRUITING | A Study to Compare Different Ways of Steroid Administration After Total Knee Implantation |
| NCT04432259 | PHASE4 | NOT_YET_RECRUITING | Oral Dexamethasone as an Intervention for Postoperative Pain and Nausea Management in Total Knee Arthroplasty |
| NCT04507412 | PHASE4 | RECRUITING | Intravenous Dexamethasone Administration in Patients Undergoing Total Shoulder Arthroplasty |
| NCT04545242 | PHASE4 | RECRUITING | Efficacy of DEXamethasone in Patients With Acute Hypoxemic REspiratory Failure Caused by INfEctions |
| NCT04549935 | PHASE4 | RECRUITING | The PRIME Study: A Randomized, Controlled, Prospective Study |
| NCT04826237 | PHASE4 | RECRUITING | Oral Statins and Protection From Hearing Loss |
| NCT05072262 | PHASE4 | RECRUITING | DSAEK/DMEK and Cystoid Macular Edema - the Role for Topical NSAIDs (Nepafenac) (DMEC) |
| NCT05191706 | PHASE4 | RECRUITING | Evaluate the Safety of DEXYCU for the Treatment of Inflammation Following Ocular Surgery for Childhood Cataract |
| NCT05435547 | PHASE4 | RECRUITING | Preoperative Corticosteroids in Autoimmune Thyroid Disease |
| NCT05488847 | PHASE4 | ACTIVE_NOT_RECRUITING | Opioid-Free Pain Protocol After Shoulder Arthroplasty |
| NCT05518383 | PHASE4 | RECRUITING | B-cell Mature Non-Hodgkin’s Lymphoma Treatment Protocol in Children and Adolescents 2021 |
| NCT05522465 | PHASE4 | RECRUITING | Short-course High-dose Prednisone and Dexamethasone in Children With ITP |
| NCT05561725 | PHASE4 | RECRUITING | Perioperative Steroid Dosing on the APR in AIS |
| NCT05716945 | PHASE4 | RECRUITING | The OPTIMISE Study |
| NCT05721027 | PHASE4 | RECRUITING | Ibuprofen With or Without Dexamethasone for Acute Radicular Low Back Pain. |
| NCT05731960 | PHASE4 | RECRUITING | Evaluating the Effect of Intravenous Dexamethasone on the Duration of Spinal Anesthesia After Cesarean Delivery |
| NCT05824832 | PHASE4 | RECRUITING | Buprenorphine, Clonidine, and Dexamethasone on Duration of Brachial Plexus Blocks for Upper Extremity Surgery |
| NCT05936528 | PHASE4 | NOT_YET_RECRUITING | Lactoferrin Use in ICU Patients |
| NCT06006624 | PHASE4 | ENROLLING_BY_INVITATION | Exparel vs Block for ACL Reconstruction |
| NCT06023043 | PHASE4 | NOT_YET_RECRUITING | Postoperative Steroid Use in Adolescent Idiopathic Scoliosis and Neuromuscular Scoliosis Patients |
| NCT06044480 | PHASE4 | NOT_YET_RECRUITING | Effect of Dexamethason on Postimplantation Syndrome After EVAR |
| NCT06118710 | PHASE4 | RECRUITING | Evaluation of the Omission of Dexamethasone in Premedication Regimens During Paclitaxel Treatment |
| NCT06160180 | PHASE4 | NOT_YET_RECRUITING | Comparative Assessment of Preoperative Versus Postoperative Submucosal Dexamethasone on Postoperative Complications Following Surgical Extraction of Mandibular Third Molar: Randomized Controlled Trial |
| NCT06268704 | PHASE4 | RECRUITING | Particulate vs. Non-Particulate Steroid for Sacroiliac Joint Injection |
| NCT06289673 | PHASE4 | RECRUITING | Identification of Necessary Information for Treatment Induction in Newly Diagnosed Acute Lymphoblastic Leukemia/Lymphoma |
| NCT06367855 | PHASE4 | RECRUITING | Efficacy and Safety of Preemptive Intravenous Dexamethasone in MIS-TLIF |
| NCT06404541 | PHASE4 | ACTIVE_NOT_RECRUITING | A Comparative Study Between Preservative With Benzalkonium Chloride vs Preservative Free Eye Drops on the Ocular Surface |
| NCT06408974 | PHASE4 | NOT_YET_RECRUITING | Comparison Between Ketamine Intrathecal and iv Dexamethasone for Post Cesarean Analgesia |
| NCT06409702 | PHASE4 | RECRUITING | Treatment of High-risk Newly Diagnosed Multiple Myeloma With Minimal Residual Disease Detection |
| NCT06465992 | PHASE4 | ENROLLING_BY_INVITATION | Liposomal Bupivacaine With Dexamethasone for Foot Surgery |
| NCT06575010 | PHASE4 | ENROLLING_BY_INVITATION | Exparel v Dexamethasone in RCR |
| NCT06603662 | PHASE4 | RECRUITING | Systemic Oral Glucocorticoids for the Treatment of Acute Osteoarthritis Pain in the Emergency Department |
| NCT06624436 | PHASE4 | RECRUITING | Immunomodulatory Effects of Dexamethasone, Tocilizumab and Anakinra During Experimental Human Endotoxemia |
| NCT06685991 | PHASE4 | NOT_YET_RECRUITING | Effect of Timing of Dexamethasone During Induction on Postoperative Outcomes |
Clinical evidence (CIViC)
Variant × indication × effect (3 predictive associations from 3 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| NUP214::ABL1 Fusion | B-lymphoblastic Leukemia/lymphoma, BCR-ABL1–like | Sensitivity/Response | Vincristine + Dexamethasone + Dasatinib | CIViC C | EID7208 |
| CDK4 EXPRESSION | Childhood B-cell Acute Lymphoblastic Leukemia | Sensitivity/Response | Ribociclib + Dexamethasone | CIViC D | EID7798 |
| CDK6 EXPRESSION | Childhood B-cell Acute Lymphoblastic Leukemia | Sensitivity/Response | Dexamethasone + Ribociclib | CIViC D | EID7801 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 14 clinical and 55 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
379 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ENZALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1, NR3C2 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, NR3C2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, NR3C2 |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, NR3C2 |
| BOSENTAN | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1 |
| EPLERENONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUDROCORTISONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1 |
| TADALAFIL | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| FELODIPINE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| FLUOROMETHOLONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE BUTYRATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROXYPROGESTERONE CAPROATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| ISOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| ISRADIPINE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| LOTEPREDNOL ETABONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| METHYLPREDNISOLONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| MITOTANE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| NIMODIPINE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| NISOLDIPINE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| NORGESTIMATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| PONATINIB | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| PREDNISOLONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| RACECADOTRIL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| RIMEXOLONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| SIMVASTATIN | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| SULCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| TESTOSTERONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| TIOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
| TOLCAPONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1 |
Related Atlas pages
- Genes: NR1I2, NR3C1, NR3C2
- Diseases: eye disorder, neoplasm, acne, Crohn disease, diabetic retinopathy, gout, psoriasis, ulcerative colitis, Stevens-Johnson syndrome, contact dermatitis, meningeal tuberculosis, erythema multiforme, juvenile idiopathic arthritis, mycosis fungoides, peptic ulcer disease, leukemia, ankylosing spondylitis, allergic rhinitis, trichinellosis, dermatitis herpetiformis, seborrheic dermatitis, sympathetic ophthalmia, tenosynovitis, non-autoimmune hemolytic anemia, autoimmune thrombocytopenic purpura, eosinophilic pneumonia, iritis, posterior uveitis, atopic eczema, rheumatoid arthritis, nephrotic syndrome, aplastic anemia, lymphoma, atopic conjunctivitis, optic neuritis, pulmonary tuberculosis, thrombocytopenia, pneumonia, psoriatic arthritis, pemphigus vulgaris, subacute thyroiditis, ophthalmic herpes zoster, frozen shoulder, hypercalcemia disease, adrenal gland hyperfunction, seasonal allergic rhinitis, synovitis, keratitis, exfoliative dermatitis, hemorrhoid, myocarditis, epicondylitis, iridocyclitis, chorioretinitis, choroiditis, dermatitis, chronic primary adrenal insufficiency, pemphigus, bursitis, type III hypersensitivity disease, asthma, osteoarthritis, multiple sclerosis, congenital adrenal hyperplasia, sarcoidosis, adrenal gland disorder, uveitis, herpes simplex infectious disease, systemic lupus erythematosus, plasma cell myeloma, prostate carcinoma, bronchiolitis, cirrhosis of liver, breast carcinoma, HELLP syndrome, acute respiratory distress syndrome, acute lymphoblastic leukemia, ovarian carcinoma, congenital heart disease, urinary tract infection, mantle cell lymphoma, pelvic organ prolapse, injury, B-cell acute lymphoblastic leukemia, neoplasm of mature B-cells, hepatocellular carcinoma, Hodgkins lymphoma, myelodysplastic syndrome, T-cell acute lymphoblastic leukemia, acute myeloid leukemia, colorectal adenocarcinoma, diffuse large B-cell lymphoma, prostate adenocarcinoma, sarcoma, small cell lung carcinoma, malaria, non-small cell lung carcinoma, smoldering plasma cell myeloma, breast neoplasm, chronic kidney disease, bacterial vaginosis, focal segmental glomerulosclerosis, lymphoid leukemia, otitis media, non-Hodgkin lymphoma, plasmacytoma, cysticercosis, anterior uveitis, proliferative vitreoretinopathy, rotator cuff syndrome, perennial allergic rhinitis, precursor T-cell acute lymphoblastic leukemia, amyloidosis, soft tissue sarcoma, sciatica, herpes simplex encephalitis, Meniere disease, lichen planus, oral, viral conjunctivitis, neuralgia, Waldenstrom macroglobulinemia, blepharitis, otitis externa, strabismus, acute monocytic leukemia, severe acute respiratory syndrome, acute megakaryoblastic leukemia, acute myeloblastic leukemia without maturation, myelodysplastic syndrome with single lineage dysplasia, myelodysplastic syndrome with excess blasts, ovarian neoplasm, anemia, viral pneumonia, chronic myelomonocytic leukemia, ovarian cancer, graft versus host disease, specific language disorder, acute biphenotypic leukemia, nasal cavity and paranasal sinus lethal midline granuloma, atrioventricular block, leiomyoma, follicular lymphoma, adult acute respiratory distress syndrome, mastoiditis, subarachnoid hemorrhage, male reproductive organ cancer, primary progressive multiple sclerosis, corneal edema, cataract, allergic disease, migraine disorder, sickle cell disease, ovarian hyperstimulation syndrome, bronchopulmonary dysplasia, hereditary amyloidosis, obstructive sleep apnea syndrome, influenza, glaucoma, metastatic prostate carcinoma, plasma cell neoplasm, respiratory failure, female reproductive organ cancer, colorectal neoplasm, B-lymphoblastic leukemia/lymphoma, BCR-ABL1–like
- Drugs: Enzalutamide, Fluticasone Propionate, Mifepristone, Progesterone, Bosentan, Crizotinib, Desoxycorticosterone Pivalate, Eplerenone, Fludrocortisone, Fulvestrant, Regorafenib, Tadalafil, Acenocoumarol, Benzbromarone, Betamethasone Dipropionate, Budesonide, Butoconazole, Candesartan Cilexetil, Ciclesonide, Clobetasol Propionate, Clotrimazole, Danazol, Daunorubicin, Desogestrel, Desoximetasone, Diethylstilbestrol, Econazole, Efavirenz, Ethinyl Estradiol, Felodipine, Fluorometholone, Fluticasone Furoate, Hydrocortisone, Hydrocortisone Butyrate, Hydroxyprogesterone Caproate, Isoconazole, Isradipine, Ketoconazole, Lasofoxifene, Loteprednol Etabonate, Masoprocol, Medroxyprogesterone, Methylprednisolone, Mitotane, Naftopidil, Nimodipine, Nisoldipine, Norgestimate, Ponatinib, Prednisolone, Racecadotril, Rimexolone, Simvastatin, Spironolactone, Sulconazole, Tamoxifen, Testosterone Propionate, Tioconazole, Tolcapone