Dexmedetomidine
drugOn this page
Also known as DexmedetomidinaMedetomidine, (s)-MPV-1440SID11114268Dexmeditomidine
Summary
Dexmedetomidine (CHEMBL778) is an approved small-molecule α-adrenergic agonist (ATC N05CM18) targeting ADRA2A, ADRA2B, and ADRA2C; indicated across 70 conditions including obstructive sleep apnea syndrome and toxic shock syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05CM18
- Targets: 3 (ADRA2A, ADRA2B, ADRA2C)
- Indications: 70 conditions
- Clinical trials: 1,393
- Chemistry: 200.28 Da · C13H16N2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL778 |
| Name | Dexmedetomidine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5311068 |
| ChEBI | CHEBI:4466 |
| ATC | N05CM18 |
| Molecular formula | C13H16N2 |
| Molecular weight | 200.28 |
| InChIKey | CUHVIMMYOGQXCV-NSHDSACASA-N |
SMILES: CC1=C(C(=CC=C1)[C@H](C)C2=CN=CN2)C
IUPAC name: 5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole
Pharmacological roles (ChEBI): α-adrenergic agonist, non-narcotic analgesic, analgesic, sedative.
Also known as: Dexmedetomidina, Dexmedetomidine, Medetomidine, (s)-, MPV-1440, SID11114268, dexmedetomidine, DEXMEDETOMIDINE, Dexmeditomidine
Parent form; salt/anhydrous children: CHEMBL2106195
Patent coverage: 3,996 distinct patent families (13,886 SureChEMBL compound mentions), from 3 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Agonist | 7.6 | 0.1% | P08913 |
| ADRA2B | α2B-adrenoceptor | Full agonist | 10.9 | 0.2% | P18089 |
| ADRA2C | α2C-adrenoceptor | Agonist | 9.2 | 0% | P18825 |
Broader ChEMBL bioactivity targets: 17 (assay-derived). Sample: Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Thyrotropin receptor, Adrenergic receptor alpha-2, Alpha-1D adrenergic receptor, Alpha-1A adrenergic receptor, Alpha-1B adrenergic receptor, Cytochrome P450 2D6.
Bioactivity
ChEMBL activities: 31 potent at pChembl ≥ 5 of 36 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P22909 | 10.82 | Ki | 0.01 | nM | CHEMBL_ACT_1024074 |
| ADRA1D | 10.82 | Ki | 0.01 | nM | CHEMBL_ACT_1146518 |
| P22909 | 10.82 | Ki | 0.01 | nM | CHEMBL_ACT_204005 |
| P19328 | 10.82 | Ki | 0.01 | nM | CHEMBL_ACT_784949 |
| ADRA2C | 9.32 | EC50 | 0.48 | nM | CHEMBL_ACT_16896936 |
| ADRA2A | 9.1 | EC50 | 0.8 | nM | CHEMBL_ACT_16896926 |
| ADRA2A | 8.82 | EC50 | 1.5 | nM | CHEMBL_ACT_5130912 |
| ADRA2B | 8.72 | EC50 | 1.91 | nM | CHEMBL_ACT_25844440 |
| ADRA2A | 8.67 | EC50 | 2.14 | nM | CHEMBL_ACT_16610374 |
| ADRA2A | 8.62 | EC50 | 2.37 | nM | CHEMBL_ACT_25844407 |
| ADRA2A | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_16610357 |
| ADRA2A | 8.5 | EC50 | 3.16 | nM | CHEMBL_ACT_25844402 |
| ADRA2B | 8.48 | EC50 | 3.31 | nM | CHEMBL_ACT_25844403 |
| P22909 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_1024075 |
| P15823 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_204006 |
| ADRA2C | 8.27 | EC50 | 5.37 | nM | CHEMBL_ACT_25844447 |
| ADRA1A | 7.88 | EC50 | 13.03 | nM | CHEMBL_ACT_25844454 |
| ADRA2C | 7.54 | EC50 | 28.84 | nM | CHEMBL_ACT_25844404 |
| ADRA2C | 7.51 | Ki | 30.9 | nM | CHEMBL_ACT_1918098 |
| CYP3A4 | 6.8 | Potency | 158.5 | nM | CHEMBL_ACT_4981594 |
| CYP3A4 | 6.8 | Potency | 158.5 | nM | CHEMBL_ACT_5050621 |
| CYP3A4 | 6.8 | AC50 | 158.5 | nM | CHEMBL_ACT_6022673 |
| CYP1A2 | 6.8 | AC50 | 158.5 | nM | CHEMBL_ACT_6025046 |
| CYP2C9 | 6.7 | Potency | 199.5 | nM | CHEMBL_ACT_5057562 |
| CYP2C9 | 6.7 | AC50 | 199.5 | nM | CHEMBL_ACT_5998973 |
| P18130 | 6.42 | EC50 | 376 | nM | CHEMBL_ACT_16896946 |
| ADRA1D | 5.91 | Ki | 1230 | nM | CHEMBL_ACT_25844400 |
| ADRA1A | 5.88 | Ki | 1318 | nM | CHEMBL_ACT_25844386 |
| CYP2C19 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4021239 |
| CYP2C19 | 5.3 | AC50 | 5012 | nM | CHEMBL_ACT_6021752 |
Target pathways
Aggregated over 3 target gene(s): ADRA2A, ADRA2B, ADRA2C.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signal Transduction | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signaling by GPCR | 3 | ADRA2A, ADRA2B, ADRA2C |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Amine ligand-binding receptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR downstream signalling | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenoceptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (i) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (z) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR ligand binding | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet activation, signaling and aggregation | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet Aggregation (Plug Formation) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Metabolism | 2 | ADRA2A, ADRA2C |
| Integration of energy metabolism | 2 | ADRA2A, ADRA2C |
| Metabolism of proteins | 2 | ADRA2A, ADRA2C |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | ADRA2A, ADRA2C |
| Regulation of insulin secretion | 2 | ADRA2A, ADRA2C |
| Surfactant metabolism | 2 | ADRA2A, ADRA2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| epidermal growth factor receptor signaling pathway | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| negative regulation of norepinephrine secretion | 3 |
| regulation of vasoconstriction | 3 |
| platelet activation | 3 |
| negative regulation of epinephrine secretion | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| adrenergic receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 3 |
| regulation of smooth muscle contraction | 3 |
| signal transduction | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| female pregnancy | 2 |
| negative regulation of insulin secretion | 2 |
Indications & clinical
Indications
70 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| obstructive sleep apnea syndrome | 3 | MONDO:0007147 | EFO:0003918 |
| toxic shock syndrome | 3 | MONDO:0001881 | EFO:0006834 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| subarachnoid hemorrhage | 3 | MONDO:0005099 | EFO:0000713 |
| obesity disorder | 3 | MONDO:0011122 | EFO:0001073 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| cleft palate | 3 | MONDO:0016064 | HP:0000175 |
| insomnia | 3 | MONDO:0013600 | EFO:0004698 |
| bone fracture | 3 | MONDO:0005315 | EFO:0003931 |
| opiate dependence | 3 | MONDO:0005530 | EFO:0005611 |
| brain disorder | 3 | MONDO:0005560 | EFO:0005774 |
| delirium | 3 | MONDO:0045057 | EFO:0009267 |
| respiratory failure | 3 | MONDO:0021113 | EFO:0009686 |
| gastric neoplasm | 3 | MONDO:0021085 | MONDO:0001056 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| brain injury | 3 | MONDO:0043510 | MONDO:0043510 |
| morbid obesity | 3 | MONDO:0005139 | EFO:0001074 |
| pharyngitis | 3 | MONDO:0002258 | MONDO:0002258 |
| neoplasm | 3 | MONDO:0005070 | MONDO:0004992 |
| atrial septal defect | 3 | MONDO:0006664 | MONDO:0007172 |
| rectal disorder | 3 | MONDO:0001593 | EFO:0000405 |
| lung disorder | 3 | MONDO:0005275 | EFO:0003818 |
| retinopathy of prematurity | 3 | MONDO:0006952 | EFO:1001158 |
| colorectal neoplasm | 3 | MONDO:0005335 | MONDO:0005575 |
| congenital heart disease | 2 | MONDO:0005453 | EFO:0005207 |
| acute kidney injury | 2 | MONDO:0002492 | HP:0001919 |
| brain neoplasm | 2 | MONDO:0021211 | EFO:0003833 |
| preeclampsia | 2 | MONDO:0005081 | EFO:0000668 |
| autism spectrum disorder | 2 | MONDO:0005258 | EFO:0003756 |
| mental disorder | 2 | MONDO:0005084 | EFO:0000677 |
| burn | 2 | MONDO:0043519 | EFO:0009516 |
| adrenal gland pheochromocytoma | 2 | MONDO:0004974 | EFO:0000239 |
| pulmonary hypertension | 2 | MONDO:0005149 | MONDO:0005149 |
| coronary artery disorder | 2 | MONDO:0005010 | EFO:0001645 |
| temporomandibular joint disorder | 2 | MONDO:0005473 | EFO:0005279 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| Riley-Day syndrome | 2 | MONDO:0009131 | Orphanet:1764 |
| heart disorder | 1 | MONDO:0005267 | EFO:0003777 |
| scoliosis | 1 | MONDO:0005392 | EFO:0004273 |
| epilepsy | 1 | MONDO:0005027 | EFO:0000474 |
| cocaine dependence | 1 | MONDO:0005186 | EFO:0002610 |
| kidney failure | 1 | MONDO:0001106 | EFO:1002048 |
| atrial fibrillation | 1 | MONDO:0004981 | EFO:0000275 |
| Alzheimer disease | 1 | MONDO:0004975 | MONDO:0004975 |
| hypotensive disorder | 1 | MONDO:0005468 | EFO:0005251 |
| nasal cavity polyp | 1 | MONDO:0006314 | EFO:1000391 |
| tethered spinal cord syndrome | 1 | MONDO:0006995 | EFO:1001210 |
| radius fracture | 0 | MONDO:0005325 | EFO:0003957 |
| vascular disorder | 0 | MONDO:0005385 | EFO:0004264 |
| brain ischemia | 0 | MONDO:0005299 | MONDO:0005299 |
| neuralgia | 0 | MONDO:0021667 | EFO:0005762 |
| nicotine dependence | 0 | MONDO:0008575 | EFO:0003768 |
17 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 1,393.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 510 |
| PHASE4 | 471 |
| PHASE3 | 137 |
| PHASE2 | 89 |
| PHASE2/PHASE3 | 73 |
| PHASE1 | 52 |
| EARLY_PHASE1 | 37 |
| PHASE1/PHASE2 | 24 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03384563 | PHASE4 | RECRUITING | Effect of Dexmedetomidine on the Minimum Alveolar Concentration of Sevoflurane |
| NCT03480061 | PHASE4 | ACTIVE_NOT_RECRUITING | Dexmedetomidine to Reduce the Incidence of POCD After Open Cardiac Surgery |
| NCT04289142 | PHASE4 | RECRUITING | Cognitive Outcomes After Dexmedetomidine Sedation in Cardiac Surgery Patients |
| NCT04669457 | PHASE4 | ENROLLING_BY_INVITATION | Pediatric Delirium |
| NCT04730609 | PHASE4 | RECRUITING | Dexmedetomidine for Intraoperative Shivering in Scheduled Elective Cesarean Delivery |
| NCT05031026 | PHASE4 | ACTIVE_NOT_RECRUITING | Dexmedetomidine to Prevent Hepatic Ischemia-reperfusion Injury-induced Glycocalyx Degradation and Early Allograft Dysfunction in Liver Transplantation |
| NCT05466708 | PHASE4 | RECRUITING | Safety and Efficacy of Esketamine Combined With Dexmedetomidine for Sedation of Mechanically Ventilated Patients |
| NCT05640453 | PHASE4 | RECRUITING | Pregabalin Versus Dexmedetomidine for Delirium Treatment After Coronary Artery Bypass Grafting |
| NCT05934669 | PHASE4 | RECRUITING | IN Midazolam vs IN Dexmedetomidine vs IN Ketamine During Minimal Procedures in Pediatric ED |
| NCT05935293 | PHASE4 | NOT_YET_RECRUITING | Dexmedetomidine and Kidney Transplantation |
| NCT05950646 | PHASE4 | RECRUITING | Mini-dose Dexmedetomidine-Esketamine Infusion and Perioperative Sleep Quality |
| NCT06067893 | PHASE4 | ENROLLING_BY_INVITATION | Low Dose Dexmedetomidine as a Postoperative Pain Adjunct |
| NCT06139692 | PHASE4 | RECRUITING | Comparison of Perioperative Conscious Sedation During Endovascular Thrombectomy in Acute Ischemic Stroke |
| NCT06251375 | PHASE4 | NOT_YET_RECRUITING | Early Sedation With Dexmedetomidine vs. Placebo in Older Ventilated Critically Ill Patients |
| NCT06252662 | PHASE4 | RECRUITING | Liposomal Bupivacaine Vs Bupivacaine with Dexmedetomidine in Erector Spinae Plane Blocks for Mastectomies |
| NCT06399185 | PHASE4 | RECRUITING | Effect of Dexmedetomidine and Esketamine on Catheter-related Bladder Discomfort |
| NCT06410365 | PHASE4 | NOT_YET_RECRUITING | Impact of Intrathecal vs Intravenous Dexmedetomidine |
| NCT06418308 | PHASE4 | RECRUITING | Intrathecal Dexmedetomidine vs Epinephrine |
| NCT06480539 | PHASE4 | RECRUITING | The Effect of Nocturnal Dexmedetomidine on Postoperative Sleep Quality and Fatigue After Major Surgery in Elderly Patients: DEXSLEEP Study |
| NCT06570187 | PHASE4 | RECRUITING | The Effect of Dexmedetomidine on the Renal Functions in Septic Critically Ill Patients |
| NCT06575179 | PHASE4 | RECRUITING | Dexmedetomidine Reduces Sevoflurane MAC-BAR During Pneumoperitoneum |
| NCT06631534 | PHASE4 | RECRUITING | Effect of Dexmedetomidine Supplementation to General Anaesthesia in Paediatric Transcatheter Closure of Atrial Septal Defect |
| NCT06636578 | PHASE4 | RECRUITING | Dexmedetomidine Ropivacaine Versus Plain Ropivacaine in Bilateral Pectoralis Nerve (PECS) Block |
| NCT06690021 | PHASE4 | NOT_YET_RECRUITING | Comparing The Effect of Adding Dexmedetomidine to Bupivacaine in Classical and Modified Thoracolumbar Interfascial Plane Block on Postoperative Pain in Patients Undergoing Lumbar Disc Surgeries |
| NCT06695468 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Adding Dexmedetomidine to Levobupivacaine in Rectus Sheath Block Compared to Quadratus Lumborum Block in Patients Undergoing Lower Abdominal Cancer Surgery: A Randomized Clinical Trial |
| NCT06720337 | PHASE4 | NOT_YET_RECRUITING | Comparative Study Between the Analgesic Effect of Dexmedetomidine and Magnesium Sulfate as Adjuvant to Bupivacaine Using Ultrasound-Guided Transversus Abdominis Plane Block in Abdominal Hysterectomy : A Randomized Double-blinded Study |
| NCT06734195 | PHASE4 | NOT_YET_RECRUITING | Comparing the Synergistic Effect of Caudal Dexmedetomidine and Propofol Versus Caudal Dexmedetomidine Only or Propofol Only in Prevention of Sevoflurane Related Emergence Agitation in Pediatric Patients Undergoing Congenital Inguinal Hernia Repair |
| NCT06736496 | PHASE4 | NOT_YET_RECRUITING | Comparative Study of Opioid-Free Anesthesia Versus Opioid Anesthesia in Patients Undergoing Laparoscopic Cholecystectomy |
| NCT06752317 | PHASE4 | NOT_YET_RECRUITING | Effect of Preoperative Intrathecal Dexamethasone Versus Dexmedetomidine on Paralytic Ileus After Major Abdominal Surgery |
| NCT06752629 | PHASE4 | NOT_YET_RECRUITING | Comparison Between Dexmedetomidine and Fentanyl As an Adjuvant to Bupivacaine in the Paravertebral Nerve Block in Laparoscopic Cholecystectomy for Postoperative Analgesia: Randomized Comparative Clinical Trial. |
| NCT06822088 | PHASE4 | NOT_YET_RECRUITING | Effects of Esketamine on Oxygenation and Quality of Recovery in Patients Undergoing Thoracoscopic Surgery |
| NCT06823349 | PHASE4 | RECRUITING | Comparative Analysis of Analgesic Efficacy: by Single Shot Intrathecal Analgesia (SSSA) in Normal Labor |
| NCT06837818 | PHASE4 | NOT_YET_RECRUITING | To Explore the Optimal Dose of Dexmedetomidine for Skull Pin Fixation in Intracranial Surgery |
| NCT06849466 | PHASE4 | ENROLLING_BY_INVITATION | Effect of Perioperative Dexmedetomidine on Chronic Post-Surgical Pain |
| NCT06853431 | PHASE4 | RECRUITING | Determination of ED50 and ED95 With Clinical Efficacy of Intranasal Dexmedetomidine Combined With Esketamine for Preoperative Sedation in Pediatric General Anesthesia |
| NCT06958393 | PHASE4 | NOT_YET_RECRUITING | Effect of Opioid-free Anaesthesia on Postoperative Delirium in Elderly Patients Undergoing Gastrointestinal Surgery |
| NCT06981949 | PHASE4 | NOT_YET_RECRUITING | Addition of Dexmedetomidine to Ropivacaine in Bilateral Erector Spinae Plane Block in Patients Undergoing Coronary Artery Bypass Surgery |
| NCT07022821 | PHASE4 | RECRUITING | Comparison of Dexmedetomidine + Ketamine for Postoperative Pain in C-Section |
| NCT07034300 | PHASE4 | RECRUITING | Lidocaine vs. Lidocaine With Dexmedetomidine for Intravenous Regional Anesthesia (IVRA) in Upper Limb Surgery |
| NCT07034898 | PHASE4 | ENROLLING_BY_INVITATION | Dexmedetomidine vs Labetalol for Airway Stress in Hypertensive Craniotomy Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
607 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Almotriptan | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| NAPHAZOLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTHIAZIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BRIMONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DANAZOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
Related Atlas pages
- Genes: ADRA2A, ADRA2B, ADRA2C
- Diseases: obstructive sleep apnea syndrome, toxic shock syndrome, hypertensive disorder, subarachnoid hemorrhage, obesity disorder, injury, anxiety, cleft palate, insomnia, bone fracture, opiate dependence, brain disorder, delirium, respiratory failure, gastric neoplasm, breast neoplasm, brain injury, morbid obesity, pharyngitis, neoplasm, atrial septal defect, rectal disorder, lung disorder, retinopathy of prematurity, colorectal neoplasm
- Drugs: Aclidinium Bromide, Afatinib, Almotriptan, Chenodiol, Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Naphazoline, Olanzapine, Olodaterol, Paliperidone, Pramipexole, Tamsulosin, Tegaserod, Acetophenazine, Alfuzosin, Amisulpride, Amitriptyline, Amoxapine, Apomorphine, Apraclonidine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benfluorex, Benperidol, Benzbromarone, Benzquinamide, Benzthiazide, Benztropine, Bithionol, Brexpiprazole, Brimonidine, Bromocriptine, Bromperidol, Cabergoline, Candesartan Cilexetil, Cariprazine, Carvedilol, Chlorhexidine, Chloroquine, Chlorpromazine, Cinnarizine, Cisapride, Clemastine, Clomipramine, Clonidine, Clotrimazole, Cyproheptadine, Danazol, Darifenacin, Diethylstilbestrol, Dobutamine, Domperidone, Dothiepin, Doxazosin