Diazepam
drugOn this page
Also known as Alupram 10Alupram 2Alupram 5AnsiolisinaAtensineApozepamCentrazepamDiacepinDialarDialar fteDiastatDiastat acudialDiazepam civDiazepam intensolDizacE-pamLA IIILA-IIILibervant
Summary
Diazepam (CHEMBL12) is an approved small-molecule anxiolytic drug (ATC N05BA01) targeting TRHR, GABRA1, and GABRA2; indicated across 18 conditions including epilepsy and anxiety.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05BA01
- Targets: 4 (TRHR, GABRA1, GABRA2…)
- Indications: 18 conditions
- Clinical trials: 56
- Chemistry: 284.74 Da · C16H13ClN2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL12 |
| Name | Diazepam |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3016 |
| ChEBI | CHEBI:49575 |
| ATC | N05BA01 |
| Molecular formula | C16H13ClN2O |
| Molecular weight | 284.74 |
| InChIKey | AAOVKJBEBIDNHE-UHFFFAOYSA-N |
SMILES: CN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3
IUPAC name: 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one
ChEBI definition: A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a methyl group at position 1 and a phenyl group at position 5.
Pharmacological roles (ChEBI): anxiolytic drug, anticonvulsant, sedative.
Other ChEBI roles (chemical / environmental): xenobiotic, environmental contaminant.
Also known as: Alupram 10, Alupram 2, Alupram 5, Ansiolisina, Atensine, Apozepam, Centrazepam, Diacepin, Dialar, Dialar fte, Diastat, Diastat acudial
Parent form; salt/anhydrous children: CHEMBL543191
Patent coverage: 29,956 distinct patent families (92,281 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 92,038 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TRHR | TRH1 receptor | Antagonist | 5.15 | 0% | P34981 |
| GABRA1 | GABAA receptor α1 subunit | Positive | 7.79 | 0% | P14867 |
| GABRA2 | GABAA receptor α2 subunit | Positive | 7.77 | 0% | P47869 |
| GABRA3 | GABAA receptor α3 subunit | Positive | 7.77 | 0% | P34903 |
Broader ChEMBL bioactivity targets: 43 (assay-derived). Sample: GABA-A receptor; anion channel, Gamma-aminobutyric acid receptor subunit alpha-1, GABA-A receptor; anion channel, GABA-A receptor; anion channel, GABA-A receptor; alpha-3/beta-3/gamma-2, GABA-A receptor; alpha-1/beta-3/gamma-2, GABA-A receptor; alpha-5/beta-3/gamma-2, GABA-A receptor; alpha-2/beta-3/gamma-2, GABA-A receptor; anion channel, GABA-A receptor; alpha-1/beta-2/gamma-2.
Bioactivity
ChEMBL activities: 160 potent at pChembl ≥ 5 of 170 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P30535 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_24863110 |
| P18508 | 8.68 | Ki | 2.1 | nM | CHEMBL_ACT_320295 |
| O09028 | 8.54 | Ki | 2.9 | nM | CHEMBL_ACT_466921 |
| O09028 | 8.54 | Ki | 2.9 | nM | CHEMBL_ACT_874022 |
| O09028 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_1302881 |
| GABRP | 8.38 | IC50 | 4.2 | nM | CHEMBL_ACT_25013383 |
| O09028 | 8.36 | IC50 | 4.4 | nM | CHEMBL_ACT_1106447 |
| O09028 | 8.31 | IC50 | 4.9 | nM | CHEMBL_ACT_1001855 |
| O09028 | 8.31 | Ki | 4.9 | nM | CHEMBL_ACT_1145117 |
| O09028 | 8.31 | Ki | 4.9 | nM | CHEMBL_ACT_1161711 |
| O09028 | 8.31 | Ki | 4.9 | nM | CHEMBL_ACT_351488 |
| O09028 | 8.31 | Ki | 4.9 | nM | CHEMBL_ACT_701710 |
| O09028 | 8.31 | IC50 | 4.9 | nM | CHEMBL_ACT_988889 |
| O09028 | 8.3 | Ki | 5.02 | nM | CHEMBL_ACT_139849 |
| O09028 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_457807 |
| O09028 | 8.3 | Ki | 5.02 | nM | CHEMBL_ACT_501148 |
| O09028 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_507139 |
| O09028 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_534900 |
| P23574 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_694101 |
| O09028 | 8.3 | Ki | 5.02 | nM | CHEMBL_ACT_927815 |
| O09028 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_930272 |
| O09028 | 8.27 | IC50 | 5.4 | nM | CHEMBL_ACT_372154 |
| O09028 | 8.27 | IC50 | 5.4 | nM | CHEMBL_ACT_422598 |
| O09028 | 8.27 | IC50 | 5.4 | nM | CHEMBL_ACT_922098 |
| O09028 | 8.25 | Ki | 5.62 | nM | CHEMBL_ACT_29089169 |
| O09028 | 8.25 | IC50 | 5.6 | nM | CHEMBL_ACT_992373 |
| O09028 | 8.22 | Ki | 6 | nM | CHEMBL_ACT_1039765 |
| O09028 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_116266 |
| O09028 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_1296375 |
| O09028 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_357786 |
Target pathways
Aggregated over 4 target gene(s): TRHR, GABRA1, GABRA2, GABRA3.
Top Reactome pathways
4 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| GABA receptor activation | 3 | GABRA1, GABRA2, GABRA3 |
| Signaling by ERBB4 | 1 | GABRA1 |
| Peptide ligand-binding receptors | 1 | TRHR |
| G alpha (q) signalling events | 1 | TRHR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| gamma-aminobutyric acid signaling pathway | 3 |
| synaptic transmission, GABAergic | 3 |
| chloride transmembrane transport | 3 |
| inhibitory synapse assembly | 3 |
| monoatomic ion transport | 3 |
| chloride transport | 3 |
| monoatomic ion transmembrane transport | 3 |
| regulation of postsynaptic membrane potential | 3 |
| G protein-coupled receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| signal transduction | 1 |
| regulation of presynaptic membrane potential | 1 |
Indications & clinical
Indications
18 indications (6 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| epilepsy | 4 | MONDO:0005027 | EFO:0000474 |
| anxiety | 4 | MONDO:0011918 | EFO:0005230 |
| cerebral palsy | 4 | MONDO:0006497 | EFO:1000632 |
| anxiety disorder | 4 | MONDO:0005618 | EFO:0006788 |
| stiff-person syndrome | 4 | MONDO:0008491 | EFO:0007498 |
| visual epilepsy | 3 | MONDO:0001386 | HP:0001250 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| complex partial epilepsy | 3 | MONDO:0006710 | EFO:1000877 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| Landau-Kleffner syndrome | 2 | MONDO:0009509 | EFO:1001010 |
| injury | 2 | MONDO:0021178 | EFO:0000546 |
| rotator cuff syndrome | 2 | MONDO:0007028 | EFO:1001250 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 56.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 16 |
| PHASE4 | 15 |
| PHASE2 | 6 |
| PHASE3 | 5 |
| PHASE2/PHASE3 | 5 |
| PHASE1 | 4 |
| EARLY_PHASE1 | 4 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02078336 | PHASE4 | ACTIVE_NOT_RECRUITING | Optimization of Procedural Sedation Protocol Used for Dental Care Delivery in People With Mental Disability |
| NCT01221883 | PHASE4 | UNKNOWN | Prevention of Posttraumatic Stress Disorder (PTSD) With Diazepam |
| NCT01675648 | PHASE4 | COMPLETED | Lofexidine for Inpatient Opiate Detox in Singapore |
| NCT01939093 | PHASE4 | COMPLETED | Therapeutic Effect of Quetiapine on Methamphetamine-Induced Psychosis |
| NCT02177955 | PHASE4 | COMPLETED | Comparative Study of Hemodynamic Changes Caused by Diazepam and Midazolam During Third Molar Surgery |
| NCT02494180 | PHASE4 | COMPLETED | A Non-inferiority Trial on Pain Relief During Oocyte Retrieval |
| NCT03293017 | PHASE4 | UNKNOWN | Baclofen in Managing Acute Alcohol Withdrawal |
| NCT03631901 | PHASE4 | COMPLETED | Comparison Between Melatonin and Diazepam for Prevention of Recurrent Simple Febrile Seizures |
| NCT03960671 | PHASE4 | UNKNOWN | Therapeutic Drug Monitoring of Anxiolytics in Children |
| NCT04198233 | PHASE4 | UNKNOWN | Impact of Placement of a Diazepam Suppository on Early Postoperative Pain Following Pelvic Reconstructive Surgery |
| NCT04216797 | PHASE4 | WITHDRAWN | Rectal Versus Oral Diazepam Administration in the Treatment of Levator Ani Syndrome |
| NCT04523935 | PHASE4 | COMPLETED | Excessive Crying in Children With Cerebral Palsy and Communication Deficits |
| NCT04570436 | PHASE4 | COMPLETED | Evaluating the Abuse Potential of NEURONTIN® When Taken Orally in Healthy Non-drug Dependent Participants With Sedative Drug Abuse Experience |
| NCT05041985 | PHASE4 | COMPLETED | Clinical Efficacy of Diazepam After Whiplash |
| NCT05273398 | PHASE4 | COMPLETED | Effects of Diazepam on RNS Detections |
| NCT03825809 | PHASE2/PHASE3 | RECRUITING | Nonopioid Analgesia After Labral Surgery |
| NCT00004297 | PHASE3 | COMPLETED | Phase III Randomized Study of Diazepam Vs Lorazepam Vs Placebo for Prehospital Treatment of Status Epilepticus |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT02646124 | PHASE2/PHASE3 | COMPLETED | Diazepam Use With Standard Management for Acute Low Back Pain |
| NCT02721069 | PHASE3 | COMPLETED | Repeat Dose Safety Study of NRL-1 in Epilepsy Subjects |
| NCT02904265 | PHASE2/PHASE3 | TERMINATED | Efficacy Study of Acetazolamide Versus Diazepam in Continuous Spike and Wave/Landau-Kleffner Syndrome |
| NCT02935972 | PHASE2/PHASE3 | COMPLETED | Combined Intravenous Diazepam, Local Periprostatic Nerve Block for Prostate Biopsy |
| NCT03818932 | PHASE2/PHASE3 | COMPLETED | Nonopioid Analgesia After Anterior Cruciate Ligament Reconstruction |
| NCT06103188 | PHASE3 | COMPLETED | Comparing the Effect of Melatonin, Diazepam, and Placebo on Decreasing the Level of Anxiety Preoperatively |
| NCT06293989 | PHASE3 | UNKNOWN | Efficacy and Safety of Intravenous Diazepam Given at 2 Different Doses Compared to Placebo in Acute Peripheral Vertigo |
| NCT00326612 | PHASE2 | COMPLETED | Intranasal Midazolam Versus Rectal Diazepam for Treatment of Seizures |
| NCT01318369 | PHASE2 | COMPLETED | Efficacy Study of Δ9-THC to Treat Chronic Abdominal Pain |
| NCT01417078 | PHASE2 | COMPLETED | A Pharmacokinetic Study of a Single-Dose of Diazepam Nasal Spray in Adult Epileptic Patients Experiencing a Seizure Episode |
| NCT01790555 | PHASE2 | UNKNOWN | Perioperative Δ9-THC for Postsurgical Pain |
| NCT01938092 | PHASE2 | COMPLETED | Vaginal Diazepam for the Treatment of Female Pelvic Pain |
| NCT03818919 | PHASE2 | COMPLETED | Nonopioid Analgesia After Rotator Cuff Repair |
| NCT05361447 | PHASE1/PHASE2 | WITHDRAWN | Diazepam Trial in GAD65 Associated Epilepsy |
| NCT01364558 | PHASE1 | COMPLETED | A Study of Diazepam After Intranasal and Intravenous Administration to Healthy Volunteers |
| NCT01438749 | PHASE1 | COMPLETED | A Study of The Abuse Liability Potential of RO4917838 in Recreational Drug Users |
| NCT02724423 | PHASE1 | COMPLETED | Repeat-Dose Pharmacokinetics Study of NRL-1 in Epilepsy Subjects |
| NCT07020988 | PHASE1 | COMPLETED | A Study to Assess the Time to Onset of Action of Staccato Alprazolam Versus Midazolam and Diazepam in Healthy Participants |
| NCT03165500 | EARLY_PHASE1 | COMPLETED | Comparative Evaluation of Three Anxiety Control Protocols in Third Molar Extraction |
| NCT03820193 | EARLY_PHASE1 | COMPLETED | Nonopioid Analgesia After Arthroscopic Meniscus Surgery |
| NCT05069779 | EARLY_PHASE1 | COMPLETED | Diazepam and Blood Pressure Regulation |
| NCT06271096 | EARLY_PHASE1 | COMPLETED | Intramuscular Midazolam Versus Intravenous Diazepam for Acute Seizure in Children |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 17 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
76 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ALPRAZOLAM | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| APALUTAMIDE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| BREXANOLONE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| CHLORDIAZEPOXIDE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| CLONAZEPAM | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| ESZOPICLONE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| FLUMAZENIL | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| FLUNITRAZEPAM | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| GANAXOLONE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| LIOTHYRONINE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| PROPOFOL | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| TRIAZOLAM | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| ZOLPIDEM | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2, GABRA3 |
| ALFAXALONE | ChEMBL + PubChem | Phase 2 (approved) | GABRA1, GABRA2, GABRA3 |
| ABECARNIL | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| AZD7325 | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| BAICALEIN | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| BASMISANIL | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| BRETAZENIL | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| DELORAZEPAM | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| FLAVONE | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| MK-0777 | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| PROGABIDE | ChEMBL | Phase 2 | GABRA1, GABRA2, GABRA3 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | GABRA1, GABRA2 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| CHLORAMBUCIL | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| EPINASTINE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| ETOMIDATE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| SIMVASTATIN | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| ZALEPLON | ChEMBL | Phase 4 (approved) | GABRA1, GABRA2 |
| SURAMIN | ChEMBL | Phase 3 | GABRA1, GABRA2 |
| TIRATRICOL | ChEMBL | Phase 3 | GABRA1, GABRA2 |
| DARIGABAT | ChEMBL | Phase 2 | GABRA1, GABRA3 |
| PANADIPLON | ChEMBL | Phase 2 | GABRA1, GABRA3 |
| ZOTEPINE | ChEMBL | Phase 2 | GABRA1, GABRA2 |
| Afatinib | PubChem | Approved | GABRA1, GABRA2 |
| Apixaban | PubChem | Approved | GABRA1, GABRA2 |
| Binimetinib | PubChem | Approved | GABRA1, GABRA2 |
| chenodiol | PubChem | Approved | GABRA1, GABRA2 |
| Fulvestrant | PubChem | Approved | GABRA1, GABRA2 |
| gentian violet | PubChem | Approved | GABRA1, GABRA2 |
| Imipenem | PubChem | Approved | GABRA1, GABRA2 |
| Lactulose | PubChem | Approved | GABRA1, GABRA2 |
| levocarnitine | PubChem | Approved | GABRA1, GABRA2 |
| podofilox | PubChem | Approved | GABRA1, GABRA2 |
| Propylene Glycol | PubChem | Approved | GABRA1, GABRA2 |
| Pyrazinamide | PubChem | Approved | GABRA1, GABRA2 |
| Pyridoxine | PubChem | Approved | GABRA1, GABRA2 |
| Riociguat | PubChem | Approved | GABRA1, GABRA2 |
| saxagliptin | PubChem | Approved | GABRA1, GABRA2 |
| Thiamine | PubChem | Approved | GABRA1, GABRA2 |
| Vorapaxar | PubChem | Approved | GABRA1, GABRA2 |
Related Atlas pages
- Genes: TRHR, GABRA1, GABRA2, GABRA3
- Diseases: epilepsy, anxiety, cerebral palsy, anxiety disorder, stiff-person syndrome, dementia, complex partial epilepsy, depressive disorder
- Drugs: Alprazolam, Apalutamide, Brexanolone, Chlordiazepoxide, Clonazepam, Enzalutamide, Eszopiclone, Flumazenil, Flunitrazepam, Ganaxolone, Liothyronine, Propofol, Triazolam, Zolpidem, Crizotinib, Asenapine, Azelastine, Benperidol, Candesartan Cilexetil, Chlorambucil, Clozapine, Epinastine, Etomidate, Glafenine, Simvastatin, Tipranavir, Troglitazone, Zaleplon, Suramin, Tiratricol, Afatinib, Apixaban, Binimetinib, chenodiol, Fulvestrant, Imipenem, Lactulose, levocarnitine, podofilox, Propylene Glycol, Pyrazinamide, Pyridoxine, Riociguat, saxagliptin, Thiamine, Vorapaxar