Dichlorphenamide
drugOn this page
Also known as DaranideDiclofenamidaDiclofenamideKeveyisOratroldichlorophenamidedichorophenamideSID11112264SID56463645SID144203952SID174006804DICHLORPHENAMIDE (DICLOFENAMIDE)
Summary
Dichlorphenamide (CHEMBL17) is an approved small-molecule EC 4.2.1.1 (carbonic anhydrase) inhibitor (ATC S01EC02) targeting CA1, CA4, and CA12; indicated across 4 conditions including glaucoma and myotonic syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: S01EC02
- Targets: 3 (CA1, CA4, CA12)
- Indications: 4 conditions
- Clinical trials: 2
- Chemistry: 305.2 Da · C6H6Cl2N2O4S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL17 |
| Name | Dichlorphenamide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3038 |
| ChEBI | CHEBI:101085 |
| ATC | S01EC02 |
| Molecular formula | C6H6Cl2N2O4S2 |
| Molecular weight | 305.2 |
| InChIKey | GJQPMPFPNINLKP-UHFFFAOYSA-N |
SMILES: C1=C(C=C(C(=C1S(=O)(=O)N)Cl)Cl)S(=O)(=O)N
IUPAC name: 4,5-dichlorobenzene-1,3-disulfonamide
ChEBI definition: A sulfonamide that is benzene-1,3-disulfonamide in which the hydrogens at positions 4 and 5 are substituted by chlorine. An oral carbonic anhydrase inhibitor, it partially suppresses the secretion (inflow) of aqueous humor in the eye and so reduces intraocular pressure. It is used for the treatment of glaucoma.
Pharmacological roles (ChEBI): EC 4.2.1.1 (carbonic anhydrase) inhibitor, antiglaucoma drug, ophthalmology drug.
Also known as: Daranide, Dichlorphenamide, Diclofenamida, Diclofenamide, Keveyis, Oratrol, dichlorophenamide, dichlorphenamide, Dichlorophenamide, dichorophenamide, Dichorophenamide, SID11112264
Patent coverage: 2,344 distinct patent families (9,022 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 8,909 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CA1 | carbonic anhydrase 1 | Inhibition | 7.13 | 0% | P00915 |
| CA4 | carbonic anhydrase 4 | Inhibition | 4.82 | 0.3% | P22748 |
| CA12 | carbonic anhydrase 12 | Inhibition | 7.3 | 0.2% | O43570 |
Broader ChEMBL bioactivity targets: 22 (assay-derived). Sample: Prelamin-A/C, Carbonic anhydrase 2, Carbonic anhydrase 13, Carbonic anhydrase 7, Carbonic anhydrase 1, Carbonic anhydrase 4, Carbonic anhydrase 6, Carbonic anhydrase 12, Cytochrome P450 2C9, Carbonic anhydrase 14.
Bioactivity
ChEMBL activities: 328 potent at pChembl ≥ 5 of 333 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CA7 | 8.22 | Ki | 6 | nM | CHEMBL_ACT_2159090 |
| CA2 | 8.1 | Ki | 8 | nM | CHEMBL_ACT_1435148 |
| CA2 | 8.05 | Ki | 9 | nM | CHEMBL_ACT_2159056 |
| CA5B | 7.68 | Ki | 21 | nM | CHEMBL_ACT_1655281 |
| CA5B | 7.68 | Ki | 21 | nM | CHEMBL_ACT_1780629 |
| CA5B | 7.68 | Ki | 21 | nM | CHEMBL_ACT_2056557 |
| CA5B | 7.68 | Ki | 21 | nM | CHEMBL_ACT_3393265 |
| CA5B | 7.68 | Ki | 21 | nM | CHEMBL_ACT_5236269 |
| Q9D6N1 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_1435963 |
| Q9D6N1 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_1780634 |
| Q9D6N1 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_2056592 |
| Q9D6N1 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_3393270 |
| Q9D6N1 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_60267 |
| CA13 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_6262815 |
| CA1 | 7.6 | Ki | 25 | nM | CHEMBL_ACT_1435147 |
| CA7 | 7.58 | Ki | 26.5 | nM | CHEMBL_ACT_13859508 |
| CA7 | 7.58 | Ki | 26.5 | nM | CHEMBL_ACT_1435962 |
| CA7 | 7.58 | Ki | 26 | nM | CHEMBL_ACT_1780630 |
| CA7 | 7.58 | Ki | 26 | nM | CHEMBL_ACT_2056571 |
| CA7 | 7.58 | Ki | 26 | nM | CHEMBL_ACT_3393267 |
| CA7 | 7.58 | Ki | 26 | nM | CHEMBL_ACT_6262810 |
| CA9 | 7.47 | Ki | 34 | nM | CHEMBL_ACT_1435149 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_1042470 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_10946398 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_12083959 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_1264410 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_12655983 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_13286815 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_13866458 |
| CA2 | 7.42 | Ki | 38 | nM | CHEMBL_ACT_13872676 |
Target pathways
Aggregated over 3 target gene(s): CA1, CA4, CA12.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 3 | CA1, CA12, CA4 |
| Reversible hydration of carbon dioxide | 3 | CA1, CA12, CA4 |
| Erythrocytes take up carbon dioxide and release oxygen | 2 | CA1, CA4 |
| Erythrocytes take up oxygen and release carbon dioxide | 2 | CA1, CA4 |
| O2/CO2 exchange in erythrocytes | 2 | CA1, CA4 |
| Transport of small molecules | 2 | CA1, CA4 |
| Cytokine Signaling in Immune system | 1 | CA1 |
| Immune System | 1 | CA1 |
| Interleukin-12 family signaling | 1 | CA1 |
| Signaling by Interleukins | 1 | CA1 |
| Gene and protein expression by JAK-STAT signaling after Interleukin-12 stimulation | 1 | CA1 |
| Interleukin-12 signaling | 1 | CA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| response to fructose | 1 |
| bicarbonate transport | 1 |
| estrous cycle | 1 |
| chloride ion homeostasis | 1 |
Indications & clinical
Indications
4 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| glaucoma | 4 | MONDO:0005041 | MONDO:0005041 |
| myotonic syndrome | 3 | MONDO:0016120 | MONDO:0008195 |
| hypokalemic periodic paralysis | 3 | MONDO:0008223 | MONDO:0008223 |
| hyperkalemic periodic paralysis | 3 | MONDO:0008224 | MONDO:0008224 |
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00004802 | PHASE3 | COMPLETED | Phase III Randomized, Double-Blind, Placebo-Controlled Study of Dichlorphenamide for Periodic Paralyses and Associated Sodium Channel Disorders |
| NCT00494507 | PHASE3 | COMPLETED | Hyper- and Hypokalemic Periodic Paralysis Study |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
87 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACETAMINOPHEN | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| ACETAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| BORTEZOMIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| BRINZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| CHLORTHALIDONE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| COUMARIN | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| ETHOXZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| FAMOTIDINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| FUROSEMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| HYDROQUINONE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| IMATINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| INDAPAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| LACOSAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| LEVETIRACETAM | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| MAFENIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| METHAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| PHENOL | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| SALICYLIC ACID | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| SULFANILAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| TOPIRAMATE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| TRICHLORMETHIAZIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| TRIENTINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| VERALIPRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| ZONISAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| CAFFEIC ACID | ChEMBL | Phase 3 | CA1, CA12, CA4 |
| CURCUMIN | ChEMBL | Phase 3 | CA1, CA12, CA4 |
| QUERCETIN | ChEMBL | Phase 3 | CA1, CA12, CA4 |
| RESVERATROL | ChEMBL | Phase 3 | CA1, CA12, CA4 |
| SACCHARIN | ChEMBL | Phase 3 | CA1, CA12, CA4 |
| SPERMIDINE | ChEMBL | Phase 3 | CA1, CA12, CA4 |
| COUMAPHOS | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| DITIOCARB | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| GALLIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| IROSUSTAT | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| PCI-27483 | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| SONEPIPRAZOLE | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| SULFASUCCINAMIDE | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12 |
| PYRITHIONE ZINC | ChEMBL | Phase 4 (approved) | CA12, CA4 |
| SODIUM | ChEMBL | Phase 4 (approved) | CA1, CA4 |
| SULPIRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12 |
| P-TOLUENESULFONAMIDE | ChEMBL | Phase 3 | CA1, CA12 |
| PRITELIVIR | ChEMBL | Phase 3 | CA1, CA12 |
| THIMEROSAL | ChEMBL | Phase 3 | CA12, CA4 |
| BENZYLSULFAMIDE | ChEMBL | Phase 2 | CA1, CA12 |
| CARZENIDE | ChEMBL | Phase 2 | CA1, CA12 |
| DAIDZEIN | ChEMBL | Phase 2 | CA12, CA4 |
| FLAVONE | ChEMBL | Phase 2 | CA1, CA12 |
| INDISULAM | ChEMBL | Phase 2 | CA1, CA12 |
| ISOQUERCETIN | ChEMBL | Phase 2 | CA12, CA4 |
| LUTEOLIN | ChEMBL | Phase 2 | CA12, CA4 |
| PROPAZOLAMIDE | ChEMBL | Phase 2 | CA1, CA4 |
| Sodium Carbonate | PubChem | Approved | CA1, CA4 |
| CHLOROTHIAZIDE | ChEMBL | Phase 4 (approved) | CA1 |
Related Atlas pages
- Genes: CA1, CA4, CA12
- Diseases: glaucoma, hypokalemic periodic paralysis, hyperkalemic periodic paralysis
- Drugs: Acetaminophen, Acetazolamide, Bortezomib, Brinzolamide, Celecoxib, Chlorthalidone, Dobutamine, Dorzolamide, Ethoxzolamide, Famotidine, Furosemide, Hydroquinone, Imatinib, Indapamide, Lacosamide, Levetiracetam, Mafenide, Methazolamide, Nilotinib, Phenol, Salicylic Acid, Sulfanilamide, Topiramate, Trichlormethiazide, Trientine, Valdecoxib, Veralipride, Zonisamide, Caffeic Acid, Curcumin, Quercetin, Resveratrol, Saccharin, Spermidine, Pazopanib, Pyrithione Zinc, Sodium, Sulpiride, P-Toluenesulfonamide, Pritelivir, Thimerosal, Sodium Carbonate, Chlorothiazide