Diethylstilbestrol
drugOn this page
Also known as ApstilDietilestilbestrolDistilbeneNSC-3070StilbestroStilbestrolStilbetinStilboesterolTampovaganDiethylstilbesterol (DES)DESDiethyllstilbestroldiethylstilbesterolTrans-diethylstillbestrolSID11112132SID11532921SID17389919SID26747240SID26752777
Summary
Diethylstilbestrol (CHEMBL411) is an approved small-molecule antineoplastic agent (ATC G03CB02) targeting ESR1, ESR2, and ESRRA; indicated across 2 conditions including neoplasm.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G03CB02 (+2 more)
- Targets: 5 (ESR1, ESR2, ESRRA…)
- Indications: 2 conditions
- Clinical trials: 12
- Chemistry: 268.3 Da · C18H20O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL411 |
| Name | Diethylstilbestrol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 448537 |
| ChEBI | CHEBI:41922 |
| ATC | G03CB02, G03CC05, L02AA01 |
| Molecular formula | C18H20O2 |
| Molecular weight | 268.3 |
| InChIKey | RGLYKWWBQGJZGM-ISLYRVAYSA-N |
SMILES: CC/C(=C(/CC)\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)O
IUPAC name: 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
ChEBI definition: An olefinic compound that is trans-hex-3-ene in which the hydrogens at positions 3 and 4 have been replaced by p-hydroxyphenyl groups.
Pharmacological roles (ChEBI): antineoplastic agent, carcinogenic agent, xenoestrogen, EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor, antifungal agent, endocrine disruptor, EC 1.1.1.146 (11β-hydroxysteroid dehydrogenase) inhibitor, autophagy inducer, calcium channel blocker.
Also known as: Apstil, Diethylstilbestrol, Dietilestilbestrol, Distilbene, NSC-3070, Stilbestro, Stilbestrol, Stilbetin, Stilboesterol, Tampovagan, Diethylstilbesterol (DES), DES
Patent coverage: 206,791 distinct patent families (353,912 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ESR1 | Estrogen receptor-α | Agonist | 10.4 | 1.7% | P03372 |
| ESR2 | Estrogen receptor-β | Agonist | 9.8 | 0.2% | Q92731 |
| ESRRA | Estrogen-related receptor-α | Antagonist | 5.3 | 13.8% | P11474 |
| ESRRB | Estrogen-related receptor-β | Antagonist | 5.3 | 0.2% | O95718 |
| ESRRG | Estrogen-related receptor-γ | Antagonist | 5.3 | 0.4% | P62508 |
Broader ChEMBL bioactivity targets: 77 (assay-derived). Sample: Microtubule-associated protein tau, Ubiquitin carboxyl-terminal hydrolase 2, Nuclear receptor ROR-gamma, Survival motor neuron protein, Prelamin-A/C, Inositol monophosphatase 1, Ferritin light chain, Histone-lysine N-methyltransferase 2A, Cysteinyl leukotriene receptor 1, 5-hydroxytryptamine receptor 2B.
Bioactivity
ChEMBL activities: 96 potent at pChembl ≥ 5 of 161 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ESR2 | 10.7 | EC50 | 0.02 | nM | CHEMBL_ACT_206515 |
| ESR1 | 10.22 | EC50 | 0.06 | nM | CHEMBL_ACT_206516 |
| ESR1 | 10 | AC50 | 0.1 | nM | CHEMBL_ACT_25167224 |
| ESR1 | 9.96 | EC50 | 0.11 | nM | CHEMBL_ACT_19211887 |
| ESR1 | 9.9 | Ki | 0.13 | nM | CHEMBL_ACT_1281824 |
| ESR1 | 9.89 | Ki | 0.13 | nM | CHEMBL_ACT_1281826 |
| ESR1 | 9.7 | EC50 | 0.2 | nM | CHEMBL_ACT_19211878 |
| ESR1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_25522251 |
| ESR1 | 9.66 | Ki | 0.22 | nM | CHEMBL_ACT_13340320 |
| ESR1 | 9.58 | Ki | 0.26 | nM | CHEMBL_ACT_7702721 |
| ESR1 | 9.48 | IC50 | 0.33 | nM | CHEMBL_ACT_820735 |
| ESR1 | 9.31 | Ki | 0.49 | nM | CHEMBL_ACT_1176579 |
| ESR2 | 9.2 | Ki | 0.63 | nM | CHEMBL_ACT_1176580 |
| ESR1 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_25522255 |
| ESR1 | 9.04 | IC50 | 0.92 | nM | CHEMBL_ACT_7702720 |
| ESR1 | 8.6 | EC50 | 2.5 | nM | CHEMBL_ACT_25522267 |
| ESR1 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1001016 |
| ESR1 | 8.52 | AC50 | 3 | nM | CHEMBL_ACT_25138912 |
| ESR2 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_1001017 |
| ESR2 | 8.05 | EC50 | 9 | nM | CHEMBL_ACT_206513 |
| ESR2 | 7.99 | AC50 | 10.2 | nM | CHEMBL_ACT_25175189 |
| ESR1 | 7.92 | EC50 | 12 | nM | CHEMBL_ACT_206514 |
| MAPK1 | 6.5 | Potency | 316.2 | nM | CHEMBL_ACT_4546067 |
| AOX1 | 6.34 | IC50 | 460 | nM | CHEMBL_ACT_5102802 |
| ABCG2 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_11000877 |
| ESR2 | 6.21 | IC50 | 610 | nM | CHEMBL_ACT_12102860 |
| ESRRG | 6.2 | EC50 | 630 | nM | CHEMBL_ACT_1507451 |
| PGR | 6.18 | AC50 | 659.1 | nM | CHEMBL_ACT_25204345 |
| ESR1 | 6.11 | IC50 | 770 | nM | CHEMBL_ACT_12102861 |
| SLC6A3 | 6.07 | Ki | 851 | nM | CHEMBL_ACT_7702717 |
Target pathways
Aggregated over 5 target gene(s): ESR1, ESR2, ESRRA, ESRRB, ESRRG.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 5 | ESR1, ESR2, ESRRA, ESRRB, ESRRG |
| PIP3 activates AKT signaling | 2 | ESR1, ESR2 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 2 | ESR1, ESR2 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | ESR1, ESR2 |
| ESR-mediated signaling | 2 | ESR1, ESR2 |
| Regulation of RUNX2 expression and activity | 2 | ESR1, ESRRA |
| Extra-nuclear estrogen signaling | 2 | ESR1, ESR2 |
| Nuclear signaling by ERBB4 | 1 | ESR1 |
| PPARA activates gene expression | 1 | ESRRA |
| Transcriptional activation of mitochondrial biogenesis | 1 | ESRRA |
| SUMOylation of intracellular receptors | 1 | ESR1 |
| Ovarian tumor domain proteases | 1 | ESR1 |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | ESR1 |
| RUNX1 regulates estrogen receptor mediated transcription | 1 | ESR1 |
| RUNX1 regulates transcription of genes involved in WNT signaling | 1 | ESR1 |
| Estrogen-dependent gene expression | 1 | ESR1 |
| Mitochondrial unfolded protein response (UPRmt) | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | ESR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of DNA-templated transcription | 5 |
| regulation of transcription by RNA polymerase II | 5 |
| positive regulation of transcription by RNA polymerase II | 5 |
| nuclear receptor-mediated steroid hormone signaling pathway | 4 |
| positive regulation of DNA-templated transcription | 4 |
| negative regulation of transcription by RNA polymerase II | 3 |
| signal transduction | 2 |
| estrogen receptor signaling pathway | 2 |
| obsolete positive regulation of DNA-binding transcription factor activity | 2 |
| cellular response to estradiol stimulus | 2 |
| regulation of gene expression | 2 |
| cellular response to oxygen-containing compound | 2 |
| intracellular receptor signaling pathway | 2 |
| antral ovarian follicle growth | 1 |
| epithelial cell development | 1 |
Indications & clinical
Indications
2 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 9 |
| PHASE4 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01637896 | PHASE4 | TERMINATED | A Comparison Between Paclitaxel-eluting Balloon in Combination With BMS Implantation vs Conventional Balloon and DES Implantation |
| NCT01925027 | PHASE4 | UNKNOWN | Efficacy and Safety of Nano+ Polymer-free Sirolimus-Eluting Stent: A Optical Coherent Tomography Study |
| NCT00316927 | PHASE3 | COMPLETED | Dexamethasone, Aspirin, and Diethylstilbestrol in Treating Patients With Locally Advanced or Metastatic Prostate Cancer |
| NCT04859985 | Not specified | ACTIVE_NOT_RECRUITING | The SELUTION DeNovo Study |
| NCT06168422 | Not specified | RECRUITING | A Cohort Study of PCI Strategies for Severely Calcified Lesions of Complex Coronary Arteries in the Elderly |
| NCT03190473 | Not specified | TERMINATED | OPTIMIZE IDE for the Treatment of ACS |
| NCT03223974 | Not specified | COMPLETED | Clinical Trial on Safety and Efficacy of Drug-coated Balloon in Treatment of Coronary Bifurcation Lesions |
| NCT03939468 | Not specified | UNKNOWN | Drug-Coated Balloon in Combination With New Generation Drug-Eluting Stent for de Novo Diffuse Disease Treatment |
| NCT04265989 | Not specified | UNKNOWN | A New Classification and Interventional Therapy for Coronary Artery Ectasia |
| NCT04842838 | Not specified | UNKNOWN | Comparative Clinical Study of Drug-coating Balloon Strategy and Drug-eluting Stent Strategy |
| NCT05650450 | Not specified | UNKNOWN | Drug-Coated Balloon in Combination With New Generation Drug-Eluting Stent in the Treatment of Long Diffuse Coronary Artery Disease |
| NCT05750771 | Not specified | COMPLETED | Comparison of DCB and DES for Severe Calcification of de Novo Lesion in Elderly CHD |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
178 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRA, ESRRB, ESRRG |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | ESR1, ESR2, ESRRA, ESRRB, ESRRG |
| TAMOXIFEN | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRA, ESRRG |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRA |
| MIFEPRISTONE | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, ESRRA |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| CISPLATIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ELACESTRANT | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTETROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| PHENOLPHTHALEIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ACOLBIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AFIMOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AMCENESTRANT | ChEMBL | Phase 3 | ESR1, ESR2 |
| ARZOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| BENSERAZIDE | ChEMBL | Phase 3 | ESR1, ESR2 |
| ALFATRADIOL | ChEMBL | Phase 2 | ESR1, ESR2 |
| AUS-131 | ChEMBL | Phase 2 | ESR1, ESR2 |
| BRILANESTRANT | ChEMBL | Phase 2 | ESR1, ESR2 |
| DAIDZEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| ERTEBEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| GTX-758 | ChEMBL | Phase 2 | ESR1, ESR2 |
| IDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| LEVORMELOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| MOXESTROL | ChEMBL | Phase 2 | ESR1, ESR2 |
| PIPENDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| PRINABEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| STALLIMYCIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| Bosentan | PubChem | Approved | ESR1, ESR2 |
| Dihydroergotamine | PubChem | Approved | ESR1, ESR2 |
| Fidaxomicin | PubChem | Approved | ESR1, ESR2 |
| Propoxyphene | PubChem | Approved | ESR1, ESR2 |
| Pyrazinamide | PubChem | Approved | ESR1, ESR2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | ESR1 |
| AZTREONAM | ChEMBL | Phase 4 (approved) | ESR1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | ESR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BISACODYL | ChEMBL | Phase 4 (approved) | ESR1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFADROXIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFEPIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFTAZIDIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CERIVASTATIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CHLOROTRIANISENE | ChEMBL | Phase 4 (approved) | ESR1 |
Related Atlas pages
- Genes: ESR1, ESR2, ESRRA, ESRRB, ESRRG
- Diseases: neoplasm
- Drugs: Estradiol, Tamoxifen, Fulvestrant, Mifepristone, Bazedoxifene, Bithionol, Cisplatin, Elacestrant, Estetrol, Estriol, Estrone, Ethinyl Estradiol, Hexachlorophene, Lasofoxifene, Medroxyprogesterone, Phenolphthalein, Raloxifene, Spironolactone, Acolbifene, Afimoxifene, Amcenestrant, Arzoxifene, Benserazide, Bosentan, Dihydroergotamine, Fidaxomicin, Propoxyphene, Pyrazinamide, Acetophenazine, Alectinib, Apomorphine, Aripiprazole, Aspirin, Aztreonam, Belinostat, Benzbromarone, Bexarotene, Bisacodyl, Bromocriptine, Butoconazole, Candesartan Cilexetil, Caspofungin, Cefadroxil, Cefepime, Ceftazidime, Cerivastatin, Chlorotrianisene