Dihydroergotamine
drugOn this page
Also known as DihidroergotaminaMAP-0004MAP0004NeomigranSID26751735SID50104427SID90341683SID104171355SID124883195SID144204372SID170465012SID174006617
Summary
Dihydroergotamine (CHEMBL1732) is an approved small-molecule serotonergic agonist (ATC N02CA01) targeting HTR6, HTR7, and HTR1B; indicated across 3 conditions including migraine disorder and migraine with aura.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N02CA01 (+1 more)
- Targets: 6 (HTR6, HTR7, HTR1B…)
- Indications: 3 conditions
- Clinical trials: 12
- Chemistry: 583.7 Da · C33H37N5O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1732 |
| Name | Dihydroergotamine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 10531 |
| ChEBI | CHEBI:4562 |
| ATC | N02CA01, N02CA51 |
| Molecular formula | C33H37N5O5 |
| Molecular weight | 583.7 |
| InChIKey | LUZRJRNZXALNLM-JGRZULCMSA-N |
SMILES: C[C@@]1(C(=O)N2[C@H](C(=O)N3CCC[C@H]3[C@@]2(O1)O)CC4=CC=CC=C4)NC(=O)[C@@H]5C[C@H]6[C@@H](CC7=CNC8=CC=CC6=C78)N(C5)C
IUPAC name: (6aR,9R,10aR)-N-[(1S,2S,4R,7S)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide
ChEBI definition: Ergotamine in which a single bond replaces the double bond between positions 9 and 10. A semisynthetic ergot alkaloid with weaker oxytocic and vasoconstrictor properties than ergotamine, it is used (as the methanesulfonic or tartaric acid salts) for the treatment of migraine and orthostatic hypotension.
Pharmacological roles (ChEBI): serotonergic agonist, non-narcotic analgesic, vasoconstrictor agent, dopamine agonist, sympatholytic agent.
Also known as: Dihidroergotamina, Dihydroergotamine, MAP-0004, MAP0004, Neomigran, SID26751735, SID50104427, SID90341683, SID104171355, dihydroergotamine, SID124883195, SID144204372
Parent form; salt/anhydrous children: CHEMBL1200517
Patent coverage: 3,306 distinct patent families (12,897 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 12,872 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR6 | 5-HT6 receptor | Antagonist | 8.3 | 0.2% | P50406 |
| HTR7 | 5-HT7 receptor | Antagonist | 8 | 0.8% | P34969 |
| HTR1B | 5-HT1B receptor | Full agonist | 9.2 | 0.2% | P28222 |
| HTR1D | 5-HT1D receptor | Full agonist | 9.9 | 0% | P28221 |
| HTR1E | 5-ht1e receptor | Full agonist | 5.6 | 0% | P28566 |
| HTR1F | 5-HT1F receptor | Full agonist | 7.1 | 0.1% | P30939 |
Broader ChEMBL bioactivity targets: 37 (assay-derived). Sample: Microtubule-associated protein tau, Solute carrier family 22 member 2, Multidrug and toxin extrusion protein 1, Multidrug and toxin extrusion protein 2, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Histamine H2 receptor, Alpha-2B adrenergic receptor.
Bioactivity
ChEMBL activities: 68 potent at pChembl ≥ 5 of 78 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P19327 | 9.42 | Ki | 0.38 | nM | CHEMBL_ACT_7700636 |
| P28564 | 9.42 | Ki | 0.38 | nM | CHEMBL_ACT_7700638 |
| ADRA2A | 9.41 | Ki | 0.39 | nM | CHEMBL_ACT_7696371 |
| P19327 | 9.18 | IC50 | 0.66 | nM | CHEMBL_ACT_7700635 |
| P28564 | 9.07 | IC50 | 0.85 | nM | CHEMBL_ACT_7700637 |
| ADRA2A | 8.99 | IC50 | 1.03 | nM | CHEMBL_ACT_7696370 |
| HTR6 | 8.83 | Ki | 1.49 | nM | CHEMBL_ACT_7700650 |
| ADRA2C | 8.82 | Ki | 1.51 | nM | CHEMBL_ACT_7696375 |
| ADRA2B | 8.75 | Ki | 1.77 | nM | CHEMBL_ACT_7696373 |
| DRD3 | 8.74 | Ki | 1.81 | nM | CHEMBL_ACT_7698483 |
| P43140 | 8.69 | Ki | 2.04 | nM | CHEMBL_ACT_7696365 |
| HTR2A | 8.64 | Ki | 2.27 | nM | CHEMBL_ACT_7700640 |
| DRD2 | 8.53 | Ki | 2.96 | nM | CHEMBL_ACT_7698481 |
| HTR6 | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_7700649 |
| ADRA2A | 8.48 | AC50 | 3.3 | nM | CHEMBL_ACT_25157094 |
| P19328 | 8.43 | IC50 | 3.7 | nM | CHEMBL_ACT_160407 |
| HTR2B | 8.43 | Ki | 3.7 | nM | CHEMBL_ACT_25553827 |
| ADRA2B | 8.41 | IC50 | 3.87 | nM | CHEMBL_ACT_7696372 |
| HTR2B | 8.36 | Ki | 4.33 | nM | CHEMBL_ACT_7700642 |
| P15823 | 8.35 | Ki | 4.48 | nM | CHEMBL_ACT_7696367 |
| P43140 | 8.3 | IC50 | 5.03 | nM | CHEMBL_ACT_7696364 |
| DRD3 | 8.27 | IC50 | 5.34 | nM | CHEMBL_ACT_7698482 |
| HTR2B | 8.17 | IC50 | 6.8 | nM | CHEMBL_ACT_7700641 |
| HTR2A | 8.1 | IC50 | 7.96 | nM | CHEMBL_ACT_7700639 |
| P15823 | 8.09 | IC50 | 8.09 | nM | CHEMBL_ACT_7696366 |
| DRD2 | 8.05 | IC50 | 8.88 | nM | CHEMBL_ACT_7698480 |
| ADRA2C | 8 | IC50 | 10 | nM | CHEMBL_ACT_7696374 |
| HTR1A | 7.9 | AC50 | 12.6 | nM | CHEMBL_ACT_25164654 |
| ADRA1D | 7.85 | Ki | 14 | nM | CHEMBL_ACT_7696369 |
| ADRA2A | 7.79 | AC50 | 16.2 | nM | CHEMBL_ACT_25156068 |
Target pathways
Aggregated over 6 target gene(s): HTR6, HTR7, HTR1B, HTR1D, HTR1E, HTR1F.
Top Reactome pathways
10 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| Signaling by GPCR | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| Class A/1 (Rhodopsin-like receptors) | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| Amine ligand-binding receptors | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| GPCR downstream signalling | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| Serotonin receptors | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| GPCR ligand binding | 6 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| G alpha (i) signalling events | 4 | HTR1B, HTR1D, HTR1E, HTR1F |
| G alpha (s) signalling events | 2 | HTR6, HTR7 |
| RHOBTB3 ATPase cycle | 1 | HTR7 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 6 |
| chemical synaptic transmission | 6 |
| signal transduction | 6 |
| G protein-coupled receptor signaling pathway | 6 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 4 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 4 |
| vasoconstriction | 3 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 3 |
| adenylate cyclase-activating serotonin receptor signaling pathway | 2 |
| G protein-coupled serotonin receptor signaling pathway | 2 |
| smooth muscle contraction | 2 |
| regulation of behavior | 2 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 1 |
| cerebral cortex cell migration | 1 |
| positive regulation of TOR signaling | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| migraine disorder | 4 | MONDO:0005277 | MONDO:0005277 |
| migraine with aura | 3 | MONDO:0005475 | MONDO:0005475 |
| migraine without aura | 3 | MONDO:0100431 | MONDO:0100431 |
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 5 |
| PHASE1 | 5 |
| PHASE1/PHASE2 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00623636 | PHASE3 | COMPLETED | Phase 3 Study of MAP0004 in Adult Migraineurs |
| NCT02582996 | PHASE3 | SUSPENDED | Cefalium® Compared to Tylenol® in the Treatment of Migraine Attacks |
| NCT03901482 | PHASE3 | COMPLETED | A Randomized, Double-Blind, Placebo-Controlled Study to Evaluate STS101 in the Acute Treatment of Migraine |
| NCT04406649 | PHASE3 | COMPLETED | A Study to Evaluate the Safety of STS101 in the Acute Treatment of Migraine |
| NCT04940390 | PHASE3 | COMPLETED | A Randomized, Double-Blind, Parallel Group, Placebo-Controlled Study to Assess STS101 in the Acute Treatment of Migraine |
| NCT01199965 | PHASE1/PHASE2 | COMPLETED | Pharmacokinetics & Tolerability Study of MAP0004 in Smoking and Non-Smoking Adult Volunteers |
| NCT03885154 | PHASE2 | TERMINATED | Valproic Acid and Dihydroergotamine as Abortive Therapy in Pediatric Migraine |
| NCT01089062 | PHASE1 | COMPLETED | Pharmacodynamic Study to Compare Acute Effects of Dihydroergotamine Mesylate (DHE) on Pulmonary Arterial Pressure |
| NCT01191723 | PHASE1 | COMPLETED | QT Intervals Study to Compare the Acute Effects of Orally Inhaled Dihydroergotamine (DHE), Oral Moxifloxacin, and Placebo |
| NCT01468558 | PHASE1 | COMPLETED | Pharmacokinetics & Tolerability Study of MAP0004 Co-administered With Ketoconazole |
| NCT03874832 | PHASE1 | COMPLETED | A Phase I Study to Study the PK and Safety of Single Doses of STS101, DHE Injection and Nasal Spray in Healthy Subjects |
| NCT05337254 | PHASE1 | COMPLETED | A Study of the PK and Safety of Single Doses of STS101, DHE Injection and Nasal Spray in Healthy Subjects |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 1 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
169 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| RISPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| SEROTONIN | ChEMBL + PubChem | Phase 3 (approved) | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| MEBUFOTENIN | ChEMBL | Phase 2 | HTR1B, HTR1D, HTR1E, HTR1F, HTR6, HTR7 |
| BREXPIPRAZOLE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR6, HTR7 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1E, HTR1F, HTR6, HTR7 |
| ERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F, HTR6 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1E, HTR1F, HTR6, HTR7 |
| SUMATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F, HTR7 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR6, HTR7 |
| YOHIMBINE | ChEMBL + PubChem | Phase 3 (approved) | HTR1B, HTR1D, HTR1E, HTR1F, HTR6 |
| PSILOCIN | ChEMBL | Phase 2 | HTR1B, HTR1D, HTR1E, HTR6, HTR7 |
| CYPROHEPTADINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR1F, HTR6, HTR7 |
| LASMIDITAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1D, HTR1E, HTR1F, HTR7 |
| NARATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F |
| QUETIAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR1F, HTR6, HTR7 |
| RIZATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR1F, HTR6, HTR7 |
| ZOLMITRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR1F |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR6, HTR7 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR6, HTR7 |
| FROVATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR1E, HTR7 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR6, HTR7 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR6, HTR7 |
| VILAZODONE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR6, HTR7 |
| LATREPIRDINE | ChEMBL | Phase 3 | HTR1D, HTR1E, HTR6, HTR7 |
| LYSERGIDE | ChEMBL | Phase 2 | HTR1D, HTR1E, HTR6, HTR7 |
| RITANSERIN | ChEMBL | Phase 2 | HTR1B, HTR1E, HTR6, HTR7 |
| ELETRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1E, HTR1F |
| METHYLERGONOVINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR1F, HTR6 |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D, HTR7 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1E, HTR7 |
| ZIPRASIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR6, HTR7 |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR1D, HTR6, HTR7 |
| KETOTIFEN | ChEMBL | Phase 4 (approved) | HTR1B, HTR6, HTR7 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR1D, HTR6, HTR7 |
| OXYMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR6 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR7 |
| SILODOSIN | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR7 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR1D, HTR6, HTR7 |
| GSK163090 | ChEMBL | Phase 2 | HTR1B, HTR1D, HTR7 |
| NIGULDIPINE | ChEMBL | Phase 2 | HTR1B, HTR6, HTR7 |
| PENFLURIDOL | ChEMBL | Phase 2 | HTR1D, HTR6, HTR7 |
| SPIRAMIDE | ChEMBL | Phase 2 | HTR1D, HTR6, HTR7 |
| ASENAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR6 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| HYDROXYZINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | HTR1B, HTR6 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
| THIOTHIXENE | ChEMBL | Phase 4 (approved) | HTR6, HTR7 |
Related Atlas pages
- Genes: HTR6, HTR7, HTR1B, HTR1D, HTR1E, HTR1F
- Diseases: migraine disorder, migraine with aura, migraine without aura
- Drugs: Imipramine, Risperidone, Serotonin, Brexpiprazole, Clozapine, Ergotamine, Olanzapine, Sumatriptan, Azelastine, Yohimbine, Cyproheptadine, Lasmiditan, Naratriptan, Quetiapine, Rizatriptan, Sorafenib, Zolmitriptan, Aripiprazole, Cariprazine, Frovatriptan, Ketanserin, Nefazodone, Vilazodone, Latrepirdine, Eletriptan, Methylergonovine, Paliperidone, Pramipexole, Ziprasidone, Cinacalcet, Ketotifen, Mianserin, Oxymetazoline, Salmeterol, Silodosin, Tegaserod, Asenapine, Amoxapine, Astemizole, Carvedilol, Chlorpromazine, Dibenzepin, Doxepin, Fluphenazine, Haloperidol, Hydroxyzine, Loxapine, Methysergide, Promazine, Sertindole, Thioridazine, Thiothixene