Dinaciclib
drugOn this page
Also known as Mk-7965SCH 727965SCH-727965SCH727965DINACICLIB (SCH727965)Dinaciclip
Summary
Dinaciclib (CHEMBL2103840) is a phase-3 clinical-stage small-molecule EC 2.7.11.22 (cyclin-dependent kinase) inhibitor targeting CDK1, CDK2, and CDK5; indicated across 12 conditions including b-cell chronic lymphocytic leukemia and plasma cell myeloma.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 4 (CDK1, CDK2, CDK5…)
- Indications: 12 conditions
- Clinical trials: 18
- Chemistry: 396.5 Da · C21H28N6O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2103840 |
| Name | Dinaciclib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 46926350 |
| ChEBI | CHEBI:95060 |
| Molecular formula | C21H28N6O2 |
| Molecular weight | 396.5 |
| InChIKey | PIMQWRZWLQKKBJ-SFHVURJKSA-N |
SMILES: CCC1=C2N=C(C=C(N2N=C1)NCC3=C[N+](=CC=C3)[O-])N4CCCC[C@H]4CCO
IUPAC name: 2-[(2S)-1-[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]ethanol
ChEBI definition: A pyrazolopyrimidine that is pyrazolo[1,5-a]pyrimidine substituted by ethyl, (2S)-2-(2-hydroxyethyl)piperidin-1-yl, and [(1-oxidopyridin-3-yl)methyl]amino groups at positions 3, 5, and 7, respectively. It is a potent pan-cyclin dependent kinase inhibitor that exhibits antineoplastic activity.
Pharmacological roles (ChEBI): EC 2.7.11.22 (cyclin-dependent kinase) inhibitor, antineoplastic agent, apoptosis inducer.
Also known as: Dinaciclib, Mk-7965, SCH 727965, SCH-727965, SCH727965, DINACICLIB, dinaciclib, DINACICLIB (SCH727965), Dinaciclib (SCH727965), Dinaciclip
Patent coverage: 900 distinct patent families (2,257 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 2,248 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CDK1 | cyclin dependent kinase 1 | Inhibition | 8.52 | 100% (common-essential) | P06493 |
| CDK2 | cyclin dependent kinase 2 | Inhibition | 8.7 | 71.1% | P24941 |
| CDK5 | cyclin dependent kinase 5 | Inhibition | 9 | 0.7% | Q00535 |
| CDK9 | cyclin dependent kinase 9 | Inhibition | 8.4 | 99.3% (common-essential) | P50750 |
Broader ChEMBL bioactivity targets: 41 (assay-derived). Sample: Serine/threonine-protein kinase TAO2, Bromodomain-containing protein 4, Serine/threonine-protein kinase ICK, Bromodomain testis-specific protein, Cyclin-dependent kinase 13, Cyclin-dependent kinase 5/CDK5 activator 1, Cyclin-dependent kinase 4/cyclin D1, Cyclin-dependent kinase 1/cyclin B1, Cyclin-dependent kinase 2/cyclin E1, Cyclin-dependent kinase 2/cyclin E.
Bioactivity
ChEMBL activities: 154 potent at pChembl ≥ 5 of 159 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16737083 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16737084 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16737208 |
| CCNA2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16737209 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16844138 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_16844139 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_18299187 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_18299188 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_19016018 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_19016063 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_19027227 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_19027228 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_19258253 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_19258254 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_22758205 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_22758215 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_22930712 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_22930713 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_23159497 |
| CDK1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_23297712 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_23297713 |
| CDK4 | 9 | IC50 | 1 | nM | CHEMBL_ACT_23297714 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_23297715 |
| CDK9 | 9 | IC50 | 1 | nM | CHEMBL_ACT_23297716 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24759627 |
| CDK4 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24788463 |
| CDK1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24788533 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24788537 |
| CDK5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24788546 |
| CDK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24975181 |
Target pathways
Aggregated over 4 target gene(s): CDK1, CDK2, CDK5, CDK9.
Top Reactome pathways
190 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 4 | CDK1, CDK2, CDK5, CDK9 |
| Generic Transcription Pathway | 4 | CDK1, CDK2, CDK5, CDK9 |
| Transcriptional Regulation by TP53 | 4 | CDK1, CDK2, CDK5, CDK9 |
| RNA Polymerase II Transcription | 4 | CDK1, CDK2, CDK5, CDK9 |
| Gene expression (Transcription) | 4 | CDK1, CDK2, CDK5, CDK9 |
| Disease | 3 | CDK2, CDK5, CDK9 |
| Regulation of TP53 Activity | 3 | CDK1, CDK2, CDK5 |
| Hemostasis | 2 | CDK2, CDK5 |
| Developmental Biology | 2 | CDK2, CDK5 |
| G0 and Early G1 | 2 | CDK1, CDK2 |
| Cell Cycle | 2 | CDK1, CDK2 |
| APC/C-mediated degradation of cell cycle proteins | 2 | CDK1, CDK2 |
| Regulation of APC/C activators between G1/S and early anaphase | 2 | CDK1, CDK2 |
| Mitotic G2-G2/M phases | 2 | CDK1, CDK2 |
| Regulation of mitotic cell cycle | 2 | CDK1, CDK2 |
| Mitotic G1 phase and G1/S transition | 2 | CDK1, CDK2 |
| TP53 Regulates Transcription of Cell Cycle Genes | 2 | CDK1, CDK2 |
| Regulation of TP53 Activity through Phosphorylation | 2 | CDK2, CDK5 |
| Regulation of TP53 Degradation | 2 | CDK1, CDK2 |
| Regulation of TP53 Expression and Degradation | 2 | CDK1, CDK2 |
| G1/S Transition | 2 | CDK1, CDK2 |
| Cyclin A/B1/B2 associated events during G2/M transition | 2 | CDK1, CDK2 |
| G2/M Transition | 2 | CDK1, CDK2 |
| Cell Cycle, Mitotic | 2 | CDK1, CDK2 |
| G2/M Checkpoints | 2 | CDK1, CDK2 |
| Cell Cycle Checkpoints | 2 | CDK1, CDK2 |
| Factors involved in megakaryocyte development and platelet production | 2 | CDK2, CDK5 |
| MAPK3 (ERK1) activation | 1 | CDK1 |
| Opioid Signalling | 1 | CDK5 |
| Formation of RNA Pol II elongation complex | 1 | CDK9 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 4 |
| DNA repair | 3 |
| DNA damage response | 3 |
| cell division | 3 |
| regulation of cell cycle | 3 |
| G1/S transition of mitotic cell cycle | 2 |
| G2/M transition of mitotic cell cycle | 2 |
| microtubule cytoskeleton organization | 2 |
| DNA replication | 2 |
| apoptotic process | 2 |
| cell migration | 2 |
| negative regulation of protein ubiquitination | 2 |
| positive regulation of DNA replication | 2 |
| rhythmic process | 2 |
| regulation of heterochromatin organization | 2 |
Indications & clinical
Indications
12 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| B-cell chronic lymphocytic leukemia | 3 | MONDO:0004948 | EFO:0000095 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| acute lymphoblastic leukemia | 2 | MONDO:0004967 | EFO:0000220 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
| male breast carcinoma | 1 | MONDO:0005628 | EFO:0006861 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| prolymphocytic leukemia | 1 | MONDO:0001023 | MONDO:0001023 |
| breast neoplasm | 1 | MONDO:0021100 | MONDO:0007254 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| lymphoid leukemia | 1 | MONDO:0005402 | EFO:0004289 |
| non-Hodgkin lymphoma | 1 | MONDO:0018908 | EFO:0005952 |
Clinical trials
Total trials: 18.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 10 |
| PHASE2 | 5 |
| PHASE1/PHASE2 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01580228 | PHASE3 | COMPLETED | A Phase 3 Study Comparing Dinaciclib Versus Ofatumumab in Patients With Refractory Chronic Lymphocytic Leukemia (P07714) |
| NCT00937937 | PHASE2 | ACTIVE_NOT_RECRUITING | Dinaciclib in Treating Patients With Stage IV Melanoma |
| NCT00732810 | PHASE2 | COMPLETED | SCH 727965 in Patients With Advanced Breast and Lung Cancers (Study P04716) |
| NCT00798213 | PHASE2 | TERMINATED | SCH 727965 in Patients With Acute Myelogenous Leukemia and Acute Lymphoblastic Leukemia (P04717AM2)(TERMINATED) |
| NCT00871546 | PHASE2 | TERMINATED | SCH 727965 in Patients With Mantle Cell Lymphoma or B-Cell Chronic Lymphocytic Leukemia (Study P04715) |
| NCT01026324 | PHASE1/PHASE2 | TERMINATED | Dinaciclib in Treating Patients With Stage III-IV Melanoma |
| NCT01096342 | PHASE2 | COMPLETED | Dinaciclib in Treating Patients With Relapsed or Refractory Multiple Myeloma |
| NCT01515176 | PHASE1/PHASE2 | COMPLETED | Ofatumumab and Dinaciclib in Treating Patients With Relapsed or Refractory Chronic Lymphocytic Leukemia, Small Lymphocytic Lymphoma, or B-Cell Prolymphocytic Leukemia |
| NCT01434316 | PHASE1 | ACTIVE_NOT_RECRUITING | Veliparib and Dinaciclib in Treating Patients With Advanced Solid Tumors |
| NCT00871663 | PHASE1 | COMPLETED | Phase 1 Weekly Dosing of SCH 727965 in Patients With Advanced Cancer (Study P04629AM6) |
| NCT00871910 | PHASE1 | COMPLETED | Phase 1 Every-3-Week Dosing of SCH 727965 in Patients With Advanced Cancer (Study P04630) |
| NCT01624441 | PHASE1 | COMPLETED | Dinaciclib and Epirubicin Hydrochloride in Treating Patients With Metastatic Triple-Negative Breast Cancer |
| NCT01650727 | PHASE1 | COMPLETED | A Study of Dinaciclib in Combination With Rituximab in Participants With Chronic Lymphocytic Leukemia and Small Lymphocytic Lymphoma (P07974) |
| NCT01676753 | PHASE1 | COMPLETED | Phase 1b Trial of Dinaciclib With Pembrolizumab for Advanced Breast Cancer |
| NCT01711528 | PHASE1 | COMPLETED | Dinaciclib, Bortezomib, and Dexamethasone in Treating Patients With Relapsed Multiple Myeloma |
| NCT01783171 | PHASE1 | COMPLETED | Dinaciclib and Akt Inhibitor MK2206 in Treating Patients With Pancreatic Cancer That Cannot Be Removed by Surgery |
| NCT02684617 | PHASE1 | TERMINATED | Study of Pembrolizumab (MK-3475) in Combination With Dinaciclib (MK-7965) in Hematologic Malignancies (MK-3475-155/KEYNOTE-155) |
| NCT03484520 | PHASE1 | TERMINATED | A Study of Venetoclax and Dinaciclib (MK7965) in Patients With Relapsed/Refractory Acute Myeloid Leukemia |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
96 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | CDK1, CDK2, CDK5, CDK9 |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | CDK1, CDK2, CDK5, CDK9 |
| ALVOCIDIB | ChEMBL | Phase 3 | CDK1, CDK2, CDK5, CDK9 |
| CRENOLANIB | ChEMBL | Phase 3 | CDK1, CDK2, CDK5, CDK9 |
| DEFACTINIB | ChEMBL | Phase 3 | CDK1, CDK2, CDK5, CDK9 |
| AT-7519 | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| CT-7001 | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| CULMERCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| CYC-065 | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| INDIRUBIN | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| ISTISOCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| MILCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| NARAZACICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| RG-547 | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| SELICICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| VORUCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| ZEMIRCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| ZOTIRACICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5, CDK9 |
| Afatinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Binimetinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Crizotinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| dacomitinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Fostamatinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Idelalisib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Pazopanib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| regorafenib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Selumetinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| Trametinib | PubChem | Approved | CDK1, CDK2, CDK5, CDK9 |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | CDK1, CDK2, CDK5 |
| LESTAURTINIB | ChEMBL | Phase 3 | CDK2, CDK5, CDK9 |
| QUERCETIN | ChEMBL | Phase 3 | CDK1, CDK2, CDK5 |
| ASNUCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK9 |
| CENISERTIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| EBVACICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK9 |
| FISETIN | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| INIXACICLIB | ChEMBL | Phase 2 | CDK2, CDK5, CDK9 |
| LUTEOLIN | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| LY-2090314 | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| R-406 | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| REBASTINIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| RIVICICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK9 |
| RONICICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK9 |
| SILMITASERTIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| SOTRASTAURIN | ChEMBL | Phase 2 | CDK1, CDK2, CDK5 |
| TEGTOCICLIB | ChEMBL | Phase 2 | CDK1, CDK2, CDK9 |
| Belzutifan | PubChem | Approved | CDK1, CDK5, CDK9 |
| Gefitinib | PubChem | Approved | CDK1, CDK5, CDK9 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | CDK2, CDK9 |
| PACRITINIB | ChEMBL | Phase 4 (approved) | CDK2, CDK9 |
| RIBOCICLIB | ChEMBL | Phase 4 (approved) | CDK2, CDK9 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | CDK2, CDK5 |
| TRILACICLIB | ChEMBL | Phase 4 (approved) | CDK2, CDK9 |
| 6-O-BENZYLGUANINE | ChEMBL | Phase 3 | CDK1, CDK2 |
| ENZASTAURIN | ChEMBL | Phase 3 | CDK2, CDK9 |
| FASUDIL | ChEMBL | Phase 3 | CDK5, CDK9 |
| LEROCICLIB | ChEMBL | Phase 3 | CDK2, CDK9 |
| LINIFANIB | ChEMBL | Phase 3 | CDK1, CDK9 |
| AT-9283 | ChEMBL | Phase 2 | CDK5, CDK9 |
| CROZBACICLIB | ChEMBL | Phase 2 | CDK1, CDK2 |
| LAUROGUADINE | ChEMBL | Phase 2 | CDK1, CDK2 |
Related Atlas pages
- Genes: CDK1, CDK2, CDK5, CDK9
- Diseases: B-cell chronic lymphocytic leukemia
- Drugs: Abemaciclib, Palbociclib, Alvocidib, Crenolanib, Defactinib, Afatinib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Idelalisib, Pazopanib, regorafenib, Selumetinib, Trametinib, Dabrafenib, Lestaurtinib, Quercetin, Belzutifan, Gefitinib, Momelotinib, Pacritinib, Ribociclib, Sorafenib, Trilaciclib, 6-O-BENZYLGUANINE, Enzastaurin, Fasudil, Lerociclib, Linifanib
- Biomarker genes: CCNE1