Doconexent
drugOn this page
Also known as 22:6 n-3C22:6 (n-3)Cervonic acidDoconexentoDocosaheaenoic-acidDocosahexaenoateDocosahexaenoic acidDocosahexaenoic acid (c22:6 n3)Docosahexanoic acidDHASID26754926SID26754927SID26754928SID50110834SID144205545
Summary
Doconexent (CHEMBL367149) is an approved small-molecule antineoplastic agent targeting FFAR1, TRPA1, and KCNK10; indicated across 39 conditions including heart failure and attention deficit-hyperactivity disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 4 (FFAR1, TRPA1, KCNK10…)
- Indications: 39 conditions
- Clinical trials: 89
- Chemistry: 328.5 Da · C22H32O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL367149 |
| Name | Doconexent |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | yes |
| PubChem CID | 445580 |
| ChEBI | CHEBI:28125 |
| Molecular formula | C22H32O2 |
| Molecular weight | 328.5 |
| InChIKey | MBMBGCFOFBJSGT-KUBAVDMBSA-N |
SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O
IUPAC name: (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid
ChEBI definition: A docosahexaenoic acid having six cis-double bonds at positions 4, 7, 10, 13, 16 and 19.
Pharmacological roles (ChEBI): nutraceutical, antineoplastic agent.
Other ChEBI roles (chemical / environmental): human metabolite, Daphnia tenebrosa metabolite, mouse metabolite, algal metabolite.
Also known as: 22:6 n-3, C22:6 (n-3), Cervonic acid, Doconexent, Doconexento, Docosaheaenoic-acid, Docosahexaenoate, Docosahexaenoic acid, Docosahexaenoic acid (c22:6 n3), Docosahexanoic acid, docosahexaenoic acid, DHA
Patent coverage: 21,887 distinct patent families (63,817 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| FFAR1 | FFA1 receptor | Full agonist | 6 | 0.4% | O14842 |
| TRPA1 | TRPA1 | Activation | 4.4 | 0.1% | O75762 |
| KCNK10 | K2P10.1 | 0% | P57789 | ||
| RXRA | Retinoid X receptor-α | Agonist | 5.1% | P19793 |
Broader ChEMBL bioactivity targets: 11 (assay-derived). Sample: Microtubule-associated protein tau, Inositol monophosphatase 1, 4’-phosphopantetheinyl transferase ffp, Oxoeicosanoid receptor 1, Aromatase, Retinoic acid receptor RXR-alpha, RXR alpha/PPAR gamma, Prostaglandin G/H synthase 1, Aldehyde dehydrogenase 1A1, Prostaglandin G/H synthase 2.
Bioactivity
ChEMBL activities: 4 potent at pChembl ≥ 5 of 17 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| OXER1 | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_13916572 |
| RXRA | 5.32 | IC50 | 4822 | nM | CHEMBL_ACT_25091477 |
| RXRA | 5.2 | Ki | 6292 | nM | CHEMBL_ACT_19307689 |
| P79208 | 5.01 | IC50 | 9800 | nM | CHEMBL_ACT_2193522 |
Target pathways
Aggregated over 4 target gene(s): FFAR1, TRPA1, KCNK10, RXRA.
Top Reactome pathways
79 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 1 | KCNK10 |
| Developmental Biology | 1 | RXRA |
| Potassium Channels | 1 | KCNK10 |
| Tandem pore domain potassium channels | 1 | KCNK10 |
| TWIK related potassium channel (TREK) | 1 | KCNK10 |
| R-HSA-1368082 | 1 | RXRA |
| BMAL1:CLOCK,NPAS2 activates circadian expression | 1 | RXRA |
| Metabolism | 1 | RXRA |
| Mitochondrial biogenesis | 1 | RXRA |
| Recycling of bile acids and salts | 1 | RXRA |
| Signal Transduction | 1 | RXRA |
| Regulation of cholesterol biosynthesis by SREBP (SREBF) | 1 | RXRA |
| Organelle biogenesis and maintenance | 1 | RXRA |
| Synthesis of bile acids and bile salts | 1 | RXRA |
| Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol | 1 | RXRA |
| Synthesis of bile acids and bile salts via 27-hydroxycholesterol | 1 | RXRA |
| Bile acid and bile salt metabolism | 1 | RXRA |
| PPARA activates gene expression | 1 | RXRA |
| Carnitine shuttle | 1 | RXRA |
| Biological oxidations | 1 | RXRA |
| Cytochrome P450 - arranged by substrate type | 1 | RXRA |
| Phase I - Functionalization of compounds | 1 | RXRA |
| Endogenous sterols | 1 | RXRA |
| Epigenetic regulation of gene expression | 1 | RXRA |
| Generic Transcription Pathway | 1 | RXRA |
| Transcriptional activation of mitochondrial biogenesis | 1 | RXRA |
| Cellular responses to stress | 1 | RXRA |
| Activation of gene expression by SREBF (SREBP) | 1 | RXRA |
| SUMOylation | 1 | RXRA |
| SUMO E3 ligases SUMOylate target proteins | 1 | RXRA |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| signal transduction | 2 |
| monoatomic ion transport | 2 |
| monoatomic ion transmembrane transport | 2 |
| G protein-coupled receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| insulin secretion | 1 |
| positive regulation of insulin secretion | 1 |
| negative regulation of interleukin-1 beta production | 1 |
| glucose homeostasis | 1 |
| positive regulation of calcium ion transport | 1 |
| response to fatty acid | 1 |
| ligand-gated ion channel signaling pathway | 1 |
| intracellular calcium ion homeostasis | 1 |
| cell surface receptor signaling pathway | 1 |
Indications & clinical
Indications
39 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| attention deficit-hyperactivity disorder | 3 | MONDO:0007743 | EFO:0003888 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| retinitis pigmentosa | 3 | MONDO:0019200 | MONDO:0019200 |
| psychotic disorder | 3 | MONDO:0005485 | EFO:0005407 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| cardiovascular disorder | 2 | MONDO:0004995 | EFO:0000319 |
| colorectal adenoma | 2 | MONDO:0005484 | EFO:0005406 |
| retinopathy of prematurity | 2 | MONDO:0006952 | EFO:1001158 |
| breast lobular carcinoma | 2 | MONDO:0000552 | EFO:0008509 |
| ductal breast carcinoma in situ | 2 | MONDO:0005023 | EFO:0000432 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| asthma | 2 | MONDO:0004979 | MONDO:0004979 |
| type 1 diabetes mellitus | 2 | MONDO:0005147 | MONDO:0005147 |
| cystic fibrosis | 2 | MONDO:0009061 | MONDO:0009061 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| autism spectrum disorder | 2 | MONDO:0005258 | EFO:0003756 |
| chronic hepatitis C virus infection | 2 | MONDO:0005354 | EFO:0004220 |
| male breast carcinoma | 2 | MONDO:0005628 | EFO:0006861 |
| mammary Paget disease | 2 | MONDO:0002648 | MONDO:0002648 |
| heart disorder | 1 | MONDO:0005267 | EFO:0003777 |
| necrotizing enterocolitis | 1 | MONDO:0005313 | EFO:0003928 |
| macular degeneration | 1 | MONDO:0003004 | EFO:0009606 |
| amblyopia | 1 | MONDO:0001020 | MONDO:0001020 |
| Parkinson disease | 1 | MONDO:0005180 | MONDO:0005180 |
| severe acute respiratory syndrome | 1 | MONDO:0005091 | MONDO:0100096 |
| leukemia | 1 | MONDO:0005059 | EFO:0000565 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
| eating disorder | 1 | MONDO:0005451 | EFO:0005203 |
7 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 89.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 53 |
| PHASE3 | 14 |
| PHASE2 | 7 |
| PHASE4 | 6 |
| PHASE2/PHASE3 | 3 |
| EARLY_PHASE1 | 3 |
| PHASE1 | 2 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06068530 | PHASE4 | RECRUITING | Mass Vaccine and Drug Administration, Bangladesh |
| NCT00449917 | PHASE4 | COMPLETED | Visiobiane Anti-age Effects on Vision Parameters |
| NCT00634686 | PHASE4 | UNKNOWN | Effects of Omega-3 Fatty Acids on Bone and Frailty |
| NCT01576783 | PHASE4 | COMPLETED | Omega Tots: A Randomized, Controlled Trial of Long-chain Polyunsaturated Fatty Acid Supplementation of Toddler Diets and Developmental Outcomes |
| NCT03781557 | PHASE4 | UNKNOWN | Effects of Omega-3 Fatty Acids Supplement in Cognition of Young Healthy Adults and in Their Reaction Time of Computerized Test After 3 Months of Taking High-concentrated DHA and EPA Fish Softgels |
| NCT03915535 | PHASE4 | TERMINATED | Impact of Fish Oil Monoglycerides on the Modulation of Mitochondrial Functions and Lactate Threshold |
| NCT03965988 | PHASE3 | RECRUITING | Docosahexaenoic Acid on Breath Holding Spells in Children |
| NCT00000116 | PHASE3 | COMPLETED | Randomized Trial of DHA for Retinitis Pigmentosa Patients Receiving Vitamin A |
| NCT00266825 | PHASE3 | COMPLETED | DHA Supplementation and Pregnancy Outcome |
| NCT00345176 | PHASE3 | COMPLETED | Age-Related Eye Disease Study 2 (AREDS2) |
| NCT00351624 | PHASE3 | COMPLETED | Effects of Docosahexaenoic Acid (DHA) on Cognitive Function in Children 4 Years of Age |
| NCT00361374 | PHASE3 | COMPLETED | Safety and Effectiveness of Omega 3-Fatty Acids, EPA Versus DHA, for the Treatment of Major Depression |
| NCT00517036 | PHASE3 | COMPLETED | Omega-3 Fatty Acids for Treating Adults With Major Depression |
| NCT00662142 | PHASE3 | COMPLETED | Effect of 8-Week Dietary DHA Supplementation on Cerebral Blood Flow and Metabolic Function |
| NCT01007110 | PHASE3 | COMPLETED | Effects of Docosahexaenoic Acid (DHA) on Fetal Cardiac Outcomes |
| NCT01422317 | PHASE3 | COMPLETED | Effects of High-dose n-3 Fatty Acids on Clinical Outcome and Serum Lipids - Omacor Following Acute Myocardial Infarction |
| NCT01796262 | PHASE3 | COMPLETED | The Effects of DHA on Attention Deficit and Hyperactivity Disorder |
| NCT01846325 | PHASE2/PHASE3 | COMPLETED | The Effects of Administration of Combined Docosahexaenoic Acid and Vitamin E Supplements on Spermatogram and Seminal Plasma Oxidative Stress in Infertile Men With Asthenozoospermia |
| NCT01883817 | PHASE3 | COMPLETED | Effect of Omega-3 Fatty Acid on Cortical Function in ADHD |
| NCT01940640 | PHASE2/PHASE3 | COMPLETED | Effect of Mother DHA Supplementation on Premature Newborn. |
| NCT02057406 | PHASE3 | COMPLETED | Omega 3 for Treatment of Depression in Patients With Heart Failure |
| NCT02487771 | PHASE3 | COMPLETED | Kansas University DHA Outcome Study (KUDOS) Follow-Up |
| NCT02541929 | PHASE2/PHASE3 | COMPLETED | Fish Oil Brain Delivery Study |
| NCT01049529 | PHASE2 | COMPLETED | Effect of Docosahexaenoic Acid on the Inflammatory Response and Clinical Outcomes From Surgical Patients |
| NCT01661764 | PHASE2 | COMPLETED | Fish Oil Supplementation, Nutrigenomics and Colorectal Cancer Prevention |
| NCT01849250 | PHASE2 | COMPLETED | Study of Docosahexaenoic Acid (DHA) in Triple Negative Breast Cancer Survivors |
| NCT01976806 | PHASE2 | COMPLETED | The Effects of DHA on Periodontitis |
| NCT02690857 | PHASE2 | COMPLETED | Study of Docosahexanoic Acid in Patients With Cystic Fibrosis (CF) |
| NCT02973360 | PHASE2 | UNKNOWN | Dose-Finding Study of SC411 in Children With Sickle Cell Disease |
| NCT03402789 | PHASE1/PHASE2 | WITHDRAWN | Docosahexaenoic Acid (DHA) Supplementation in Amblyopia |
| NCT03613844 | PHASE2 | COMPLETED | DHA Brain Delivery Trial |
| NCT00988585 | PHASE1 | COMPLETED | Evaluation of the Safety and Biologic Effects of an Eicosapentaenoic (EPA)-Enriched Oil |
| NCT01670773 | PHASE1 | COMPLETED | A Study of CAT-1004 Biomarkers in Healthy Subjects |
| NCT06494488 | EARLY_PHASE1 | RECRUITING | Differential Thrombogenesis by EPA and DHA Mediated by HDL |
| NCT07012486 | EARLY_PHASE1 | RECRUITING | Efficacy of Dihydroartemisinin for Treating Female Androgenetic Alopecia |
| NCT02517502 | EARLY_PHASE1 | COMPLETED | Docosahexaenoic Acid (DHA) To Prevent Development of Cognitive Dysfunction Due to Chemotherapy |
| NCT01260961 | Not specified | ACTIVE_NOT_RECRUITING | Developing Treatment, Treatment Validation and Treatment Scope in the Setting of an Autism Clinical Trial |
| NCT02647723 | Not specified | ACTIVE_NOT_RECRUITING | Improving Maternal and Child Health Through Prenatal Fatty Acid Supplementation |
| NCT05038462 | Not specified | RECRUITING | Fetal Brain Care: Therapies for Brain Neurodevelopment in Fetal Growth Restriction |
| NCT05191823 | Not specified | ENROLLING_BY_INVITATION | Omega Tots Long Term Follow-up |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
51 molecules share ≥1 primary target. Top 51 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ROSIGLITAZONE | ChEMBL | Phase 4 (approved) | FFAR1, RXRA |
| CARVEDILOL | ChEMBL + PubChem | Phase 4 (approved) | KCNK10 |
| DICLOFENAC | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| DISULFIRAM | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| MEFENAMIC ACID | ChEMBL + PubChem | Phase 4 (approved) | TRPA1 |
| SULINDAC | ChEMBL + PubChem | Phase 4 (approved) | RXRA |
| ALITRETINOIN | ChEMBL | Phase 4 (approved) | RXRA |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | RXRA |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | RXRA |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | RXRA |
| FLUVASTATIN | ChEMBL | Phase 4 (approved) | RXRA |
| LEVOTHYROXINE | ChEMBL | Phase 4 (approved) | RXRA |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | RXRA |
| MENTHOL | ChEMBL | Phase 4 (approved) | TRPA1 |
| NICOTINE | ChEMBL | Phase 4 (approved) | TRPA1 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | RXRA |
| PIOGLITAZONE | ChEMBL | Phase 4 (approved) | RXRA |
| PITAVASTATIN | ChEMBL | Phase 4 (approved) | RXRA |
| TRETINOIN | ChEMBL | Phase 4 (approved) | RXRA |
| RESVERATROL | ChEMBL + PubChem | Phase 3 (approved) | TRPA1 |
| CANNABINOL | ChEMBL | Phase 3 | TRPA1 |
| FASIGLIFAM | ChEMBL | Phase 3 | FFAR1 |
| GAMOLENIC ACID | ChEMBL | Phase 3 | FFAR1 |
| ICILLIN | ChEMBL | Phase 3 | TRPA1 |
| ICOSAPENT | ChEMBL | Phase 3 | RXRA |
| LEVOMENTHOL | ChEMBL | Phase 3 | TRPA1 |
| TIRATRICOL | ChEMBL | Phase 3 | RXRA |
| ALLICIN | ChEMBL | Phase 2 | TRPA1 |
| CANNABIDIVARIN | ChEMBL | Phase 2 | TRPA1 |
| CANNABIGEROL | ChEMBL | Phase 2 | TRPA1 |
| CARVACROL | ChEMBL | Phase 2 | TRPA1 |
| CHLORDANTOIN | ChEMBL | Phase 2 | TRPA1 |
| FENBUFEN | ChEMBL | Phase 2 | FFAR1 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | TRPA1 |
| IRX-4204 | ChEMBL | Phase 2 | RXRA |
| LINOLEIC ACID | ChEMBL | Phase 2 | FFAR1 |
| PIRINIXIC ACID | ChEMBL | Phase 2 | RXRA |
| RG6341 | ChEMBL | Phase 2 | TRPA1 |
| SALIRASIB | ChEMBL | Phase 2 | TRPA1 |
| SANGUINARIUM | ChEMBL | Phase 2 | TRPA1 |
| TETRAHYDROCANNABIVARIN | ChEMBL | Phase 2 | TRPA1 |
| THYMOL | ChEMBL | Phase 2 | TRPA1 |
| Acetaldehyde | PubChem | Approved | TRPA1 |
| Berberine Chloride | PubChem | Approved | RXRA |
| Caffeine | PubChem | Approved | TRPA1 |
| camphor (synthetic) | PubChem | Approved | TRPA1 |
| dronabinol | PubChem | Approved | TRPA1 |
| Eugenol | PubChem | Approved | TRPA1 |
| Ezetimibe | PubChem | Approved | RXRA |
| menthol, unspecified form | PubChem | Approved | TRPA1 |
| Propylene Glycol | PubChem | Approved | TRPA1 |
Related Atlas pages
- Genes: FFAR1, TRPA1, KCNK10, RXRA
- Diseases: heart failure, attention deficit-hyperactivity disorder, major depressive disorder, depressive disorder, Alzheimer disease, retinitis pigmentosa, psychotic disorder, bipolar disorder
- Drugs: Rosiglitazone, Carvedilol, Diclofenac, Disulfiram, Mefenamic Acid, Sulindac, Alitretinoin, Bexarotene, Calcitriol, Domperidone, Fluvastatin, Levothyroxine, Meclofenamic Acid, Menthol, Nicotine, Oxaprozin, Pioglitazone, Pitavastatin, Tretinoin, Resveratrol, Cannabinol, Fasiglifam, Gamolenic Acid, Icillin, Icosapent, Tiratricol, Berberine Chloride, Caffeine, camphor (synthetic), dronabinol, Ezetimibe, Propylene Glycol